| Commit message (Collapse) | Author | Age |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
memset on xtensa is capable of accessing user memory, but KASAN checks
if memset function is actually used for that and reports it as an error:
==================================================================
BUG: KASAN: user-memory-access in padzero+0x4d/0x58
Write of size 519 at addr 0049ddf9 by task init/1
Call Trace:
[<b0189978>] kasan_report+0x160/0x238
[<b0188818>] check_memory_region+0xf8/0x100
[<b018891c>] memset+0x20/0x34
[<b0238b71>] padzero+0x4d/0x58
==================================================================
Use __memset in __xtensa_clear_user to avoid that.
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Cover kernel addresses above 0x90000000 by the shadow map. Enable
HAVE_ARCH_KASAN when MMU is enabled. Provide kasan_early_init that fills
shadow map with writable copies of kasan_zero_page. Call
kasan_early_init right after mmu initialization in the setup_arch.
Provide kasan_init that allocates proper shadow map pages from the
memblock and puts these pages into the shadow map for addresses from
VMALLOC area to the end of KSEG. Call kasan_init right after memblock
initialization. Don't use KASAN for the boot code, MMU and KASAN
initialization and page fault handler. Make kernel stack size 4 times
larger when KASAN is enabled to avoid stack overflows.
GCC 7.3, 8 or newer is required to build the xtensa kernel with KASAN.
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
|
|
|
|
|
| |
The virtual address space between the page table and the VMALLOC region
is big enough to host KASAN shadow map and there's enough space between
the VMALLOC area and KSEG for the fixmap and kmap.
Move fixmap and kmap to the gap between VMALLOC area and KSEG, just
above the KSEG. Reorder entries in the kernel memory layout printing
code. Drop duplicate PGTABLE_START definition, use
XCHAL_PAGE_TABLE_VADDR instead.
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
|
|
| |
swapper_pg_dir is located in the .bss, so it's zero-initialized anyway.
With KASAN enabled paging_init will be called after KASAN
initialization, it must not erase page directory entries set up for
KASAN shadow map.
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
|
|
|
| |
KIO region placement may be specified in the device tree, that's why
it's initialized with the rest of MMU after the early_init_devtree. In
order to support KASAN the MMU must be initialized earlier.
Separate KIO initialization from the rest of MMU initialization.
Reinitialize KIO if its location is specified in the device tree.
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
|
|
|
|
|
| |
Paging on xtensa architecture requires functioning exception handling
because hardware cannot transparently access page tables that are not
currently mapped by TLB. Exception handling is set up late in the
initialization process, but working paging is needed for KASAN.
Provide early_trap_init that sets up minimal exception handling
sufficient for KASAN to work.
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
| |
Instead of using flat array of longs use normal C structure and generate
EXC_TABLE_* constants in the asm-offsets.c
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
| |
Replace #ifdef'fed/commented out debug printk statements with pr_debug.
Replace printk statements with pr_* equivalents.
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
| |
The implementation is adopted from the ARM arch. GCC 7.3, 8 or newer is
required for building the xtensa kernel with SSP.
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
| |
Print hardware config ID on startup and config ID recorded in the
configuration if it doesn't match one read from the hardware.
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
|
| |
Define kernel stack size in kmem_layout and use it in
current_thread_info, GET_THREAD_INFO, THREAD_SIZE and THERAD_SIZE_ORDER
definitions.
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
| |
Use ENTRY and ENDPROC throughout arch/xtensa/lib assembly sources.
Introduce asm/linkage.h and define xtensa-specific __ALIGN macro there.
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
| |
Remove duplicate definitions of ALIGN/src_b/__src_b and SSA8/ssa8/__ssa8
from assembly sources and put single definition into asm/asmmacro.h
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
| |
Remove duplicate definitions of EX() and similar TRY/CATCH and SRC/DST
macros from assembly sources and put single definition into asm/asmmacro.h
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
|
| |
Now that xtensa assembly sources are compiled with -mlongcalls let the
assembler and linker relax call instructions into l32r + callx where
needed. This change makes the code cleaner and potentially a bit faster.
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
|
|
|
|
|
| |
vmlinux.lds.S doesn't do anything special with literals, so instead of
keeping them separate put them into the corresponding text sections.
Drop explicit .literal sections from the vmlinux.lds.S, use standard
section macros. Mark literal pool locations in the assembly sources.
Unfortunately assembler doesn't put literals into .init sections and
external libgcc may still have .literal sections, so sed transformation
to the linker script is still needed.
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
|
|
|
|
|
|
|
|
| |
By default xtensa gcc inserts memw for all volatile object accesses.
This is too pessimistic for the kernel: there should be no "normal"
volatile objects, and all special objects, like MMIO or objects shared
between CPUs should have explicit barriers.
Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
|
| |
|
|\
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip
Pull x86 fixes from Thomas Gleixner:
"A set of small fixes:
- make KGDB work again which got broken by the conversion of WARN()
to #UD. The WARN fixup needs to run before the notifier callchain,
otherwise KGDB tries to handle it and crashes.
- disable KASAN in the ORC unwinder to prevent false positive KASAN
warnings
- prevent default mapping above 47bit when 5 level page tables are
enabled
- make the delay calibration optimization work correctly, which had
the conditionals the wrong way around and was operating on data
which was not yet updated.
- remove the bogus X86_TRAP_BP trap init from the default IDT init
table, which broke 32bit int3 handling by overwriting the correct
int3 setup.
- replace this_cpu* with boot_cpu_data access in the preemptible
oprofile init code"
* 'x86-urgent-for-linus' of git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip:
x86/debug: Handle warnings before the notifier chain, to fix KGDB crash
x86/mm: Fix ELF_ET_DYN_BASE for 5-level paging
x86/idt: Remove X86_TRAP_BP initialization in idt_setup_traps()
x86/oprofile/ppro: Do not use __this_cpu*() in preemptible context
x86/unwind: Disable KASAN checking in the ORC unwinder
x86/smpboot: Make optimization of delay calibration work correctly
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
Commit:
9a93848fe787 ("x86/debug: Implement __WARN() using UD0")
turned warnings into UD0, but the fixup code only runs after the
notify_die() chain. This is a problem, in particular, with kgdb,
which kicks in as if it was a BUG().
Fix this by running the fixup code before the notifier chain in
the invalid op handler path.
Signed-off-by: Alexander Shishkin <alexander.shishkin@linux.intel.com>
Tested-by: Ilya Dryomov <idryomov@gmail.com>
Acked-by: Daniel Thompson <daniel.thompson@linaro.org>
Acked-by: Thomas Gleixner <tglx@linutronix.de>
Cc: Jason Wessel <jason.wessel@windriver.com>
Cc: Arjan van de Ven <arjan@linux.intel.com>
Cc: Borislav Petkov <bp@alien8.de>
Cc: Linus Torvalds <torvalds@linux-foundation.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Richard Weinberger <richard.weinberger@gmail.com>
Cc: <stable@vger.kernel.org> # v4.12+
Link: http://lkml.kernel.org/r/20170724100428.19173-1-alexander.shishkin@linux.intel.com
Signed-off-by: Ingo Molnar <mingo@kernel.org>
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
On machines with 5-level paging we don't want to allocate mapping above
47-bit unless user explicitly asked for it. See b569bab78d8d ("x86/mm:
Prepare to expose larger address space to userspace") for details.
c715b72c1ba4 ("mm: revert x86_64 and arm64 ELF_ET_DYN_BASE base
changes") broke the behaviour. After the commit elf binary and heap got
mapped above 47-bits.
Use DEFAULT_MAP_WINDOW instead of TASK_SIZE to determine ELF_ET_DYN_BASE so
it's forced to be below 47-bits unconditionally.
Fixes: c715b72c1ba4 ("mm: revert x86_64 and arm64 ELF_ET_DYN_BASE base changes")
Signed-off-by: Kirill A. Shutemov <kirill.shutemov@linux.intel.com>
Signed-off-by: Thomas Gleixner <tglx@linutronix.de>
Acked-by: Michal Hocko <mhocko@suse.com>
Cc: Kees Cook <keescook@chromium.org>
Cc: Nicholas Piggin <npiggin@gmail.com>
Cc: linux-mm@kvack.org
Cc: Andrew Morton <akpm@linux-foundation.org>
Link: https://lkml.kernel.org/r/20171107103804.47341-1-kirill.shutemov@linux.intel.com
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
Commit b70543a0b2b6("x86/idt: Move regular trap init to tables") moves
regular trap init for each trap vector into a table based
initialization. It introduced the initialization for vector X86_TRAP_BP
which was not in the code which it replaced. This breaks uprobe
functionality for x86_32; the probed program segfaults instead of handling
the probe proper.
The reason for this is that TRAP_BP is set up as system interrupt gate
(DPL3) in the early IDT and then replaced by a regular interrupt gate
(DPL0) in idt_setup_traps(). The DPL0 restriction causes the int3 trap
to fail with a #GP resulting in a SIGSEGV of the probed program.
On 64bit this does not cause a problem because the IDT entry is replaced
with a system interrupt gate (DPL3) with interrupt stack afterwards.
Remove X86_TRAP_BP from the def_idts table which is used in
idt_setup_traps(). Remove a redundant entry for X86_TRAP_NMI in def_idts
while at it. Tested on both x86_64 and x86_32.
[ tglx: Amended changelog with a description of the root cause ]
Fixes: b70543a0b2b6("x86/idt: Move regular trap init to tables")
Reported-and-tested-by: Yonghong Song <yhs@fb.com>
Signed-off-by: Yonghong Song <yhs@fb.com>
Signed-off-by: Thomas Gleixner <tglx@linutronix.de>
Cc: a.p.zijlstra@chello.nl
Cc: ast@fb.com
Cc: oleg@redhat.com
Cc: luto@kernel.org
Cc: kernel-team@fb.com
Link: https://lkml.kernel.org/r/20171108192845.552709-1-yhs@fb.com
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
The warning below says it all:
BUG: using __this_cpu_read() in preemptible [00000000] code: swapper/0/1
caller is __this_cpu_preempt_check
CPU: 0 PID: 1 Comm: swapper/0 Not tainted 4.14.0-rc8 #4
Call Trace:
dump_stack
check_preemption_disabled
? do_early_param
__this_cpu_preempt_check
arch_perfmon_init
op_nmi_init
? alloc_pci_root_info
oprofile_arch_init
oprofile_init
do_one_initcall
...
These accessors should not have been used in the first place: it is PPro so
no mixed silicon revisions and thus it can simply use boot_cpu_data.
Reported-by: Fengguang Wu <fengguang.wu@intel.com>
Tested-by: Fengguang Wu <fengguang.wu@intel.com>
Fix-creation-mandated-by: Linus Torvalds <torvalds@linux-foundation.org>
Signed-off-by: Borislav Petkov <bp@suse.de>
Signed-off-by: Thomas Gleixner <tglx@linutronix.de>
Cc: Robert Richter <rric@kernel.org>
Cc: x86@kernel.org
Cc: stable@vger.kernel.org
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
Fengguang reported a KASAN warning:
Kprobe smoke test: started
==================================================================
BUG: KASAN: stack-out-of-bounds in deref_stack_reg+0xb5/0x11a
Read of size 8 at addr ffff8800001c7cd8 by task swapper/1
CPU: 0 PID: 1 Comm: swapper Not tainted 4.14.0-rc8 #26
Call Trace:
<#DB>
...
save_trace+0xd9/0x1d3
mark_lock+0x5f7/0xdc3
__lock_acquire+0x6b4/0x38ef
lock_acquire+0x1a1/0x2aa
_raw_spin_lock_irqsave+0x46/0x55
kretprobe_table_lock+0x1a/0x42
pre_handler_kretprobe+0x3f5/0x521
kprobe_int3_handler+0x19c/0x25f
do_int3+0x61/0x142
int3+0x30/0x60
[...]
The ORC unwinder got confused by some kprobes changes, which isn't
surprising since the runtime code no longer matches vmlinux and the
stack was modified for kretprobes.
Until we have a way for generated code to register changes with the
unwinder, these types of warnings are inevitable. So just disable KASAN
checks for stack accesses in the ORC unwinder.
Reported-by: Fengguang Wu <fengguang.wu@intel.com>
Signed-off-by: Josh Poimboeuf <jpoimboe@redhat.com>
Cc: Linus Torvalds <torvalds@linux-foundation.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Thiago Jung Bauermann <bauerman@linux.vnet.ibm.com>
Cc: Thomas Gleixner <tglx@linutronix.de>
Link: http://lkml.kernel.org/r/20171108021934.zbl6unh5hpugybc5@treble
Signed-off-by: Ingo Molnar <mingo@kernel.org>
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
If the TSC has constant frequency then the delay calibration can be skipped
when it has been calibrated for a package already. This is checked in
calibrate_delay_is_known(), but that function is buggy in two aspects:
It returns 'false' if
(!tsc_disabled && !cpu_has(&cpu_data(cpu), X86_FEATURE_CONSTANT_TSC)
which is obviously the reverse of the intended check and the check for the
sibling mask cannot work either because the topology links have not been
set up yet.
Correct the condition and move the call to set_cpu_sibling_map() before
invoking calibrate_delay() so the sibling check works correctly.
[ tglx: Rewrote changelong ]
Fixes: c25323c07345 ("x86/tsc: Use topology functions")
Signed-off-by: Pavel Tatashin <pasha.tatashin@oracle.com>
Signed-off-by: Thomas Gleixner <tglx@linutronix.de>
Cc: peterz@infradead.org
Cc: bob.picco@oracle.com
Cc: steven.sistare@oracle.com
Cc: daniel.m.jordan@oracle.com
Cc: stable@vger.kernel.org
Link: https://lkml.kernel.org/r/20171028001100.26603-1-pasha.tatashin@oracle.com
|
|\ \
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | | |
git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip
Pull perf tool fixes from Thomas Gleixner:
"A small set of fixes for perf tool:
- synchronize the i915 drm header to avoid the 'out of date' warning
- make sure that perf trace cleans up its temporary files on exit
- unbreak the build with newer flex versions
- add missing braces in the eBPF parsing rules"
* 'perf-urgent-for-linus' of git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip:
tooling/headers: Sync the tools/include/uapi/drm/i915_drm.h UAPI header
perf trace: Call machine__exit() at exit
perf tools: Fix eBPF event specification parsing
perf tools: Add "reject" option for parse-events.l
|
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | | |
Last minute upstream update to one of the UAPI headers - sync it with tooling,
to address this warning:
Warning: Kernel ABI header at 'tools/include/uapi/drm/i915_drm.h' differs from latest version at 'include/uapi/drm/i915_drm.h'
Cc: Arnaldo Carvalho de Melo <acme@redhat.com>
Cc: Jiri Olsa <jolsa@redhat.com>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: linux-kernel@vger.kernel.org
Signed-off-by: Ingo Molnar <mingo@kernel.org>
|
| |\ \
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
git://git.kernel.org/pub/scm/linux/kernel/git/acme/linux into perf/urgent
Pull perf tooling fixes from Arnaldo Carvalho de Melo.
Signed-off-by: Ingo Molnar <mingo@kernel.org>
|
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
Otherwise 'perf trace' leaves a temporary file /tmp/perf-vdso.so-XXXXXX.
$ perf trace -o log true
$ ls -l /tmp/perf-vdso.*
-rw------- 1 root root 8192 Nov 8 03:08 /tmp/perf-vdso.so-5bCpD0
Signed-off-by: Andrei Vagin <avagin@openvz.org>
Reviewed-by: Jiri Olsa <jolsa@redhat.com>
Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Vasily Averin <vvs@virtuozzo.com>
Link: http://lkml.kernel.org/r/20171108002246.8924-1-avagin@openvz.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
Looks like I've reached the new level of stupidity, adding missing braces.
Committer testing:
Given the following eBPF C filter, that will add a record when it
returns true, i.e. when the tv_nsec variable is > 2000ns, should be
built and installed via sys_bpf(), but fails to do so before this patch:
# cat filter.c
#include <uapi/linux/bpf.h>
#define SEC(NAME) __attribute__((section(NAME), used))
SEC("func=hrtimer_nanosleep rqtp->tv_nsec")
int func(void *ctx, int err, long nsec)
{
return nsec > 1000;
}
char _license[] SEC("license") = "GPL";
int _version SEC("version") = LINUX_VERSION_CODE;
#
# perf trace -e nanosleep,filter.c usleep 1
invalid or unsupported event: 'filter.c'
Run 'perf list' for a list of valid events
Usage: perf trace [<options>] [<command>]
or: perf trace [<options>] -- <command> [<options>]
or: perf trace record [<options>] [<command>]
or: perf trace record [<options>] -- <command> [<options>]
-e, --event <event> event/syscall selector. use 'perf list' to list available events
#
And works again after it is applied, the nothing is inserted when the co
# perf trace -e *sleep,filter.c usleep 1
0.000 ( 0.066 ms): usleep/23994 nanosleep(rqtp: 0x7ffead94a0d0) = 0
# perf trace -e *sleep,filter.c usleep 2
0.000 ( 0.008 ms): usleep/24378 nanosleep(rqtp: 0x7fffa021ba50) ...
0.008 ( ): perf_bpf_probe:func:(ffffffffb410cb30) tv_nsec=2000)
0.000 ( 0.066 ms): usleep/24378 ... [continued]: nanosleep()) = 0
#
The intent of 9445464bb831 is kept:
# perf stat -e 'cpu/uops_executed.core,krava/' true
event syntax error: '..cuted.core,krava/'
\___ unknown term
valid terms: cmask,pc,event,edge,in_tx,any,ldlat,inv,umask,in_tx_cp,offcore_rsp,config,config1,config2,name,period
Run 'perf list' for a list of valid events
Usage: perf stat [<options>] [<command>]
-e, --event <event> event selector. use 'perf list' to list available events
#
# perf stat -e 'cpu/uops_executed.core,period=1/' true
Performance counter stats for 'true':
808,332 cpu/uops_executed.core,period=1/
0.002997237 seconds time elapsed
#
Reported-by: Arnaldo Carvalho de Melo <acme@kernel.org>
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Cc: Andi Kleen <andi@firstfloor.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Fixes: 9445464bb831 ("perf tools: Unwind properly location after REJECT")
Link: http://lkml.kernel.org/n/tip-diea0ihbwpxfw6938huv3whj@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
Arnaldo reported broken builds in some distros using a newer flex
release, 2.6.4, found in Alpine Linux 3.6 and Edge, with flex not
spotting the REJECT macro:
CC /tmp/build/perf/util/parse-events-flex.o
util/parse-events.l: In function 'parse_events_lex':
/tmp/build/perf/util/parse-events-flex.c:4734:16: error: \
'reject_used_but_not_detected' undeclared (first use in this function)
It's happening because we put the REJECT under another USER_REJECT macro
in following commit:
9445464bb831 perf tools: Unwind properly location after REJECT
Fortunately flex provides option for force it to use REJECT, adding it
to parse-events.l.
Reported-by: Arnaldo Carvalho de Melo <acme@kernel.org>
Reported-by: Markus Trippelsdorf <markus@trippelsdorf.de>
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Reviewed-by: Andi Kleen <andi@firstfloor.org>
Tested-by: Arnaldo Carvalho de Melo <acme@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Fixes: 9445464bb831 ("perf tools: Unwind properly location after REJECT")
Link: http://lkml.kernel.org/n/tip-7kdont984mw12ijk7rji6b8p@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|\ \ \ \
| |/ / /
|/| | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
Pull networking fixes from David Miller:
1) Use after free in vlan, from Cong Wang.
2) Handle NAPI poll with a zero budget properly in mlx5 driver, from
Saeed Mahameed.
3) If DMA mapping fails in mlx5 driver, NULL out page, from Inbar
Karmy.
4) Handle overrun in RX FIFO of sun4i CAN driver, from Gerhard
Bertelsmann.
5) Missing return in mdb and vlan prepare phase of DSA layer, from
Vivien Didelot.
* git://git.kernel.org/pub/scm/linux/kernel/git/davem/net:
vlan: fix a use-after-free in vlan_device_event()
net: dsa: return after vlan prepare phase
net: dsa: return after mdb prepare phase
can: ifi: Fix transmitter delay calculation
tcp: fix tcp_fastretrans_alert warning
tcp: gso: avoid refcount_t warning from tcp_gso_segment()
can: peak: Add support for new PCIe/M2 CAN FD interfaces
can: sun4i: handle overrun in RX FIFO
can: c_can: don't indicate triple sampling support for D_CAN
net/mlx5e: Increase Striding RQ minimum size limit to 4 multi-packet WQEs
net/mlx5e: Set page to null in case dma mapping fails
net/mlx5e: Fix napi poll with zero budget
net/mlx5: Cancel health poll before sending panic teardown command
net/mlx5: Loop over temp list to release delay events
rds: ib: Fix NULL pointer dereference in debug code
|
| |\ \ \
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
git://git.kernel.org/pub/scm/linux/kernel/git/mkl/linux-can
Marc Kleine-Budde says:
====================
pull-request: can 2017-11-10
this is a pull request for net/master.
The first patch by Richard Schütz for the c_can driver removes the false
indication to support triple sampling for d_can. Gerhard Bertelsmann's
patch for the sun4i driver improves the RX overrun handling. The patch
by Stephane Grosjean for the peak_canfd driver adds the PCI ids for
various new PCIe/M2 interfaces. Marek Vasut's patch for the ifi driver
fix transmitter delay calculation.
====================
Signed-off-by: David S. Miller <davem@davemloft.net>
|
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
The CANFD transmitter delay calculation formula was updated in the
latest software drop from IFI and improves the behavior of the IFI
CANFD core during bitrate switching. Use the new formula to improve
stability of the CANFD operation.
Signed-off-by: Marek Vasut <marex@denx.de>
Cc: Markus Marb <markus@marb.org>
Cc: linux-stable <stable@vger.kernel.org>
Signed-off-by: Marc Kleine-Budde <mkl@pengutronix.de>
|
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
This adds support for the following PEAK-System CAN FD interfaces:
PCAN-cPCIe FD CAN FD Interface for cPCI Serial (2 or 4 channels)
PCAN-PCIe/104-Express CAN FD Interface for PCIe/104-Express (1, 2 or 4 ch.)
PCAN-miniPCIe FD CAN FD Interface for PCIe Mini (1, 2 or 4 channels)
PCAN-PCIe FD OEM CAN FD Interface for PCIe OEM version (1, 2 or 4 ch.)
PCAN-M.2 CAN FD Interface for M.2 (1 or 2 channels)
Like the PCAN-PCIe FD interface, all of these boards run the same IP Core
that is able to handle CAN FD (see also http://www.peak-system.com).
Signed-off-by: Stephane Grosjean <s.grosjean@peak-system.com>
Cc: linux-stable <stable@vger.kernel.org>
Signed-off-by: Marc Kleine-Budde <mkl@pengutronix.de>
|
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
SUN4Is CAN IP has a 64 byte deep FIFO buffer. If the buffer is not
drained fast enough (overrun) it's getting mangled. Already received
frames are dropped - the data can't be restored.
Signed-off-by: Gerhard Bertelsmann <info@gerhard-bertelsmann.de>
Cc: linux-stable <stable@vger.kernel.org>
Signed-off-by: Marc Kleine-Budde <mkl@pengutronix.de>
|
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
The D_CAN controller doesn't provide a triple sampling mode, so don't set
the CAN_CTRLMODE_3_SAMPLES flag in ctrlmode_supported. Currently enabling
triple sampling is a no-op.
Signed-off-by: Richard Schütz <rschuetz@uni-koblenz.de>
Cc: linux-stable <stable@vger.kernel.org> # >= v3.6
Signed-off-by: Marc Kleine-Budde <mkl@pengutronix.de>
|
| |\ \ \ \
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | | |
git://git.kernel.org/pub/scm/linux/kernel/git/saeed/linux
Saeed Mahameed says:
====================
Mellanox, mlx5 fixes 2017-11-08
The following series includes some fixes for mlx5 core and etherent
driver.
Sorry for the late submission but as you can see i have some very
critical fixes below that i would like them merged into this RC.
Please pull and let me know if there is any problem.
For -stable:
('net/mlx5e: Set page to null in case dma mapping fails') kernels >= 4.13
('net/mlx5: FPGA, return -EINVAL if size is zero') kernels >= 4.13
('net/mlx5: Cancel health poll before sending panic teardown command') kernels >= 4.13
V1->V2:
- Fix Reviewed-by tag of the 2nd patch.
- Drop the FPGA 0 size fix, it needs some more change log info.
====================
Signed-off-by: David S. Miller <davem@davemloft.net>
|
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | | |
This is to prevent the case of working with a single MPWQE
(1 WQE is always reserved as RQ is linked-list).
When the WQE is fully consumed, HW should still have available buffer
in order not to drop packets.
Fixes: 461017cb006a ("net/mlx5e: Support RX multi-packet WQE (Striding RQ)")
Signed-off-by: Eugenia Emantayev <eugenia@mellanox.com>
Reviewed-by: Tariq Toukan <tariqt@mellanox.com>
Cc: kernel-team@fb.com
Signed-off-by: Saeed Mahameed <saeedm@mellanox.com>
|
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | | |
Currently, when dma mapping fails, put_page is called,
but the page is not set to null. Later, in the page_reuse treatment in
mlx5e_free_rx_descs(), mlx5e_page_release() is called for the second time,
improperly doing dma_unmap (for a non-mapped address) and an extra put_page.
Prevent this by nullifying the page pointer when dma_map fails.
Fixes: accd58833237 ("net/mlx5e: Introduce RX Page-Reuse")
Signed-off-by: Inbar Karmy <inbark@mellanox.com>
Reviewed-by: Tariq Toukan <tariqt@mellanox.com>
Cc: kernel-team@fb.com
Signed-off-by: Saeed Mahameed <saeedm@mellanox.com>
|
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | | |
napi->poll can be called with budget 0, e.g. in netpoll scenarios
where the caller only wants to poll TX rings
(poll_one_napi@net/core/netpoll.c).
The below commit changed RX polling from "while" loop to "do {} while",
which caused to ignore the initial budget and handle at least one RX
packet.
This fixes the following warning:
[ 2852.049194] mlx5e_napi_poll+0x0/0x260 [mlx5_core] exceeded budget in poll
[ 2852.049195] ------------[ cut here ]------------
[ 2852.049195] WARNING: CPU: 0 PID: 25691 at net/core/netpoll.c:171 netpoll_poll_dev+0x18a/0x1a0
Fixes: 4b7dfc992514 ("net/mlx5e: Early-return on empty completion queues")
Signed-off-by: Saeed Mahameed <saeedm@mellanox.com>
Reviewed-by: Tariq Toukan <tariqt@mellanox.com>
Reported-by: Martin KaFai Lau <kafai@fb.com>
Tested-by: Martin KaFai Lau <kafai@fb.com>
Cc: kernel-team@fb.com
Signed-off-by: Saeed Mahameed <saeedm@mellanox.com>
|
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | | |
After the panic teardown firmware command, health_care detects the error
in PCI bus and calls the mlx5_pci_err_detected. This health_care flow is
no longer needed because the panic teardown firmware command will bring
down the PCI bus communication with the HCA.
The solution is to cancel the health care timer and its pending
workqueue request before sending panic teardown firmware command.
Kernel trace:
mlx5_core 0033:01:00.0: Shutdown was called
mlx5_core 0033:01:00.0: health_care:154:(pid 9304): handling bad device here
mlx5_core 0033:01:00.0: mlx5_handle_bad_state:114:(pid 9304): NIC state 1
mlx5_core 0033:01:00.0: mlx5_pci_err_detected was called
mlx5_core 0033:01:00.0: mlx5_enter_error_state:96:(pid 9304): start
mlx5_3:mlx5_ib_event:3061:(pid 9304): warning: event on port 0
mlx5_core 0033:01:00.0: mlx5_enter_error_state:104:(pid 9304): end
Unable to handle kernel paging request for data at address 0x0000003f
Faulting instruction address: 0xc0080000434b8c80
Fixes: 8812c24d28f4 ('net/mlx5: Add fast unload support in shutdown flow')
Signed-off-by: Huy Nguyen <huyn@mellanox.com>
Reviewed-by: Moshe Shemesh <moshe@mellanox.com>
Signed-off-by: Saeed Mahameed <saeedm@mellanox.com>
|
| | |/ / /
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
list_splice_init initializing waiting_events_list after splicing it to
temp list, therefore we should loop over temp list to fire the events.
Fixes: 4ca637a20a52 ("net/mlx5: Delay events till mlx5 interface's add complete for pci resume")
Signed-off-by: Huy Nguyen <huyn@mellanox.com>
Signed-off-by: Feras Daoud <ferasda@mellanox.com>
Signed-off-by: Saeed Mahameed <saeedm@mellanox.com>
|
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
After refcnt reaches zero, vlan_vid_del() could free
dev->vlan_info via RCU:
RCU_INIT_POINTER(dev->vlan_info, NULL);
call_rcu(&vlan_info->rcu, vlan_info_rcu_free);
However, the pointer 'grp' still points to that memory
since it is set before vlan_vid_del():
vlan_info = rtnl_dereference(dev->vlan_info);
if (!vlan_info)
goto out;
grp = &vlan_info->grp;
Depends on when that RCU callback is scheduled, we could
trigger a use-after-free in vlan_group_for_each_dev()
right following this vlan_vid_del().
Fix it by moving vlan_vid_del() before setting grp. This
is also symmetric to the vlan_vid_add() we call in
vlan_device_event().
Reported-by: Fengguang Wu <fengguang.wu@intel.com>
Fixes: efc73f4bbc23 ("net: Fix memory leak - vlan_info struct")
Cc: Alexander Duyck <alexander.duyck@gmail.com>
Cc: Linus Torvalds <torvalds@linux-foundation.org>
Cc: Girish Moodalbail <girish.moodalbail@oracle.com>
Signed-off-by: Cong Wang <xiyou.wangcong@gmail.com>
Reviewed-by: Girish Moodalbail <girish.moodalbail@oracle.com>
Tested-by: Fengguang Wu <fengguang.wu@intel.com>
Signed-off-by: David S. Miller <davem@davemloft.net>
|
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
The current code does not return after successfully preparing the VLAN
addition on every ports member of a it. Fix this.
Fixes: 1ca4aa9cd4cc ("net: dsa: check VLAN capability of every switch")
Signed-off-by: Vivien Didelot <vivien.didelot@savoirfairelinux.com>
Reviewed-by: Andrew Lunn <andrew@lunn.ch>
Signed-off-by: David S. Miller <davem@davemloft.net>
|
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
The current code does not return after successfully preparing the MDB
addition on every ports member of a multicast group. Fix this.
Fixes: a1a6b7ea7f2d ("net: dsa: add cross-chip multicast support")
Reported-by: Egil Hjelmeland <privat@egil-hjelmeland.no>
Signed-off-by: Vivien Didelot <vivien.didelot@savoirfairelinux.com>
Reviewed-by: Andrew Lunn <andrew@lunn.ch>
Signed-off-by: David S. Miller <davem@davemloft.net>
|
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
This patch fixes the cause of an WARNING indicatng TCP has pending
retransmission in Open state in tcp_fastretrans_alert().
The root cause is a bad interaction between path mtu probing,
if enabled, and the RACK loss detection. Upong receiving a SACK
above the sequence of the MTU probing packet, RACK could mark the
probe packet lost in tcp_fastretrans_alert(), prior to calling
tcp_simple_retransmit().
tcp_simple_retransmit() only enters Loss state if it newly marks
the probe packet lost. If the probe packet is already identified as
lost by RACK, the sender remains in Open state with some packets
marked lost and retransmitted. Then the next SACK would trigger
the warning. The likely scenario is that the probe packet was
lost due to its size or network congestion. The actual impact of
this warning is small by potentially entering fast recovery an
ACK later.
The simple fix is always entering recovery (Loss) state if some
packet is marked lost during path MTU probing.
Fixes: a0370b3f3f2c ("tcp: enable RACK loss detection to trigger recovery")
Reported-by: Oleksandr Natalenko <oleksandr@natalenko.name>
Reported-by: Alexei Starovoitov <alexei.starovoitov@gmail.com>
Reported-by: Roman Gushchin <guro@fb.com>
Signed-off-by: Yuchung Cheng <ycheng@google.com>
Reviewed-by: Eric Dumazet <edumazet@google.com>
Acked-by: Neal Cardwell <ncardwell@google.com>
Signed-off-by: David S. Miller <davem@davemloft.net>
|
| |/ / /
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
When a GSO skb of truesize O is segmented into 2 new skbs of truesize N1
and N2, we want to transfer socket ownership to the new fresh skbs.
In order to avoid expensive atomic operations on a cache line subject to
cache bouncing, we replace the sequence :
refcount_add(N1, &sk->sk_wmem_alloc);
refcount_add(N2, &sk->sk_wmem_alloc); // repeated by number of segments
refcount_sub(O, &sk->sk_wmem_alloc);
by a single
refcount_add(sum_of(N) - O, &sk->sk_wmem_alloc);
Problem is :
In some pathological cases, sum(N) - O might be a negative number, and
syzkaller bot was apparently able to trigger this trace [1]
atomic_t was ok with this construct, but we need to take care of the
negative delta with refcount_t
[1]
refcount_t: saturated; leaking memory.
------------[ cut here ]------------
WARNING: CPU: 0 PID: 8404 at lib/refcount.c:77 refcount_add_not_zero+0x198/0x200 lib/refcount.c:77
Kernel panic - not syncing: panic_on_warn set ...
CPU: 0 PID: 8404 Comm: syz-executor2 Not tainted 4.14.0-rc5-mm1+ #20
Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/01/2011
Call Trace:
__dump_stack lib/dump_stack.c:16 [inline]
dump_stack+0x194/0x257 lib/dump_stack.c:52
panic+0x1e4/0x41c kernel/panic.c:183
__warn+0x1c4/0x1e0 kernel/panic.c:546
report_bug+0x211/0x2d0 lib/bug.c:183
fixup_bug+0x40/0x90 arch/x86/kernel/traps.c:177
do_trap_no_signal arch/x86/kernel/traps.c:211 [inline]
do_trap+0x260/0x390 arch/x86/kernel/traps.c:260
do_error_trap+0x120/0x390 arch/x86/kernel/traps.c:297
do_invalid_op+0x1b/0x20 arch/x86/kernel/traps.c:310
invalid_op+0x18/0x20 arch/x86/entry/entry_64.S:905
RIP: 0010:refcount_add_not_zero+0x198/0x200 lib/refcount.c:77
RSP: 0018:ffff8801c606e3a0 EFLAGS: 00010282
RAX: 0000000000000026 RBX: 0000000000001401 RCX: 0000000000000000
RDX: 0000000000000026 RSI: ffffc900036fc000 RDI: ffffed0038c0dc68
RBP: ffff8801c606e430 R08: 0000000000000001 R09: 0000000000000000
R10: ffff8801d97f5eba R11: 0000000000000000 R12: ffff8801d5acf73c
R13: 1ffff10038c0dc75 R14: 00000000ffffffff R15: 00000000fffff72f
refcount_add+0x1b/0x60 lib/refcount.c:101
tcp_gso_segment+0x10d0/0x16b0 net/ipv4/tcp_offload.c:155
tcp4_gso_segment+0xd4/0x310 net/ipv4/tcp_offload.c:51
inet_gso_segment+0x60c/0x11c0 net/ipv4/af_inet.c:1271
skb_mac_gso_segment+0x33f/0x660 net/core/dev.c:2749
__skb_gso_segment+0x35f/0x7f0 net/core/dev.c:2821
skb_gso_segment include/linux/netdevice.h:3971 [inline]
validate_xmit_skb+0x4ba/0xb20 net/core/dev.c:3074
__dev_queue_xmit+0xe49/0x2070 net/core/dev.c:3497
dev_queue_xmit+0x17/0x20 net/core/dev.c:3538
neigh_hh_output include/net/neighbour.h:471 [inline]
neigh_output include/net/neighbour.h:479 [inline]
ip_finish_output2+0xece/0x1460 net/ipv4/ip_output.c:229
ip_finish_output+0x85e/0xd10 net/ipv4/ip_output.c:317
NF_HOOK_COND include/linux/netfilter.h:238 [inline]
ip_output+0x1cc/0x860 net/ipv4/ip_output.c:405
dst_output include/net/dst.h:459 [inline]
ip_local_out+0x95/0x160 net/ipv4/ip_output.c:124
ip_queue_xmit+0x8c6/0x18e0 net/ipv4/ip_output.c:504
tcp_transmit_skb+0x1ab7/0x3840 net/ipv4/tcp_output.c:1137
tcp_write_xmit+0x663/0x4de0 net/ipv4/tcp_output.c:2341
__tcp_push_pending_frames+0xa0/0x250 net/ipv4/tcp_output.c:2513
tcp_push_pending_frames include/net/tcp.h:1722 [inline]
tcp_data_snd_check net/ipv4/tcp_input.c:5050 [inline]
tcp_rcv_established+0x8c7/0x18a0 net/ipv4/tcp_input.c:5497
tcp_v4_do_rcv+0x2ab/0x7d0 net/ipv4/tcp_ipv4.c:1460
sk_backlog_rcv include/net/sock.h:909 [inline]
__release_sock+0x124/0x360 net/core/sock.c:2264
release_sock+0xa4/0x2a0 net/core/sock.c:2776
tcp_sendmsg+0x3a/0x50 net/ipv4/tcp.c:1462
inet_sendmsg+0x11f/0x5e0 net/ipv4/af_inet.c:763
sock_sendmsg_nosec net/socket.c:632 [inline]
sock_sendmsg+0xca/0x110 net/socket.c:642
___sys_sendmsg+0x31c/0x890 net/socket.c:2048
__sys_sendmmsg+0x1e6/0x5f0 net/socket.c:2138
Fixes: 14afee4b6092 ("net: convert sock.sk_wmem_alloc from atomic_t to refcount_t")
Signed-off-by: Eric Dumazet <edumazet@google.com>
Reported-by: syzbot <syzkaller@googlegroups.com>
Signed-off-by: David S. Miller <davem@davemloft.net>
|
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
rds_ib_recv_refill() is a function that refills an IB receive
queue. It can be called from both the CQE handler (tasklet) and a
worker thread.
Just after the call to ib_post_recv(), a debug message is printed with
rdsdebug():
ret = ib_post_recv(ic->i_cm_id->qp, &recv->r_wr, &failed_wr);
rdsdebug("recv %p ibinc %p page %p addr %lu ret %d\n", recv,
recv->r_ibinc, sg_page(&recv->r_frag->f_sg),
(long) ib_sg_dma_address(
ic->i_cm_id->device,
&recv->r_frag->f_sg),
ret);
Now consider an invocation of rds_ib_recv_refill() from the worker
thread, which is preemptible. Further, assume that the worker thread
is preempted between the ib_post_recv() and rdsdebug() statements.
Then, if the preemption is due to a receive CQE event, the
rds_ib_recv_cqe_handler() will be invoked. This function processes
receive completions, including freeing up data structures, such as the
recv->r_frag.
In this scenario, rds_ib_recv_cqe_handler() will process the receive
WR posted above. That implies, that the recv->r_frag has been freed
before the above rdsdebug() statement has been executed. When it is
later executed, we will have a NULL pointer dereference:
[ 4088.068008] BUG: unable to handle kernel NULL pointer dereference at 0000000000000020
[ 4088.076754] IP: rds_ib_recv_refill+0x87/0x620 [rds_rdma]
[ 4088.082686] PGD 0 P4D 0
[ 4088.085515] Oops: 0000 [#1] SMP
[ 4088.089015] Modules linked in: rds_rdma(OE) rds(OE) rpcsec_gss_krb5(E) nfsv4(E) dns_resolver(E) nfs(E) fscache(E) mlx4_ib(E) ib_ipoib(E) rdma_ucm(E) ib_ucm(E) ib_uverbs(E) ib_umad(E) rdma_cm(E) ib_cm(E) iw_cm(E) ib_core(E) binfmt_misc(E) sb_edac(E) intel_powerclamp(E) coretemp(E) kvm_intel(E) kvm(E) irqbypass(E) crct10dif_pclmul(E) crc32_pclmul(E) ghash_clmulni_intel(E) pcbc(E) aesni_intel(E) crypto_simd(E) iTCO_wdt(E) glue_helper(E) iTCO_vendor_support(E) sg(E) cryptd(E) pcspkr(E) ipmi_si(E) ipmi_devintf(E) ipmi_msghandler(E) shpchp(E) ioatdma(E) i2c_i801(E) wmi(E) lpc_ich(E) mei_me(E) mei(E) mfd_core(E) nfsd(E) auth_rpcgss(E) nfs_acl(E) lockd(E) grace(E) sunrpc(E) ip_tables(E) ext4(E) mbcache(E) jbd2(E) fscrypto(E) mgag200(E) i2c_algo_bit(E) drm_kms_helper(E) syscopyarea(E) sysfillrect(E) sysimgblt(E)
[ 4088.168486] fb_sys_fops(E) ahci(E) ixgbe(E) libahci(E) ttm(E) mdio(E) ptp(E) pps_core(E) drm(E) sd_mod(E) libata(E) crc32c_intel(E) mlx4_core(E) i2c_core(E) dca(E) megaraid_sas(E) dm_mirror(E) dm_region_hash(E) dm_log(E) dm_mod(E) [last unloaded: rds]
[ 4088.193442] CPU: 20 PID: 1244 Comm: kworker/20:2 Tainted: G OE 4.14.0-rc7.master.20171105.ol7.x86_64 #1
[ 4088.205097] Hardware name: Oracle Corporation ORACLE SERVER X5-2L/ASM,MOBO TRAY,2U, BIOS 31110000 03/03/2017
[ 4088.216074] Workqueue: ib_cm cm_work_handler [ib_cm]
[ 4088.221614] task: ffff885fa11d0000 task.stack: ffffc9000e598000
[ 4088.228224] RIP: 0010:rds_ib_recv_refill+0x87/0x620 [rds_rdma]
[ 4088.234736] RSP: 0018:ffffc9000e59bb68 EFLAGS: 00010286
[ 4088.240568] RAX: 0000000000000000 RBX: ffffc9002115d050 RCX: ffffc9002115d050
[ 4088.248535] RDX: ffffffffa0521380 RSI: ffffffffa0522158 RDI: ffffffffa0525580
[ 4088.256498] RBP: ffffc9000e59bbf8 R08: 0000000000000005 R09: 0000000000000000
[ 4088.264465] R10: 0000000000000339 R11: 0000000000000001 R12: 0000000000000000
[ 4088.272433] R13: ffff885f8c9d8000 R14: ffffffff81a0a060 R15: ffff884676268000
[ 4088.280397] FS: 0000000000000000(0000) GS:ffff885fbec80000(0000) knlGS:0000000000000000
[ 4088.289434] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033
[ 4088.295846] CR2: 0000000000000020 CR3: 0000000001e09005 CR4: 00000000001606e0
[ 4088.303816] Call Trace:
[ 4088.306557] rds_ib_cm_connect_complete+0xe0/0x220 [rds_rdma]
[ 4088.312982] ? __dynamic_pr_debug+0x8c/0xb0
[ 4088.317664] ? __queue_work+0x142/0x3c0
[ 4088.321944] rds_rdma_cm_event_handler+0x19e/0x250 [rds_rdma]
[ 4088.328370] cma_ib_handler+0xcd/0x280 [rdma_cm]
[ 4088.333522] cm_process_work+0x25/0x120 [ib_cm]
[ 4088.338580] cm_work_handler+0xd6b/0x17aa [ib_cm]
[ 4088.343832] process_one_work+0x149/0x360
[ 4088.348307] worker_thread+0x4d/0x3e0
[ 4088.352397] kthread+0x109/0x140
[ 4088.355996] ? rescuer_thread+0x380/0x380
[ 4088.360467] ? kthread_park+0x60/0x60
[ 4088.364563] ret_from_fork+0x25/0x30
[ 4088.368548] Code: 48 89 45 90 48 89 45 98 eb 4d 0f 1f 44 00 00 48 8b 43 08 48 89 d9 48 c7 c2 80 13 52 a0 48 c7 c6 58 21 52 a0 48 c7 c7 80 55 52 a0 <4c> 8b 48 20 44 89 64 24 08 48 8b 40 30 49 83 e1 fc 48 89 04 24
[ 4088.389612] RIP: rds_ib_recv_refill+0x87/0x620 [rds_rdma] RSP: ffffc9000e59bb68
[ 4088.397772] CR2: 0000000000000020
[ 4088.401505] ---[ end trace fe922e6ccf004431 ]---
This bug was provoked by compiling rds out-of-tree with
EXTRA_CFLAGS="-DRDS_DEBUG -DDEBUG" and inserting an artificial delay
between the rdsdebug() and ib_ib_port_recv() statements:
/* XXX when can this fail? */
ret = ib_post_recv(ic->i_cm_id->qp, &recv->r_wr, &failed_wr);
+ if (can_wait)
+ usleep_range(1000, 5000);
rdsdebug("recv %p ibinc %p page %p addr %lu ret %d\n", recv,
recv->r_ibinc, sg_page(&recv->r_frag->f_sg),
(long) ib_sg_dma_address(
The fix is simply to move the rdsdebug() statement up before the
ib_post_recv() and remove the printing of ret, which is taken care of
anyway by the non-debug code.
Signed-off-by: Håkon Bugge <haakon.bugge@oracle.com>
Reviewed-by: Knut Omang <knut.omang@oracle.com>
Reviewed-by: Wei Lin Guay <wei.lin.guay@oracle.com>
Acked-by: Santosh Shilimkar <santosh.shilimkar@oracle.com>
Signed-off-by: David S. Miller <davem@davemloft.net>
|
|\ \ \ \
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
Pull ceph gix from Ilya Dryomov:
"Memory allocation flags fix, marked for stable"
* tag 'ceph-for-4.14-rc9' of git://github.com/ceph/ceph-client:
rbd: use GFP_NOIO for parent stat and data requests
|