aboutsummaryrefslogtreecommitdiffstats
Commit message (Collapse)AuthorAge
* xtensa: use __memset in __xtensa_clear_userMax Filippov2017-12-17
| | | | | | | | | | | | | | | | | | | | memset on xtensa is capable of accessing user memory, but KASAN checks if memset function is actually used for that and reports it as an error: ================================================================== BUG: KASAN: user-memory-access in padzero+0x4d/0x58 Write of size 519 at addr 0049ddf9 by task init/1 Call Trace: [<b0189978>] kasan_report+0x160/0x238 [<b0188818>] check_memory_region+0xf8/0x100 [<b018891c>] memset+0x20/0x34 [<b0238b71>] padzero+0x4d/0x58 ================================================================== Use __memset in __xtensa_clear_user to avoid that. Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: add support for KASANMax Filippov2017-12-17
| | | | | | | | | | | | | | | | Cover kernel addresses above 0x90000000 by the shadow map. Enable HAVE_ARCH_KASAN when MMU is enabled. Provide kasan_early_init that fills shadow map with writable copies of kasan_zero_page. Call kasan_early_init right after mmu initialization in the setup_arch. Provide kasan_init that allocates proper shadow map pages from the memblock and puts these pages into the shadow map for addresses from VMALLOC area to the end of KSEG. Call kasan_init right after memblock initialization. Don't use KASAN for the boot code, MMU and KASAN initialization and page fault handler. Make kernel stack size 4 times larger when KASAN is enabled to avoid stack overflows. GCC 7.3, 8 or newer is required to build the xtensa kernel with KASAN. Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: move fixmap and kmap just above the KSEGMax Filippov2017-12-17
| | | | | | | | | | | | The virtual address space between the page table and the VMALLOC region is big enough to host KASAN shadow map and there's enough space between the VMALLOC area and KSEG for the fixmap and kmap. Move fixmap and kmap to the gap between VMALLOC area and KSEG, just above the KSEG. Reorder entries in the kernel memory layout printing code. Drop duplicate PGTABLE_START definition, use XCHAL_PAGE_TABLE_VADDR instead. Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: don't clear swapper_pg_dir in paging_initMax Filippov2017-12-17
| | | | | | | | | swapper_pg_dir is located in the .bss, so it's zero-initialized anyway. With KASAN enabled paging_init will be called after KASAN initialization, it must not erase page directory entries set up for KASAN shadow map. Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: extract init_kioMax Filippov2017-12-17
| | | | | | | | | | KIO region placement may be specified in the device tree, that's why it's initialized with the rest of MMU after the early_init_devtree. In order to support KASAN the MMU must be initialized earlier. Separate KIO initialization from the rest of MMU initialization. Reinitialize KIO if its location is specified in the device tree. Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: implement early_trap_initMax Filippov2017-12-17
| | | | | | | | | | | | Paging on xtensa architecture requires functioning exception handling because hardware cannot transparently access page tables that are not currently mapped by TLB. Exception handling is set up late in the initialization process, but working paging is needed for KASAN. Provide early_trap_init that sets up minimal exception handling sufficient for KASAN to work. Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: clean up exception handling structureMax Filippov2017-12-17
| | | | | | | Instead of using flat array of longs use normal C structure and generate EXC_TABLE_* constants in the asm-offsets.c Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: clean up custom-controlled debug outputMax Filippov2017-12-17
| | | | | | | Replace #ifdef'fed/commented out debug printk statements with pr_debug. Replace printk statements with pr_* equivalents. Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: enable stack protectorMax Filippov2017-12-17
| | | | | | | The implementation is adopted from the ARM arch. GCC 7.3, 8 or newer is required for building the xtensa kernel with SSP. Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: print hardware config ID on startupMax Filippov2017-12-10
| | | | | | | Print hardware config ID on startup and config ID recorded in the configuration if it doesn't match one read from the hardware. Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: consolidate kernel stack size related definitionsMax Filippov2017-12-10
| | | | | | | | Define kernel stack size in kmem_layout and use it in current_thread_info, GET_THREAD_INFO, THREAD_SIZE and THERAD_SIZE_ORDER definitions. Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: clean up functions in assembly codeMax Filippov2017-12-10
| | | | | | | Use ENTRY and ENDPROC throughout arch/xtensa/lib assembly sources. Introduce asm/linkage.h and define xtensa-specific __ALIGN macro there. Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: clean up word alignment macros in assembly codeMax Filippov2017-12-10
| | | | | | | Remove duplicate definitions of ALIGN/src_b/__src_b and SSA8/ssa8/__ssa8 from assembly sources and put single definition into asm/asmmacro.h Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: clean up fixups in assembly codeMax Filippov2017-12-10
| | | | | | | Remove duplicate definitions of EX() and similar TRY/CATCH and SRC/DST macros from assembly sources and put single definition into asm/asmmacro.h Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: use call instead of callx in assembly codeMax Filippov2017-12-10
| | | | | | | | Now that xtensa assembly sources are compiled with -mlongcalls let the assembler and linker relax call instructions into l32r + callx where needed. This change makes the code cleaner and potentially a bit faster. Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: build kernel with text-section-literalsMax Filippov2017-12-10
| | | | | | | | | | | | vmlinux.lds.S doesn't do anything special with literals, so instead of keeping them separate put them into the corresponding text sections. Drop explicit .literal sections from the vmlinux.lds.S, use standard section macros. Mark literal pool locations in the assembly sources. Unfortunately assembler doesn't put literals into .init sections and external libgcc may still have .literal sections, so sed transformation to the linker script is still needed. Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* xtensa: add -mno-serialize-volatile to CFLAGSMax Filippov2017-12-10
| | | | | | | | | By default xtensa gcc inserts memw for all volatile object accesses. This is too pessimistic for the kernel: there should be no "normal" volatile objects, and all special objects, like MMIO or objects shared between CPUs should have explicit barriers. Signed-off-by: Max Filippov <jcmvbkbc@gmail.com>
* Linux 4.14Linus Torvalds2017-11-12
|
* Merge branch 'x86-urgent-for-linus' of ↵Linus Torvalds2017-11-12
|\ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip Pull x86 fixes from Thomas Gleixner: "A set of small fixes: - make KGDB work again which got broken by the conversion of WARN() to #UD. The WARN fixup needs to run before the notifier callchain, otherwise KGDB tries to handle it and crashes. - disable KASAN in the ORC unwinder to prevent false positive KASAN warnings - prevent default mapping above 47bit when 5 level page tables are enabled - make the delay calibration optimization work correctly, which had the conditionals the wrong way around and was operating on data which was not yet updated. - remove the bogus X86_TRAP_BP trap init from the default IDT init table, which broke 32bit int3 handling by overwriting the correct int3 setup. - replace this_cpu* with boot_cpu_data access in the preemptible oprofile init code" * 'x86-urgent-for-linus' of git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip: x86/debug: Handle warnings before the notifier chain, to fix KGDB crash x86/mm: Fix ELF_ET_DYN_BASE for 5-level paging x86/idt: Remove X86_TRAP_BP initialization in idt_setup_traps() x86/oprofile/ppro: Do not use __this_cpu*() in preemptible context x86/unwind: Disable KASAN checking in the ORC unwinder x86/smpboot: Make optimization of delay calibration work correctly
| * x86/debug: Handle warnings before the notifier chain, to fix KGDB crashAlexander Shishkin2017-11-10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Commit: 9a93848fe787 ("x86/debug: Implement __WARN() using UD0") turned warnings into UD0, but the fixup code only runs after the notify_die() chain. This is a problem, in particular, with kgdb, which kicks in as if it was a BUG(). Fix this by running the fixup code before the notifier chain in the invalid op handler path. Signed-off-by: Alexander Shishkin <alexander.shishkin@linux.intel.com> Tested-by: Ilya Dryomov <idryomov@gmail.com> Acked-by: Daniel Thompson <daniel.thompson@linaro.org> Acked-by: Thomas Gleixner <tglx@linutronix.de> Cc: Jason Wessel <jason.wessel@windriver.com> Cc: Arjan van de Ven <arjan@linux.intel.com> Cc: Borislav Petkov <bp@alien8.de> Cc: Linus Torvalds <torvalds@linux-foundation.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Richard Weinberger <richard.weinberger@gmail.com> Cc: <stable@vger.kernel.org> # v4.12+ Link: http://lkml.kernel.org/r/20170724100428.19173-1-alexander.shishkin@linux.intel.com Signed-off-by: Ingo Molnar <mingo@kernel.org>
| * x86/mm: Fix ELF_ET_DYN_BASE for 5-level pagingKirill A. Shutemov2017-11-09
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On machines with 5-level paging we don't want to allocate mapping above 47-bit unless user explicitly asked for it. See b569bab78d8d ("x86/mm: Prepare to expose larger address space to userspace") for details. c715b72c1ba4 ("mm: revert x86_64 and arm64 ELF_ET_DYN_BASE base changes") broke the behaviour. After the commit elf binary and heap got mapped above 47-bits. Use DEFAULT_MAP_WINDOW instead of TASK_SIZE to determine ELF_ET_DYN_BASE so it's forced to be below 47-bits unconditionally. Fixes: c715b72c1ba4 ("mm: revert x86_64 and arm64 ELF_ET_DYN_BASE base changes") Signed-off-by: Kirill A. Shutemov <kirill.shutemov@linux.intel.com> Signed-off-by: Thomas Gleixner <tglx@linutronix.de> Acked-by: Michal Hocko <mhocko@suse.com> Cc: Kees Cook <keescook@chromium.org> Cc: Nicholas Piggin <npiggin@gmail.com> Cc: linux-mm@kvack.org Cc: Andrew Morton <akpm@linux-foundation.org> Link: https://lkml.kernel.org/r/20171107103804.47341-1-kirill.shutemov@linux.intel.com
| * x86/idt: Remove X86_TRAP_BP initialization in idt_setup_traps()Yonghong Song2017-11-08
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Commit b70543a0b2b6("x86/idt: Move regular trap init to tables") moves regular trap init for each trap vector into a table based initialization. It introduced the initialization for vector X86_TRAP_BP which was not in the code which it replaced. This breaks uprobe functionality for x86_32; the probed program segfaults instead of handling the probe proper. The reason for this is that TRAP_BP is set up as system interrupt gate (DPL3) in the early IDT and then replaced by a regular interrupt gate (DPL0) in idt_setup_traps(). The DPL0 restriction causes the int3 trap to fail with a #GP resulting in a SIGSEGV of the probed program. On 64bit this does not cause a problem because the IDT entry is replaced with a system interrupt gate (DPL3) with interrupt stack afterwards. Remove X86_TRAP_BP from the def_idts table which is used in idt_setup_traps(). Remove a redundant entry for X86_TRAP_NMI in def_idts while at it. Tested on both x86_64 and x86_32. [ tglx: Amended changelog with a description of the root cause ] Fixes: b70543a0b2b6("x86/idt: Move regular trap init to tables") Reported-and-tested-by: Yonghong Song <yhs@fb.com> Signed-off-by: Yonghong Song <yhs@fb.com> Signed-off-by: Thomas Gleixner <tglx@linutronix.de> Cc: a.p.zijlstra@chello.nl Cc: ast@fb.com Cc: oleg@redhat.com Cc: luto@kernel.org Cc: kernel-team@fb.com Link: https://lkml.kernel.org/r/20171108192845.552709-1-yhs@fb.com
| * x86/oprofile/ppro: Do not use __this_cpu*() in preemptible contextBorislav Petkov2017-11-08
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The warning below says it all: BUG: using __this_cpu_read() in preemptible [00000000] code: swapper/0/1 caller is __this_cpu_preempt_check CPU: 0 PID: 1 Comm: swapper/0 Not tainted 4.14.0-rc8 #4 Call Trace: dump_stack check_preemption_disabled ? do_early_param __this_cpu_preempt_check arch_perfmon_init op_nmi_init ? alloc_pci_root_info oprofile_arch_init oprofile_init do_one_initcall ... These accessors should not have been used in the first place: it is PPro so no mixed silicon revisions and thus it can simply use boot_cpu_data. Reported-by: Fengguang Wu <fengguang.wu@intel.com> Tested-by: Fengguang Wu <fengguang.wu@intel.com> Fix-creation-mandated-by: Linus Torvalds <torvalds@linux-foundation.org> Signed-off-by: Borislav Petkov <bp@suse.de> Signed-off-by: Thomas Gleixner <tglx@linutronix.de> Cc: Robert Richter <rric@kernel.org> Cc: x86@kernel.org Cc: stable@vger.kernel.org
| * x86/unwind: Disable KASAN checking in the ORC unwinderJosh Poimboeuf2017-11-08
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fengguang reported a KASAN warning: Kprobe smoke test: started ================================================================== BUG: KASAN: stack-out-of-bounds in deref_stack_reg+0xb5/0x11a Read of size 8 at addr ffff8800001c7cd8 by task swapper/1 CPU: 0 PID: 1 Comm: swapper Not tainted 4.14.0-rc8 #26 Call Trace: <#DB> ... save_trace+0xd9/0x1d3 mark_lock+0x5f7/0xdc3 __lock_acquire+0x6b4/0x38ef lock_acquire+0x1a1/0x2aa _raw_spin_lock_irqsave+0x46/0x55 kretprobe_table_lock+0x1a/0x42 pre_handler_kretprobe+0x3f5/0x521 kprobe_int3_handler+0x19c/0x25f do_int3+0x61/0x142 int3+0x30/0x60 [...] The ORC unwinder got confused by some kprobes changes, which isn't surprising since the runtime code no longer matches vmlinux and the stack was modified for kretprobes. Until we have a way for generated code to register changes with the unwinder, these types of warnings are inevitable. So just disable KASAN checks for stack accesses in the ORC unwinder. Reported-by: Fengguang Wu <fengguang.wu@intel.com> Signed-off-by: Josh Poimboeuf <jpoimboe@redhat.com> Cc: Linus Torvalds <torvalds@linux-foundation.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Thiago Jung Bauermann <bauerman@linux.vnet.ibm.com> Cc: Thomas Gleixner <tglx@linutronix.de> Link: http://lkml.kernel.org/r/20171108021934.zbl6unh5hpugybc5@treble Signed-off-by: Ingo Molnar <mingo@kernel.org>
| * x86/smpboot: Make optimization of delay calibration work correctlyPavel Tatashin2017-11-07
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If the TSC has constant frequency then the delay calibration can be skipped when it has been calibrated for a package already. This is checked in calibrate_delay_is_known(), but that function is buggy in two aspects: It returns 'false' if (!tsc_disabled && !cpu_has(&cpu_data(cpu), X86_FEATURE_CONSTANT_TSC) which is obviously the reverse of the intended check and the check for the sibling mask cannot work either because the topology links have not been set up yet. Correct the condition and move the call to set_cpu_sibling_map() before invoking calibrate_delay() so the sibling check works correctly. [ tglx: Rewrote changelong ] Fixes: c25323c07345 ("x86/tsc: Use topology functions") Signed-off-by: Pavel Tatashin <pasha.tatashin@oracle.com> Signed-off-by: Thomas Gleixner <tglx@linutronix.de> Cc: peterz@infradead.org Cc: bob.picco@oracle.com Cc: steven.sistare@oracle.com Cc: daniel.m.jordan@oracle.com Cc: stable@vger.kernel.org Link: https://lkml.kernel.org/r/20171028001100.26603-1-pasha.tatashin@oracle.com
* | Merge branch 'perf-urgent-for-linus' of ↵Linus Torvalds2017-11-12
|\ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip Pull perf tool fixes from Thomas Gleixner: "A small set of fixes for perf tool: - synchronize the i915 drm header to avoid the 'out of date' warning - make sure that perf trace cleans up its temporary files on exit - unbreak the build with newer flex versions - add missing braces in the eBPF parsing rules" * 'perf-urgent-for-linus' of git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip: tooling/headers: Sync the tools/include/uapi/drm/i915_drm.h UAPI header perf trace: Call machine__exit() at exit perf tools: Fix eBPF event specification parsing perf tools: Add "reject" option for parse-events.l
| * | tooling/headers: Sync the tools/include/uapi/drm/i915_drm.h UAPI headerIngo Molnar2017-11-11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Last minute upstream update to one of the UAPI headers - sync it with tooling, to address this warning: Warning: Kernel ABI header at 'tools/include/uapi/drm/i915_drm.h' differs from latest version at 'include/uapi/drm/i915_drm.h' Cc: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: Jiri Olsa <jolsa@redhat.com> Cc: Peter Zijlstra <peterz@infradead.org> Cc: linux-kernel@vger.kernel.org Signed-off-by: Ingo Molnar <mingo@kernel.org>
| * | Merge branch 'perf/urgent' of ↵Ingo Molnar2017-11-11
| |\ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | git://git.kernel.org/pub/scm/linux/kernel/git/acme/linux into perf/urgent Pull perf tooling fixes from Arnaldo Carvalho de Melo. Signed-off-by: Ingo Molnar <mingo@kernel.org>
| | * | perf trace: Call machine__exit() at exitAndrei Vagin2017-11-09
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Otherwise 'perf trace' leaves a temporary file /tmp/perf-vdso.so-XXXXXX. $ perf trace -o log true $ ls -l /tmp/perf-vdso.* -rw------- 1 root root 8192 Nov 8 03:08 /tmp/perf-vdso.so-5bCpD0 Signed-off-by: Andrei Vagin <avagin@openvz.org> Reviewed-by: Jiri Olsa <jolsa@redhat.com> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Vasily Averin <vvs@virtuozzo.com> Link: http://lkml.kernel.org/r/20171108002246.8924-1-avagin@openvz.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
| | * | perf tools: Fix eBPF event specification parsingJiri Olsa2017-11-09
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Looks like I've reached the new level of stupidity, adding missing braces. Committer testing: Given the following eBPF C filter, that will add a record when it returns true, i.e. when the tv_nsec variable is > 2000ns, should be built and installed via sys_bpf(), but fails to do so before this patch: # cat filter.c #include <uapi/linux/bpf.h> #define SEC(NAME) __attribute__((section(NAME), used)) SEC("func=hrtimer_nanosleep rqtp->tv_nsec") int func(void *ctx, int err, long nsec) { return nsec > 1000; } char _license[] SEC("license") = "GPL"; int _version SEC("version") = LINUX_VERSION_CODE; # # perf trace -e nanosleep,filter.c usleep 1 invalid or unsupported event: 'filter.c' Run 'perf list' for a list of valid events Usage: perf trace [<options>] [<command>] or: perf trace [<options>] -- <command> [<options>] or: perf trace record [<options>] [<command>] or: perf trace record [<options>] -- <command> [<options>] -e, --event <event> event/syscall selector. use 'perf list' to list available events # And works again after it is applied, the nothing is inserted when the co # perf trace -e *sleep,filter.c usleep 1 0.000 ( 0.066 ms): usleep/23994 nanosleep(rqtp: 0x7ffead94a0d0) = 0 # perf trace -e *sleep,filter.c usleep 2 0.000 ( 0.008 ms): usleep/24378 nanosleep(rqtp: 0x7fffa021ba50) ... 0.008 ( ): perf_bpf_probe:func:(ffffffffb410cb30) tv_nsec=2000) 0.000 ( 0.066 ms): usleep/24378 ... [continued]: nanosleep()) = 0 # The intent of 9445464bb831 is kept: # perf stat -e 'cpu/uops_executed.core,krava/' true event syntax error: '..cuted.core,krava/' \___ unknown term valid terms: cmask,pc,event,edge,in_tx,any,ldlat,inv,umask,in_tx_cp,offcore_rsp,config,config1,config2,name,period Run 'perf list' for a list of valid events Usage: perf stat [<options>] [<command>] -e, --event <event> event selector. use 'perf list' to list available events # # perf stat -e 'cpu/uops_executed.core,period=1/' true Performance counter stats for 'true': 808,332 cpu/uops_executed.core,period=1/ 0.002997237 seconds time elapsed # Reported-by: Arnaldo Carvalho de Melo <acme@kernel.org> Signed-off-by: Jiri Olsa <jolsa@kernel.org> Cc: Andi Kleen <andi@firstfloor.org> Cc: Namhyung Kim <namhyung@kernel.org> Fixes: 9445464bb831 ("perf tools: Unwind properly location after REJECT") Link: http://lkml.kernel.org/n/tip-diea0ihbwpxfw6938huv3whj@git.kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
| | * | perf tools: Add "reject" option for parse-events.lJiri Olsa2017-11-09
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Arnaldo reported broken builds in some distros using a newer flex release, 2.6.4, found in Alpine Linux 3.6 and Edge, with flex not spotting the REJECT macro: CC /tmp/build/perf/util/parse-events-flex.o util/parse-events.l: In function 'parse_events_lex': /tmp/build/perf/util/parse-events-flex.c:4734:16: error: \ 'reject_used_but_not_detected' undeclared (first use in this function) It's happening because we put the REJECT under another USER_REJECT macro in following commit: 9445464bb831 perf tools: Unwind properly location after REJECT Fortunately flex provides option for force it to use REJECT, adding it to parse-events.l. Reported-by: Arnaldo Carvalho de Melo <acme@kernel.org> Reported-by: Markus Trippelsdorf <markus@trippelsdorf.de> Signed-off-by: Jiri Olsa <jolsa@kernel.org> Reviewed-by: Andi Kleen <andi@firstfloor.org> Tested-by: Arnaldo Carvalho de Melo <acme@kernel.org> Cc: Namhyung Kim <namhyung@kernel.org> Fixes: 9445464bb831 ("perf tools: Unwind properly location after REJECT") Link: http://lkml.kernel.org/n/tip-7kdont984mw12ijk7rji6b8p@git.kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | | | Merge git://git.kernel.org/pub/scm/linux/kernel/git/davem/netLinus Torvalds2017-11-11
|\ \ \ \ | |/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Pull networking fixes from David Miller: 1) Use after free in vlan, from Cong Wang. 2) Handle NAPI poll with a zero budget properly in mlx5 driver, from Saeed Mahameed. 3) If DMA mapping fails in mlx5 driver, NULL out page, from Inbar Karmy. 4) Handle overrun in RX FIFO of sun4i CAN driver, from Gerhard Bertelsmann. 5) Missing return in mdb and vlan prepare phase of DSA layer, from Vivien Didelot. * git://git.kernel.org/pub/scm/linux/kernel/git/davem/net: vlan: fix a use-after-free in vlan_device_event() net: dsa: return after vlan prepare phase net: dsa: return after mdb prepare phase can: ifi: Fix transmitter delay calculation tcp: fix tcp_fastretrans_alert warning tcp: gso: avoid refcount_t warning from tcp_gso_segment() can: peak: Add support for new PCIe/M2 CAN FD interfaces can: sun4i: handle overrun in RX FIFO can: c_can: don't indicate triple sampling support for D_CAN net/mlx5e: Increase Striding RQ minimum size limit to 4 multi-packet WQEs net/mlx5e: Set page to null in case dma mapping fails net/mlx5e: Fix napi poll with zero budget net/mlx5: Cancel health poll before sending panic teardown command net/mlx5: Loop over temp list to release delay events rds: ib: Fix NULL pointer dereference in debug code
| * | | Merge tag 'linux-can-fixes-for-4.14-20171110' of ↵David S. Miller2017-11-11
| |\ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | git://git.kernel.org/pub/scm/linux/kernel/git/mkl/linux-can Marc Kleine-Budde says: ==================== pull-request: can 2017-11-10 this is a pull request for net/master. The first patch by Richard Schütz for the c_can driver removes the false indication to support triple sampling for d_can. Gerhard Bertelsmann's patch for the sun4i driver improves the RX overrun handling. The patch by Stephane Grosjean for the peak_canfd driver adds the PCI ids for various new PCIe/M2 interfaces. Marek Vasut's patch for the ifi driver fix transmitter delay calculation. ==================== Signed-off-by: David S. Miller <davem@davemloft.net>
| | * | | can: ifi: Fix transmitter delay calculationMarek Vasut2017-11-10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The CANFD transmitter delay calculation formula was updated in the latest software drop from IFI and improves the behavior of the IFI CANFD core during bitrate switching. Use the new formula to improve stability of the CANFD operation. Signed-off-by: Marek Vasut <marex@denx.de> Cc: Markus Marb <markus@marb.org> Cc: linux-stable <stable@vger.kernel.org> Signed-off-by: Marc Kleine-Budde <mkl@pengutronix.de>
| | * | | can: peak: Add support for new PCIe/M2 CAN FD interfacesStephane Grosjean2017-11-10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This adds support for the following PEAK-System CAN FD interfaces: PCAN-cPCIe FD CAN FD Interface for cPCI Serial (2 or 4 channels) PCAN-PCIe/104-Express CAN FD Interface for PCIe/104-Express (1, 2 or 4 ch.) PCAN-miniPCIe FD CAN FD Interface for PCIe Mini (1, 2 or 4 channels) PCAN-PCIe FD OEM CAN FD Interface for PCIe OEM version (1, 2 or 4 ch.) PCAN-M.2 CAN FD Interface for M.2 (1 or 2 channels) Like the PCAN-PCIe FD interface, all of these boards run the same IP Core that is able to handle CAN FD (see also http://www.peak-system.com). Signed-off-by: Stephane Grosjean <s.grosjean@peak-system.com> Cc: linux-stable <stable@vger.kernel.org> Signed-off-by: Marc Kleine-Budde <mkl@pengutronix.de>
| | * | | can: sun4i: handle overrun in RX FIFOGerhard Bertelsmann2017-11-10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | SUN4Is CAN IP has a 64 byte deep FIFO buffer. If the buffer is not drained fast enough (overrun) it's getting mangled. Already received frames are dropped - the data can't be restored. Signed-off-by: Gerhard Bertelsmann <info@gerhard-bertelsmann.de> Cc: linux-stable <stable@vger.kernel.org> Signed-off-by: Marc Kleine-Budde <mkl@pengutronix.de>
| | * | | can: c_can: don't indicate triple sampling support for D_CANRichard Schütz2017-11-10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The D_CAN controller doesn't provide a triple sampling mode, so don't set the CAN_CTRLMODE_3_SAMPLES flag in ctrlmode_supported. Currently enabling triple sampling is a no-op. Signed-off-by: Richard Schütz <rschuetz@uni-koblenz.de> Cc: linux-stable <stable@vger.kernel.org> # >= v3.6 Signed-off-by: Marc Kleine-Budde <mkl@pengutronix.de>
| * | | | Merge tag 'mlx5-fixes-2017-11-08' of ↵David S. Miller2017-11-11
| |\ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | git://git.kernel.org/pub/scm/linux/kernel/git/saeed/linux Saeed Mahameed says: ==================== Mellanox, mlx5 fixes 2017-11-08 The following series includes some fixes for mlx5 core and etherent driver. Sorry for the late submission but as you can see i have some very critical fixes below that i would like them merged into this RC. Please pull and let me know if there is any problem. For -stable: ('net/mlx5e: Set page to null in case dma mapping fails') kernels >= 4.13 ('net/mlx5: FPGA, return -EINVAL if size is zero') kernels >= 4.13 ('net/mlx5: Cancel health poll before sending panic teardown command') kernels >= 4.13 V1->V2: - Fix Reviewed-by tag of the 2nd patch. - Drop the FPGA 0 size fix, it needs some more change log info. ==================== Signed-off-by: David S. Miller <davem@davemloft.net>
| | * | | | net/mlx5e: Increase Striding RQ minimum size limit to 4 multi-packet WQEsEugenia Emantayev2017-11-10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is to prevent the case of working with a single MPWQE (1 WQE is always reserved as RQ is linked-list). When the WQE is fully consumed, HW should still have available buffer in order not to drop packets. Fixes: 461017cb006a ("net/mlx5e: Support RX multi-packet WQE (Striding RQ)") Signed-off-by: Eugenia Emantayev <eugenia@mellanox.com> Reviewed-by: Tariq Toukan <tariqt@mellanox.com> Cc: kernel-team@fb.com Signed-off-by: Saeed Mahameed <saeedm@mellanox.com>
| | * | | | net/mlx5e: Set page to null in case dma mapping failsInbar Karmy2017-11-10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, when dma mapping fails, put_page is called, but the page is not set to null. Later, in the page_reuse treatment in mlx5e_free_rx_descs(), mlx5e_page_release() is called for the second time, improperly doing dma_unmap (for a non-mapped address) and an extra put_page. Prevent this by nullifying the page pointer when dma_map fails. Fixes: accd58833237 ("net/mlx5e: Introduce RX Page-Reuse") Signed-off-by: Inbar Karmy <inbark@mellanox.com> Reviewed-by: Tariq Toukan <tariqt@mellanox.com> Cc: kernel-team@fb.com Signed-off-by: Saeed Mahameed <saeedm@mellanox.com>
| | * | | | net/mlx5e: Fix napi poll with zero budgetSaeed Mahameed2017-11-10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | napi->poll can be called with budget 0, e.g. in netpoll scenarios where the caller only wants to poll TX rings (poll_one_napi@net/core/netpoll.c). The below commit changed RX polling from "while" loop to "do {} while", which caused to ignore the initial budget and handle at least one RX packet. This fixes the following warning: [ 2852.049194] mlx5e_napi_poll+0x0/0x260 [mlx5_core] exceeded budget in poll [ 2852.049195] ------------[ cut here ]------------ [ 2852.049195] WARNING: CPU: 0 PID: 25691 at net/core/netpoll.c:171 netpoll_poll_dev+0x18a/0x1a0 Fixes: 4b7dfc992514 ("net/mlx5e: Early-return on empty completion queues") Signed-off-by: Saeed Mahameed <saeedm@mellanox.com> Reviewed-by: Tariq Toukan <tariqt@mellanox.com> Reported-by: Martin KaFai Lau <kafai@fb.com> Tested-by: Martin KaFai Lau <kafai@fb.com> Cc: kernel-team@fb.com Signed-off-by: Saeed Mahameed <saeedm@mellanox.com>
| | * | | | net/mlx5: Cancel health poll before sending panic teardown commandHuy Nguyen2017-11-10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | After the panic teardown firmware command, health_care detects the error in PCI bus and calls the mlx5_pci_err_detected. This health_care flow is no longer needed because the panic teardown firmware command will bring down the PCI bus communication with the HCA. The solution is to cancel the health care timer and its pending workqueue request before sending panic teardown firmware command. Kernel trace: mlx5_core 0033:01:00.0: Shutdown was called mlx5_core 0033:01:00.0: health_care:154:(pid 9304): handling bad device here mlx5_core 0033:01:00.0: mlx5_handle_bad_state:114:(pid 9304): NIC state 1 mlx5_core 0033:01:00.0: mlx5_pci_err_detected was called mlx5_core 0033:01:00.0: mlx5_enter_error_state:96:(pid 9304): start mlx5_3:mlx5_ib_event:3061:(pid 9304): warning: event on port 0 mlx5_core 0033:01:00.0: mlx5_enter_error_state:104:(pid 9304): end Unable to handle kernel paging request for data at address 0x0000003f Faulting instruction address: 0xc0080000434b8c80 Fixes: 8812c24d28f4 ('net/mlx5: Add fast unload support in shutdown flow') Signed-off-by: Huy Nguyen <huyn@mellanox.com> Reviewed-by: Moshe Shemesh <moshe@mellanox.com> Signed-off-by: Saeed Mahameed <saeedm@mellanox.com>
| | * | | | net/mlx5: Loop over temp list to release delay eventsHuy Nguyen2017-11-10
| | |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | list_splice_init initializing waiting_events_list after splicing it to temp list, therefore we should loop over temp list to fire the events. Fixes: 4ca637a20a52 ("net/mlx5: Delay events till mlx5 interface's add complete for pci resume") Signed-off-by: Huy Nguyen <huyn@mellanox.com> Signed-off-by: Feras Daoud <ferasda@mellanox.com> Signed-off-by: Saeed Mahameed <saeedm@mellanox.com>
| * | | | vlan: fix a use-after-free in vlan_device_event()Cong Wang2017-11-11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | After refcnt reaches zero, vlan_vid_del() could free dev->vlan_info via RCU: RCU_INIT_POINTER(dev->vlan_info, NULL); call_rcu(&vlan_info->rcu, vlan_info_rcu_free); However, the pointer 'grp' still points to that memory since it is set before vlan_vid_del(): vlan_info = rtnl_dereference(dev->vlan_info); if (!vlan_info) goto out; grp = &vlan_info->grp; Depends on when that RCU callback is scheduled, we could trigger a use-after-free in vlan_group_for_each_dev() right following this vlan_vid_del(). Fix it by moving vlan_vid_del() before setting grp. This is also symmetric to the vlan_vid_add() we call in vlan_device_event(). Reported-by: Fengguang Wu <fengguang.wu@intel.com> Fixes: efc73f4bbc23 ("net: Fix memory leak - vlan_info struct") Cc: Alexander Duyck <alexander.duyck@gmail.com> Cc: Linus Torvalds <torvalds@linux-foundation.org> Cc: Girish Moodalbail <girish.moodalbail@oracle.com> Signed-off-by: Cong Wang <xiyou.wangcong@gmail.com> Reviewed-by: Girish Moodalbail <girish.moodalbail@oracle.com> Tested-by: Fengguang Wu <fengguang.wu@intel.com> Signed-off-by: David S. Miller <davem@davemloft.net>
| * | | | net: dsa: return after vlan prepare phaseVivien Didelot2017-11-11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current code does not return after successfully preparing the VLAN addition on every ports member of a it. Fix this. Fixes: 1ca4aa9cd4cc ("net: dsa: check VLAN capability of every switch") Signed-off-by: Vivien Didelot <vivien.didelot@savoirfairelinux.com> Reviewed-by: Andrew Lunn <andrew@lunn.ch> Signed-off-by: David S. Miller <davem@davemloft.net>
| * | | | net: dsa: return after mdb prepare phaseVivien Didelot2017-11-11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current code does not return after successfully preparing the MDB addition on every ports member of a multicast group. Fix this. Fixes: a1a6b7ea7f2d ("net: dsa: add cross-chip multicast support") Reported-by: Egil Hjelmeland <privat@egil-hjelmeland.no> Signed-off-by: Vivien Didelot <vivien.didelot@savoirfairelinux.com> Reviewed-by: Andrew Lunn <andrew@lunn.ch> Signed-off-by: David S. Miller <davem@davemloft.net>
| * | | | tcp: fix tcp_fastretrans_alert warningYuchung Cheng2017-11-10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This patch fixes the cause of an WARNING indicatng TCP has pending retransmission in Open state in tcp_fastretrans_alert(). The root cause is a bad interaction between path mtu probing, if enabled, and the RACK loss detection. Upong receiving a SACK above the sequence of the MTU probing packet, RACK could mark the probe packet lost in tcp_fastretrans_alert(), prior to calling tcp_simple_retransmit(). tcp_simple_retransmit() only enters Loss state if it newly marks the probe packet lost. If the probe packet is already identified as lost by RACK, the sender remains in Open state with some packets marked lost and retransmitted. Then the next SACK would trigger the warning. The likely scenario is that the probe packet was lost due to its size or network congestion. The actual impact of this warning is small by potentially entering fast recovery an ACK later. The simple fix is always entering recovery (Loss) state if some packet is marked lost during path MTU probing. Fixes: a0370b3f3f2c ("tcp: enable RACK loss detection to trigger recovery") Reported-by: Oleksandr Natalenko <oleksandr@natalenko.name> Reported-by: Alexei Starovoitov <alexei.starovoitov@gmail.com> Reported-by: Roman Gushchin <guro@fb.com> Signed-off-by: Yuchung Cheng <ycheng@google.com> Reviewed-by: Eric Dumazet <edumazet@google.com> Acked-by: Neal Cardwell <ncardwell@google.com> Signed-off-by: David S. Miller <davem@davemloft.net>
| * | | | tcp: gso: avoid refcount_t warning from tcp_gso_segment()Eric Dumazet2017-11-10
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When a GSO skb of truesize O is segmented into 2 new skbs of truesize N1 and N2, we want to transfer socket ownership to the new fresh skbs. In order to avoid expensive atomic operations on a cache line subject to cache bouncing, we replace the sequence : refcount_add(N1, &sk->sk_wmem_alloc); refcount_add(N2, &sk->sk_wmem_alloc); // repeated by number of segments refcount_sub(O, &sk->sk_wmem_alloc); by a single refcount_add(sum_of(N) - O, &sk->sk_wmem_alloc); Problem is : In some pathological cases, sum(N) - O might be a negative number, and syzkaller bot was apparently able to trigger this trace [1] atomic_t was ok with this construct, but we need to take care of the negative delta with refcount_t [1] refcount_t: saturated; leaking memory. ------------[ cut here ]------------ WARNING: CPU: 0 PID: 8404 at lib/refcount.c:77 refcount_add_not_zero+0x198/0x200 lib/refcount.c:77 Kernel panic - not syncing: panic_on_warn set ... CPU: 0 PID: 8404 Comm: syz-executor2 Not tainted 4.14.0-rc5-mm1+ #20 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/01/2011 Call Trace: __dump_stack lib/dump_stack.c:16 [inline] dump_stack+0x194/0x257 lib/dump_stack.c:52 panic+0x1e4/0x41c kernel/panic.c:183 __warn+0x1c4/0x1e0 kernel/panic.c:546 report_bug+0x211/0x2d0 lib/bug.c:183 fixup_bug+0x40/0x90 arch/x86/kernel/traps.c:177 do_trap_no_signal arch/x86/kernel/traps.c:211 [inline] do_trap+0x260/0x390 arch/x86/kernel/traps.c:260 do_error_trap+0x120/0x390 arch/x86/kernel/traps.c:297 do_invalid_op+0x1b/0x20 arch/x86/kernel/traps.c:310 invalid_op+0x18/0x20 arch/x86/entry/entry_64.S:905 RIP: 0010:refcount_add_not_zero+0x198/0x200 lib/refcount.c:77 RSP: 0018:ffff8801c606e3a0 EFLAGS: 00010282 RAX: 0000000000000026 RBX: 0000000000001401 RCX: 0000000000000000 RDX: 0000000000000026 RSI: ffffc900036fc000 RDI: ffffed0038c0dc68 RBP: ffff8801c606e430 R08: 0000000000000001 R09: 0000000000000000 R10: ffff8801d97f5eba R11: 0000000000000000 R12: ffff8801d5acf73c R13: 1ffff10038c0dc75 R14: 00000000ffffffff R15: 00000000fffff72f refcount_add+0x1b/0x60 lib/refcount.c:101 tcp_gso_segment+0x10d0/0x16b0 net/ipv4/tcp_offload.c:155 tcp4_gso_segment+0xd4/0x310 net/ipv4/tcp_offload.c:51 inet_gso_segment+0x60c/0x11c0 net/ipv4/af_inet.c:1271 skb_mac_gso_segment+0x33f/0x660 net/core/dev.c:2749 __skb_gso_segment+0x35f/0x7f0 net/core/dev.c:2821 skb_gso_segment include/linux/netdevice.h:3971 [inline] validate_xmit_skb+0x4ba/0xb20 net/core/dev.c:3074 __dev_queue_xmit+0xe49/0x2070 net/core/dev.c:3497 dev_queue_xmit+0x17/0x20 net/core/dev.c:3538 neigh_hh_output include/net/neighbour.h:471 [inline] neigh_output include/net/neighbour.h:479 [inline] ip_finish_output2+0xece/0x1460 net/ipv4/ip_output.c:229 ip_finish_output+0x85e/0xd10 net/ipv4/ip_output.c:317 NF_HOOK_COND include/linux/netfilter.h:238 [inline] ip_output+0x1cc/0x860 net/ipv4/ip_output.c:405 dst_output include/net/dst.h:459 [inline] ip_local_out+0x95/0x160 net/ipv4/ip_output.c:124 ip_queue_xmit+0x8c6/0x18e0 net/ipv4/ip_output.c:504 tcp_transmit_skb+0x1ab7/0x3840 net/ipv4/tcp_output.c:1137 tcp_write_xmit+0x663/0x4de0 net/ipv4/tcp_output.c:2341 __tcp_push_pending_frames+0xa0/0x250 net/ipv4/tcp_output.c:2513 tcp_push_pending_frames include/net/tcp.h:1722 [inline] tcp_data_snd_check net/ipv4/tcp_input.c:5050 [inline] tcp_rcv_established+0x8c7/0x18a0 net/ipv4/tcp_input.c:5497 tcp_v4_do_rcv+0x2ab/0x7d0 net/ipv4/tcp_ipv4.c:1460 sk_backlog_rcv include/net/sock.h:909 [inline] __release_sock+0x124/0x360 net/core/sock.c:2264 release_sock+0xa4/0x2a0 net/core/sock.c:2776 tcp_sendmsg+0x3a/0x50 net/ipv4/tcp.c:1462 inet_sendmsg+0x11f/0x5e0 net/ipv4/af_inet.c:763 sock_sendmsg_nosec net/socket.c:632 [inline] sock_sendmsg+0xca/0x110 net/socket.c:642 ___sys_sendmsg+0x31c/0x890 net/socket.c:2048 __sys_sendmmsg+0x1e6/0x5f0 net/socket.c:2138 Fixes: 14afee4b6092 ("net: convert sock.sk_wmem_alloc from atomic_t to refcount_t") Signed-off-by: Eric Dumazet <edumazet@google.com> Reported-by: syzbot <syzkaller@googlegroups.com> Signed-off-by: David S. Miller <davem@davemloft.net>
| * | | rds: ib: Fix NULL pointer dereference in debug codeHåkon Bugge2017-11-10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | rds_ib_recv_refill() is a function that refills an IB receive queue. It can be called from both the CQE handler (tasklet) and a worker thread. Just after the call to ib_post_recv(), a debug message is printed with rdsdebug(): ret = ib_post_recv(ic->i_cm_id->qp, &recv->r_wr, &failed_wr); rdsdebug("recv %p ibinc %p page %p addr %lu ret %d\n", recv, recv->r_ibinc, sg_page(&recv->r_frag->f_sg), (long) ib_sg_dma_address( ic->i_cm_id->device, &recv->r_frag->f_sg), ret); Now consider an invocation of rds_ib_recv_refill() from the worker thread, which is preemptible. Further, assume that the worker thread is preempted between the ib_post_recv() and rdsdebug() statements. Then, if the preemption is due to a receive CQE event, the rds_ib_recv_cqe_handler() will be invoked. This function processes receive completions, including freeing up data structures, such as the recv->r_frag. In this scenario, rds_ib_recv_cqe_handler() will process the receive WR posted above. That implies, that the recv->r_frag has been freed before the above rdsdebug() statement has been executed. When it is later executed, we will have a NULL pointer dereference: [ 4088.068008] BUG: unable to handle kernel NULL pointer dereference at 0000000000000020 [ 4088.076754] IP: rds_ib_recv_refill+0x87/0x620 [rds_rdma] [ 4088.082686] PGD 0 P4D 0 [ 4088.085515] Oops: 0000 [#1] SMP [ 4088.089015] Modules linked in: rds_rdma(OE) rds(OE) rpcsec_gss_krb5(E) nfsv4(E) dns_resolver(E) nfs(E) fscache(E) mlx4_ib(E) ib_ipoib(E) rdma_ucm(E) ib_ucm(E) ib_uverbs(E) ib_umad(E) rdma_cm(E) ib_cm(E) iw_cm(E) ib_core(E) binfmt_misc(E) sb_edac(E) intel_powerclamp(E) coretemp(E) kvm_intel(E) kvm(E) irqbypass(E) crct10dif_pclmul(E) crc32_pclmul(E) ghash_clmulni_intel(E) pcbc(E) aesni_intel(E) crypto_simd(E) iTCO_wdt(E) glue_helper(E) iTCO_vendor_support(E) sg(E) cryptd(E) pcspkr(E) ipmi_si(E) ipmi_devintf(E) ipmi_msghandler(E) shpchp(E) ioatdma(E) i2c_i801(E) wmi(E) lpc_ich(E) mei_me(E) mei(E) mfd_core(E) nfsd(E) auth_rpcgss(E) nfs_acl(E) lockd(E) grace(E) sunrpc(E) ip_tables(E) ext4(E) mbcache(E) jbd2(E) fscrypto(E) mgag200(E) i2c_algo_bit(E) drm_kms_helper(E) syscopyarea(E) sysfillrect(E) sysimgblt(E) [ 4088.168486] fb_sys_fops(E) ahci(E) ixgbe(E) libahci(E) ttm(E) mdio(E) ptp(E) pps_core(E) drm(E) sd_mod(E) libata(E) crc32c_intel(E) mlx4_core(E) i2c_core(E) dca(E) megaraid_sas(E) dm_mirror(E) dm_region_hash(E) dm_log(E) dm_mod(E) [last unloaded: rds] [ 4088.193442] CPU: 20 PID: 1244 Comm: kworker/20:2 Tainted: G OE 4.14.0-rc7.master.20171105.ol7.x86_64 #1 [ 4088.205097] Hardware name: Oracle Corporation ORACLE SERVER X5-2L/ASM,MOBO TRAY,2U, BIOS 31110000 03/03/2017 [ 4088.216074] Workqueue: ib_cm cm_work_handler [ib_cm] [ 4088.221614] task: ffff885fa11d0000 task.stack: ffffc9000e598000 [ 4088.228224] RIP: 0010:rds_ib_recv_refill+0x87/0x620 [rds_rdma] [ 4088.234736] RSP: 0018:ffffc9000e59bb68 EFLAGS: 00010286 [ 4088.240568] RAX: 0000000000000000 RBX: ffffc9002115d050 RCX: ffffc9002115d050 [ 4088.248535] RDX: ffffffffa0521380 RSI: ffffffffa0522158 RDI: ffffffffa0525580 [ 4088.256498] RBP: ffffc9000e59bbf8 R08: 0000000000000005 R09: 0000000000000000 [ 4088.264465] R10: 0000000000000339 R11: 0000000000000001 R12: 0000000000000000 [ 4088.272433] R13: ffff885f8c9d8000 R14: ffffffff81a0a060 R15: ffff884676268000 [ 4088.280397] FS: 0000000000000000(0000) GS:ffff885fbec80000(0000) knlGS:0000000000000000 [ 4088.289434] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 4088.295846] CR2: 0000000000000020 CR3: 0000000001e09005 CR4: 00000000001606e0 [ 4088.303816] Call Trace: [ 4088.306557] rds_ib_cm_connect_complete+0xe0/0x220 [rds_rdma] [ 4088.312982] ? __dynamic_pr_debug+0x8c/0xb0 [ 4088.317664] ? __queue_work+0x142/0x3c0 [ 4088.321944] rds_rdma_cm_event_handler+0x19e/0x250 [rds_rdma] [ 4088.328370] cma_ib_handler+0xcd/0x280 [rdma_cm] [ 4088.333522] cm_process_work+0x25/0x120 [ib_cm] [ 4088.338580] cm_work_handler+0xd6b/0x17aa [ib_cm] [ 4088.343832] process_one_work+0x149/0x360 [ 4088.348307] worker_thread+0x4d/0x3e0 [ 4088.352397] kthread+0x109/0x140 [ 4088.355996] ? rescuer_thread+0x380/0x380 [ 4088.360467] ? kthread_park+0x60/0x60 [ 4088.364563] ret_from_fork+0x25/0x30 [ 4088.368548] Code: 48 89 45 90 48 89 45 98 eb 4d 0f 1f 44 00 00 48 8b 43 08 48 89 d9 48 c7 c2 80 13 52 a0 48 c7 c6 58 21 52 a0 48 c7 c7 80 55 52 a0 <4c> 8b 48 20 44 89 64 24 08 48 8b 40 30 49 83 e1 fc 48 89 04 24 [ 4088.389612] RIP: rds_ib_recv_refill+0x87/0x620 [rds_rdma] RSP: ffffc9000e59bb68 [ 4088.397772] CR2: 0000000000000020 [ 4088.401505] ---[ end trace fe922e6ccf004431 ]--- This bug was provoked by compiling rds out-of-tree with EXTRA_CFLAGS="-DRDS_DEBUG -DDEBUG" and inserting an artificial delay between the rdsdebug() and ib_ib_port_recv() statements: /* XXX when can this fail? */ ret = ib_post_recv(ic->i_cm_id->qp, &recv->r_wr, &failed_wr); + if (can_wait) + usleep_range(1000, 5000); rdsdebug("recv %p ibinc %p page %p addr %lu ret %d\n", recv, recv->r_ibinc, sg_page(&recv->r_frag->f_sg), (long) ib_sg_dma_address( The fix is simply to move the rdsdebug() statement up before the ib_post_recv() and remove the printing of ret, which is taken care of anyway by the non-debug code. Signed-off-by: Håkon Bugge <haakon.bugge@oracle.com> Reviewed-by: Knut Omang <knut.omang@oracle.com> Reviewed-by: Wei Lin Guay <wei.lin.guay@oracle.com> Acked-by: Santosh Shilimkar <santosh.shilimkar@oracle.com> Signed-off-by: David S. Miller <davem@davemloft.net>
* | | | Merge tag 'ceph-for-4.14-rc9' of git://github.com/ceph/ceph-clientLinus Torvalds2017-11-10
|\ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Pull ceph gix from Ilya Dryomov: "Memory allocation flags fix, marked for stable" * tag 'ceph-for-4.14-rc9' of git://github.com/ceph/ceph-client: rbd: use GFP_NOIO for parent stat and data requests
generated by cgit v1.2.2 (git 2.25.0) at 2025-08-14 17:17:19 -0400