Merge branch 'origin' into for-linus

Conflicts:
	MAINTAINERS

96 files changed, 13045 insertions, 3442 deletions

diff --git a/drivers/video/Kconfig b/drivers/video/Kconfig
index cef3e1d9b92e..9bbb2855ea91 100644
--- a/drivers/video/Kconfig
+++ b/drivers/video/Kconfig
@@ -1275,26 +1275,6 @@ config FB_MATROX_MAVEN
           painting procedures (the secondary head does not use acceleration
           engine).
 
-config FB_MATROX_MULTIHEAD
-        bool "Multihead support"
-        depends on FB_MATROX
-        ---help---
-          Say Y here if you have more than one (supported) Matrox device in
-          your computer and you want to use all of them for different monitors
-          ("multihead"). If you have only one device, you should say N because
-          the driver compiled with Y is larger and a bit slower, especially on
-          ia32 (ix86).
-
-          If you said M to "Matrox unified accelerated driver" and N here, you
-          will still be able to use several Matrox devices simultaneously:
-          insert several instances of the module matroxfb into the kernel
-          with insmod, supplying the parameter "dev=N" where N is 0, 1, etc.
-          for the different Matrox devices. This method is slightly faster but
-          uses 40 KB of kernel memory per Matrox card.
-
-          There is no need for enabling 'Matrox multihead support' if you have
-          only one Matrox card in the box.
-
 config FB_RADEON
         tristate "ATI Radeon display support"
         depends on FB && PCI
@@ -1869,7 +1849,7 @@ config FB_W100
 
 config FB_SH_MOBILE_LCDC
         tristate "SuperH Mobile LCDC framebuffer support"
-        depends on FB && SUPERH
+        depends on FB && SUPERH && HAVE_CLK
         select FB_SYS_FILLRECT
         select FB_SYS_COPYAREA
         select FB_SYS_IMAGEBLIT
@@ -2041,6 +2021,17 @@ config FB_SH7760
           and 8, 15 or 16 bpp color; 90 degrees clockwise display rotation for
           panels <= 320 pixel horizontal resolution.
 
+config FB_DA8XX
+        tristate "DA8xx/OMAP-L1xx Framebuffer support"
+        depends on FB && ARCH_DAVINCI_DA8XX
+        select FB_CFB_FILLRECT
+        select FB_CFB_COPYAREA
+        select FB_CFB_IMAGEBLIT
+        ---help---
+          This is the frame buffer device driver for the TI LCD controller
+          found on DA8xx/OMAP-L1xx SoCs.
+          If unsure, say N.
+
 config FB_VIRTUAL
         tristate "Virtual Frame Buffer support (ONLY FOR TESTING!)"
         depends on FB
@@ -2117,6 +2108,17 @@ config FB_MB862XX_LIME
         ---help---
           Framebuffer support for Fujitsu Lime GDC on host CPU bus.
 
+config FB_EP93XX
+        tristate "EP93XX frame buffer support"
+        depends on FB && ARCH_EP93XX
+        select FB_CFB_FILLRECT
+        select FB_CFB_COPYAREA
+        select FB_CFB_IMAGEBLIT
+        ---help---
+          Framebuffer driver for the Cirrus Logic EP93XX series of processors.
+          This driver is also available as a module. The module will be called
+          ep93xx-fb.
+
 config FB_PRE_INIT_FB
         bool "Don't reinitialize, use bootloader's GDC/Display configuration"
         depends on FB_MB862XX_LIME
@@ -2124,6 +2126,14 @@ config FB_PRE_INIT_FB
           Select this option if display contents should be inherited as set by
           the bootloader.
 
+config FB_MSM
+        tristate
+        depends on FB && ARCH_MSM
+        select FB_CFB_FILLRECT
+        select FB_CFB_COPYAREA
+        select FB_CFB_IMAGEBLIT
+        default y
+
 config FB_MX3
         tristate "MX3 Framebuffer support"
         depends on FB && MX3_IPU
diff --git a/drivers/video/Makefile b/drivers/video/Makefile
index 01a819f47371..80232e124889 100644
--- a/drivers/video/Makefile
+++ b/drivers/video/Makefile
@@ -85,6 +85,7 @@ obj-$(CONFIG_FB_Q40)              += q40fb.o
 obj-$(CONFIG_FB_TGA)              += tgafb.o
 obj-$(CONFIG_FB_HP300)            += hpfb.o
 obj-$(CONFIG_FB_G364)             += g364fb.o
+obj-$(CONFIG_FB_EP93XX)           += ep93xx-fb.o
 obj-$(CONFIG_FB_SA1100)           += sa1100fb.o
 obj-$(CONFIG_FB_HIT)              += hitfb.o
 obj-$(CONFIG_FB_EPSON1355)        += epson1355fb.o
@@ -126,6 +127,7 @@ obj-$(CONFIG_FB_OMAP)             += omap/
 obj-$(CONFIG_XEN_FBDEV_FRONTEND)  += xen-fbfront.o
 obj-$(CONFIG_FB_CARMINE)          += carminefb.o
 obj-$(CONFIG_FB_MB862XX)          += mb862xx/
+obj-$(CONFIG_FB_MSM)              += msm/
 
 # Platform or fallback drivers go here
 obj-$(CONFIG_FB_UVESA)            += uvesafb.o
@@ -136,6 +138,7 @@ obj-$(CONFIG_FB_OF)               += offb.o
 obj-$(CONFIG_FB_BF54X_LQ043)      += bf54x-lq043fb.o
 obj-$(CONFIG_FB_BFIN_T350MCQB)    += bfin-t350mcqb-fb.o
 obj-$(CONFIG_FB_MX3)              += mx3fb.o
+obj-$(CONFIG_FB_DA8XX)            += da8xx-fb.o
 
 # the test framebuffer is last
 obj-$(CONFIG_FB_VIRTUAL)          += vfb.o
diff --git a/drivers/video/aty/atyfb_base.c b/drivers/video/aty/atyfb_base.c
index 63d3739d43a8..913b4a47ae52 100644
--- a/drivers/video/aty/atyfb_base.c
+++ b/drivers/video/aty/atyfb_base.c
@@ -132,7 +132,7 @@
 #endif
 
 #define PRINTKI(fmt, args...)   printk(KERN_INFO "atyfb: " fmt, ## args)
-#define PRINTKE(fmt, args...)    printk(KERN_ERR "atyfb: " fmt, ## args)
+#define PRINTKE(fmt, args...)   printk(KERN_ERR "atyfb: " fmt, ## args)
 
 #if defined(CONFIG_PM) || defined(CONFIG_PMAC_BACKLIGHT) || \
 defined (CONFIG_FB_ATY_GENERIC_LCD) || defined(CONFIG_FB_ATY_BACKLIGHT)
@@ -188,24 +188,23 @@ u32 aty_ld_lcd(int index, const struct atyfb_par *par)
  */
 static void ATIReduceRatio(int *Numerator, int *Denominator)
 {
-    int Multiplier, Divider, Remainder;
+        int Multiplier, Divider, Remainder;
 
-    Multiplier = *Numerator;
-    Divider = *Denominator;
+        Multiplier = *Numerator;
+        Divider = *Denominator;
 
-    while ((Remainder = Multiplier % Divider))
-    {
-        Multiplier = Divider;
-        Divider = Remainder;
-    }
+        while ((Remainder = Multiplier % Divider)) {
+                Multiplier = Divider;
+                Divider = Remainder;
+        }
 
-    *Numerator /= Divider;
-    *Denominator /= Divider;
+        *Numerator /= Divider;
+        *Denominator /= Divider;
 }
 #endif
-    /*
-     *  The Hardware parameters for each card
-     */
+/*
+ * The Hardware parameters for each card
+ */
 
 struct pci_mmap_map {
         unsigned long voff;
@@ -223,17 +222,19 @@ static struct fb_fix_screeninfo atyfb_fix __devinitdata = {
         .ypanstep       = 1,
 };
 
-    /*
-     *  Frame buffer device API
-     */
+/*
+ * Frame buffer device API
+ */
 
 static int atyfb_open(struct fb_info *info, int user);
 static int atyfb_release(struct fb_info *info, int user);
-static int atyfb_check_var(struct fb_var_screeninfo *var, struct fb_info *info);
+static int atyfb_check_var(struct fb_var_screeninfo *var,
+                           struct fb_info *info);
 static int atyfb_set_par(struct fb_info *info);
 static int atyfb_setcolreg(u_int regno, u_int red, u_int green, u_int blue,
-        u_int transp, struct fb_info *info);
-static int atyfb_pan_display(struct fb_var_screeninfo *var, struct fb_info *info);
+                           u_int transp, struct fb_info *info);
+static int atyfb_pan_display(struct fb_var_screeninfo *var,
+                             struct fb_info *info);
 static int atyfb_blank(int blank, struct fb_info *info);
 static int atyfb_ioctl(struct fb_info *info, u_int cmd, u_long arg);
 #ifdef __sparc__
@@ -241,9 +242,9 @@ static int atyfb_mmap(struct fb_info *info, struct vm_area_struct *vma);
 #endif
 static int atyfb_sync(struct fb_info *info);
 
-    /*
-     *  Internal routines
-     */
+/*
+ * Internal routines
+ */
 
 static int aty_init(struct fb_info *info);
 
@@ -254,8 +255,11 @@ static int store_video_par(char *videopar, unsigned char m64_num);
 static void aty_get_crtc(const struct atyfb_par *par, struct crtc *crtc);
 
 static void aty_set_crtc(const struct atyfb_par *par, const struct crtc *crtc);
-static int aty_var_to_crtc(const struct fb_info *info, const struct fb_var_screeninfo *var, struct crtc *crtc);
-static int aty_crtc_to_var(const struct crtc *crtc, struct fb_var_screeninfo *var);
+static int aty_var_to_crtc(const struct fb_info *info,
+                           const struct fb_var_screeninfo *var,
+                           struct crtc *crtc);
+static int aty_crtc_to_var(const struct crtc *crtc,
+                           struct fb_var_screeninfo *var);
 static void set_off_pitch(struct atyfb_par *par, const struct fb_info *info);
 #ifdef CONFIG_PPC
 static int read_aty_sense(const struct atyfb_par *par);
@@ -264,9 +268,9 @@ static int read_aty_sense(const struct atyfb_par *par);
 static DEFINE_MUTEX(reboot_lock);
 static struct fb_info *reboot_info;
 
-    /*
-     *  Interface used by the world
-     */
+/*
+ * Interface used by the world
+ */
 
 static struct fb_var_screeninfo default_var = {
         /* 640x480, 60 Hz, Non-Interlaced (25.175 MHz dotclock) */
@@ -452,14 +456,14 @@ static int __devinit correct_chipset(struct atyfb_par *par)
         type = chip_id & CFG_CHIP_TYPE;
         rev = (chip_id & CFG_CHIP_REV) >> 24;
 
-        switch(par->pci_id) {
+        switch (par->pci_id) {
 #ifdef CONFIG_FB_ATY_GX
         case PCI_CHIP_MACH64GX:
-                if(type != 0x00d7)
+                if (type != 0x00d7)
                         return -ENODEV;
                 break;
         case PCI_CHIP_MACH64CX:
-                if(type != 0x0057)
+                if (type != 0x0057)
                         return -ENODEV;
                 break;
 #endif
@@ -564,7 +568,8 @@ static char *aty_xl_ram[8] __devinitdata = {
 };
 #endif /* CONFIG_FB_ATY_CT */
 
-static u32 atyfb_get_pixclock(struct fb_var_screeninfo *var, struct atyfb_par *par)
+static u32 atyfb_get_pixclock(struct fb_var_screeninfo *var,
+                              struct atyfb_par *par)
 {
         u32 pixclock = var->pixclock;
 #ifdef CONFIG_FB_ATY_GENERIC_LCD
@@ -572,7 +577,7 @@ static u32 atyfb_get_pixclock(struct fb_var_screeninfo *var, struct atyfb_par *p
         par->pll.ct.xres = 0;
         if (par->lcd_table != 0) {
                 lcd_on_off = aty_ld_lcd(LCD_GEN_CNTL, par);
-                if(lcd_on_off & LCD_ON) {
+                if (lcd_on_off & LCD_ON) {
                         par->pll.ct.xres = var->xres;
                         pixclock = par->lcd_pixclock;
                 }
@@ -584,7 +589,7 @@ static u32 atyfb_get_pixclock(struct fb_var_screeninfo *var, struct atyfb_par *p
 #if defined(CONFIG_PPC)
 
 /*
- *  Apple monitor sense
+ * Apple monitor sense
  */
 
 static int __devinit read_aty_sense(const struct atyfb_par *par)
@@ -625,16 +630,16 @@ static int __devinit read_aty_sense(const struct atyfb_par *par)
 /* ------------------------------------------------------------------------- */
 
 /*
- *  CRTC programming
+ * CRTC programming
  */
 
 static void aty_get_crtc(const struct atyfb_par *par, struct crtc *crtc)
 {
 #ifdef CONFIG_FB_ATY_GENERIC_LCD
         if (par->lcd_table != 0) {
-                if(!M64_HAS(LT_LCD_REGS)) {
-                    crtc->lcd_index = aty_ld_le32(LCD_INDEX, par);
-                    aty_st_le32(LCD_INDEX, crtc->lcd_index, par);
+                if (!M64_HAS(LT_LCD_REGS)) {
+                        crtc->lcd_index = aty_ld_le32(LCD_INDEX, par);
+                        aty_st_le32(LCD_INDEX, crtc->lcd_index, par);
                 }
                 crtc->lcd_config_panel = aty_ld_lcd(CNFG_PANEL, par);
                 crtc->lcd_gen_cntl = aty_ld_lcd(LCD_GEN_CNTL, par);
@@ -642,7 +647,7 @@ static void aty_get_crtc(const struct atyfb_par *par, struct crtc *crtc)
 
                 /* switch to non shadow registers */
                 aty_st_lcd(LCD_GEN_CNTL, crtc->lcd_gen_cntl &
-                    ~(CRTC_RW_SELECT | SHADOW_EN | SHADOW_RW_EN), par);
+                           ~(CRTC_RW_SELECT | SHADOW_EN | SHADOW_RW_EN), par);
 
                 /* save stretching */
                 crtc->horz_stretching = aty_ld_lcd(HORZ_STRETCHING, par);
@@ -663,7 +668,7 @@ static void aty_get_crtc(const struct atyfb_par *par, struct crtc *crtc)
         if (par->lcd_table != 0) {
                 /* switch to shadow registers */
                 aty_st_lcd(LCD_GEN_CNTL, (crtc->lcd_gen_cntl & ~CRTC_RW_SELECT) |
-                        SHADOW_EN | SHADOW_RW_EN, par);
+                           SHADOW_EN | SHADOW_RW_EN, par);
 
                 crtc->shadow_h_tot_disp = aty_ld_le32(CRTC_H_TOTAL_DISP, par);
                 crtc->shadow_h_sync_strt_wid = aty_ld_le32(CRTC_H_SYNC_STRT_WID, par);
@@ -680,21 +685,20 @@ static void aty_set_crtc(const struct atyfb_par *par, const struct crtc *crtc)
 #ifdef CONFIG_FB_ATY_GENERIC_LCD
         if (par->lcd_table != 0) {
                 /* stop CRTC */
-                aty_st_le32(CRTC_GEN_CNTL, crtc->gen_cntl & ~(CRTC_EXT_DISP_EN | CRTC_EN), par);
+                aty_st_le32(CRTC_GEN_CNTL, crtc->gen_cntl &
+                            ~(CRTC_EXT_DISP_EN | CRTC_EN), par);
 
                 /* update non-shadow registers first */
                 aty_st_lcd(CNFG_PANEL, crtc->lcd_config_panel, par);
                 aty_st_lcd(LCD_GEN_CNTL, crtc->lcd_gen_cntl &
-                        ~(CRTC_RW_SELECT | SHADOW_EN | SHADOW_RW_EN), par);
+                           ~(CRTC_RW_SELECT | SHADOW_EN | SHADOW_RW_EN), par);
 
                 /* temporarily disable stretching */
-                aty_st_lcd(HORZ_STRETCHING,
-                        crtc->horz_stretching &
-                        ~(HORZ_STRETCH_MODE | HORZ_STRETCH_EN), par);
-                aty_st_lcd(VERT_STRETCHING,
-                        crtc->vert_stretching &
-                        ~(VERT_STRETCH_RATIO1 | VERT_STRETCH_RATIO2 |
-                        VERT_STRETCH_USE0 | VERT_STRETCH_EN), par);
+                aty_st_lcd(HORZ_STRETCHING, crtc->horz_stretching &
+                           ~(HORZ_STRETCH_MODE | HORZ_STRETCH_EN), par);
+                aty_st_lcd(VERT_STRETCHING, crtc->vert_stretching &
+                           ~(VERT_STRETCH_RATIO1 | VERT_STRETCH_RATIO2 |
+                             VERT_STRETCH_USE0 | VERT_STRETCH_EN), par);
         }
 #endif
         /* turn off CRT */
@@ -702,17 +706,19 @@ static void aty_set_crtc(const struct atyfb_par *par, const struct crtc *crtc)
 
         DPRINTK("setting up CRTC\n");
         DPRINTK("set primary CRT to %ix%i %c%c composite %c\n",
-            ((((crtc->h_tot_disp>>16) & 0xff) + 1)<<3), (((crtc->v_tot_disp>>16) & 0x7ff) + 1),
-            (crtc->h_sync_strt_wid & 0x200000)?'N':'P', (crtc->v_sync_strt_wid & 0x200000)?'N':'P',
-            (crtc->gen_cntl & CRTC_CSYNC_EN)?'P':'N');
-
-        DPRINTK("CRTC_H_TOTAL_DISP: %x\n",crtc->h_tot_disp);
-        DPRINTK("CRTC_H_SYNC_STRT_WID: %x\n",crtc->h_sync_strt_wid);
-        DPRINTK("CRTC_V_TOTAL_DISP: %x\n",crtc->v_tot_disp);
-        DPRINTK("CRTC_V_SYNC_STRT_WID: %x\n",crtc->v_sync_strt_wid);
+                ((((crtc->h_tot_disp >> 16) & 0xff) + 1) << 3),
+                (((crtc->v_tot_disp >> 16) & 0x7ff) + 1),
+                (crtc->h_sync_strt_wid & 0x200000) ? 'N' : 'P',
+                (crtc->v_sync_strt_wid & 0x200000) ? 'N' : 'P',
+                (crtc->gen_cntl & CRTC_CSYNC_EN) ? 'P' : 'N');
+
+        DPRINTK("CRTC_H_TOTAL_DISP: %x\n", crtc->h_tot_disp);
+        DPRINTK("CRTC_H_SYNC_STRT_WID: %x\n", crtc->h_sync_strt_wid);
+        DPRINTK("CRTC_V_TOTAL_DISP: %x\n", crtc->v_tot_disp);
+        DPRINTK("CRTC_V_SYNC_STRT_WID: %x\n", crtc->v_sync_strt_wid);
         DPRINTK("CRTC_OFF_PITCH: %x\n", crtc->off_pitch);
         DPRINTK("CRTC_VLINE_CRNT_VLINE: %x\n", crtc->vline_crnt_vline);
-        DPRINTK("CRTC_GEN_CNTL: %x\n",crtc->gen_cntl);
+        DPRINTK("CRTC_GEN_CNTL: %x\n", crtc->gen_cntl);
 
         aty_st_le32(CRTC_H_TOTAL_DISP, crtc->h_tot_disp, par);
         aty_st_le32(CRTC_H_SYNC_STRT_WID, crtc->h_sync_strt_wid, par);
@@ -732,16 +738,22 @@ static void aty_set_crtc(const struct atyfb_par *par, const struct crtc *crtc)
         if (par->lcd_table != 0) {
                 /* switch to shadow registers */
                 aty_st_lcd(LCD_GEN_CNTL, (crtc->lcd_gen_cntl & ~CRTC_RW_SELECT) |
-                        (SHADOW_EN | SHADOW_RW_EN), par);
+                           SHADOW_EN | SHADOW_RW_EN, par);
 
                 DPRINTK("set shadow CRT to %ix%i %c%c\n",
-                    ((((crtc->shadow_h_tot_disp>>16) & 0xff) + 1)<<3), (((crtc->shadow_v_tot_disp>>16) & 0x7ff) + 1),
-                    (crtc->shadow_h_sync_strt_wid & 0x200000)?'N':'P', (crtc->shadow_v_sync_strt_wid & 0x200000)?'N':'P');
-
-                DPRINTK("SHADOW CRTC_H_TOTAL_DISP: %x\n", crtc->shadow_h_tot_disp);
-                DPRINTK("SHADOW CRTC_H_SYNC_STRT_WID: %x\n", crtc->shadow_h_sync_strt_wid);
-                DPRINTK("SHADOW CRTC_V_TOTAL_DISP: %x\n", crtc->shadow_v_tot_disp);
-                DPRINTK("SHADOW CRTC_V_SYNC_STRT_WID: %x\n", crtc->shadow_v_sync_strt_wid);
+                        ((((crtc->shadow_h_tot_disp >> 16) & 0xff) + 1) << 3),
+                        (((crtc->shadow_v_tot_disp >> 16) & 0x7ff) + 1),
+                        (crtc->shadow_h_sync_strt_wid & 0x200000) ? 'N' : 'P',
+                        (crtc->shadow_v_sync_strt_wid & 0x200000) ? 'N' : 'P');
+
+                DPRINTK("SHADOW CRTC_H_TOTAL_DISP: %x\n",
+                        crtc->shadow_h_tot_disp);
+                DPRINTK("SHADOW CRTC_H_SYNC_STRT_WID: %x\n",
+                        crtc->shadow_h_sync_strt_wid);
+                DPRINTK("SHADOW CRTC_V_TOTAL_DISP: %x\n",
+                        crtc->shadow_v_tot_disp);
+                DPRINTK("SHADOW CRTC_V_SYNC_STRT_WID: %x\n",
+                        crtc->shadow_v_sync_strt_wid);
 
                 aty_st_le32(CRTC_H_TOTAL_DISP, crtc->shadow_h_tot_disp, par);
                 aty_st_le32(CRTC_H_SYNC_STRT_WID, crtc->shadow_h_sync_strt_wid, par);
@@ -752,16 +764,16 @@ static void aty_set_crtc(const struct atyfb_par *par, const struct crtc *crtc)
                 DPRINTK("LCD_GEN_CNTL: %x\n", crtc->lcd_gen_cntl);
                 DPRINTK("HORZ_STRETCHING: %x\n", crtc->horz_stretching);
                 DPRINTK("VERT_STRETCHING: %x\n", crtc->vert_stretching);
-                if(!M64_HAS(LT_LCD_REGS))
-                    DPRINTK("EXT_VERT_STRETCH: %x\n", crtc->ext_vert_stretch);
+                if (!M64_HAS(LT_LCD_REGS))
+                        DPRINTK("EXT_VERT_STRETCH: %x\n", crtc->ext_vert_stretch);
 
                 aty_st_lcd(LCD_GEN_CNTL, crtc->lcd_gen_cntl, par);
                 aty_st_lcd(HORZ_STRETCHING, crtc->horz_stretching, par);
                 aty_st_lcd(VERT_STRETCHING, crtc->vert_stretching, par);
-                if(!M64_HAS(LT_LCD_REGS)) {
-                    aty_st_lcd(EXT_VERT_STRETCH, crtc->ext_vert_stretch, par);
-                    aty_ld_le32(LCD_INDEX, par);
-                    aty_st_le32(LCD_INDEX, crtc->lcd_index, par);
+                if (!M64_HAS(LT_LCD_REGS)) {
+                        aty_st_lcd(EXT_VERT_STRETCH, crtc->ext_vert_stretch, par);
+                        aty_ld_le32(LCD_INDEX, par);
+                        aty_st_le32(LCD_INDEX, crtc->lcd_index, par);
                 }
         }
 #endif /* CONFIG_FB_ATY_GENERIC_LCD */
@@ -779,7 +791,8 @@ static u32 calc_line_length(struct atyfb_par *par, u32 vxres, u32 bpp)
 }
 
 static int aty_var_to_crtc(const struct fb_info *info,
-        const struct fb_var_screeninfo *var, struct crtc *crtc)
+                           const struct fb_var_screeninfo *var,
+                           struct crtc *crtc)
 {
         struct atyfb_par *par = (struct atyfb_par *) info->par;
         u32 xres, yres, vxres, vyres, xoffset, yoffset, bpp;
@@ -814,34 +827,32 @@ static int aty_var_to_crtc(const struct fb_info *info,
         if (bpp <= 8) {
                 bpp = 8;
                 pix_width = CRTC_PIX_WIDTH_8BPP;
-                dp_pix_width =
-                    HOST_8BPP | SRC_8BPP | DST_8BPP |
-                    BYTE_ORDER_LSB_TO_MSB;
+                dp_pix_width = HOST_8BPP | SRC_8BPP | DST_8BPP |
+                        BYTE_ORDER_LSB_TO_MSB;
                 dp_chain_mask = DP_CHAIN_8BPP;
         } else if (bpp <= 15) {
                 bpp = 16;
                 pix_width = CRTC_PIX_WIDTH_15BPP;
                 dp_pix_width = HOST_15BPP | SRC_15BPP | DST_15BPP |
-                    BYTE_ORDER_LSB_TO_MSB;
+                        BYTE_ORDER_LSB_TO_MSB;
                 dp_chain_mask = DP_CHAIN_15BPP;
         } else if (bpp <= 16) {
                 bpp = 16;
                 pix_width = CRTC_PIX_WIDTH_16BPP;
                 dp_pix_width = HOST_16BPP | SRC_16BPP | DST_16BPP |
-                    BYTE_ORDER_LSB_TO_MSB;
+                        BYTE_ORDER_LSB_TO_MSB;
                 dp_chain_mask = DP_CHAIN_16BPP;
         } else if (bpp <= 24 && M64_HAS(INTEGRATED)) {
                 bpp = 24;
                 pix_width = CRTC_PIX_WIDTH_24BPP;
-                dp_pix_width =
-                    HOST_8BPP | SRC_8BPP | DST_8BPP |
-                    BYTE_ORDER_LSB_TO_MSB;
+                dp_pix_width = HOST_8BPP | SRC_8BPP | DST_8BPP |
+                        BYTE_ORDER_LSB_TO_MSB;
                 dp_chain_mask = DP_CHAIN_24BPP;
         } else if (bpp <= 32) {
                 bpp = 32;
                 pix_width = CRTC_PIX_WIDTH_32BPP;
                 dp_pix_width = HOST_32BPP | SRC_32BPP | DST_32BPP |
-                    BYTE_ORDER_LSB_TO_MSB;
+                        BYTE_ORDER_LSB_TO_MSB;
                 dp_chain_mask = DP_CHAIN_32BPP;
         } else
                 FAIL("invalid bpp");
@@ -854,9 +865,9 @@ static int aty_var_to_crtc(const struct fb_info *info,
         h_sync_pol = sync & FB_SYNC_HOR_HIGH_ACT ? 0 : 1;
         v_sync_pol = sync & FB_SYNC_VERT_HIGH_ACT ? 0 : 1;
 
-        if((xres > 1600) || (yres > 1200)) {
+        if ((xres > 1600) || (yres > 1200)) {
                 FAIL("MACH64 chips are designed for max 1600x1200\n"
-                "select anoter resolution.");
+                     "select anoter resolution.");
         }
         h_sync_strt = h_disp + var->right_margin;
         h_sync_end = h_sync_strt + var->hsync_len;
@@ -869,11 +880,12 @@ static int aty_var_to_crtc(const struct fb_info *info,
 
 #ifdef CONFIG_FB_ATY_GENERIC_LCD
         if (par->lcd_table != 0) {
-                if(!M64_HAS(LT_LCD_REGS)) {
-                    u32 lcd_index = aty_ld_le32(LCD_INDEX, par);
-                    crtc->lcd_index = lcd_index &
-                        ~(LCD_INDEX_MASK | LCD_DISPLAY_DIS | LCD_SRC_SEL | CRTC2_DISPLAY_DIS);
-                    aty_st_le32(LCD_INDEX, lcd_index, par);
+                if (!M64_HAS(LT_LCD_REGS)) {
+                        u32 lcd_index = aty_ld_le32(LCD_INDEX, par);
+                        crtc->lcd_index = lcd_index &
+                                ~(LCD_INDEX_MASK | LCD_DISPLAY_DIS |
+                                  LCD_SRC_SEL | CRTC2_DISPLAY_DIS);
+                        aty_st_le32(LCD_INDEX, lcd_index, par);
                 }
 
                 if (!M64_HAS(MOBIL_BUS))
@@ -888,12 +900,14 @@ static int aty_var_to_crtc(const struct fb_info *info,
                         USE_SHADOWED_ROWCUR | SHADOW_EN | SHADOW_RW_EN);
                 crtc->lcd_gen_cntl |= DONT_SHADOW_VPAR | LOCK_8DOT;
 
-                if((crtc->lcd_gen_cntl & LCD_ON) &&
-                        ((xres > par->lcd_width) || (yres > par->lcd_height))) {
-                        /* We cannot display the mode on the LCD. If the CRT is enabled
-                           we can turn off the LCD.
-                           If the CRT is off, it isn't a good idea to switch it on; we don't
-                           know if one is connected. So it's better to fail then.
+                if ((crtc->lcd_gen_cntl & LCD_ON) &&
+                    ((xres > par->lcd_width) || (yres > par->lcd_height))) {
+                        /*
+                         * We cannot display the mode on the LCD. If the CRT is
+                         * enabled we can turn off the LCD.
+                         * If the CRT is off, it isn't a good idea to switch it
+                         * on; we don't know if one is connected. So it's better
+                         * to fail then.
                          */
                         if (crtc->lcd_gen_cntl & CRT_ON) {
                                 if (!(var->activate & FB_ACTIVATE_TEST))
@@ -916,17 +930,18 @@ static int aty_var_to_crtc(const struct fb_info *info,
 
                 vmode &= ~(FB_VMODE_DOUBLE | FB_VMODE_INTERLACED);
 
-                /* This is horror! When we simulate, say 640x480 on an 800x600
-                   LCD monitor, the CRTC should be programmed 800x600 values for
-                   the non visible part, but 640x480 for the visible part.
-                   This code has been tested on a laptop with it's 1400x1050 LCD
-                   monitor and a conventional monitor both switched on.
-                   Tested modes: 1280x1024, 1152x864, 1024x768, 800x600,
-                    works with little glitches also with DOUBLESCAN modes
+                /*
+                 * This is horror! When we simulate, say 640x480 on an 800x600
+                 * LCD monitor, the CRTC should be programmed 800x600 values for
+                 * the non visible part, but 640x480 for the visible part.
+                 * This code has been tested on a laptop with it's 1400x1050 LCD
+                 * monitor and a conventional monitor both switched on.
+                 * Tested modes: 1280x1024, 1152x864, 1024x768, 800x600,
+                 * works with little glitches also with DOUBLESCAN modes
                  */
                 if (yres < par->lcd_height) {
                         VScan = par->lcd_height / yres;
-                        if(VScan > 1) {
+                        if (VScan > 1) {
                                 VScan = 2;
                                 vmode |= FB_VMODE_DOUBLE;
                         }
@@ -952,7 +967,7 @@ static int aty_var_to_crtc(const struct fb_info *info,
         FAIL_MAX("h_disp too large", h_disp, 0xff);
         FAIL_MAX("h_sync_strt too large", h_sync_strt, 0x1ff);
         /*FAIL_MAX("h_sync_wid too large", h_sync_wid, 0x1f);*/
-        if(h_sync_wid > 0x1f)
+        if (h_sync_wid > 0x1f)
                 h_sync_wid = 0x1f;
         FAIL_MAX("h_total too large", h_total, 0x1ff);
 
@@ -978,7 +993,7 @@ static int aty_var_to_crtc(const struct fb_info *info,
         FAIL_MAX("v_disp too large", v_disp, 0x7ff);
         FAIL_MAX("v_sync_stsrt too large", v_sync_strt, 0x7ff);
         /*FAIL_MAX("v_sync_wid too large", v_sync_wid, 0x1f);*/
-        if(v_sync_wid > 0x1f)
+        if (v_sync_wid > 0x1f)
                 v_sync_wid = 0x1f;
         FAIL_MAX("v_total too large", v_total, 0x7ff);
 
@@ -995,11 +1010,13 @@ static int aty_var_to_crtc(const struct fb_info *info,
                 ((line_length / bpp) << 22);
         crtc->vline_crnt_vline = 0;
 
-        crtc->h_tot_disp = h_total | (h_disp<<16);
-        crtc->h_sync_strt_wid = (h_sync_strt & 0xff) | (h_sync_dly<<8) |
-                ((h_sync_strt & 0x100)<<4) | (h_sync_wid<<16) | (h_sync_pol<<21);
-        crtc->v_tot_disp = v_total | (v_disp<<16);
-        crtc->v_sync_strt_wid = v_sync_strt | (v_sync_wid<<16) | (v_sync_pol<<21);
+        crtc->h_tot_disp = h_total | (h_disp << 16);
+        crtc->h_sync_strt_wid = (h_sync_strt & 0xff) | (h_sync_dly << 8) |
+                ((h_sync_strt & 0x100) << 4) | (h_sync_wid << 16) |
+                (h_sync_pol << 21);
+        crtc->v_tot_disp = v_total | (v_disp << 16);
+        crtc->v_sync_strt_wid = v_sync_strt | (v_sync_wid << 16) |
+                (v_sync_pol << 21);
 
         /* crtc->gen_cntl = aty_ld_le32(CRTC_GEN_CNTL, par) & CRTC_PRESERVED_MASK; */
         crtc->gen_cntl = CRTC_EXT_DISP_EN | CRTC_EN | pix_width | c_sync;
@@ -1014,13 +1031,15 @@ static int aty_var_to_crtc(const struct fb_info *info,
 #ifdef CONFIG_FB_ATY_GENERIC_LCD
         if (par->lcd_table != 0) {
                 vdisplay = yres;
-                if(vmode & FB_VMODE_DOUBLE)
+                if (vmode & FB_VMODE_DOUBLE)
                         vdisplay <<= 1;
                 crtc->gen_cntl &= ~(CRTC2_EN | CRTC2_PIX_WIDTH);
                 crtc->lcd_gen_cntl &= ~(HORZ_DIVBY2_EN | DIS_HOR_CRT_DIVBY2 |
-                        /*TVCLK_PM_EN | VCLK_DAC_PM_EN |*/
-                        USE_SHADOWED_VEND | USE_SHADOWED_ROWCUR | SHADOW_EN | SHADOW_RW_EN);
-                crtc->lcd_gen_cntl |= (DONT_SHADOW_VPAR/* | LOCK_8DOT*/);
+                                        /*TVCLK_PM_EN | VCLK_DAC_PM_EN |*/
+                                        USE_SHADOWED_VEND |
+                                        USE_SHADOWED_ROWCUR |
+                                        SHADOW_EN | SHADOW_RW_EN);
+                crtc->lcd_gen_cntl |= DONT_SHADOW_VPAR/* | LOCK_8DOT*/;
 
                 /* MOBILITY M1 tested, FIXME: LT */
                 crtc->horz_stretching = aty_ld_lcd(HORZ_STRETCHING, par);
@@ -1028,28 +1047,32 @@ static int aty_var_to_crtc(const struct fb_info *info,
                         crtc->ext_vert_stretch = aty_ld_lcd(EXT_VERT_STRETCH, par) &
                                 ~(AUTO_VERT_RATIO | VERT_STRETCH_MODE | VERT_STRETCH_RATIO3);
 
-                crtc->horz_stretching &=
-                        ~(HORZ_STRETCH_RATIO | HORZ_STRETCH_LOOP | AUTO_HORZ_RATIO |
-                        HORZ_STRETCH_MODE | HORZ_STRETCH_EN);
+                crtc->horz_stretching &= ~(HORZ_STRETCH_RATIO |
+                                           HORZ_STRETCH_LOOP | AUTO_HORZ_RATIO |
+                                           HORZ_STRETCH_MODE | HORZ_STRETCH_EN);
                 if (xres < par->lcd_width && crtc->lcd_gen_cntl & LCD_ON) {
                         do {
                                 /*
-                                * The horizontal blender misbehaves when HDisplay is less than a
-                                * a certain threshold (440 for a 1024-wide panel).  It doesn't
-                                * stretch such modes enough.  Use pixel replication instead of
-                                * blending to stretch modes that can be made to exactly fit the
-                                * panel width.  The undocumented "NoLCDBlend" option allows the
-                                * pixel-replicated mode to be slightly wider or narrower than the
-                                * panel width.  It also causes a mode that is exactly half as wide
-                                * as the panel to be pixel-replicated, rather than blended.
-                                */
+                                 * The horizontal blender misbehaves when
+                                 * HDisplay is less than a certain threshold
+                                 * (440 for a 1024-wide panel).  It doesn't
+                                 * stretch such modes enough.  Use pixel
+                                 * replication instead of blending to stretch
+                                 * modes that can be made to exactly fit the
+                                 * panel width.  The undocumented "NoLCDBlend"
+                                 * option allows the pixel-replicated mode to
+                                 * be slightly wider or narrower than the
+                                 * panel width.  It also causes a mode that is
+                                 * exactly half as wide as the panel to be
+                                 * pixel-replicated, rather than blended.
+                                 */
                                 int HDisplay  = xres & ~7;
                                 int nStretch  = par->lcd_width / HDisplay;
                                 int Remainder = par->lcd_width % HDisplay;
 
                                 if ((!Remainder && ((nStretch > 2))) ||
-                                        (((HDisplay * 16) / par->lcd_width) < 7)) {
-                                        static const char StretchLoops[] = {10, 12, 13, 15, 16};
+                                    (((HDisplay * 16) / par->lcd_width) < 7)) {
+                                        static const char StretchLoops[] = { 10, 12, 13, 15, 16 };
                                         int horz_stretch_loop = -1, BestRemainder;
                                         int Numerator = HDisplay, Denominator = par->lcd_width;
                                         int Index = 5;
@@ -1098,12 +1121,12 @@ static int aty_var_to_crtc(const struct fb_info *info,
                                 (((vdisplay * (VERT_STRETCH_RATIO0 + 1)) / par->lcd_height) & VERT_STRETCH_RATIO0));
 
                         if (!M64_HAS(LT_LCD_REGS) &&
-                            xres <= (M64_HAS(MOBIL_BUS)?1024:800))
+                            xres <= (M64_HAS(MOBIL_BUS) ? 1024 : 800))
                                 crtc->ext_vert_stretch |= VERT_STRETCH_MODE;
                 } else {
                         /*
-                         * Don't use vertical blending if the mode is too wide or not
-                         * vertically stretched.
+                         * Don't use vertical blending if the mode is too wide
+                         * or not vertically stretched.
                          */
                         crtc->vert_stretching = 0;
                 }
@@ -1125,11 +1148,11 @@ static int aty_var_to_crtc(const struct fb_info *info,
         return 0;
 }
 
-static int aty_crtc_to_var(const struct crtc *crtc, struct fb_var_screeninfo *var)
+static int aty_crtc_to_var(const struct crtc *crtc,
+                           struct fb_var_screeninfo *var)
 {
         u32 xres, yres, bpp, left, right, upper, lower, hslen, vslen, sync;
-        u32 h_total, h_disp, h_sync_strt, h_sync_dly, h_sync_wid,
-            h_sync_pol;
+        u32 h_total, h_disp, h_sync_strt, h_sync_dly, h_sync_wid, h_sync_pol;
         u32 v_total, v_disp, v_sync_strt, v_sync_wid, v_sync_pol, c_sync;
         u32 pix_width;
         u32 double_scan, interlace;
@@ -1161,8 +1184,8 @@ static int aty_crtc_to_var(const struct crtc *crtc, struct fb_var_screeninfo *va
         lower = v_sync_strt - v_disp;
         vslen = v_sync_wid;
         sync = (h_sync_pol ? 0 : FB_SYNC_HOR_HIGH_ACT) |
-            (v_sync_pol ? 0 : FB_SYNC_VERT_HIGH_ACT) |
-            (c_sync ? FB_SYNC_COMP_HIGH_ACT : 0);
+                (v_sync_pol ? 0 : FB_SYNC_VERT_HIGH_ACT) |
+                (c_sync ? FB_SYNC_COMP_HIGH_ACT : 0);
 
         switch (pix_width) {
 #if 0
@@ -1252,20 +1275,21 @@ static int aty_crtc_to_var(const struct crtc *crtc, struct fb_var_screeninfo *va
         var->vsync_len = vslen;
         var->sync = sync;
         var->vmode = FB_VMODE_NONINTERLACED;
-        /* In double scan mode, the vertical parameters are doubled, so we need to
-           half them to get the right values.
-           In interlaced mode the values are already correct, so no correction is
-           necessary.
+        /*
+         * In double scan mode, the vertical parameters are doubled,
+         * so we need to halve them to get the right values.
+         * In interlaced mode the values are already correct,
+         * so no correction is necessary.
          */
         if (interlace)
                 var->vmode = FB_VMODE_INTERLACED;
 
         if (double_scan) {
                 var->vmode = FB_VMODE_DOUBLE;
-                var->yres>>=1;
-                var->upper_margin>>=1;
-                var->lower_margin>>=1;
-                var->vsync_len>>=1;
+                var->yres >>= 1;
+                var->upper_margin >>= 1;
+                var->lower_margin >>= 1;
+                var->vsync_len >>= 1;
         }
 
         return 0;
@@ -1286,7 +1310,8 @@ static int atyfb_set_par(struct fb_info *info)
         if (par->asleep)
                 return 0;
 
-        if ((err = aty_var_to_crtc(info, var, &par->crtc)))
+        err = aty_var_to_crtc(info, var, &par->crtc);
+        if (err)
                 return err;
 
         pixclock = atyfb_get_pixclock(var, par);
@@ -1295,7 +1320,9 @@ static int atyfb_set_par(struct fb_info *info)
                 PRINTKE("Invalid pixclock\n");
                 return -EINVAL;
         } else {
-                if((err = par->pll_ops->var_to_pll(info, pixclock, var->bits_per_pixel, &par->pll)))
+                err = par->pll_ops->var_to_pll(info, pixclock,
+                                               var->bits_per_pixel, &par->pll);
+                if (err)
                         return err;
         }
 
@@ -1313,22 +1340,23 @@ static int atyfb_set_par(struct fb_info *info)
                 wait_for_idle(par);
 
         aty_set_crtc(par, &par->crtc);
-        par->dac_ops->set_dac(info, &par->pll, var->bits_per_pixel, par->accel_flags);
+        par->dac_ops->set_dac(info, &par->pll,
+                              var->bits_per_pixel, par->accel_flags);
         par->pll_ops->set_pll(info, &par->pll);
 
 #ifdef DEBUG
-        if(par->pll_ops && par->pll_ops->pll_to_var)
-                pixclock_in_ps = par->pll_ops->pll_to_var(info, &(par->pll));
+        if (par->pll_ops && par->pll_ops->pll_to_var)
+                pixclock_in_ps = par->pll_ops->pll_to_var(info, &par->pll);
         else
                 pixclock_in_ps = 0;
 
-        if(0 == pixclock_in_ps) {
+        if (0 == pixclock_in_ps) {
                 PRINTKE("ALERT ops->pll_to_var get 0\n");
                 pixclock_in_ps = pixclock;
         }
 
         memset(&debug, 0, sizeof(debug));
-        if(!aty_crtc_to_var(&(par->crtc), &debug)) {
+        if (!aty_crtc_to_var(&par->crtc, &debug)) {
                 u32 hSync, vRefresh;
                 u32 h_disp, h_sync_strt, h_sync_end, h_total;
                 u32 v_disp, v_sync_strt, v_sync_end, v_total;
@@ -1344,16 +1372,20 @@ static int atyfb_set_par(struct fb_info *info)
 
                 hSync = 1000000000 / (pixclock_in_ps * h_total);
                 vRefresh = (hSync * 1000) / v_total;
-                if (par->crtc.gen_cntl & CRTC_INTERLACE_EN)
-                vRefresh *= 2;
-                if (par->crtc.gen_cntl & CRTC_DBL_SCAN_EN)
-                vRefresh /= 2;
+                if (par->crtc.gen_cntl & CRTC_INTERLACE_EN)
+                        vRefresh *= 2;
+                if (par->crtc.gen_cntl & CRTC_DBL_SCAN_EN)
+                        vRefresh /= 2;
 
                 DPRINTK("atyfb_set_par\n");
-                DPRINTK(" Set Visible Mode to %ix%i-%i\n", var->xres, var->yres, var->bits_per_pixel);
-                DPRINTK(" Virtual resolution %ix%i, pixclock_in_ps %i (calculated %i)\n",
-                        var->xres_virtual, var->yres_virtual, pixclock, pixclock_in_ps);
-                DPRINTK(" Dot clock:           %i MHz\n", 1000000 / pixclock_in_ps);
+                DPRINTK(" Set Visible Mode to %ix%i-%i\n",
+                        var->xres, var->yres, var->bits_per_pixel);
+                DPRINTK(" Virtual resolution %ix%i, "
+                        "pixclock_in_ps %i (calculated %i)\n",
+                        var->xres_virtual, var->yres_virtual,
+                        pixclock, pixclock_in_ps);
+                DPRINTK(" Dot clock:           %i MHz\n",
+                        1000000 / pixclock_in_ps);
                 DPRINTK(" Horizontal sync:     %i kHz\n", hSync);
                 DPRINTK(" Vertical refresh:    %i Hz\n", vRefresh);
                 DPRINTK(" x  style: %i.%03i %i %i %i %i   %i %i %i %i\n",
@@ -1448,7 +1480,8 @@ static int atyfb_set_par(struct fb_info *info)
         base = 0x2000;
         printk("debug atyfb: Mach64 non-shadow register values:");
         for (i = 0; i < 256; i = i+4) {
-                if(i%16 == 0) printk("\ndebug atyfb: 0x%04X: ", base + i);
+                if (i % 16 == 0)
+                        printk("\ndebug atyfb: 0x%04X: ", base + i);
                 printk(" %08X", aty_ld_le32(i, par));
         }
         printk("\n\n");
@@ -1458,8 +1491,10 @@ static int atyfb_set_par(struct fb_info *info)
         base = 0x00;
         printk("debug atyfb: Mach64 PLL register values:");
         for (i = 0; i < 64; i++) {
-                if(i%16 == 0) printk("\ndebug atyfb: 0x%02X: ", base + i);
-                if(i%4 == 0)  printk(" ");
+                if (i % 16 == 0)
+                        printk("\ndebug atyfb: 0x%02X: ", base + i);
+                if (i % 4 == 0)
+                        printk(" ");
                 printk("%02X", aty_ld_pll_ct(i, par));
         }
         printk("\n\n");
@@ -1470,19 +1505,21 @@ static int atyfb_set_par(struct fb_info *info)
                 /* LCD registers */
                 base = 0x00;
                 printk("debug atyfb: LCD register values:");
-                if(M64_HAS(LT_LCD_REGS)) {
-                    for(i = 0; i <= POWER_MANAGEMENT; i++) {
-                        if(i == EXT_VERT_STRETCH)
-                            continue;
-                        printk("\ndebug atyfb: 0x%04X: ", lt_lcd_regs[i]);
-                        printk(" %08X", aty_ld_lcd(i, par));
-                    }
-
+                if (M64_HAS(LT_LCD_REGS)) {
+                        for (i = 0; i <= POWER_MANAGEMENT; i++) {
+                                if (i == EXT_VERT_STRETCH)
+                                        continue;
+                                printk("\ndebug atyfb: 0x%04X: ",
+                                       lt_lcd_regs[i]);
+                                printk(" %08X", aty_ld_lcd(i, par));
+                        }
                 } else {
-                    for (i = 0; i < 64; i++) {
-                        if(i%4 == 0) printk("\ndebug atyfb: 0x%02X: ", base + i);
-                        printk(" %08X", aty_ld_lcd(i, par));
-                    }
+                        for (i = 0; i < 64; i++) {
+                                if (i % 4 == 0)
+                                        printk("\ndebug atyfb: 0x%02X: ",
+                                               base + i);
+                                printk(" %08X", aty_ld_lcd(i, par));
+                        }
                 }
                 printk("\n\n");
         }
@@ -1500,9 +1537,10 @@ static int atyfb_check_var(struct fb_var_screeninfo *var, struct fb_info *info)
         union aty_pll pll;
         u32 pixclock;
 
-        memcpy(&pll, &(par->pll), sizeof(pll));
+        memcpy(&pll, &par->pll, sizeof(pll));
 
-        if((err = aty_var_to_crtc(info, var, &crtc)))
+        err = aty_var_to_crtc(info, var, &crtc);
+        if (err)
                 return err;
 
         pixclock = atyfb_get_pixclock(var, par);
@@ -1512,7 +1550,9 @@ static int atyfb_check_var(struct fb_var_screeninfo *var, struct fb_info *info)
                         PRINTKE("Invalid pixclock\n");
                 return -EINVAL;
         } else {
-                if((err = par->pll_ops->var_to_pll(info, pixclock, var->bits_per_pixel, &pll)))
+                err = par->pll_ops->var_to_pll(info, pixclock,
+                                               var->bits_per_pixel, &pll);
+                if (err)
                         return err;
         }
 
@@ -1539,9 +1579,9 @@ static void set_off_pitch(struct atyfb_par *par, const struct fb_info *info)
 }
 
 
-    /*
-     *  Open/Release the frame buffer device
-     */
+/*
+ * Open/Release the frame buffer device
+ */
 
 static int atyfb_open(struct fb_info *info, int user)
 {
@@ -1553,7 +1593,7 @@ static int atyfb_open(struct fb_info *info, int user)
                 par->mmaped = 0;
 #endif
         }
-        return (0);
+        return 0;
 }
 
 static irqreturn_t aty_irq(int irq, void *dev_id)
@@ -1568,7 +1608,8 @@ static irqreturn_t aty_irq(int irq, void *dev_id)
 
         if (int_cntl & CRTC_VBLANK_INT) {
                 /* clear interrupt */
-                aty_st_le32(CRTC_INT_CNTL, (int_cntl & CRTC_INT_EN_MASK) | CRTC_VBLANK_INT_AK, par);
+                aty_st_le32(CRTC_INT_CNTL, (int_cntl & CRTC_INT_EN_MASK) |
+                            CRTC_VBLANK_INT_AK, par);
                 par->vblank.count++;
                 if (par->vblank.pan_display) {
                         par->vblank.pan_display = 0;
@@ -1603,9 +1644,11 @@ static int aty_enable_irq(struct atyfb_par *par, int reenable)
                 spin_lock_irq(&par->int_lock);
                 int_cntl = aty_ld_le32(CRTC_INT_CNTL, par) & CRTC_INT_EN_MASK;
                 if (!(int_cntl & CRTC_VBLANK_INT_EN)) {
-                        printk("atyfb: someone disabled IRQ [%08x]\n", int_cntl);
+                        printk("atyfb: someone disabled IRQ [%08x]\n",
+                               int_cntl);
                         /* re-enable interrupt */
-                        aty_st_le32(CRTC_INT_CNTL, int_cntl | CRTC_VBLANK_INT_EN, par );
+                        aty_st_le32(CRTC_INT_CNTL, int_cntl |
+                                    CRTC_VBLANK_INT_EN, par);
                 }
                 spin_unlock_irq(&par->int_lock);
         }
@@ -1625,7 +1668,7 @@ static int aty_disable_irq(struct atyfb_par *par)
                 spin_lock_irq(&par->int_lock);
                 int_cntl = aty_ld_le32(CRTC_INT_CNTL, par) & CRTC_INT_EN_MASK;
                 /* disable interrupt */
-                aty_st_le32(CRTC_INT_CNTL, int_cntl & ~CRTC_VBLANK_INT_EN, par );
+                aty_st_le32(CRTC_INT_CNTL, int_cntl & ~CRTC_VBLANK_INT_EN, par);
                 spin_unlock_irq(&par->int_lock);
                 free_irq(par->irq, par);
         }
@@ -1636,50 +1679,62 @@ static int aty_disable_irq(struct atyfb_par *par)
 static int atyfb_release(struct fb_info *info, int user)
 {
         struct atyfb_par *par = (struct atyfb_par *) info->par;
-        if (user) {
-                par->open--;
-                mdelay(1);
-                wait_for_idle(par);
-                if (!par->open) {
 #ifdef __sparc__
-                        int was_mmaped = par->mmaped;
+        int was_mmaped;
+#endif
 
-                        par->mmaped = 0;
+        if (!user)
+                return 0;
 
-                        if (was_mmaped) {
-                                struct fb_var_screeninfo var;
+        par->open--;
+        mdelay(1);
+        wait_for_idle(par);
 
-                                /* Now reset the default display config, we have no
-                                 * idea what the program(s) which mmap'd the chip did
-                                 * to the configuration, nor whether it restored it
-                                 * correctly.
-                                 */
-                                var = default_var;
-                                if (noaccel)
-                                        var.accel_flags &= ~FB_ACCELF_TEXT;
-                                else
-                                        var.accel_flags |= FB_ACCELF_TEXT;
-                                if (var.yres == var.yres_virtual) {
-                                        u32 videoram = (info->fix.smem_len - (PAGE_SIZE << 2));
-                                        var.yres_virtual = ((videoram * 8) / var.bits_per_pixel) / var.xres_virtual;
-                                        if (var.yres_virtual < var.yres)
-                                                var.yres_virtual = var.yres;
-                                }
-                        }
-#endif
-                        aty_disable_irq(par);
+        if (par->open)
+                return 0;
+
+#ifdef __sparc__
+        was_mmaped = par->mmaped;
+
+        par->mmaped = 0;
+
+        if (was_mmaped) {
+                struct fb_var_screeninfo var;
+
+                /*
+                 * Now reset the default display config, we have
+                 * no idea what the program(s) which mmap'd the
+                 * chip did to the configuration, nor whether it
+                 * restored it correctly.
+                 */
+                var = default_var;
+                if (noaccel)
+                        var.accel_flags &= ~FB_ACCELF_TEXT;
+                else
+                        var.accel_flags |= FB_ACCELF_TEXT;
+                if (var.yres == var.yres_virtual) {
+                        u32 videoram = (info->fix.smem_len - (PAGE_SIZE << 2));
+                        var.yres_virtual =
+                                ((videoram * 8) / var.bits_per_pixel) /
+                                var.xres_virtual;
+                        if (var.yres_virtual < var.yres)
+                                var.yres_virtual = var.yres;
                 }
         }
-        return (0);
+#endif
+        aty_disable_irq(par);
+
+        return 0;
 }
 
-    /*
-     *  Pan or Wrap the Display
-     *
-     *  This call looks only at xoffset, yoffset and the FB_VMODE_YWRAP flag
-     */
+/*
+ * Pan or Wrap the Display
+ *
+ * This call looks only at xoffset, yoffset and the FB_VMODE_YWRAP flag
+ */
 
-static int atyfb_pan_display(struct fb_var_screeninfo *var, struct fb_info *info)
+static int atyfb_pan_display(struct fb_var_screeninfo *var,
+                             struct fb_info *info)
 {
         struct atyfb_par *par = (struct atyfb_par *) info->par;
         u32 xres, yres, xoffset, yoffset;
@@ -1690,7 +1745,8 @@ static int atyfb_pan_display(struct fb_var_screeninfo *var, struct fb_info *info
                 yres >>= 1;
         xoffset = (var->xoffset + 7) & ~7;
         yoffset = var->yoffset;
-        if (xoffset + xres > par->crtc.vxres || yoffset + yres > par->crtc.vyres)
+        if (xoffset + xres > par->crtc.vxres ||
+            yoffset + yres > par->crtc.vyres)
                 return -EINVAL;
         info->var.xoffset = xoffset;
         info->var.yoffset = yoffset;
@@ -1727,10 +1783,10 @@ static int aty_waitforvblank(struct atyfb_par *par, u32 crtc)
                 return ret;
 
         count = vbl->count;
-        ret = wait_event_interruptible_timeout(vbl->wait, count != vbl->count, HZ/10);
-        if (ret < 0) {
+        ret = wait_event_interruptible_timeout(vbl->wait,
+                                               count != vbl->count, HZ/10);
+        if (ret < 0)
                 return ret;
-        }
         if (ret == 0) {
                 aty_enable_irq(par, 1);
                 return -ETIMEDOUT;
@@ -1784,7 +1840,8 @@ static int atyfb_ioctl(struct fb_info *info, u_int cmd, u_long arg)
                 fbtyp.fb_depth = info->var.bits_per_pixel;
                 fbtyp.fb_cmsize = info->cmap.len;
                 fbtyp.fb_size = info->fix.smem_len;
-                if (copy_to_user((struct fbtype __user *) arg, &fbtyp, sizeof(fbtyp)))
+                if (copy_to_user((struct fbtype __user *) arg, &fbtyp,
+                                 sizeof(fbtyp)))
                         return -EFAULT;
                 break;
 #endif /* __sparc__ */
@@ -1804,7 +1861,7 @@ static int atyfb_ioctl(struct fb_info *info, u_int cmd, u_long arg)
         case ATYIO_CLKR:
                 if (M64_HAS(INTEGRATED)) {
                         struct atyclk clk;
-                        union aty_pll *pll = &(par->pll);
+                        union aty_pll *pll = &par->pll;
                         u32 dsp_config = pll->ct.dsp_config;
                         u32 dsp_on_off = pll->ct.dsp_on_off;
                         clk.ref_clk_per = par->ref_clk_per;
@@ -1829,8 +1886,9 @@ static int atyfb_ioctl(struct fb_info *info, u_int cmd, u_long arg)
         case ATYIO_CLKW:
                 if (M64_HAS(INTEGRATED)) {
                         struct atyclk clk;
-                        union aty_pll *pll = &(par->pll);
-                        if (copy_from_user(&clk, (struct atyclk __user *) arg, sizeof(clk)))
+                        union aty_pll *pll = &par->pll;
+                        if (copy_from_user(&clk, (struct atyclk __user *) arg,
+                                           sizeof(clk)))
                                 return -EFAULT;
                         par->ref_clk_per = clk.ref_clk_per;
                         pll->ct.pll_ref_div = clk.pll_ref_div;
@@ -1841,8 +1899,10 @@ static int atyfb_ioctl(struct fb_info *info, u_int cmd, u_long arg)
                         pll->ct.vclk_fb_div = clk.vclk_fb_div;
                         pll->ct.vclk_post_div_real = clk.vclk_post_div;
                         pll->ct.dsp_config = (clk.dsp_xclks_per_row & 0x3fff) |
-                                ((clk.dsp_loop_latency & 0xf)<<16)| ((clk.dsp_precision & 7)<<20);
-                        pll->ct.dsp_on_off = (clk.dsp_off & 0x7ff) | ((clk.dsp_on & 0x7ff)<<16);
+                                ((clk.dsp_loop_latency & 0xf) << 16) |
+                                ((clk.dsp_precision & 7) << 20);
+                        pll->ct.dsp_on_off = (clk.dsp_off & 0x7ff) |
+                                ((clk.dsp_on & 0x7ff) << 16);
                         /*aty_calc_pll_ct(info, &pll->ct);*/
                         aty_set_pll_ct(info, pll);
                 } else
@@ -1913,8 +1973,7 @@ static int atyfb_mmap(struct fb_info *info, struct vm_area_struct *vma)
                                 continue;
 
                         map_size = par->mmap_map[i].size - (offset - start);
-                        map_offset =
-                            par->mmap_map[i].poff + (offset - start);
+                        map_offset = par->mmap_map[i].poff + (offset - start);
                         break;
                 }
                 if (!map_size) {
@@ -1924,8 +1983,7 @@ static int atyfb_mmap(struct fb_info *info, struct vm_area_struct *vma)
                 if (page + map_size > size)
                         map_size = size - page;
 
-                pgprot_val(vma->vm_page_prot) &=
-                    ~(par->mmap_map[i].prot_mask);
+                pgprot_val(vma->vm_page_prot) &= ~(par->mmap_map[i].prot_mask);
                 pgprot_val(vma->vm_page_prot) |= par->mmap_map[i].prot_flag;
 
                 if (remap_pfn_range(vma, vma->vm_start + page,
@@ -2029,7 +2087,8 @@ static int atyfb_pci_suspend(struct pci_dev *pdev, pm_message_t state)
         par->asleep = 1;
         par->lock_blank = 1;
 
-        /* Because we may change PCI D state ourselves, we need to
+        /*
+         * Because we may change PCI D state ourselves, we need to
          * first save the config space content so the core can
          * restore it properly on resume.
          */
@@ -2080,7 +2139,8 @@ static int atyfb_pci_resume(struct pci_dev *pdev)
 
         acquire_console_sem();
 
-        /* PCI state will have been restored by the core, so
+        /*
+         * PCI state will have been restored by the core, so
          * we should be in D0 now with our config space fully
          * restored
          */
@@ -2192,8 +2252,8 @@ static void aty_bl_init(struct atyfb_par *par)
 
         info->bl_dev = bd;
         fb_bl_default_curve(info, 0,
-                0x3F * FB_BACKLIGHT_MAX / MAX_LEVEL,
-                0xFF * FB_BACKLIGHT_MAX / MAX_LEVEL);
+                            0x3F * FB_BACKLIGHT_MAX / MAX_LEVEL,
+                            0xFF * FB_BACKLIGHT_MAX / MAX_LEVEL);
 
         bd->props.max_brightness = FB_BACKLIGHT_LEVELS - 1;
         bd->props.brightness = bd->props.max_brightness;
@@ -2236,16 +2296,16 @@ static void __devinit aty_calc_mem_refresh(struct atyfb_par *par, int xclk)
                 size = ARRAY_SIZE(ragepro_tbl);
         }
 
-        for (i=0; i < size; i++) {
+        for (i = 0; i < size; i++) {
                 if (xclk < refresh_tbl[i])
-                break;
+                        break;
         }
         par->mem_refresh_rate = i;
 }
 
-    /*
-     *  Initialisation
-     */
+/*
+ * Initialisation
+ */
 
 static struct fb_info *fb_list = NULL;
 
@@ -2375,8 +2435,10 @@ static int __devinit aty_init(struct fb_info *info)
         }
 #endif
 #ifdef CONFIG_PPC_PMAC
-        /* The Apple iBook1 uses non-standard memory frequencies. We detect it
-         * and set the frequency manually. */
+        /*
+         * The Apple iBook1 uses non-standard memory frequencies.
+         * We detect it and set the frequency manually.
+         */
         if (machine_is_compatible("PowerBook2,1")) {
                 par->pll_limits.mclk = 70;
                 par->pll_limits.xclk = 53;
@@ -2421,13 +2483,14 @@ static int __devinit aty_init(struct fb_info *info)
 
         /* save previous video mode */
         aty_get_crtc(par, &par->saved_crtc);
-        if(par->pll_ops->get_pll)
+        if (par->pll_ops->get_pll)
                 par->pll_ops->get_pll(info, &par->saved_pll);
 
         par->mem_cntl = aty_ld_le32(MEM_CNTL, par);
         gtb_memsize = M64_HAS(GTB_DSP);
         if (gtb_memsize)
-                switch (par->mem_cntl & 0xF) {  /* 0xF used instead of MEM_SIZE_ALIAS */
+                /* 0xF used instead of MEM_SIZE_ALIAS */
+                switch (par->mem_cntl & 0xF) {
                 case MEM_SIZE_512K:
                         info->fix.smem_len = 0x80000;
                         break;
@@ -2496,8 +2559,8 @@ static int __devinit aty_init(struct fb_info *info)
         }
 
         /*
-         *  Reg Block 0 (CT-compatible block) is at mmio_start
-         *  Reg Block 1 (multimedia extensions) is at mmio_start - 0x400
+         * Reg Block 0 (CT-compatible block) is at mmio_start
+         * Reg Block 1 (multimedia extensions) is at mmio_start - 0x400
          */
         if (M64_HAS(GX)) {
                 info->fix.mmio_len = 0x400;
@@ -2516,84 +2579,98 @@ static int __devinit aty_init(struct fb_info *info)
         }
 
         PRINTKI("%d%c %s, %s MHz XTAL, %d MHz PLL, %d Mhz MCLK, %d MHz XCLK\n",
-               info->fix.smem_len == 0x80000 ? 512 : (info->fix.smem_len >> 20),
-               info->fix.smem_len == 0x80000 ? 'K' : 'M', ramname, xtal, par->pll_limits.pll_max,
-               par->pll_limits.mclk, par->pll_limits.xclk);
+                info->fix.smem_len == 0x80000 ? 512 : (info->fix.smem_len>>20),
+                info->fix.smem_len == 0x80000 ? 'K' : 'M', ramname, xtal,
+                par->pll_limits.pll_max, par->pll_limits.mclk,
+                par->pll_limits.xclk);
 
 #if defined(DEBUG) && defined(CONFIG_FB_ATY_CT)
         if (M64_HAS(INTEGRATED)) {
                 int i;
-                printk("debug atyfb: BUS_CNTL DAC_CNTL MEM_CNTL EXT_MEM_CNTL CRTC_GEN_CNTL "
-                       "DSP_CONFIG DSP_ON_OFF CLOCK_CNTL\n"
-                       "debug atyfb: %08x %08x %08x %08x     %08x      %08x   %08x   %08x\n"
+                printk("debug atyfb: BUS_CNTL DAC_CNTL MEM_CNTL "
+                       "EXT_MEM_CNTL CRTC_GEN_CNTL DSP_CONFIG "
+                       "DSP_ON_OFF CLOCK_CNTL\n"
+                       "debug atyfb: %08x %08x %08x "
+                       "%08x     %08x      %08x   "
+                       "%08x   %08x\n"
                        "debug atyfb: PLL",
-                        aty_ld_le32(BUS_CNTL, par), aty_ld_le32(DAC_CNTL, par),
-                        aty_ld_le32(MEM_CNTL, par), aty_ld_le32(EXT_MEM_CNTL, par),
-                        aty_ld_le32(CRTC_GEN_CNTL, par), aty_ld_le32(DSP_CONFIG, par),
-                        aty_ld_le32(DSP_ON_OFF, par), aty_ld_le32(CLOCK_CNTL, par));
+                       aty_ld_le32(BUS_CNTL, par),
+                       aty_ld_le32(DAC_CNTL, par),
+                       aty_ld_le32(MEM_CNTL, par),
+                       aty_ld_le32(EXT_MEM_CNTL, par),
+                       aty_ld_le32(CRTC_GEN_CNTL, par),
+                       aty_ld_le32(DSP_CONFIG, par),
+                       aty_ld_le32(DSP_ON_OFF, par),
+                       aty_ld_le32(CLOCK_CNTL, par));
                 for (i = 0; i < 40; i++)
                         printk(" %02x", aty_ld_pll_ct(i, par));
                 printk("\n");
         }
 #endif
-        if(par->pll_ops->init_pll)
+        if (par->pll_ops->init_pll)
                 par->pll_ops->init_pll(info, &par->pll);
         if (par->pll_ops->resume_pll)
                 par->pll_ops->resume_pll(info, &par->pll);
 
         /*
-         *  Last page of 8 MB (4 MB on ISA) aperture is MMIO,
-         *  unless the auxiliary register aperture is used.
+         * Last page of 8 MB (4 MB on ISA) aperture is MMIO,
+         * unless the auxiliary register aperture is used.
          */
-
         if (!par->aux_start &&
-                (info->fix.smem_len == 0x800000 || (par->bus_type == ISA && info->fix.smem_len == 0x400000)))
+            (info->fix.smem_len == 0x800000 ||
+             (par->bus_type == ISA && info->fix.smem_len == 0x400000)))
                 info->fix.smem_len -= GUI_RESERVE;
 
         /*
-         *  Disable register access through the linear aperture
-         *  if the auxiliary aperture is used so we can access
-         *  the full 8 MB of video RAM on 8 MB boards.
+         * Disable register access through the linear aperture
+         * if the auxiliary aperture is used so we can access
+         * the full 8 MB of video RAM on 8 MB boards.
          */
         if (par->aux_start)
-                aty_st_le32(BUS_CNTL, aty_ld_le32(BUS_CNTL, par) | BUS_APER_REG_DIS, par);
+                aty_st_le32(BUS_CNTL, aty_ld_le32(BUS_CNTL, par) |
+                            BUS_APER_REG_DIS, par);
 
 #ifdef CONFIG_MTRR
         par->mtrr_aper = -1;
         par->mtrr_reg = -1;
         if (!nomtrr) {
                 /* Cover the whole resource. */
-                 par->mtrr_aper = mtrr_add(par->res_start, par->res_size, MTRR_TYPE_WRCOMB, 1);
-                 if (par->mtrr_aper >= 0 && !par->aux_start) {
+                par->mtrr_aper = mtrr_add(par->res_start, par->res_size,
+                                          MTRR_TYPE_WRCOMB, 1);
+                if (par->mtrr_aper >= 0 && !par->aux_start) {
                         /* Make a hole for mmio. */
-                        par->mtrr_reg = mtrr_add(par->res_start + 0x800000 - GUI_RESERVE,
-                                GUI_RESERVE, MTRR_TYPE_UNCACHABLE, 1);
+                        par->mtrr_reg = mtrr_add(par->res_start + 0x800000 -
+                                                 GUI_RESERVE, GUI_RESERVE,
+                                                 MTRR_TYPE_UNCACHABLE, 1);
                         if (par->mtrr_reg < 0) {
                                 mtrr_del(par->mtrr_aper, 0, 0);
                                 par->mtrr_aper = -1;
                         }
-                 }
+                }
         }
 #endif
 
         info->fbops = &atyfb_ops;
         info->pseudo_palette = par->pseudo_palette;
         info->flags = FBINFO_DEFAULT           |
-                      FBINFO_HWACCEL_IMAGEBLIT |
-                      FBINFO_HWACCEL_FILLRECT  |
-                      FBINFO_HWACCEL_COPYAREA  |
-                      FBINFO_HWACCEL_YPAN;
+                      FBINFO_HWACCEL_IMAGEBLIT |
+                      FBINFO_HWACCEL_FILLRECT  |
+                      FBINFO_HWACCEL_COPYAREA  |
+                      FBINFO_HWACCEL_YPAN;
 
 #ifdef CONFIG_PMAC_BACKLIGHT
         if (M64_HAS(G3_PB_1_1) && machine_is_compatible("PowerBook1,1")) {
-                /* these bits let the 101 powerbook wake up from sleep -- paulus */
-                aty_st_lcd(POWER_MANAGEMENT, aty_ld_lcd(POWER_MANAGEMENT, par)
-                           | (USE_F32KHZ | TRISTATE_MEM_EN), par);
+                /*
+                 * these bits let the 101 powerbook
+                 * wake up from sleep -- paulus
+                 */
+                aty_st_lcd(POWER_MANAGEMENT, aty_ld_lcd(POWER_MANAGEMENT, par) |
+                           USE_F32KHZ | TRISTATE_MEM_EN, par);
         } else
 #endif
         if (M64_HAS(MOBIL_BUS) && backlight) {
 #ifdef CONFIG_FB_ATY_BACKLIGHT
-                aty_bl_init (par);
+                aty_bl_init(par);
 #endif
         }
 
@@ -2601,8 +2678,8 @@ static int __devinit aty_init(struct fb_info *info)
 #ifdef CONFIG_PPC
         if (machine_is(powermac)) {
                 /*
-                 *  FIXME: The NVRAM stuff should be put in a Mac-specific file, as it
-                 *         applies to all Mac video cards
+                 * FIXME: The NVRAM stuff should be put in a Mac-specific file,
+                 *        as it applies to all Mac video cards
                  */
                 if (mode) {
                         if (mac_find_mode(&var, info, mode, 8))
@@ -2615,8 +2692,7 @@ static int __devinit aty_init(struct fb_info *info)
                                         default_vmode = VMODE_1024_768_60;
                                 else if (machine_is_compatible("iMac"))
                                         default_vmode = VMODE_1024_768_75;
-                                else if (machine_is_compatible
-                                         ("PowerBook2,1"))
+                                else if (machine_is_compatible("PowerBook2,1"))
                                         /* iBook with 800x600 LCD */
                                         default_vmode = VMODE_800_600_60;
                                 else
@@ -2630,7 +2706,7 @@ static int __devinit aty_init(struct fb_info *info)
                         if (default_cmode < CMODE_8 || default_cmode > CMODE_32)
                                 default_cmode = CMODE_8;
                         if (!mac_vmode_to_var(default_vmode, default_cmode,
-                                               &var))
+                                              &var))
                                 has_var = 1;
                 }
         }
@@ -2702,12 +2778,12 @@ aty_init_exit:
 
 #ifdef CONFIG_MTRR
         if (par->mtrr_reg >= 0) {
-            mtrr_del(par->mtrr_reg, 0, 0);
-            par->mtrr_reg = -1;
+                mtrr_del(par->mtrr_reg, 0, 0);
+                par->mtrr_reg = -1;
         }
         if (par->mtrr_aper >= 0) {
-            mtrr_del(par->mtrr_aper, 0, 0);
-            par->mtrr_aper = -1;
+                mtrr_del(par->mtrr_aper, 0, 0);
+                par->mtrr_aper = -1;
         }
 #endif
         return ret;
@@ -2735,18 +2811,18 @@ static int __devinit store_video_par(char *video_str, unsigned char m64_num)
         phys_size[m64_num] = size;
         phys_guiregbase[m64_num] = guiregbase;
         PRINTKI("stored them all: $%08lX $%08lX $%08lX \n", vmembase, size,
-               guiregbase);
+                guiregbase);
         return 0;
 
-      mach64_invalid:
+ mach64_invalid:
         phys_vmembase[m64_num] = 0;
         return -1;
 }
 #endif /* CONFIG_ATARI */
 
-    /*
-     *  Blank the display.
-     */
+/*
+ * Blank the display.
+ */
 
 static int atyfb_blank(int blank, struct fb_info *info)
 {
@@ -2768,20 +2844,20 @@ static int atyfb_blank(int blank, struct fb_info *info)
         gen_cntl = aty_ld_le32(CRTC_GEN_CNTL, par);
         gen_cntl &= ~0x400004c;
         switch (blank) {
-                case FB_BLANK_UNBLANK:
-                        break;
-                case FB_BLANK_NORMAL:
-                        gen_cntl |= 0x4000040;
-                        break;
-                case FB_BLANK_VSYNC_SUSPEND:
-                        gen_cntl |= 0x4000048;
-                        break;
-                case FB_BLANK_HSYNC_SUSPEND:
-                        gen_cntl |= 0x4000044;
-                        break;
-                case FB_BLANK_POWERDOWN:
-                        gen_cntl |= 0x400004c;
-                        break;
+        case FB_BLANK_UNBLANK:
+                break;
+        case FB_BLANK_NORMAL:
+                gen_cntl |= 0x4000040;
+                break;
+        case FB_BLANK_VSYNC_SUSPEND:
+                gen_cntl |= 0x4000048;
+                break;
+        case FB_BLANK_HSYNC_SUSPEND:
+                gen_cntl |= 0x4000044;
+                break;
+        case FB_BLANK_POWERDOWN:
+                gen_cntl |= 0x400004c;
+                break;
         }
         aty_st_le32(CRTC_GEN_CNTL, gen_cntl, par);
 
@@ -2806,15 +2882,15 @@ static void aty_st_pal(u_int regno, u_int red, u_int green, u_int blue,
         aty_st_8(DAC_DATA, blue, par);
 }
 
-    /*
-     *  Set a single color register. The values supplied are already
-     *  rounded down to the hardware's capabilities (according to the
-     *  entries in the var structure). Return != 0 for invalid regno.
-     *  !! 4 & 8 =  PSEUDO, > 8 = DIRECTCOLOR
-     */
+/*
+ * Set a single color register. The values supplied are already
+ * rounded down to the hardware's capabilities (according to the
+ * entries in the var structure). Return != 0 for invalid regno.
+ * !! 4 & 8 =  PSEUDO, > 8 = DIRECTCOLOR
+ */
 
 static int atyfb_setcolreg(u_int regno, u_int red, u_int green, u_int blue,
-        u_int transp, struct fb_info *info)
+                           u_int transp, struct fb_info *info)
 {
         struct atyfb_par *par = (struct atyfb_par *) info->par;
         int i, depth;
@@ -2868,16 +2944,15 @@ static int atyfb_setcolreg(u_int regno, u_int red, u_int green, u_int blue,
                 if (depth == 16) {
                         if (regno < 32)
                                 aty_st_pal(regno << 3, red,
-                                           par->palette[regno<<1].green,
+                                           par->palette[regno << 1].green,
                                            blue, par);
-                        red = par->palette[regno>>1].red;
-                        blue = par->palette[regno>>1].blue;
+                        red = par->palette[regno >> 1].red;
+                        blue = par->palette[regno >> 1].blue;
                         regno <<= 2;
                 } else if (depth == 15) {
                         regno <<= 3;
-                        for(i = 0; i < 8; i++) {
-                            aty_st_pal(regno + i, red, green, blue, par);
-                        }
+                        for (i = 0; i < 8; i++)
+                                aty_st_pal(regno + i, red, green, blue, par);
                 }
         }
         aty_st_pal(regno, red, green, blue, par);
@@ -2890,7 +2965,8 @@ static int atyfb_setcolreg(u_int regno, u_int red, u_int green, u_int blue,
 #ifdef __sparc__
 
 static int __devinit atyfb_setup_sparc(struct pci_dev *pdev,
-                        struct fb_info *info, unsigned long addr)
+                                       struct fb_info *info,
+                                       unsigned long addr)
 {
         struct atyfb_par *par = info->par;
         struct device_node *dp;
@@ -2978,7 +3054,8 @@ static int __devinit atyfb_setup_sparc(struct pci_dev *pdev,
                 j++;
         }
 
-        if((ret = correct_chipset(par)))
+        ret = correct_chipset(par);
+        if (ret)
                 return ret;
 
         if (IS_XL(pdev->device)) {
@@ -3108,28 +3185,28 @@ static void __devinit aty_init_lcd(struct atyfb_par *par, u32 bios_base)
         u32 driv_inf_tab, sig;
         u16 lcd_ofs;
 
-        /* To support an LCD panel, we should know it's dimensions and
+        /*
+         * To support an LCD panel, we should know it's dimensions and
          *  it's desired pixel clock.
          * There are two ways to do it:
          *  - Check the startup video mode and calculate the panel
          *    size from it. This is unreliable.
          *  - Read it from the driver information table in the video BIOS.
-        */
+         */
         /* Address of driver information table is at offset 0x78. */
         driv_inf_tab = bios_base + *((u16 *)(bios_base+0x78));
 
         /* Check for the driver information table signature. */
-        sig = (*(u32 *)driv_inf_tab);
+        sig = *(u32 *)driv_inf_tab;
         if ((sig == 0x54504c24) || /* Rage LT pro */
-                (sig == 0x544d5224) || /* Rage mobility */
-                (sig == 0x54435824) || /* Rage XC */
-                (sig == 0x544c5824)) { /* Rage XL */
+            (sig == 0x544d5224) || /* Rage mobility */
+            (sig == 0x54435824) || /* Rage XC */
+            (sig == 0x544c5824)) { /* Rage XL */
                 PRINTKI("BIOS contains driver information table.\n");
-                lcd_ofs = (*(u16 *)(driv_inf_tab + 10));
+                lcd_ofs = *(u16 *)(driv_inf_tab + 10);
                 par->lcd_table = 0;
-                if (lcd_ofs != 0) {
+                if (lcd_ofs != 0)
                         par->lcd_table = bios_base + lcd_ofs;
-                }
         }
 
         if (par->lcd_table != 0) {
@@ -3144,14 +3221,16 @@ static void __devinit aty_init_lcd(struct atyfb_par *par, u32 bios_base)
                 u16 width, height, panel_type, refresh_rates;
                 u16 *lcdmodeptr;
                 u32 format;
-                u8 lcd_refresh_rates[16] = {50,56,60,67,70,72,75,76,85,90,100,120,140,150,160,200};
-                /* The most important information is the panel size at
+                u8 lcd_refresh_rates[16] = { 50, 56, 60, 67, 70, 72, 75, 76, 85,
+                                             90, 100, 120, 140, 150, 160, 200 };
+                /*
+                 * The most important information is the panel size at
                  * offset 25 and 27, but there's some other nice information
                  * which we print to the screen.
                  */
                 id = *(u8 *)par->lcd_table;
-                strncpy(model,(char *)par->lcd_table+1,24);
-                model[23]=0;
+                strncpy(model, (char *)par->lcd_table+1, 24);
+                model[23] = 0;
 
                 width = par->lcd_width = *(u16 *)(par->lcd_table+25);
                 height = par->lcd_height = *(u16 *)(par->lcd_table+27);
@@ -3164,7 +3243,7 @@ static void __devinit aty_init_lcd(struct atyfb_par *par, u32 bios_base)
                         txtdual = "dual (split) ";
                 else
                         txtdual = "";
-                tech = (panel_type>>2) & 63;
+                tech = (panel_type >> 2) & 63;
                 switch (tech) {
                 case 0:
                         txtmonitor = "passive matrix";
@@ -3224,22 +3303,24 @@ static void __devinit aty_init_lcd(struct atyfb_par *par, u32 bios_base)
                         }
                 }
                 PRINTKI("%s%s %s monitor detected: %s\n",
-                        txtdual ,txtcolour, txtmonitor, model);
+                        txtdual, txtcolour, txtmonitor, model);
                 PRINTKI("       id=%d, %dx%d pixels, %s\n",
                         id, width, height, txtformat);
                 refresh_rates_buf[0] = 0;
                 refresh_rates = *(u16 *)(par->lcd_table+62);
                 m = 1;
                 f = 0;
-                for (i=0;i<16;i++) {
+                for (i = 0; i < 16; i++) {
                         if (refresh_rates & m) {
                                 if (f == 0) {
-                                        sprintf(strbuf, "%d", lcd_refresh_rates[i]);
+                                        sprintf(strbuf, "%d",
+                                                lcd_refresh_rates[i]);
                                         f++;
                                 } else {
-                                        sprintf(strbuf, ",%d", lcd_refresh_rates[i]);
+                                        sprintf(strbuf, ",%d",
+                                                lcd_refresh_rates[i]);
                                 }
-                                strcat(refresh_rates_buf,strbuf);
+                                strcat(refresh_rates_buf, strbuf);
                         }
                         m = m << 1;
                 }
@@ -3247,7 +3328,8 @@ static void __devinit aty_init_lcd(struct atyfb_par *par, u32 bios_base)
                 PRINTKI("       supports refresh rates [%s], default %d Hz\n",
                         refresh_rates_buf, lcd_refresh_rates[default_refresh_rate]);
                 par->lcd_refreshrate = lcd_refresh_rates[default_refresh_rate];
-                /* We now need to determine the crtc parameters for the
+                /*
+                 * We now need to determine the crtc parameters for the
                  * LCD monitor. This is tricky, because they are not stored
                  * individually in the BIOS. Instead, the BIOS contains a
                  * table of display modes that work for this monitor.
@@ -3382,7 +3464,9 @@ static int __devinit init_from_bios(struct atyfb_par *par)
 }
 #endif /* __i386__ */
 
-static int __devinit atyfb_setup_generic(struct pci_dev *pdev, struct fb_info *info, unsigned long addr)
+static int __devinit atyfb_setup_generic(struct pci_dev *pdev,
+                                         struct fb_info *info,
+                                         unsigned long addr)
 {
         struct atyfb_par *par = info->par;
         u16 tmp;
@@ -3429,10 +3513,12 @@ static int __devinit atyfb_setup_generic(struct pci_dev *pdev, struct fb_info *i
                 goto atyfb_setup_generic_fail;
         }
 
-        if((ret = correct_chipset(par)))
+        ret = correct_chipset(par);
+        if (ret)
                 goto atyfb_setup_generic_fail;
 #ifdef __i386__
-        if((ret = init_from_bios(par)))
+        ret = init_from_bios(par);
+        if (ret)
                 goto atyfb_setup_generic_fail;
 #endif
         if (!(aty_ld_le32(CRTC_GEN_CNTL, par) & CRTC_EXT_DISP_EN))
@@ -3457,7 +3543,8 @@ atyfb_setup_generic_fail:
 
 #endif /* !__sparc__ */
 
-static int __devinit atyfb_pci_probe(struct pci_dev *pdev, const struct pci_device_id *ent)
+static int __devinit atyfb_pci_probe(struct pci_dev *pdev,
+                                     const struct pci_device_id *ent)
 {
         unsigned long addr, res_start, res_size;
         struct fb_info *info;
@@ -3482,10 +3569,10 @@ static int __devinit atyfb_pci_probe(struct pci_dev *pdev, const struct pci_devi
         /* Reserve space */
         res_start = rp->start;
         res_size = rp->end - rp->start + 1;
-        if (!request_mem_region (res_start, res_size, "atyfb"))
+        if (!request_mem_region(res_start, res_size, "atyfb"))
                 return -EBUSY;
 
-        /* Allocate framebuffer */
+        /* Allocate framebuffer */
         info = framebuffer_alloc(sizeof(struct atyfb_par), &pdev->dev);
         if (!info) {
                 PRINTKE("atyfb_pci_probe() can't alloc fb_info\n");
@@ -3573,7 +3660,8 @@ static int __init atyfb_atari_probe(void)
         for (m64_num = 0; m64_num < mach64_count; m64_num++) {
                 if (!phys_vmembase[m64_num] || !phys_size[m64_num] ||
                     !phys_guiregbase[m64_num]) {
-                    PRINTKI("phys_*[%d] parameters not set => returning early. \n", m64_num);
+                        PRINTKI("phys_*[%d] parameters not set => "
+                                "returning early. \n", m64_num);
                         continue;
                 }
 
@@ -3589,8 +3677,8 @@ static int __init atyfb_atari_probe(void)
                 par->irq = (unsigned int) -1; /* something invalid */
 
                 /*
-                 *  Map the video memory (physical address given) to somewhere in the
-                 *  kernel address space.
+                 * Map the video memory (physical address given)
+                 * to somewhere in the kernel address space.
                  */
                 info->screen_base = ioremap(phys_vmembase[m64_num], phys_size[m64_num]);
                 info->fix.smem_start = (unsigned long)info->screen_base; /* Fake! */
@@ -3661,12 +3749,12 @@ static void __devexit atyfb_remove(struct fb_info *info)
 
 #ifdef CONFIG_MTRR
         if (par->mtrr_reg >= 0) {
-            mtrr_del(par->mtrr_reg, 0, 0);
-            par->mtrr_reg = -1;
+                mtrr_del(par->mtrr_reg, 0, 0);
+                par->mtrr_reg = -1;
         }
         if (par->mtrr_aper >= 0) {
-            mtrr_del(par->mtrr_aper, 0, 0);
-            par->mtrr_aper = -1;
+                mtrr_del(par->mtrr_aper, 0, 0);
+                par->mtrr_aper = -1;
         }
 #endif
 #ifndef __sparc__
@@ -3900,29 +3988,29 @@ static const struct dmi_system_id atyfb_reboot_ids[] = {
 
 static int __init atyfb_init(void)
 {
-    int err1 = 1, err2 = 1;
+        int err1 = 1, err2 = 1;
 #ifndef MODULE
-    char *option = NULL;
+        char *option = NULL;
 
-    if (fb_get_options("atyfb", &option))
-        return -ENODEV;
-    atyfb_setup(option);
+        if (fb_get_options("atyfb", &option))
+                return -ENODEV;
+        atyfb_setup(option);
 #endif
 
 #ifdef CONFIG_PCI
-    err1 = pci_register_driver(&atyfb_driver);
+        err1 = pci_register_driver(&atyfb_driver);
 #endif
 #ifdef CONFIG_ATARI
-    err2 = atyfb_atari_probe();
+        err2 = atyfb_atari_probe();
 #endif
 
-    if (err1 && err2)
-        return -ENODEV;
+        if (err1 && err2)
+                return -ENODEV;
 
-    if (dmi_check_system(atyfb_reboot_ids))
-        register_reboot_notifier(&atyfb_reboot_notifier);
+        if (dmi_check_system(atyfb_reboot_ids))
+                register_reboot_notifier(&atyfb_reboot_notifier);
 
-    return 0;
+        return 0;
 }
 
 static void __exit atyfb_exit(void)
@@ -3951,8 +4039,7 @@ MODULE_PARM_DESC(mclk, "int: override memory clock");
 module_param(xclk, int, 0);
 MODULE_PARM_DESC(xclk, "int: override accelerated engine clock");
 module_param(comp_sync, int, 0);
-MODULE_PARM_DESC(comp_sync,
-                 "Set composite sync signal to low (0) or high (1)");
+MODULE_PARM_DESC(comp_sync, "Set composite sync signal to low (0) or high (1)");
 module_param(mode, charp, 0);
 MODULE_PARM_DESC(mode, "Specify resolution as \"<xres>x<yres>[-<bpp>][@<refresh>]\" ");
 #ifdef CONFIG_MTRR
diff --git a/drivers/video/au1100fb.c b/drivers/video/au1100fb.c
index 378f27745a1d..a699aab63820 100644
--- a/drivers/video/au1100fb.c
+++ b/drivers/video/au1100fb.c
@@ -715,8 +715,11 @@ int au1100fb_setup(char *options)
                         }
                         /* Mode option (only option that start with digit) */
                         else if (isdigit(this_opt[0])) {
-                                mode = kmalloc(strlen(this_opt) + 1, GFP_KERNEL);
-                                strncpy(mode, this_opt, strlen(this_opt) + 1);
+                                mode = kstrdup(this_opt, GFP_KERNEL);
+                                if (!mode) {
+                                        print_err("memory allocation failed");
+                                        return -ENOMEM;
+                                }
                         }
                         /* Unsupported option */
                         else {
diff --git a/drivers/video/backlight/corgi_lcd.c b/drivers/video/backlight/corgi_lcd.c
index f8a4bb20f41a..2211a852af9c 100644
--- a/drivers/video/backlight/corgi_lcd.c
+++ b/drivers/video/backlight/corgi_lcd.c
@@ -639,3 +639,4 @@ module_exit(corgi_lcd_exit);
 MODULE_DESCRIPTION("LCD and backlight driver for SHARP C7x0/Cxx00");
 MODULE_AUTHOR("Eric Miao <eric.miao@marvell.com>");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:corgi-lcd");
diff --git a/drivers/video/backlight/ltv350qv.c b/drivers/video/backlight/ltv350qv.c
index 2eb206bf73e6..4631ca8fa4a4 100644
--- a/drivers/video/backlight/ltv350qv.c
+++ b/drivers/video/backlight/ltv350qv.c
@@ -328,3 +328,4 @@ module_exit(ltv350qv_exit);
 MODULE_AUTHOR("Haavard Skinnemoen <hskinnemoen@atmel.com>");
 MODULE_DESCRIPTION("Samsung LTV350QV LCD Driver");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:ltv350qv");
diff --git a/drivers/video/backlight/tdo24m.c b/drivers/video/backlight/tdo24m.c
index 51422fc4f606..bbfb502add67 100644
--- a/drivers/video/backlight/tdo24m.c
+++ b/drivers/video/backlight/tdo24m.c
@@ -472,3 +472,4 @@ module_exit(tdo24m_exit);
 MODULE_AUTHOR("Eric Miao <eric.miao@marvell.com>");
 MODULE_DESCRIPTION("Driver for Toppoly TDO24M LCD Panel");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:tdo24m");
diff --git a/drivers/video/backlight/tosa_lcd.c b/drivers/video/backlight/tosa_lcd.c
index b7fbc75a62fc..50ec17dfc517 100644
--- a/drivers/video/backlight/tosa_lcd.c
+++ b/drivers/video/backlight/tosa_lcd.c
@@ -300,4 +300,4 @@ module_exit(tosa_lcd_exit);
 MODULE_AUTHOR("Dmitry Baryshkov");
 MODULE_LICENSE("GPL v2");
 MODULE_DESCRIPTION("LCD/Backlight control for Sharp SL-6000 PDA");
-
+MODULE_ALIAS("spi:tosa-lcd");
diff --git a/drivers/video/backlight/vgg2432a4.c b/drivers/video/backlight/vgg2432a4.c
index 8e653b8a6f17..b49063c831e7 100644
--- a/drivers/video/backlight/vgg2432a4.c
+++ b/drivers/video/backlight/vgg2432a4.c
@@ -280,5 +280,4 @@ module_exit(vgg2432a4_exit);
 MODULE_AUTHOR("Ben Dooks <ben-linux@fluff.org>");
 MODULE_DESCRIPTION("VGG2432A4 LCD Driver");
 MODULE_LICENSE("GPL v2");
-
-
+MODULE_ALIAS("spi:VGG2432A4");
diff --git a/drivers/video/cfbcopyarea.c b/drivers/video/cfbcopyarea.c
index df03f3776dcc..79e5f40e6486 100644
--- a/drivers/video/cfbcopyarea.c
+++ b/drivers/video/cfbcopyarea.c
@@ -114,7 +114,7 @@ bitcpy(struct fb_info *p, unsigned long __iomem *dst, int dst_idx,
                                 d0 >>= right;
                         } else if (src_idx+n <= bits) {
                                 // Single source word
-                                d0 <<= left;;
+                                d0 <<= left;
                         } else {
                                 // 2 source words
                                 d1 = FB_READL(src + 1);
diff --git a/drivers/video/console/bitblit.c b/drivers/video/console/bitblit.c
index 69864b1b3f9e..6b7c8fbc5495 100644
--- a/drivers/video/console/bitblit.c
+++ b/drivers/video/console/bitblit.c
@@ -25,7 +25,7 @@ static inline void update_attr(u8 *dst, u8 *src, int attribute,
                                struct vc_data *vc)
 {
         int i, offset = (vc->vc_font.height < 10) ? 1 : 2;
-        int width = (vc->vc_font.width + 7) >> 3;
+        int width = DIV_ROUND_UP(vc->vc_font.width, 8);
         unsigned int cellsize = vc->vc_font.height * width;
         u8 c;
 
@@ -144,7 +144,7 @@ static void bit_putcs(struct vc_data *vc, struct fb_info *info,
                       int fg, int bg)
 {
         struct fb_image image;
-        u32 width = (vc->vc_font.width + 7)/8;
+        u32 width = DIV_ROUND_UP(vc->vc_font.width, 8);
         u32 cellsize = width * vc->vc_font.height;
         u32 maxcnt = info->pixmap.size/cellsize;
         u32 scan_align = info->pixmap.scan_align - 1;
@@ -173,7 +173,7 @@ static void bit_putcs(struct vc_data *vc, struct fb_info *info,
                         cnt = count;
 
                 image.width = vc->vc_font.width * cnt;
-                pitch = ((image.width + 7) >> 3) + scan_align;
+                pitch = DIV_ROUND_UP(image.width, 8) + scan_align;
                 pitch &= ~scan_align;
                 size = pitch * image.height + buf_align;
                 size &= ~buf_align;
@@ -239,7 +239,7 @@ static void bit_cursor(struct vc_data *vc, struct fb_info *info, int mode,
         struct fb_cursor cursor;
         struct fbcon_ops *ops = info->fbcon_par;
         unsigned short charmask = vc->vc_hi_font_mask ? 0x1ff : 0xff;
-        int w = (vc->vc_font.width + 7) >> 3, c;
+        int w = DIV_ROUND_UP(vc->vc_font.width, 8), c;
         int y = real_y(ops->p, vc->vc_y);
         int attribute, use_sw = (vc->vc_cursor_type & 0x10);
         int err = 1;
diff --git a/drivers/video/console/fbcon.c b/drivers/video/console/fbcon.c
index 3a44695b9c09..5a686cea23f4 100644
--- a/drivers/video/console/fbcon.c
+++ b/drivers/video/console/fbcon.c
@@ -114,6 +114,7 @@ static int last_fb_vc = MAX_NR_CONSOLES - 1;
 static int fbcon_is_default = 1; 
 static int fbcon_has_exited;
 static int primary_device = -1;
+static int fbcon_has_console_bind;
 
 #ifdef CONFIG_FRAMEBUFFER_CONSOLE_DETECT_PRIMARY
 static int map_override;
@@ -544,6 +545,8 @@ static int fbcon_takeover(int show_logo)
                         con2fb_map[i] = -1;
                 }
                 info_idx = -1;
+        } else {
+                fbcon_has_console_bind = 1;
         }
 
         return err;
@@ -725,7 +728,7 @@ static int con2fb_release_oldinfo(struct vc_data *vc, struct fb_info *oldinfo,
                                   int oldidx, int found)
 {
         struct fbcon_ops *ops = oldinfo->fbcon_par;
-        int err = 0;
+        int err = 0, ret;
 
         if (oldinfo->fbops->fb_release &&
             oldinfo->fbops->fb_release(oldinfo, 0)) {
@@ -752,8 +755,14 @@ static int con2fb_release_oldinfo(struct vc_data *vc, struct fb_info *oldinfo,
                   newinfo in an undefined state. Thus, a call to
                   fb_set_par() may be needed for the newinfo.
                 */
-                if (newinfo->fbops->fb_set_par)
-                        newinfo->fbops->fb_set_par(newinfo);
+                if (newinfo->fbops->fb_set_par) {
+                        ret = newinfo->fbops->fb_set_par(newinfo);
+
+                        if (ret)
+                                printk(KERN_ERR "con2fb_release_oldinfo: "
+                                        "detected unhandled fb_set_par error, "
+                                        "error code %d\n", ret);
+                }
         }
 
         return err;
@@ -763,11 +772,18 @@ static void con2fb_init_display(struct vc_data *vc, struct fb_info *info,
                                 int unit, int show_logo)
 {
         struct fbcon_ops *ops = info->fbcon_par;
+        int ret;
 
         ops->currcon = fg_console;
 
-        if (info->fbops->fb_set_par && !(ops->flags & FBCON_FLAGS_INIT))
-                info->fbops->fb_set_par(info);
+        if (info->fbops->fb_set_par && !(ops->flags & FBCON_FLAGS_INIT)) {
+                ret = info->fbops->fb_set_par(info);
+
+                if (ret)
+                        printk(KERN_ERR "con2fb_init_display: detected "
+                                "unhandled fb_set_par error, "
+                                "error code %d\n", ret);
+        }
 
         ops->flags |= FBCON_FLAGS_INIT;
         ops->graphics = 0;
@@ -1006,7 +1022,7 @@ static void fbcon_init(struct vc_data *vc, int init)
         struct vc_data *svc = *default_mode;
         struct display *t, *p = &fb_display[vc->vc_num];
         int logo = 1, new_rows, new_cols, rows, cols, charcnt = 256;
-        int cap;
+        int cap, ret;
 
         if (info_idx == -1 || info == NULL)
             return;
@@ -1092,8 +1108,15 @@ static void fbcon_init(struct vc_data *vc, int init)
          */
         if (CON_IS_VISIBLE(vc) && vc->vc_mode == KD_TEXT) {
                 if (info->fbops->fb_set_par &&
-                    !(ops->flags & FBCON_FLAGS_INIT))
-                        info->fbops->fb_set_par(info);
+                    !(ops->flags & FBCON_FLAGS_INIT)) {
+                        ret = info->fbops->fb_set_par(info);
+
+                        if (ret)
+                                printk(KERN_ERR "fbcon_init: detected "
+                                        "unhandled fb_set_par error, "
+                                        "error code %d\n", ret);
+                }
+
                 ops->flags |= FBCON_FLAGS_INIT;
         }
 
@@ -2119,7 +2142,7 @@ static int fbcon_switch(struct vc_data *vc)
         struct fbcon_ops *ops;
         struct display *p = &fb_display[vc->vc_num];
         struct fb_var_screeninfo var;
-        int i, prev_console, charcnt = 256;
+        int i, ret, prev_console, charcnt = 256;
 
         info = registered_fb[con2fb_map[vc->vc_num]];
         ops = info->fbcon_par;
@@ -2174,8 +2197,14 @@ static int fbcon_switch(struct vc_data *vc)
 
         if (old_info != NULL && (old_info != info ||
                                  info->flags & FBINFO_MISC_ALWAYS_SETPAR)) {
-                if (info->fbops->fb_set_par)
-                        info->fbops->fb_set_par(info);
+                if (info->fbops->fb_set_par) {
+                        ret = info->fbops->fb_set_par(info);
+
+                        if (ret)
+                                printk(KERN_ERR "fbcon_switch: detected "
+                                        "unhandled fb_set_par error, "
+                                        "error code %d\n", ret);
+                }
 
                 if (old_info != info)
                         fbcon_del_cursor_timer(old_info);
@@ -2923,6 +2952,10 @@ static int fbcon_unbind(void)
 
         ret = unbind_con_driver(&fb_con, first_fb_vc, last_fb_vc,
                                 fbcon_is_default);
+
+        if (!ret)
+                fbcon_has_console_bind = 0;
+
         return ret;
 }
 #else
@@ -2936,6 +2969,9 @@ static int fbcon_fb_unbind(int idx)
 {
         int i, new_idx = -1, ret = 0;
 
+        if (!fbcon_has_console_bind)
+                return 0;
+
         for (i = first_fb_vc; i <= last_fb_vc; i++) {
                 if (con2fb_map[i] != idx &&
                     con2fb_map[i] != -1) {
diff --git a/drivers/video/console/newport_con.c b/drivers/video/console/newport_con.c
index d31b203bf654..3772433c49d1 100644
--- a/drivers/video/console/newport_con.c
+++ b/drivers/video/console/newport_con.c
@@ -216,7 +216,7 @@ static void newport_get_screensize(void)
         }
 
         newport_xsize = newport_ysize = 0;
-        for (i = 0; linetable[i + 1] && (i < sizeof(linetable)); i += 2) {
+        for (i = 0; i < ARRAY_SIZE(linetable) - 1 && linetable[i + 1]; i += 2) {
                 cols = 0;
                 newport_vc2_set(npregs, VC2_IREG_RADDR, linetable[i]);
                 npregs->set.dcbmode = (NPORT_DMODE_AVC2 | VC2_REGADDR_RAM |
diff --git a/drivers/video/console/vgacon.c b/drivers/video/console/vgacon.c
index 59d7d5ec17a4..da55ccaf4d55 100644
--- a/drivers/video/console/vgacon.c
+++ b/drivers/video/console/vgacon.c
@@ -180,7 +180,6 @@ static inline void vga_set_mem_top(struct vc_data *c)
 }
 
 #ifdef CONFIG_VGACON_SOFT_SCROLLBACK
-#include <linux/slab.h>
 /* software scrollback */
 static void *vgacon_scrollback;
 static int vgacon_scrollback_tail;
@@ -590,12 +589,14 @@ static void vgacon_init(struct vc_data *c, int init)
 
 static void vgacon_deinit(struct vc_data *c)
 {
-        /* When closing the last console, reset video origin */
-        if (!--vgacon_uni_pagedir[1]) {
+        /* When closing the active console, reset video origin */
+        if (CON_IS_VISIBLE(c)) {
                 c->vc_visible_origin = vga_vram_base;
                 vga_set_mem_top(c);
-                con_free_unimap(c);
         }
+
+        if (!--vgacon_uni_pagedir[1])
+                con_free_unimap(c);
         c->vc_uni_pagedir_loc = &c->vc_uni_pagedir;
         con_set_default_unimap(c);
 }
diff --git a/drivers/video/da8xx-fb.c b/drivers/video/da8xx-fb.c
new file mode 100644
index 000000000000..42e1005e2916
--- /dev/null
+++ b/drivers/video/da8xx-fb.c
@@ -0,0 +1,890 @@
+/*
+ * Copyright (C) 2008-2009 MontaVista Software Inc.
+ * Copyright (C) 2008-2009 Texas Instruments Inc
+ *
+ * Based on the LCD driver for TI Avalanche processors written by
+ * Ajay Singh and Shalom Hai.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option)any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ */
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/fb.h>
+#include <linux/dma-mapping.h>
+#include <linux/device.h>
+#include <linux/platform_device.h>
+#include <linux/uaccess.h>
+#include <linux/device.h>
+#include <linux/interrupt.h>
+#include <linux/clk.h>
+#include <video/da8xx-fb.h>
+
+#define DRIVER_NAME "da8xx_lcdc"
+
+/* LCD Status Register */
+#define LCD_END_OF_FRAME0               BIT(8)
+#define LCD_FIFO_UNDERFLOW              BIT(5)
+#define LCD_SYNC_LOST                   BIT(2)
+
+/* LCD DMA Control Register */
+#define LCD_DMA_BURST_SIZE(x)           ((x) << 4)
+#define LCD_DMA_BURST_1                 0x0
+#define LCD_DMA_BURST_2                 0x1
+#define LCD_DMA_BURST_4                 0x2
+#define LCD_DMA_BURST_8                 0x3
+#define LCD_DMA_BURST_16                0x4
+#define LCD_END_OF_FRAME_INT_ENA        BIT(2)
+#define LCD_DUAL_FRAME_BUFFER_ENABLE    BIT(0)
+
+/* LCD Control Register */
+#define LCD_CLK_DIVISOR(x)              ((x) << 8)
+#define LCD_RASTER_MODE                 0x01
+
+/* LCD Raster Control Register */
+#define LCD_PALETTE_LOAD_MODE(x)        ((x) << 20)
+#define PALETTE_AND_DATA                0x00
+#define PALETTE_ONLY                    0x01
+
+#define LCD_MONO_8BIT_MODE              BIT(9)
+#define LCD_RASTER_ORDER                BIT(8)
+#define LCD_TFT_MODE                    BIT(7)
+#define LCD_UNDERFLOW_INT_ENA           BIT(6)
+#define LCD_MONOCHROME_MODE             BIT(1)
+#define LCD_RASTER_ENABLE               BIT(0)
+#define LCD_TFT_ALT_ENABLE              BIT(23)
+#define LCD_STN_565_ENABLE              BIT(24)
+
+/* LCD Raster Timing 2 Register */
+#define LCD_AC_BIAS_TRANSITIONS_PER_INT(x)      ((x) << 16)
+#define LCD_AC_BIAS_FREQUENCY(x)                ((x) << 8)
+#define LCD_SYNC_CTRL                           BIT(25)
+#define LCD_SYNC_EDGE                           BIT(24)
+#define LCD_INVERT_PIXEL_CLOCK                  BIT(22)
+#define LCD_INVERT_LINE_CLOCK                   BIT(21)
+#define LCD_INVERT_FRAME_CLOCK                  BIT(20)
+
+/* LCD Block */
+#define  LCD_CTRL_REG                           0x4
+#define  LCD_STAT_REG                           0x8
+#define  LCD_RASTER_CTRL_REG                    0x28
+#define  LCD_RASTER_TIMING_0_REG                0x2C
+#define  LCD_RASTER_TIMING_1_REG                0x30
+#define  LCD_RASTER_TIMING_2_REG                0x34
+#define  LCD_DMA_CTRL_REG                       0x40
+#define  LCD_DMA_FRM_BUF_BASE_ADDR_0_REG        0x44
+#define  LCD_DMA_FRM_BUF_CEILING_ADDR_0_REG     0x48
+
+#define WSI_TIMEOUT     50
+#define PALETTE_SIZE    256
+#define LEFT_MARGIN     64
+#define RIGHT_MARGIN    64
+#define UPPER_MARGIN    32
+#define LOWER_MARGIN    32
+
+static resource_size_t da8xx_fb_reg_base;
+static struct resource *lcdc_regs;
+
+static inline unsigned int lcdc_read(unsigned int addr)
+{
+        return (unsigned int)__raw_readl(da8xx_fb_reg_base + (addr));
+}
+
+static inline void lcdc_write(unsigned int val, unsigned int addr)
+{
+        __raw_writel(val, da8xx_fb_reg_base + (addr));
+}
+
+struct da8xx_fb_par {
+        resource_size_t p_palette_base;
+        unsigned char *v_palette_base;
+        struct clk *lcdc_clk;
+        int irq;
+        unsigned short pseudo_palette[16];
+        unsigned int databuf_sz;
+        unsigned int palette_sz;
+};
+
+/* Variable Screen Information */
+static struct fb_var_screeninfo da8xx_fb_var __devinitdata = {
+        .xoffset = 0,
+        .yoffset = 0,
+        .transp = {0, 0, 0},
+        .nonstd = 0,
+        .activate = 0,
+        .height = -1,
+        .width = -1,
+        .pixclock = 46666,      /* 46us - AUO display */
+        .accel_flags = 0,
+        .left_margin = LEFT_MARGIN,
+        .right_margin = RIGHT_MARGIN,
+        .upper_margin = UPPER_MARGIN,
+        .lower_margin = LOWER_MARGIN,
+        .sync = 0,
+        .vmode = FB_VMODE_NONINTERLACED
+};
+
+static struct fb_fix_screeninfo da8xx_fb_fix __devinitdata = {
+        .id = "DA8xx FB Drv",
+        .type = FB_TYPE_PACKED_PIXELS,
+        .type_aux = 0,
+        .visual = FB_VISUAL_PSEUDOCOLOR,
+        .xpanstep = 1,
+        .ypanstep = 1,
+        .ywrapstep = 1,
+        .accel = FB_ACCEL_NONE
+};
+
+struct da8xx_panel {
+        const char      name[25];       /* Full name <vendor>_<model> */
+        unsigned short  width;
+        unsigned short  height;
+        int             hfp;            /* Horizontal front porch */
+        int             hbp;            /* Horizontal back porch */
+        int             hsw;            /* Horizontal Sync Pulse Width */
+        int             vfp;            /* Vertical front porch */
+        int             vbp;            /* Vertical back porch */
+        int             vsw;            /* Vertical Sync Pulse Width */
+        int             pxl_clk;        /* Pixel clock */
+        unsigned char   invert_pxl_clk; /* Invert Pixel clock */
+};
+
+static struct da8xx_panel known_lcd_panels[] = {
+        /* Sharp LCD035Q3DG01 */
+        [0] = {
+                .name = "Sharp_LCD035Q3DG01",
+                .width = 320,
+                .height = 240,
+                .hfp = 8,
+                .hbp = 6,
+                .hsw = 0,
+                .vfp = 2,
+                .vbp = 2,
+                .vsw = 0,
+                .pxl_clk = 0x10,
+                .invert_pxl_clk = 1,
+        },
+        /* Sharp LK043T1DG01 */
+        [1] = {
+                .name = "Sharp_LK043T1DG01",
+                .width = 480,
+                .height = 272,
+                .hfp = 2,
+                .hbp = 2,
+                .hsw = 41,
+                .vfp = 2,
+                .vbp = 2,
+                .vsw = 10,
+                .pxl_clk = 0x12,
+                .invert_pxl_clk = 0,
+        },
+};
+
+/* Disable the Raster Engine of the LCD Controller */
+static void lcd_disable_raster(struct da8xx_fb_par *par)
+{
+        u32 reg;
+
+        reg = lcdc_read(LCD_RASTER_CTRL_REG);
+        if (reg & LCD_RASTER_ENABLE)
+                lcdc_write(reg & ~LCD_RASTER_ENABLE, LCD_RASTER_CTRL_REG);
+}
+
+static void lcd_blit(int load_mode, struct da8xx_fb_par *par)
+{
+        u32 tmp = par->p_palette_base + par->databuf_sz - 4;
+        u32 reg;
+
+        /* Update the databuf in the hw. */
+        lcdc_write(par->p_palette_base, LCD_DMA_FRM_BUF_BASE_ADDR_0_REG);
+        lcdc_write(tmp, LCD_DMA_FRM_BUF_CEILING_ADDR_0_REG);
+
+        /* Start the DMA. */
+        reg = lcdc_read(LCD_RASTER_CTRL_REG);
+        reg &= ~(3 << 20);
+        if (load_mode == LOAD_DATA)
+                reg |= LCD_PALETTE_LOAD_MODE(PALETTE_AND_DATA);
+        else if (load_mode == LOAD_PALETTE)
+                reg |= LCD_PALETTE_LOAD_MODE(PALETTE_ONLY);
+
+        lcdc_write(reg, LCD_RASTER_CTRL_REG);
+}
+
+/* Configure the Burst Size of DMA */
+static int lcd_cfg_dma(int burst_size)
+{
+        u32 reg;
+
+        reg = lcdc_read(LCD_DMA_CTRL_REG) & 0x00000001;
+        switch (burst_size) {
+        case 1:
+                reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_1);
+                break;
+        case 2:
+                reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_2);
+                break;
+        case 4:
+                reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_4);
+                break;
+        case 8:
+                reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_8);
+                break;
+        case 16:
+                reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_16);
+                break;
+        default:
+                return -EINVAL;
+        }
+        lcdc_write(reg, LCD_DMA_CTRL_REG);
+
+        return 0;
+}
+
+static void lcd_cfg_ac_bias(int period, int transitions_per_int)
+{
+        u32 reg;
+
+        /* Set the AC Bias Period and Number of Transisitons per Interrupt */
+        reg = lcdc_read(LCD_RASTER_TIMING_2_REG) & 0xFFF00000;
+        reg |= LCD_AC_BIAS_FREQUENCY(period) |
+                LCD_AC_BIAS_TRANSITIONS_PER_INT(transitions_per_int);
+        lcdc_write(reg, LCD_RASTER_TIMING_2_REG);
+}
+
+static void lcd_cfg_horizontal_sync(int back_porch, int pulse_width,
+                int front_porch)
+{
+        u32 reg;
+
+        reg = lcdc_read(LCD_RASTER_TIMING_0_REG) & 0xf;
+        reg |= ((back_porch & 0xff) << 24)
+            | ((front_porch & 0xff) << 16)
+            | ((pulse_width & 0x3f) << 10);
+        lcdc_write(reg, LCD_RASTER_TIMING_0_REG);
+}
+
+static void lcd_cfg_vertical_sync(int back_porch, int pulse_width,
+                int front_porch)
+{
+        u32 reg;
+
+        reg = lcdc_read(LCD_RASTER_TIMING_1_REG) & 0x3ff;
+        reg |= ((back_porch & 0xff) << 24)
+            | ((front_porch & 0xff) << 16)
+            | ((pulse_width & 0x3f) << 10);
+        lcdc_write(reg, LCD_RASTER_TIMING_1_REG);
+}
+
+static int lcd_cfg_display(const struct lcd_ctrl_config *cfg)
+{
+        u32 reg;
+
+        reg = lcdc_read(LCD_RASTER_CTRL_REG) & ~(LCD_TFT_MODE |
+                                                LCD_MONO_8BIT_MODE |
+                                                LCD_MONOCHROME_MODE);
+
+        switch (cfg->p_disp_panel->panel_shade) {
+        case MONOCHROME:
+                reg |= LCD_MONOCHROME_MODE;
+                if (cfg->mono_8bit_mode)
+                        reg |= LCD_MONO_8BIT_MODE;
+                break;
+        case COLOR_ACTIVE:
+                reg |= LCD_TFT_MODE;
+                if (cfg->tft_alt_mode)
+                        reg |= LCD_TFT_ALT_ENABLE;
+                break;
+
+        case COLOR_PASSIVE:
+                if (cfg->stn_565_mode)
+                        reg |= LCD_STN_565_ENABLE;
+                break;
+
+        default:
+                return -EINVAL;
+        }
+
+        /* enable additional interrupts here */
+        reg |= LCD_UNDERFLOW_INT_ENA;
+
+        lcdc_write(reg, LCD_RASTER_CTRL_REG);
+
+        reg = lcdc_read(LCD_RASTER_TIMING_2_REG);
+
+        if (cfg->sync_ctrl)
+                reg |= LCD_SYNC_CTRL;
+        else
+                reg &= ~LCD_SYNC_CTRL;
+
+        if (cfg->sync_edge)
+                reg |= LCD_SYNC_EDGE;
+        else
+                reg &= ~LCD_SYNC_EDGE;
+
+        if (cfg->invert_line_clock)
+                reg |= LCD_INVERT_LINE_CLOCK;
+        else
+                reg &= ~LCD_INVERT_LINE_CLOCK;
+
+        if (cfg->invert_frm_clock)
+                reg |= LCD_INVERT_FRAME_CLOCK;
+        else
+                reg &= ~LCD_INVERT_FRAME_CLOCK;
+
+        lcdc_write(reg, LCD_RASTER_TIMING_2_REG);
+
+        return 0;
+}
+
+static int lcd_cfg_frame_buffer(struct da8xx_fb_par *par, u32 width, u32 height,
+                u32 bpp, u32 raster_order)
+{
+        u32 bpl, reg;
+
+        /* Disable Dual Frame Buffer. */
+        reg = lcdc_read(LCD_DMA_CTRL_REG);
+        lcdc_write(reg & ~LCD_DUAL_FRAME_BUFFER_ENABLE,
+                                                LCD_DMA_CTRL_REG);
+        /* Set the Panel Width */
+        /* Pixels per line = (PPL + 1)*16 */
+        /*0x3F in bits 4..9 gives max horisontal resolution = 1024 pixels*/
+        width &= 0x3f0;
+        reg = lcdc_read(LCD_RASTER_TIMING_0_REG);
+        reg &= 0xfffffc00;
+        reg |= ((width >> 4) - 1) << 4;
+        lcdc_write(reg, LCD_RASTER_TIMING_0_REG);
+
+        /* Set the Panel Height */
+        reg = lcdc_read(LCD_RASTER_TIMING_1_REG);
+        reg = ((height - 1) & 0x3ff) | (reg & 0xfffffc00);
+        lcdc_write(reg, LCD_RASTER_TIMING_1_REG);
+
+        /* Set the Raster Order of the Frame Buffer */
+        reg = lcdc_read(LCD_RASTER_CTRL_REG) & ~(1 << 8);
+        if (raster_order)
+                reg |= LCD_RASTER_ORDER;
+        lcdc_write(reg, LCD_RASTER_CTRL_REG);
+
+        switch (bpp) {
+        case 1:
+        case 2:
+        case 4:
+        case 16:
+                par->palette_sz = 16 * 2;
+                break;
+
+        case 8:
+                par->palette_sz = 256 * 2;
+                break;
+
+        default:
+                return -EINVAL;
+        }
+
+        bpl = width * bpp / 8;
+        par->databuf_sz = height * bpl + par->palette_sz;
+
+        return 0;
+}
+
+static int fb_setcolreg(unsigned regno, unsigned red, unsigned green,
+                              unsigned blue, unsigned transp,
+                              struct fb_info *info)
+{
+        struct da8xx_fb_par *par = info->par;
+        unsigned short *palette = (unsigned short *)par->v_palette_base;
+        u_short pal;
+
+        if (regno > 255)
+                return 1;
+
+        if (info->fix.visual == FB_VISUAL_DIRECTCOLOR)
+                return 1;
+
+        if (info->var.bits_per_pixel == 8) {
+                red >>= 4;
+                green >>= 8;
+                blue >>= 12;
+
+                pal = (red & 0x0f00);
+                pal |= (green & 0x00f0);
+                pal |= (blue & 0x000f);
+
+                palette[regno] = pal;
+
+        } else if ((info->var.bits_per_pixel == 16) && regno < 16) {
+                red >>= (16 - info->var.red.length);
+                red <<= info->var.red.offset;
+
+                green >>= (16 - info->var.green.length);
+                green <<= info->var.green.offset;
+
+                blue >>= (16 - info->var.blue.length);
+                blue <<= info->var.blue.offset;
+
+                par->pseudo_palette[regno] = red | green | blue;
+
+                palette[0] = 0x4000;
+        }
+
+        return 0;
+}
+
+static void lcd_reset(struct da8xx_fb_par *par)
+{
+        /* Disable the Raster if previously Enabled */
+        if (lcdc_read(LCD_RASTER_CTRL_REG) & LCD_RASTER_ENABLE)
+                lcd_disable_raster(par);
+
+        /* DMA has to be disabled */
+        lcdc_write(0, LCD_DMA_CTRL_REG);
+        lcdc_write(0, LCD_RASTER_CTRL_REG);
+}
+
+static int lcd_init(struct da8xx_fb_par *par, const struct lcd_ctrl_config *cfg,
+                struct da8xx_panel *panel)
+{
+        u32 bpp;
+        int ret = 0;
+
+        lcd_reset(par);
+
+        /* Configure the LCD clock divisor. */
+        lcdc_write(LCD_CLK_DIVISOR(panel->pxl_clk) |
+                        (LCD_RASTER_MODE & 0x1), LCD_CTRL_REG);
+
+        if (panel->invert_pxl_clk)
+                lcdc_write((lcdc_read(LCD_RASTER_TIMING_2_REG) |
+                        LCD_INVERT_PIXEL_CLOCK), LCD_RASTER_TIMING_2_REG);
+        else
+                lcdc_write((lcdc_read(LCD_RASTER_TIMING_2_REG) &
+                        ~LCD_INVERT_PIXEL_CLOCK), LCD_RASTER_TIMING_2_REG);
+
+        /* Configure the DMA burst size. */
+        ret = lcd_cfg_dma(cfg->dma_burst_sz);
+        if (ret < 0)
+                return ret;
+
+        /* Configure the AC bias properties. */
+        lcd_cfg_ac_bias(cfg->ac_bias, cfg->ac_bias_intrpt);
+
+        /* Configure the vertical and horizontal sync properties. */
+        lcd_cfg_vertical_sync(panel->vbp, panel->vsw, panel->vfp);
+        lcd_cfg_horizontal_sync(panel->hbp, panel->hsw, panel->hfp);
+
+        /* Configure for disply */
+        ret = lcd_cfg_display(cfg);
+        if (ret < 0)
+                return ret;
+
+        if (QVGA != cfg->p_disp_panel->panel_type)
+                return -EINVAL;
+
+        if (cfg->bpp <= cfg->p_disp_panel->max_bpp &&
+            cfg->bpp >= cfg->p_disp_panel->min_bpp)
+                bpp = cfg->bpp;
+        else
+                bpp = cfg->p_disp_panel->max_bpp;
+        if (bpp == 12)
+                bpp = 16;
+        ret = lcd_cfg_frame_buffer(par, (unsigned int)panel->width,
+                                (unsigned int)panel->height, bpp,
+                                cfg->raster_order);
+        if (ret < 0)
+                return ret;
+
+        /* Configure FDD */
+        lcdc_write((lcdc_read(LCD_RASTER_CTRL_REG) & 0xfff00fff) |
+                       (cfg->fdd << 12), LCD_RASTER_CTRL_REG);
+
+        return 0;
+}
+
+static irqreturn_t lcdc_irq_handler(int irq, void *arg)
+{
+        u32 stat = lcdc_read(LCD_STAT_REG);
+        u32 reg;
+
+        if ((stat & LCD_SYNC_LOST) && (stat & LCD_FIFO_UNDERFLOW)) {
+                reg = lcdc_read(LCD_RASTER_CTRL_REG);
+                lcdc_write(reg & ~LCD_RASTER_ENABLE, LCD_RASTER_CTRL_REG);
+                lcdc_write(stat, LCD_STAT_REG);
+                lcdc_write(reg | LCD_RASTER_ENABLE, LCD_RASTER_CTRL_REG);
+        } else
+                lcdc_write(stat, LCD_STAT_REG);
+
+        return IRQ_HANDLED;
+}
+
+static int fb_check_var(struct fb_var_screeninfo *var,
+                        struct fb_info *info)
+{
+        int err = 0;
+
+        switch (var->bits_per_pixel) {
+        case 1:
+        case 8:
+                var->red.offset = 0;
+                var->red.length = 8;
+                var->green.offset = 0;
+                var->green.length = 8;
+                var->blue.offset = 0;
+                var->blue.length = 8;
+                var->transp.offset = 0;
+                var->transp.length = 0;
+                break;
+        case 4:
+                var->red.offset = 0;
+                var->red.length = 4;
+                var->green.offset = 0;
+                var->green.length = 4;
+                var->blue.offset = 0;
+                var->blue.length = 4;
+                var->transp.offset = 0;
+                var->transp.length = 0;
+                break;
+        case 16:                /* RGB 565 */
+                var->red.offset = 0;
+                var->red.length = 5;
+                var->green.offset = 5;
+                var->green.length = 6;
+                var->blue.offset = 11;
+                var->blue.length = 5;
+                var->transp.offset = 0;
+                var->transp.length = 0;
+                break;
+        default:
+                err = -EINVAL;
+        }
+
+        var->red.msb_right = 0;
+        var->green.msb_right = 0;
+        var->blue.msb_right = 0;
+        var->transp.msb_right = 0;
+        return err;
+}
+
+static int __devexit fb_remove(struct platform_device *dev)
+{
+        struct fb_info *info = dev_get_drvdata(&dev->dev);
+
+        if (info) {
+                struct da8xx_fb_par *par = info->par;
+
+                if (lcdc_read(LCD_RASTER_CTRL_REG) & LCD_RASTER_ENABLE)
+                        lcd_disable_raster(par);
+                lcdc_write(0, LCD_RASTER_CTRL_REG);
+
+                /* disable DMA  */
+                lcdc_write(0, LCD_DMA_CTRL_REG);
+
+                unregister_framebuffer(info);
+                fb_dealloc_cmap(&info->cmap);
+                dma_free_coherent(NULL, par->databuf_sz + PAGE_SIZE,
+                                        info->screen_base,
+                                        info->fix.smem_start);
+                free_irq(par->irq, par);
+                clk_disable(par->lcdc_clk);
+                clk_put(par->lcdc_clk);
+                framebuffer_release(info);
+                iounmap((void __iomem *)da8xx_fb_reg_base);
+                release_mem_region(lcdc_regs->start, resource_size(lcdc_regs));
+
+        }
+        return 0;
+}
+
+static int fb_ioctl(struct fb_info *info, unsigned int cmd,
+                          unsigned long arg)
+{
+        struct lcd_sync_arg sync_arg;
+
+        switch (cmd) {
+        case FBIOGET_CONTRAST:
+        case FBIOPUT_CONTRAST:
+        case FBIGET_BRIGHTNESS:
+        case FBIPUT_BRIGHTNESS:
+        case FBIGET_COLOR:
+        case FBIPUT_COLOR:
+                return -ENOTTY;
+        case FBIPUT_HSYNC:
+                if (copy_from_user(&sync_arg, (char *)arg,
+                                sizeof(struct lcd_sync_arg)))
+                        return -EFAULT;
+                lcd_cfg_horizontal_sync(sync_arg.back_porch,
+                                        sync_arg.pulse_width,
+                                        sync_arg.front_porch);
+                break;
+        case FBIPUT_VSYNC:
+                if (copy_from_user(&sync_arg, (char *)arg,
+                                sizeof(struct lcd_sync_arg)))
+                        return -EFAULT;
+                lcd_cfg_vertical_sync(sync_arg.back_porch,
+                                        sync_arg.pulse_width,
+                                        sync_arg.front_porch);
+                break;
+        default:
+                return -EINVAL;
+        }
+        return 0;
+}
+
+static struct fb_ops da8xx_fb_ops = {
+        .owner = THIS_MODULE,
+        .fb_check_var = fb_check_var,
+        .fb_setcolreg = fb_setcolreg,
+        .fb_ioctl = fb_ioctl,
+        .fb_fillrect = cfb_fillrect,
+        .fb_copyarea = cfb_copyarea,
+        .fb_imageblit = cfb_imageblit,
+};
+
+static int __init fb_probe(struct platform_device *device)
+{
+        struct da8xx_lcdc_platform_data *fb_pdata =
+                                                device->dev.platform_data;
+        struct lcd_ctrl_config *lcd_cfg;
+        struct da8xx_panel *lcdc_info;
+        struct fb_info *da8xx_fb_info;
+        struct clk *fb_clk = NULL;
+        struct da8xx_fb_par *par;
+        resource_size_t len;
+        int ret, i;
+
+        if (fb_pdata == NULL) {
+                dev_err(&device->dev, "Can not get platform data\n");
+                return -ENOENT;
+        }
+
+        lcdc_regs = platform_get_resource(device, IORESOURCE_MEM, 0);
+        if (!lcdc_regs) {
+                dev_err(&device->dev,
+                        "Can not get memory resource for LCD controller\n");
+                return -ENOENT;
+        }
+
+        len = resource_size(lcdc_regs);
+
+        lcdc_regs = request_mem_region(lcdc_regs->start, len, lcdc_regs->name);
+        if (!lcdc_regs)
+                return -EBUSY;
+
+        da8xx_fb_reg_base = (resource_size_t)ioremap(lcdc_regs->start, len);
+        if (!da8xx_fb_reg_base) {
+                ret = -EBUSY;
+                goto err_request_mem;
+        }
+
+        fb_clk = clk_get(&device->dev, NULL);
+        if (IS_ERR(fb_clk)) {
+                dev_err(&device->dev, "Can not get device clock\n");
+                ret = -ENODEV;
+                goto err_ioremap;
+        }
+        ret = clk_enable(fb_clk);
+        if (ret)
+                goto err_clk_put;
+
+        for (i = 0, lcdc_info = known_lcd_panels;
+                i < ARRAY_SIZE(known_lcd_panels);
+                i++, lcdc_info++) {
+                if (strcmp(fb_pdata->type, lcdc_info->name) == 0)
+                        break;
+        }
+
+        if (i == ARRAY_SIZE(known_lcd_panels)) {
+                dev_err(&device->dev, "GLCD: No valid panel found\n");
+                ret = ENODEV;
+                goto err_clk_disable;
+        } else
+                dev_info(&device->dev, "GLCD: Found %s panel\n",
+                                        fb_pdata->type);
+
+        lcd_cfg = (struct lcd_ctrl_config *)fb_pdata->controller_data;
+
+        da8xx_fb_info = framebuffer_alloc(sizeof(struct da8xx_fb_par),
+                                        &device->dev);
+        if (!da8xx_fb_info) {
+                dev_dbg(&device->dev, "Memory allocation failed for fb_info\n");
+                ret = -ENOMEM;
+                goto err_clk_disable;
+        }
+
+        par = da8xx_fb_info->par;
+
+        if (lcd_init(par, lcd_cfg, lcdc_info) < 0) {
+                dev_err(&device->dev, "lcd_init failed\n");
+                ret = -EFAULT;
+                goto err_release_fb;
+        }
+
+        /* allocate frame buffer */
+        da8xx_fb_info->screen_base = dma_alloc_coherent(NULL,
+                                        par->databuf_sz + PAGE_SIZE,
+                                        (resource_size_t *)
+                                        &da8xx_fb_info->fix.smem_start,
+                                        GFP_KERNEL | GFP_DMA);
+
+        if (!da8xx_fb_info->screen_base) {
+                dev_err(&device->dev,
+                        "GLCD: kmalloc for frame buffer failed\n");
+                ret = -EINVAL;
+                goto err_release_fb;
+        }
+
+        /* move palette base pointer by (PAGE_SIZE - palette_sz) bytes */
+        par->v_palette_base = da8xx_fb_info->screen_base +
+                                (PAGE_SIZE - par->palette_sz);
+        par->p_palette_base = da8xx_fb_info->fix.smem_start +
+                                (PAGE_SIZE - par->palette_sz);
+
+        /* the rest of the frame buffer is pixel data */
+        da8xx_fb_fix.smem_start = par->p_palette_base + par->palette_sz;
+        da8xx_fb_fix.smem_len = par->databuf_sz - par->palette_sz;
+        da8xx_fb_fix.line_length = (lcdc_info->width * lcd_cfg->bpp) / 8;
+
+        par->lcdc_clk = fb_clk;
+
+        par->irq = platform_get_irq(device, 0);
+        if (par->irq < 0) {
+                ret = -ENOENT;
+                goto err_release_fb_mem;
+        }
+
+        ret = request_irq(par->irq, lcdc_irq_handler, 0, DRIVER_NAME, par);
+        if (ret)
+                goto err_release_fb_mem;
+
+        /* Initialize par */
+        da8xx_fb_info->var.bits_per_pixel = lcd_cfg->bpp;
+
+        da8xx_fb_var.xres = lcdc_info->width;
+        da8xx_fb_var.xres_virtual = lcdc_info->width;
+
+        da8xx_fb_var.yres = lcdc_info->height;
+        da8xx_fb_var.yres_virtual = lcdc_info->height;
+
+        da8xx_fb_var.grayscale =
+            lcd_cfg->p_disp_panel->panel_shade == MONOCHROME ? 1 : 0;
+        da8xx_fb_var.bits_per_pixel = lcd_cfg->bpp;
+
+        da8xx_fb_var.hsync_len = lcdc_info->hsw;
+        da8xx_fb_var.vsync_len = lcdc_info->vsw;
+
+        /* Initialize fbinfo */
+        da8xx_fb_info->flags = FBINFO_FLAG_DEFAULT;
+        da8xx_fb_info->fix = da8xx_fb_fix;
+        da8xx_fb_info->var = da8xx_fb_var;
+        da8xx_fb_info->fbops = &da8xx_fb_ops;
+        da8xx_fb_info->pseudo_palette = par->pseudo_palette;
+
+        ret = fb_alloc_cmap(&da8xx_fb_info->cmap, PALETTE_SIZE, 0);
+        if (ret)
+                goto err_free_irq;
+
+        /* First palette_sz byte of the frame buffer is the palette */
+        da8xx_fb_info->cmap.len = par->palette_sz;
+
+        /* Flush the buffer to the screen. */
+        lcd_blit(LOAD_DATA, par);
+
+        /* initialize var_screeninfo */
+        da8xx_fb_var.activate = FB_ACTIVATE_FORCE;
+        fb_set_var(da8xx_fb_info, &da8xx_fb_var);
+
+        dev_set_drvdata(&device->dev, da8xx_fb_info);
+        /* Register the Frame Buffer  */
+        if (register_framebuffer(da8xx_fb_info) < 0) {
+                dev_err(&device->dev,
+                        "GLCD: Frame Buffer Registration Failed!\n");
+                ret = -EINVAL;
+                goto err_dealloc_cmap;
+        }
+
+        /* enable raster engine */
+        lcdc_write(lcdc_read(LCD_RASTER_CTRL_REG) |
+                        LCD_RASTER_ENABLE, LCD_RASTER_CTRL_REG);
+
+        return 0;
+
+err_dealloc_cmap:
+        fb_dealloc_cmap(&da8xx_fb_info->cmap);
+
+err_free_irq:
+        free_irq(par->irq, par);
+
+err_release_fb_mem:
+        dma_free_coherent(NULL, par->databuf_sz + PAGE_SIZE,
+                                da8xx_fb_info->screen_base,
+                                da8xx_fb_info->fix.smem_start);
+
+err_release_fb:
+        framebuffer_release(da8xx_fb_info);
+
+err_clk_disable:
+        clk_disable(fb_clk);
+
+err_clk_put:
+        clk_put(fb_clk);
+
+err_ioremap:
+        iounmap((void __iomem *)da8xx_fb_reg_base);
+
+err_request_mem:
+        release_mem_region(lcdc_regs->start, len);
+
+        return ret;
+}
+
+#ifdef CONFIG_PM
+static int fb_suspend(struct platform_device *dev, pm_message_t state)
+{
+         return -EBUSY;
+}
+static int fb_resume(struct platform_device *dev)
+{
+         return -EBUSY;
+}
+#else
+#define fb_suspend NULL
+#define fb_resume NULL
+#endif
+
+static struct platform_driver da8xx_fb_driver = {
+        .probe = fb_probe,
+        .remove = fb_remove,
+        .suspend = fb_suspend,
+        .resume = fb_resume,
+        .driver = {
+                   .name = DRIVER_NAME,
+                   .owner = THIS_MODULE,
+                   },
+};
+
+static int __init da8xx_fb_init(void)
+{
+        return platform_driver_register(&da8xx_fb_driver);
+}
+
+static void __exit da8xx_fb_cleanup(void)
+{
+        platform_driver_unregister(&da8xx_fb_driver);
+}
+
+module_init(da8xx_fb_init);
+module_exit(da8xx_fb_cleanup);
+
+MODULE_DESCRIPTION("Framebuffer driver for TI da8xx/omap-l1xx");
+MODULE_AUTHOR("Texas Instruments");
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/ep93xx-fb.c b/drivers/video/ep93xx-fb.c
new file mode 100644
index 000000000000..bd9d46f95291
--- /dev/null
+++ b/drivers/video/ep93xx-fb.c
@@ -0,0 +1,646 @@
+/*
+ * linux/drivers/video/ep93xx-fb.c
+ *
+ * Framebuffer support for the EP93xx series.
+ *
+ * Copyright (C) 2007 Bluewater Systems Ltd
+ * Author: Ryan Mallon <ryan@bluewatersys.com>
+ *
+ * Copyright (c) 2009 H Hartley Sweeten <hsweeten@visionengravers.com>
+ *
+ * Based on the Cirrus Logic ep93xxfb driver, and various other ep93xxfb
+ * drivers.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ */
+
+#include <linux/platform_device.h>
+#include <linux/dma-mapping.h>
+#include <linux/clk.h>
+#include <linux/fb.h>
+
+#include <mach/fb.h>
+
+/* Vertical Frame Timing Registers */
+#define EP93XXFB_VLINES_TOTAL                   0x0000  /* SW locked */
+#define EP93XXFB_VSYNC                          0x0004  /* SW locked */
+#define EP93XXFB_VACTIVE                        0x0008  /* SW locked */
+#define EP93XXFB_VBLANK                         0x0228  /* SW locked */
+#define EP93XXFB_VCLK                           0x000c  /* SW locked */
+
+/* Horizontal Frame Timing Registers */
+#define EP93XXFB_HCLKS_TOTAL                    0x0010  /* SW locked */
+#define EP93XXFB_HSYNC                          0x0014  /* SW locked */
+#define EP93XXFB_HACTIVE                        0x0018  /* SW locked */
+#define EP93XXFB_HBLANK                         0x022c  /* SW locked */
+#define EP93XXFB_HCLK                           0x001c  /* SW locked */
+
+/* Frame Buffer Memory Configuration Registers */
+#define EP93XXFB_SCREEN_PAGE                    0x0028
+#define EP93XXFB_SCREEN_HPAGE                   0x002c
+#define EP93XXFB_SCREEN_LINES                   0x0030
+#define EP93XXFB_LINE_LENGTH                    0x0034
+#define EP93XXFB_VLINE_STEP                     0x0038
+#define EP93XXFB_LINE_CARRY                     0x003c  /* SW locked */
+#define EP93XXFB_EOL_OFFSET                     0x0230
+
+/* Other Video Registers */
+#define EP93XXFB_BRIGHTNESS                     0x0020
+#define EP93XXFB_ATTRIBS                        0x0024  /* SW locked */
+#define EP93XXFB_SWLOCK                         0x007c  /* SW locked */
+#define EP93XXFB_AC_RATE                        0x0214
+#define EP93XXFB_FIFO_LEVEL                     0x0234
+#define EP93XXFB_PIXELMODE                      0x0054
+#define EP93XXFB_PIXELMODE_32BPP                (0x7 << 0)
+#define EP93XXFB_PIXELMODE_24BPP                (0x6 << 0)
+#define EP93XXFB_PIXELMODE_16BPP                (0x4 << 0)
+#define EP93XXFB_PIXELMODE_8BPP                 (0x2 << 0)
+#define EP93XXFB_PIXELMODE_SHIFT_1P_24B         (0x0 << 3)
+#define EP93XXFB_PIXELMODE_SHIFT_1P_18B         (0x1 << 3)
+#define EP93XXFB_PIXELMODE_COLOR_LUT            (0x0 << 10)
+#define EP93XXFB_PIXELMODE_COLOR_888            (0x4 << 10)
+#define EP93XXFB_PIXELMODE_COLOR_555            (0x5 << 10)
+#define EP93XXFB_PARL_IF_OUT                    0x0058
+#define EP93XXFB_PARL_IF_IN                     0x005c
+
+/* Blink Control Registers */
+#define EP93XXFB_BLINK_RATE                     0x0040
+#define EP93XXFB_BLINK_MASK                     0x0044
+#define EP93XXFB_BLINK_PATTRN                   0x0048
+#define EP93XXFB_PATTRN_MASK                    0x004c
+#define EP93XXFB_BKGRND_OFFSET                  0x0050
+
+/* Hardware Cursor Registers */
+#define EP93XXFB_CURSOR_ADR_START               0x0060
+#define EP93XXFB_CURSOR_ADR_RESET               0x0064
+#define EP93XXFB_CURSOR_SIZE                    0x0068
+#define EP93XXFB_CURSOR_COLOR1                  0x006c
+#define EP93XXFB_CURSOR_COLOR2                  0x0070
+#define EP93XXFB_CURSOR_BLINK_COLOR1            0x021c
+#define EP93XXFB_CURSOR_BLINK_COLOR2            0x0220
+#define EP93XXFB_CURSOR_XY_LOC                  0x0074
+#define EP93XXFB_CURSOR_DSCAN_HY_LOC            0x0078
+#define EP93XXFB_CURSOR_BLINK_RATE_CTRL         0x0224
+
+/* LUT Registers */
+#define EP93XXFB_GRY_SCL_LUTR                   0x0080
+#define EP93XXFB_GRY_SCL_LUTG                   0x0280
+#define EP93XXFB_GRY_SCL_LUTB                   0x0300
+#define EP93XXFB_LUT_SW_CONTROL                 0x0218
+#define EP93XXFB_LUT_SW_CONTROL_SWTCH           (1 << 0)
+#define EP93XXFB_LUT_SW_CONTROL_SSTAT           (1 << 1)
+#define EP93XXFB_COLOR_LUT                      0x0400
+
+/* Video Signature Registers */
+#define EP93XXFB_VID_SIG_RSLT_VAL               0x0200
+#define EP93XXFB_VID_SIG_CTRL                   0x0204
+#define EP93XXFB_VSIG                           0x0208
+#define EP93XXFB_HSIG                           0x020c
+#define EP93XXFB_SIG_CLR_STR                    0x0210
+
+/* Minimum / Maximum resolutions supported */
+#define EP93XXFB_MIN_XRES                       64
+#define EP93XXFB_MIN_YRES                       64
+#define EP93XXFB_MAX_XRES                       1024
+#define EP93XXFB_MAX_YRES                       768
+
+struct ep93xx_fbi {
+        struct ep93xxfb_mach_info       *mach_info;
+        struct clk                      *clk;
+        struct resource                 *res;
+        void __iomem                    *mmio_base;
+        unsigned int                    pseudo_palette[256];
+};
+
+static int check_screenpage_bug = 1;
+module_param(check_screenpage_bug, int, 0644);
+MODULE_PARM_DESC(check_screenpage_bug,
+                 "Check for bit 27 screen page bug. Default = 1");
+
+static inline unsigned int ep93xxfb_readl(struct ep93xx_fbi *fbi,
+                                          unsigned int off)
+{
+        return __raw_readl(fbi->mmio_base + off);
+}
+
+static inline void ep93xxfb_writel(struct ep93xx_fbi *fbi,
+                                   unsigned int val, unsigned int off)
+{
+        __raw_writel(val, fbi->mmio_base + off);
+}
+
+/*
+ * Write to one of the locked raster registers.
+ */
+static inline void ep93xxfb_out_locked(struct ep93xx_fbi *fbi,
+                                       unsigned int val, unsigned int reg)
+{
+        /*
+         * We don't need a lock or delay here since the raster register
+         * block will remain unlocked until the next access.
+         */
+        ep93xxfb_writel(fbi, 0xaa, EP93XXFB_SWLOCK);
+        ep93xxfb_writel(fbi, val, reg);
+}
+
+static void ep93xxfb_set_video_attribs(struct fb_info *info)
+{
+        struct ep93xx_fbi *fbi = info->par;
+        unsigned int attribs;
+
+        attribs = EP93XXFB_ENABLE;
+        attribs |= fbi->mach_info->flags;
+        ep93xxfb_out_locked(fbi, attribs, EP93XXFB_ATTRIBS);
+}
+
+static int ep93xxfb_set_pixelmode(struct fb_info *info)
+{
+        struct ep93xx_fbi *fbi = info->par;
+        unsigned int val;
+
+        info->var.transp.offset = 0;
+        info->var.transp.length = 0;
+
+        switch (info->var.bits_per_pixel) {
+        case 8:
+                val = EP93XXFB_PIXELMODE_8BPP | EP93XXFB_PIXELMODE_COLOR_LUT |
+                        EP93XXFB_PIXELMODE_SHIFT_1P_18B;
+
+                info->var.red.offset    = 0;
+                info->var.red.length    = 8;
+                info->var.green.offset  = 0;
+                info->var.green.length  = 8;
+                info->var.blue.offset   = 0;
+                info->var.blue.length   = 8;
+                info->fix.visual        = FB_VISUAL_PSEUDOCOLOR;
+                break;
+
+        case 16:
+                val = EP93XXFB_PIXELMODE_16BPP | EP93XXFB_PIXELMODE_COLOR_555 |
+                        EP93XXFB_PIXELMODE_SHIFT_1P_18B;
+
+                info->var.red.offset    = 11;
+                info->var.red.length    = 5;
+                info->var.green.offset  = 5;
+                info->var.green.length  = 6;
+                info->var.blue.offset   = 0;
+                info->var.blue.length   = 5;
+                info->fix.visual        = FB_VISUAL_TRUECOLOR;
+                break;
+
+        case 24:
+                val = EP93XXFB_PIXELMODE_24BPP | EP93XXFB_PIXELMODE_COLOR_888 |
+                        EP93XXFB_PIXELMODE_SHIFT_1P_24B;
+
+                info->var.red.offset    = 16;
+                info->var.red.length    = 8;
+                info->var.green.offset  = 8;
+                info->var.green.length  = 8;
+                info->var.blue.offset   = 0;
+                info->var.blue.length   = 8;
+                info->fix.visual        = FB_VISUAL_TRUECOLOR;
+                break;
+
+        case 32:
+                val = EP93XXFB_PIXELMODE_32BPP | EP93XXFB_PIXELMODE_COLOR_888 |
+                        EP93XXFB_PIXELMODE_SHIFT_1P_24B;
+
+                info->var.red.offset    = 16;
+                info->var.red.length    = 8;
+                info->var.green.offset  = 8;
+                info->var.green.length  = 8;
+                info->var.blue.offset   = 0;
+                info->var.blue.length   = 8;
+                info->fix.visual        = FB_VISUAL_TRUECOLOR;
+                break;
+
+        default:
+                return -EINVAL;
+        }
+
+        ep93xxfb_writel(fbi, val, EP93XXFB_PIXELMODE);
+        return 0;
+}
+
+static void ep93xxfb_set_timing(struct fb_info *info)
+{
+        struct ep93xx_fbi *fbi = info->par;
+        unsigned int vlines_total, hclks_total, start, stop;
+
+        vlines_total = info->var.yres + info->var.upper_margin +
+                info->var.lower_margin + info->var.vsync_len - 1;
+
+        hclks_total = info->var.xres + info->var.left_margin +
+                info->var.right_margin + info->var.hsync_len - 1;
+
+        ep93xxfb_out_locked(fbi, vlines_total, EP93XXFB_VLINES_TOTAL);
+        ep93xxfb_out_locked(fbi, hclks_total, EP93XXFB_HCLKS_TOTAL);
+
+        start = vlines_total;
+        stop = vlines_total - info->var.vsync_len;
+        ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_VSYNC);
+
+        start = vlines_total - info->var.vsync_len - info->var.upper_margin;
+        stop = info->var.lower_margin - 1;
+        ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_VBLANK);
+        ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_VACTIVE);
+
+        start = vlines_total;
+        stop = vlines_total + 1;
+        ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_VCLK);
+
+        start = hclks_total;
+        stop = hclks_total - info->var.hsync_len;
+        ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_HSYNC);
+
+        start = hclks_total - info->var.hsync_len - info->var.left_margin;
+        stop = info->var.right_margin - 1;
+        ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_HBLANK);
+        ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_HACTIVE);
+
+        start = hclks_total;
+        stop = hclks_total;
+        ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_HCLK);
+
+        ep93xxfb_out_locked(fbi, 0x0, EP93XXFB_LINE_CARRY);
+}
+
+static int ep93xxfb_set_par(struct fb_info *info)
+{
+        struct ep93xx_fbi *fbi = info->par;
+
+        clk_set_rate(fbi->clk, 1000 * PICOS2KHZ(info->var.pixclock));
+
+        ep93xxfb_set_timing(info);
+
+        info->fix.line_length = info->var.xres_virtual *
+                info->var.bits_per_pixel / 8;
+
+        ep93xxfb_writel(fbi, info->fix.smem_start, EP93XXFB_SCREEN_PAGE);
+        ep93xxfb_writel(fbi, info->var.yres - 1, EP93XXFB_SCREEN_LINES);
+        ep93xxfb_writel(fbi, ((info->var.xres * info->var.bits_per_pixel)
+                              / 32) - 1, EP93XXFB_LINE_LENGTH);
+        ep93xxfb_writel(fbi, info->fix.line_length / 4, EP93XXFB_VLINE_STEP);
+        ep93xxfb_set_video_attribs(info);
+        return 0;
+}
+
+static int ep93xxfb_check_var(struct fb_var_screeninfo *var,
+                              struct fb_info *info)
+{
+        int err;
+
+        err = ep93xxfb_set_pixelmode(info);
+        if (err)
+                return err;
+
+        var->xres = max_t(unsigned int, var->xres, EP93XXFB_MIN_XRES);
+        var->xres = min_t(unsigned int, var->xres, EP93XXFB_MAX_XRES);
+        var->xres_virtual = max(var->xres_virtual, var->xres);
+
+        var->yres = max_t(unsigned int, var->yres, EP93XXFB_MIN_YRES);
+        var->yres = min_t(unsigned int, var->yres, EP93XXFB_MAX_YRES);
+        var->yres_virtual = max(var->yres_virtual, var->yres);
+
+        return 0;
+}
+
+static int ep93xxfb_mmap(struct fb_info *info, struct vm_area_struct *vma)
+{
+        unsigned int offset = vma->vm_pgoff << PAGE_SHIFT;
+
+        if (offset < info->fix.smem_len) {
+                return dma_mmap_writecombine(info->dev, vma, info->screen_base,
+                                             info->fix.smem_start,
+                                             info->fix.smem_len);
+        }
+
+        return -EINVAL;
+}
+
+static int ep93xxfb_blank(int blank_mode, struct fb_info *info)
+{
+        struct ep93xx_fbi *fbi = info->par;
+        unsigned int attribs = ep93xxfb_readl(fbi, EP93XXFB_ATTRIBS);
+
+        if (blank_mode) {
+                if (fbi->mach_info->blank)
+                        fbi->mach_info->blank(blank_mode, info);
+                ep93xxfb_out_locked(fbi, attribs & ~EP93XXFB_ENABLE,
+                                    EP93XXFB_ATTRIBS);
+                clk_disable(fbi->clk);
+        } else {
+                clk_enable(fbi->clk);
+                ep93xxfb_out_locked(fbi, attribs | EP93XXFB_ENABLE,
+                                    EP93XXFB_ATTRIBS);
+                if (fbi->mach_info->blank)
+                        fbi->mach_info->blank(blank_mode, info);
+        }
+
+        return 0;
+}
+
+static inline int ep93xxfb_convert_color(int val, int width)
+{
+        return ((val << width) + 0x7fff - val) >> 16;
+}
+
+static int ep93xxfb_setcolreg(unsigned int regno, unsigned int red,
+                              unsigned int green, unsigned int blue,
+                              unsigned int transp, struct fb_info *info)
+{
+        struct ep93xx_fbi *fbi = info->par;
+        unsigned int *pal = info->pseudo_palette;
+        unsigned int ctrl, i, rgb, lut_current, lut_stat;
+
+        switch (info->fix.visual) {
+        case FB_VISUAL_PSEUDOCOLOR:
+                rgb = ((red & 0xff00) << 8) | (green & 0xff00) |
+                        ((blue & 0xff00) >> 8);
+
+                pal[regno] = rgb;
+                ep93xxfb_writel(fbi, rgb, (EP93XXFB_COLOR_LUT + (regno << 2)));
+                ctrl = ep93xxfb_readl(fbi, EP93XXFB_LUT_SW_CONTROL);
+                lut_stat = !!(ctrl & EP93XXFB_LUT_SW_CONTROL_SSTAT);
+                lut_current = !!(ctrl & EP93XXFB_LUT_SW_CONTROL_SWTCH);
+
+                if (lut_stat == lut_current) {
+                        for (i = 0; i < 256; i++) {
+                                ep93xxfb_writel(fbi, pal[i],
+                                        EP93XXFB_COLOR_LUT + (i << 2));
+                        }
+
+                        ep93xxfb_writel(fbi,
+                                        ctrl ^ EP93XXFB_LUT_SW_CONTROL_SWTCH,
+                                        EP93XXFB_LUT_SW_CONTROL);
+                }
+                break;
+
+        case FB_VISUAL_TRUECOLOR:
+                if (regno > 16)
+                        return 1;
+
+                red = ep93xxfb_convert_color(red, info->var.red.length);
+                green = ep93xxfb_convert_color(green, info->var.green.length);
+                blue = ep93xxfb_convert_color(blue, info->var.blue.length);
+                transp = ep93xxfb_convert_color(transp,
+                                                info->var.transp.length);
+
+                pal[regno] = (red << info->var.red.offset) |
+                        (green << info->var.green.offset) |
+                        (blue << info->var.blue.offset) |
+                        (transp << info->var.transp.offset);
+                break;
+
+        default:
+                return 1;
+        }
+
+        return 0;
+}
+
+static struct fb_ops ep93xxfb_ops = {
+        .owner          = THIS_MODULE,
+        .fb_check_var   = ep93xxfb_check_var,
+        .fb_set_par     = ep93xxfb_set_par,
+        .fb_blank       = ep93xxfb_blank,
+        .fb_fillrect    = cfb_fillrect,
+        .fb_copyarea    = cfb_copyarea,
+        .fb_imageblit   = cfb_imageblit,
+        .fb_setcolreg   = ep93xxfb_setcolreg,
+        .fb_mmap        = ep93xxfb_mmap,
+};
+
+static int __init ep93xxfb_calc_fbsize(struct ep93xxfb_mach_info *mach_info)
+{
+        int i, fb_size = 0;
+
+        if (mach_info->num_modes == EP93XXFB_USE_MODEDB) {
+                fb_size = EP93XXFB_MAX_XRES * EP93XXFB_MAX_YRES *
+                        mach_info->bpp / 8;
+        } else {
+                for (i = 0; i < mach_info->num_modes; i++) {
+                        const struct fb_videomode *mode;
+                        int size;
+
+                        mode = &mach_info->modes[i];
+                        size = mode->xres * mode->yres * mach_info->bpp / 8;
+                        if (size > fb_size)
+                                fb_size = size;
+                }
+        }
+
+        return fb_size;
+}
+
+static int __init ep93xxfb_alloc_videomem(struct fb_info *info)
+{
+        struct ep93xx_fbi *fbi = info->par;
+        char __iomem *virt_addr;
+        dma_addr_t phys_addr;
+        unsigned int fb_size;
+
+        fb_size = ep93xxfb_calc_fbsize(fbi->mach_info);
+        virt_addr = dma_alloc_writecombine(info->dev, fb_size,
+                                           &phys_addr, GFP_KERNEL);
+        if (!virt_addr)
+                return -ENOMEM;
+
+        /*
+         * There is a bug in the ep93xx framebuffer which causes problems
+         * if bit 27 of the physical address is set.
+         * See: http://marc.info/?l=linux-arm-kernel&m=110061245502000&w=2
+         * There does not seem to be any offical errata for this, but I
+         * have confirmed the problem exists on my hardware (ep9315) at
+         * least.
+         */
+        if (check_screenpage_bug && phys_addr & (1 << 27)) {
+                dev_err(info->dev, "ep93xx framebuffer bug. phys addr (0x%x) "
+                        "has bit 27 set: cannot init framebuffer\n",
+                        phys_addr);
+
+                dma_free_coherent(info->dev, fb_size, virt_addr, phys_addr);
+                return -ENOMEM;
+        }
+
+        info->fix.smem_start = phys_addr;
+        info->fix.smem_len = fb_size;
+        info->screen_base = virt_addr;
+
+        return 0;
+}
+
+static void ep93xxfb_dealloc_videomem(struct fb_info *info)
+{
+        if (info->screen_base)
+                dma_free_coherent(info->dev, info->fix.smem_len,
+                                  info->screen_base, info->fix.smem_start);
+}
+
+static int __init ep93xxfb_probe(struct platform_device *pdev)
+{
+        struct ep93xxfb_mach_info *mach_info = pdev->dev.platform_data;
+        struct fb_info *info;
+        struct ep93xx_fbi *fbi;
+        struct resource *res;
+        char *video_mode;
+        int err;
+
+        if (!mach_info)
+                return -EINVAL;
+
+        info = framebuffer_alloc(sizeof(struct ep93xx_fbi), &pdev->dev);
+        if (!info)
+                return -ENOMEM;
+
+        info->dev = &pdev->dev;
+        platform_set_drvdata(pdev, info);
+        fbi = info->par;
+        fbi->mach_info = mach_info;
+
+        err = fb_alloc_cmap(&info->cmap, 256, 0);
+        if (err)
+                goto failed;
+
+        err = ep93xxfb_alloc_videomem(info);
+        if (err)
+                goto failed;
+
+        res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+        if (!res) {
+                err = -ENXIO;
+                goto failed;
+        }
+
+        res = request_mem_region(res->start, resource_size(res), pdev->name);
+        if (!res) {
+                err = -EBUSY;
+                goto failed;
+        }
+
+        fbi->res = res;
+        fbi->mmio_base = ioremap(res->start, resource_size(res));
+        if (!fbi->mmio_base) {
+                err = -ENXIO;
+                goto failed;
+        }
+
+        strcpy(info->fix.id, pdev->name);
+        info->fbops             = &ep93xxfb_ops;
+        info->fix.type          = FB_TYPE_PACKED_PIXELS;
+        info->fix.accel         = FB_ACCEL_NONE;
+        info->var.activate      = FB_ACTIVATE_NOW;
+        info->var.vmode         = FB_VMODE_NONINTERLACED;
+        info->flags             = FBINFO_DEFAULT;
+        info->node              = -1;
+        info->state             = FBINFO_STATE_RUNNING;
+        info->pseudo_palette    = &fbi->pseudo_palette;
+
+        fb_get_options("ep93xx-fb", &video_mode);
+        err = fb_find_mode(&info->var, info, video_mode,
+                           fbi->mach_info->modes, fbi->mach_info->num_modes,
+                           fbi->mach_info->default_mode, fbi->mach_info->bpp);
+        if (err == 0) {
+                dev_err(info->dev, "No suitable video mode found\n");
+                err = -EINVAL;
+                goto failed;
+        }
+
+        if (mach_info->setup) {
+                err = mach_info->setup(pdev);
+                if (err)
+                        return err;
+        }
+
+        err = ep93xxfb_check_var(&info->var, info);
+        if (err)
+                goto failed;
+
+        fbi->clk = clk_get(info->dev, NULL);
+        if (IS_ERR(fbi->clk)) {
+                err = PTR_ERR(fbi->clk);
+                fbi->clk = NULL;
+                goto failed;
+        }
+
+        ep93xxfb_set_par(info);
+        clk_enable(fbi->clk);
+
+        err = register_framebuffer(info);
+        if (err)
+                goto failed;
+
+        dev_info(info->dev, "registered. Mode = %dx%d-%d\n",
+                 info->var.xres, info->var.yres, info->var.bits_per_pixel);
+        return 0;
+
+failed:
+        if (fbi->clk)
+                clk_put(fbi->clk);
+        if (fbi->mmio_base)
+                iounmap(fbi->mmio_base);
+        if (fbi->res)
+                release_mem_region(fbi->res->start, resource_size(fbi->res));
+        ep93xxfb_dealloc_videomem(info);
+        if (&info->cmap)
+                fb_dealloc_cmap(&info->cmap);
+        if (fbi->mach_info->teardown)
+                fbi->mach_info->teardown(pdev);
+        kfree(info);
+        platform_set_drvdata(pdev, NULL);
+
+        return err;
+}
+
+static int ep93xxfb_remove(struct platform_device *pdev)
+{
+        struct fb_info *info = platform_get_drvdata(pdev);
+        struct ep93xx_fbi *fbi = info->par;
+
+        unregister_framebuffer(info);
+        clk_disable(fbi->clk);
+        clk_put(fbi->clk);
+        iounmap(fbi->mmio_base);
+        release_mem_region(fbi->res->start, resource_size(fbi->res));
+        ep93xxfb_dealloc_videomem(info);
+        fb_dealloc_cmap(&info->cmap);
+
+        if (fbi->mach_info->teardown)
+                fbi->mach_info->teardown(pdev);
+
+        kfree(info);
+        platform_set_drvdata(pdev, NULL);
+
+        return 0;
+}
+
+static struct platform_driver ep93xxfb_driver = {
+        .probe          = ep93xxfb_probe,
+        .remove         = ep93xxfb_remove,
+        .driver = {
+                .name   = "ep93xx-fb",
+                .owner  = THIS_MODULE,
+        },
+};
+
+static int __devinit ep93xxfb_init(void)
+{
+        return platform_driver_register(&ep93xxfb_driver);
+}
+
+static void __exit ep93xxfb_exit(void)
+{
+        platform_driver_unregister(&ep93xxfb_driver);
+}
+
+module_init(ep93xxfb_init);
+module_exit(ep93xxfb_exit);
+
+MODULE_DESCRIPTION("EP93XX Framebuffer Driver");
+MODULE_ALIAS("platform:ep93xx-fb");
+MODULE_AUTHOR("Ryan Mallon <ryan&bluewatersys.com>, "
+              "H Hartley Sweeten <hsweeten@visionengravers.com");
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/fbmem.c b/drivers/video/fbmem.c
index a85c818be945..a1f2e7ce730b 100644
--- a/drivers/video/fbmem.c
+++ b/drivers/video/fbmem.c
@@ -871,8 +871,8 @@ fb_pan_display(struct fb_info *info, struct fb_var_screeninfo *var)
                 err = -EINVAL;
 
         if (err || !info->fbops->fb_pan_display ||
-            var->yoffset + yres > info->var.yres_virtual ||
-            var->xoffset + info->var.xres > info->var.xres_virtual)
+            var->yoffset > info->var.yres_virtual - yres ||
+            var->xoffset > info->var.xres_virtual - info->var.xres)
                 return -EINVAL;
 
         if ((err = info->fbops->fb_pan_display(var, info)))
@@ -954,6 +954,7 @@ fb_set_var(struct fb_info *info, struct fb_var_screeninfo *var)
                         goto done;
 
                 if ((var->activate & FB_ACTIVATE_MASK) == FB_ACTIVATE_NOW) {
+                        struct fb_var_screeninfo old_var;
                         struct fb_videomode mode;
 
                         if (info->fbops->fb_get_caps) {
@@ -963,10 +964,20 @@ fb_set_var(struct fb_info *info, struct fb_var_screeninfo *var)
                                         goto done;
                         }
 
+                        old_var = info->var;
                         info->var = *var;
 
-                        if (info->fbops->fb_set_par)
-                                info->fbops->fb_set_par(info);
+                        if (info->fbops->fb_set_par) {
+                                ret = info->fbops->fb_set_par(info);
+
+                                if (ret) {
+                                        info->var = old_var;
+                                        printk(KERN_WARNING "detected "
+                                                "fb_set_par error, "
+                                                "error code: %d\n", ret);
+                                        goto done;
+                                }
+                        }
 
                         fb_pan_display(info, &info->var);
                         fb_set_cmap(&info->cmap, info);
diff --git a/drivers/video/imxfb.c b/drivers/video/imxfb.c
index 30ae3022f633..66358fa825f3 100644
--- a/drivers/video/imxfb.c
+++ b/drivers/video/imxfb.c
@@ -710,7 +710,7 @@ static int __init imxfb_probe(struct platform_device *pdev)
 
         fbi->clk = clk_get(&pdev->dev, NULL);
         if (IS_ERR(fbi->clk)) {
-                ret = PTR_ERR(fbi->clk);;
+                ret = PTR_ERR(fbi->clk);
                 dev_err(&pdev->dev, "unable to get clock: %d\n", ret);
                 goto failed_getclock;
         }
diff --git a/drivers/video/matrox/g450_pll.c b/drivers/video/matrox/g450_pll.c
index d42346e7fdda..09f6e045d5be 100644
--- a/drivers/video/matrox/g450_pll.c
+++ b/drivers/video/matrox/g450_pll.c
@@ -25,16 +25,19 @@ static inline unsigned int g450_f2vco(unsigned char p, unsigned int fin) {
         return (p & 0x40) ? fin : fin << ((p & 3) + 1);
 }
 
-static unsigned int g450_mnp2vco(CPMINFO unsigned int mnp) {
+static unsigned int g450_mnp2vco(const struct matrox_fb_info *minfo,
+                                 unsigned int mnp)
+{
         unsigned int m, n;
 
         m = ((mnp >> 16) & 0x0FF) + 1;
         n = ((mnp >>  7) & 0x1FE) + 4;
-        return (ACCESS_FBINFO(features).pll.ref_freq * n + (m >> 1)) / m;
+        return (minfo->features.pll.ref_freq * n + (m >> 1)) / m;
 }
 
-unsigned int g450_mnp2f(CPMINFO unsigned int mnp) {
-        return g450_vco2f(mnp, g450_mnp2vco(PMINFO mnp));
+unsigned int g450_mnp2f(const struct matrox_fb_info *minfo, unsigned int mnp)
+{
+        return g450_vco2f(mnp, g450_mnp2vco(minfo, mnp));
 }
 
 static inline unsigned int pll_freq_delta(unsigned int f1, unsigned int f2) {
@@ -49,7 +52,10 @@ static inline unsigned int pll_freq_delta(unsigned int f1, unsigned int f2) {
 #define NO_MORE_MNP     0x01FFFFFF
 #define G450_MNP_FREQBITS       (0xFFFFFF43)    /* do not mask high byte so we'll catch NO_MORE_MNP */
 
-static unsigned int g450_nextpll(CPMINFO const struct matrox_pll_limits* pi, unsigned int* fvco, unsigned int mnp) {
+static unsigned int g450_nextpll(const struct matrox_fb_info *minfo,
+                                 const struct matrox_pll_limits *pi,
+                                 unsigned int *fvco, unsigned int mnp)
+{
         unsigned int m, n, p;
         unsigned int tvco = *fvco;
 
@@ -90,12 +96,15 @@ static unsigned int g450_nextpll(CPMINFO const struct matrox_pll_limits* pi, uns
                 } else {
                         m--;
                 }
-                n = ((tvco * (m+1) + ACCESS_FBINFO(features).pll.ref_freq) / (ACCESS_FBINFO(features).pll.ref_freq * 2)) - 2;
+                n = ((tvco * (m+1) + minfo->features.pll.ref_freq) / (minfo->features.pll.ref_freq * 2)) - 2;
         } while (n < 0x03 || n > 0x7A);
         return (m << 16) | (n << 8) | p;
 }
 
-static unsigned int g450_firstpll(CPMINFO const struct matrox_pll_limits* pi, unsigned int* vco, unsigned int fout) {
+static unsigned int g450_firstpll(const struct matrox_fb_info *minfo,
+                                  const struct matrox_pll_limits *pi,
+                                  unsigned int *vco, unsigned int fout)
+{
         unsigned int p;
         unsigned int vcomax;
 
@@ -121,88 +130,94 @@ static unsigned int g450_firstpll(CPMINFO const struct matrox_pll_limits* pi, un
                 }
                 *vco = tvco;
         }
-        return g450_nextpll(PMINFO pi, vco, 0xFF0000 | p);
+        return g450_nextpll(minfo, pi, vco, 0xFF0000 | p);
 }
 
-static inline unsigned int g450_setpll(CPMINFO unsigned int mnp, unsigned int pll) {
+static inline unsigned int g450_setpll(const struct matrox_fb_info *minfo,
+                                       unsigned int mnp, unsigned int pll)
+{
         switch (pll) {
                 case M_PIXEL_PLL_A:
-                        matroxfb_DAC_out(PMINFO M1064_XPIXPLLAM, mnp >> 16);
-                        matroxfb_DAC_out(PMINFO M1064_XPIXPLLAN, mnp >> 8);
-                        matroxfb_DAC_out(PMINFO M1064_XPIXPLLAP, mnp);
+                        matroxfb_DAC_out(minfo, M1064_XPIXPLLAM, mnp >> 16);
+                        matroxfb_DAC_out(minfo, M1064_XPIXPLLAN, mnp >> 8);
+                        matroxfb_DAC_out(minfo, M1064_XPIXPLLAP, mnp);
                         return M1064_XPIXPLLSTAT;
 
                 case M_PIXEL_PLL_B:
-                        matroxfb_DAC_out(PMINFO M1064_XPIXPLLBM, mnp >> 16);
-                        matroxfb_DAC_out(PMINFO M1064_XPIXPLLBN, mnp >> 8);
-                        matroxfb_DAC_out(PMINFO M1064_XPIXPLLBP, mnp);
+                        matroxfb_DAC_out(minfo, M1064_XPIXPLLBM, mnp >> 16);
+                        matroxfb_DAC_out(minfo, M1064_XPIXPLLBN, mnp >> 8);
+                        matroxfb_DAC_out(minfo, M1064_XPIXPLLBP, mnp);
                         return M1064_XPIXPLLSTAT;
 
                 case M_PIXEL_PLL_C:
-                        matroxfb_DAC_out(PMINFO M1064_XPIXPLLCM, mnp >> 16);
-                        matroxfb_DAC_out(PMINFO M1064_XPIXPLLCN, mnp >> 8);
-                        matroxfb_DAC_out(PMINFO M1064_XPIXPLLCP, mnp);
+                        matroxfb_DAC_out(minfo, M1064_XPIXPLLCM, mnp >> 16);
+                        matroxfb_DAC_out(minfo, M1064_XPIXPLLCN, mnp >> 8);
+                        matroxfb_DAC_out(minfo, M1064_XPIXPLLCP, mnp);
                         return M1064_XPIXPLLSTAT;
 
                 case M_SYSTEM_PLL:
-                        matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLM, mnp >> 16);
-                        matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLN, mnp >> 8);
-                        matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLP, mnp);
+                        matroxfb_DAC_out(minfo, DAC1064_XSYSPLLM, mnp >> 16);
+                        matroxfb_DAC_out(minfo, DAC1064_XSYSPLLN, mnp >> 8);
+                        matroxfb_DAC_out(minfo, DAC1064_XSYSPLLP, mnp);
                         return DAC1064_XSYSPLLSTAT;
 
                 case M_VIDEO_PLL:
-                        matroxfb_DAC_out(PMINFO M1064_XVIDPLLM, mnp >> 16);
-                        matroxfb_DAC_out(PMINFO M1064_XVIDPLLN, mnp >> 8);
-                        matroxfb_DAC_out(PMINFO M1064_XVIDPLLP, mnp);
+                        matroxfb_DAC_out(minfo, M1064_XVIDPLLM, mnp >> 16);
+                        matroxfb_DAC_out(minfo, M1064_XVIDPLLN, mnp >> 8);
+                        matroxfb_DAC_out(minfo, M1064_XVIDPLLP, mnp);
                         return M1064_XVIDPLLSTAT;
         }
         return 0;
 }
 
-static inline unsigned int g450_cmppll(CPMINFO unsigned int mnp, unsigned int pll) {
+static inline unsigned int g450_cmppll(const struct matrox_fb_info *minfo,
+                                       unsigned int mnp, unsigned int pll)
+{
         unsigned char m = mnp >> 16;
         unsigned char n = mnp >> 8;
         unsigned char p = mnp;
 
         switch (pll) {
                 case M_PIXEL_PLL_A:
-                        return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLAM) != m ||
-                                matroxfb_DAC_in(PMINFO M1064_XPIXPLLAN) != n ||
-                                matroxfb_DAC_in(PMINFO M1064_XPIXPLLAP) != p);
+                        return (matroxfb_DAC_in(minfo, M1064_XPIXPLLAM) != m ||
+                                matroxfb_DAC_in(minfo, M1064_XPIXPLLAN) != n ||
+                                matroxfb_DAC_in(minfo, M1064_XPIXPLLAP) != p);
 
                 case M_PIXEL_PLL_B:
-                        return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLBM) != m ||
-                                matroxfb_DAC_in(PMINFO M1064_XPIXPLLBN) != n ||
-                                matroxfb_DAC_in(PMINFO M1064_XPIXPLLBP) != p);
+                        return (matroxfb_DAC_in(minfo, M1064_XPIXPLLBM) != m ||
+                                matroxfb_DAC_in(minfo, M1064_XPIXPLLBN) != n ||
+                                matroxfb_DAC_in(minfo, M1064_XPIXPLLBP) != p);
 
                 case M_PIXEL_PLL_C:
-                        return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLCM) != m ||
-                                matroxfb_DAC_in(PMINFO M1064_XPIXPLLCN) != n ||
-                                matroxfb_DAC_in(PMINFO M1064_XPIXPLLCP) != p);
+                        return (matroxfb_DAC_in(minfo, M1064_XPIXPLLCM) != m ||
+                                matroxfb_DAC_in(minfo, M1064_XPIXPLLCN) != n ||
+                                matroxfb_DAC_in(minfo, M1064_XPIXPLLCP) != p);
 
                 case M_SYSTEM_PLL:
-                        return (matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLM) != m ||
-                                matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLN) != n ||
-                                matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLP) != p);
+                        return (matroxfb_DAC_in(minfo, DAC1064_XSYSPLLM) != m ||
+                                matroxfb_DAC_in(minfo, DAC1064_XSYSPLLN) != n ||
+                                matroxfb_DAC_in(minfo, DAC1064_XSYSPLLP) != p);
 
                 case M_VIDEO_PLL:
-                        return (matroxfb_DAC_in(PMINFO M1064_XVIDPLLM) != m ||
-                                matroxfb_DAC_in(PMINFO M1064_XVIDPLLN) != n ||
-                                matroxfb_DAC_in(PMINFO M1064_XVIDPLLP) != p);
+                        return (matroxfb_DAC_in(minfo, M1064_XVIDPLLM) != m ||
+                                matroxfb_DAC_in(minfo, M1064_XVIDPLLN) != n ||
+                                matroxfb_DAC_in(minfo, M1064_XVIDPLLP) != p);
         }
         return 1;
 }
 
-static inline int g450_isplllocked(CPMINFO unsigned int regidx) {
+static inline int g450_isplllocked(const struct matrox_fb_info *minfo,
+                                   unsigned int regidx)
+{
         unsigned int j;
 
         for (j = 0; j < 1000; j++) {
-                if (matroxfb_DAC_in(PMINFO regidx) & 0x40) {
+                if (matroxfb_DAC_in(minfo, regidx) & 0x40) {
                         unsigned int r = 0;
                         int i;
 
                         for (i = 0; i < 100; i++) {
-                                r += matroxfb_DAC_in(PMINFO regidx) & 0x40;
+                                r += matroxfb_DAC_in(minfo, regidx) & 0x40;
                         }
                         return r >= (90 * 0x40);
                 }
@@ -211,8 +226,10 @@ static inline int g450_isplllocked(CPMINFO unsigned int regidx) {
         return 0;
 }
 
-static int g450_testpll(CPMINFO unsigned int mnp, unsigned int pll) {
-        return g450_isplllocked(PMINFO g450_setpll(PMINFO mnp, pll));
+static int g450_testpll(const struct matrox_fb_info *minfo, unsigned int mnp,
+                        unsigned int pll)
+{
+        return g450_isplllocked(minfo, g450_setpll(minfo, mnp, pll));
 }
 
 static void updatehwstate_clk(struct matrox_hw_state* hw, unsigned int mnp, unsigned int pll) {
@@ -225,13 +242,19 @@ static void updatehwstate_clk(struct matrox_hw_state* hw, unsigned int mnp, unsi
         }
 }
 
-void matroxfb_g450_setpll_cond(WPMINFO unsigned int mnp, unsigned int pll) {
-        if (g450_cmppll(PMINFO mnp, pll)) {
-                g450_setpll(PMINFO mnp, pll);
+void matroxfb_g450_setpll_cond(struct matrox_fb_info *minfo, unsigned int mnp,
+                               unsigned int pll)
+{
+        if (g450_cmppll(minfo, mnp, pll)) {
+                g450_setpll(minfo, mnp, pll);
         }
 }
 
-static inline unsigned int g450_findworkingpll(WPMINFO unsigned int pll, unsigned int* mnparray, unsigned int mnpcount) {
+static inline unsigned int g450_findworkingpll(struct matrox_fb_info *minfo,
+                                               unsigned int pll,
+                                               unsigned int *mnparray,
+                                               unsigned int mnpcount)
+{
         unsigned int found = 0;
         unsigned int idx;
         unsigned int mnpfound = mnparray[0];
@@ -255,22 +278,22 @@ static inline unsigned int g450_findworkingpll(WPMINFO unsigned int pll, unsigne
                 while (sptr >= sarray) {
                         unsigned int mnp = *sptr--;
                 
-                        if (g450_testpll(PMINFO mnp - 0x0300, pll) &&
-                            g450_testpll(PMINFO mnp + 0x0300, pll) &&
-                            g450_testpll(PMINFO mnp - 0x0200, pll) &&
-                            g450_testpll(PMINFO mnp + 0x0200, pll) &&
-                            g450_testpll(PMINFO mnp - 0x0100, pll) &&
-                            g450_testpll(PMINFO mnp + 0x0100, pll)) {
-                                if (g450_testpll(PMINFO mnp, pll)) {
+                        if (g450_testpll(minfo, mnp - 0x0300, pll) &&
+                            g450_testpll(minfo, mnp + 0x0300, pll) &&
+                            g450_testpll(minfo, mnp - 0x0200, pll) &&
+                            g450_testpll(minfo, mnp + 0x0200, pll) &&
+                            g450_testpll(minfo, mnp - 0x0100, pll) &&
+                            g450_testpll(minfo, mnp + 0x0100, pll)) {
+                                if (g450_testpll(minfo, mnp, pll)) {
                                         return mnp;
                                 }
-                        } else if (!found && g450_testpll(PMINFO mnp, pll)) {
+                        } else if (!found && g450_testpll(minfo, mnp, pll)) {
                                 mnpfound = mnp;
                                 found = 1;
                         }
                 }
         }
-        g450_setpll(PMINFO mnpfound, pll);
+        g450_setpll(minfo, mnpfound, pll);
         return mnpfound;
 }
 
@@ -283,7 +306,9 @@ static void g450_addcache(struct matrox_pll_cache* ci, unsigned int mnp_key, uns
         ci->data[0].mnp_value = mnp_value;
 }
 
-static int g450_checkcache(WPMINFO struct matrox_pll_cache* ci, unsigned int mnp_key) {
+static int g450_checkcache(struct matrox_fb_info *minfo,
+                           struct matrox_pll_cache *ci, unsigned int mnp_key)
+{
         unsigned int i;
         
         mnp_key &= G450_MNP_FREQBITS;
@@ -303,8 +328,10 @@ static int g450_checkcache(WPMINFO struct matrox_pll_cache* ci, unsigned int mnp
         return NO_MORE_MNP;
 }
 
-static int __g450_setclk(WPMINFO unsigned int fout, unsigned int pll, 
-                unsigned int* mnparray, unsigned int* deltaarray) {
+static int __g450_setclk(struct matrox_fb_info *minfo, unsigned int fout,
+                         unsigned int pll, unsigned int *mnparray,
+                         unsigned int *deltaarray)
+{
         unsigned int mnpcount;
         unsigned int pixel_vco;
         const struct matrox_pll_limits* pi;
@@ -321,19 +348,19 @@ static int __g450_setclk(WPMINFO unsigned int fout, unsigned int pll,
                                 
                                 matroxfb_DAC_lock_irqsave(flags);
 
-                                xpwrctrl = matroxfb_DAC_in(PMINFO M1064_XPWRCTRL);
-                                matroxfb_DAC_out(PMINFO M1064_XPWRCTRL, xpwrctrl & ~M1064_XPWRCTRL_PANELPDN);
+                                xpwrctrl = matroxfb_DAC_in(minfo, M1064_XPWRCTRL);
+                                matroxfb_DAC_out(minfo, M1064_XPWRCTRL, xpwrctrl & ~M1064_XPWRCTRL_PANELPDN);
                                 mga_outb(M_SEQ_INDEX, M_SEQ1);
                                 mga_outb(M_SEQ_DATA, mga_inb(M_SEQ_DATA) | M_SEQ1_SCROFF);
-                                tmp = matroxfb_DAC_in(PMINFO M1064_XPIXCLKCTRL);
+                                tmp = matroxfb_DAC_in(minfo, M1064_XPIXCLKCTRL);
                                 tmp |= M1064_XPIXCLKCTRL_DIS;
                                 if (!(tmp & M1064_XPIXCLKCTRL_PLL_UP)) {
                                         tmp |= M1064_XPIXCLKCTRL_PLL_UP;
                                 }
-                                matroxfb_DAC_out(PMINFO M1064_XPIXCLKCTRL, tmp);
+                                matroxfb_DAC_out(minfo, M1064_XPIXCLKCTRL, tmp);
                                 /* DVI PLL preferred for frequencies up to
                                    panel link max, standard PLL otherwise */
-                                if (fout >= MINFO->max_pixel_clock_panellink)
+                                if (fout >= minfo->max_pixel_clock_panellink)
                                         tmp = 0;
                                 else tmp =
                                         M1064_XDVICLKCTRL_DVIDATAPATHSEL |
@@ -341,8 +368,8 @@ static int __g450_setclk(WPMINFO unsigned int fout, unsigned int pll,
                                         M1064_XDVICLKCTRL_C1DVICLKEN |
                                         M1064_XDVICLKCTRL_DVILOOPCTL |
                                         M1064_XDVICLKCTRL_P1LOOPBWDTCTL;
-                                matroxfb_DAC_out(PMINFO M1064_XDVICLKCTRL,tmp);
-                                matroxfb_DAC_out(PMINFO M1064_XPWRCTRL,
+                                matroxfb_DAC_out(minfo, M1064_XDVICLKCTRL, tmp);
+                                matroxfb_DAC_out(minfo, M1064_XPWRCTRL,
                                                  xpwrctrl);
 
                                 matroxfb_DAC_unlock_irqrestore(flags);
@@ -363,20 +390,20 @@ static int __g450_setclk(WPMINFO unsigned int fout, unsigned int pll,
                                 }
                                 mga_outb(M_MISC_REG, misc);
                         }
-                        pi = &ACCESS_FBINFO(limits.pixel);
-                        ci = &ACCESS_FBINFO(cache.pixel);
+                        pi = &minfo->limits.pixel;
+                        ci = &minfo->cache.pixel;
                         break;
                 case M_SYSTEM_PLL:
                         {
                                 u_int32_t opt;
 
-                                pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, &opt);
+                                pci_read_config_dword(minfo->pcidev, PCI_OPTION_REG, &opt);
                                 if (!(opt & 0x20)) {
-                                        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, opt | 0x20);
+                                        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, opt | 0x20);
                                 }
                         }
-                        pi = &ACCESS_FBINFO(limits.system);
-                        ci = &ACCESS_FBINFO(cache.system);
+                        pi = &minfo->limits.system;
+                        ci = &minfo->cache.system;
                         break;
                 case M_VIDEO_PLL:
                         {
@@ -385,18 +412,18 @@ static int __g450_setclk(WPMINFO unsigned int fout, unsigned int pll,
                                 unsigned long flags;
                                 
                                 matroxfb_DAC_lock_irqsave(flags);
-                                tmp = matroxfb_DAC_in(PMINFO M1064_XPWRCTRL);
+                                tmp = matroxfb_DAC_in(minfo, M1064_XPWRCTRL);
                                 if (!(tmp & 2)) {
-                                        matroxfb_DAC_out(PMINFO M1064_XPWRCTRL, tmp | 2);
+                                        matroxfb_DAC_out(minfo, M1064_XPWRCTRL, tmp | 2);
                                 }
                                 
-                                mnp = matroxfb_DAC_in(PMINFO M1064_XPIXPLLCM) << 16;
-                                mnp |= matroxfb_DAC_in(PMINFO M1064_XPIXPLLCN) << 8;
-                                pixel_vco = g450_mnp2vco(PMINFO mnp);
+                                mnp = matroxfb_DAC_in(minfo, M1064_XPIXPLLCM) << 16;
+                                mnp |= matroxfb_DAC_in(minfo, M1064_XPIXPLLCN) << 8;
+                                pixel_vco = g450_mnp2vco(minfo, mnp);
                                 matroxfb_DAC_unlock_irqrestore(flags);
                         }
-                        pi = &ACCESS_FBINFO(limits.video);
-                        ci = &ACCESS_FBINFO(cache.video);
+                        pi = &minfo->limits.video;
+                        ci = &minfo->cache.video;
                         break;
                 default:
                         return -EINVAL;
@@ -407,12 +434,12 @@ static int __g450_setclk(WPMINFO unsigned int fout, unsigned int pll,
                 unsigned int mnp;
                 unsigned int xvco;
 
-                for(mnp = g450_firstpll(PMINFO pi, &xvco, fout); mnp != NO_MORE_MNP; mnp = g450_nextpll(PMINFO pi, &xvco, mnp)) {
+                for (mnp = g450_firstpll(minfo, pi, &xvco, fout); mnp != NO_MORE_MNP; mnp = g450_nextpll(minfo, pi, &xvco, mnp)) {
                         unsigned int idx;
                         unsigned int vco;
                         unsigned int delta;
 
-                        vco = g450_mnp2vco(PMINFO mnp);
+                        vco = g450_mnp2vco(minfo, mnp);
 #if 0                   
                         if (pll == M_VIDEO_PLL) {
                                 unsigned int big, small;
@@ -444,7 +471,7 @@ static int __g450_setclk(WPMINFO unsigned int fout, unsigned int pll,
                                          * (freqs near VCOmin aren't as stable)
                                          */
                                         if (delta == deltaarray[idx-1]
-                                            && vco != g450_mnp2vco(PMINFO mnparray[idx-1])
+                                            && vco != g450_mnp2vco(minfo, mnparray[idx-1])
                                             && vco < (pi->vcomin * 17 / 16)) {
                                                 break;
                                         }
@@ -468,14 +495,14 @@ static int __g450_setclk(WPMINFO unsigned int fout, unsigned int pll,
                 unsigned int mnp;
                 
                 matroxfb_DAC_lock_irqsave(flags);
-                mnp = g450_checkcache(PMINFO ci, mnparray[0]);
+                mnp = g450_checkcache(minfo, ci, mnparray[0]);
                 if (mnp != NO_MORE_MNP) {
-                        matroxfb_g450_setpll_cond(PMINFO mnp, pll);
+                        matroxfb_g450_setpll_cond(minfo, mnp, pll);
                 } else {
-                        mnp = g450_findworkingpll(PMINFO pll, mnparray, mnpcount);
+                        mnp = g450_findworkingpll(minfo, pll, mnparray, mnpcount);
                         g450_addcache(ci, mnparray[0], mnp);
                 }
-                updatehwstate_clk(&ACCESS_FBINFO(hw), mnp, pll);
+                updatehwstate_clk(&minfo->hw, mnp, pll);
                 matroxfb_DAC_unlock_irqrestore(flags);
                 return mnp;
         }
@@ -485,14 +512,16 @@ static int __g450_setclk(WPMINFO unsigned int fout, unsigned int pll,
  * Currently there is 5(p) * 10(m) = 50 possible values. */
 #define MNP_TABLE_SIZE  64
 
-int matroxfb_g450_setclk(WPMINFO unsigned int fout, unsigned int pll) {
+int matroxfb_g450_setclk(struct matrox_fb_info *minfo, unsigned int fout,
+                         unsigned int pll)
+{
         unsigned int* arr;
         
         arr = kmalloc(sizeof(*arr) * MNP_TABLE_SIZE * 2, GFP_KERNEL);
         if (arr) {
                 int r;
 
-                r = __g450_setclk(PMINFO fout, pll, arr, arr + MNP_TABLE_SIZE);
+                r = __g450_setclk(minfo, fout, pll, arr, arr + MNP_TABLE_SIZE);
                 kfree(arr);
                 return r;
         }
diff --git a/drivers/video/matrox/g450_pll.h b/drivers/video/matrox/g450_pll.h
index c17ed74501e9..aac615d18440 100644
--- a/drivers/video/matrox/g450_pll.h
+++ b/drivers/video/matrox/g450_pll.h
@@ -3,8 +3,10 @@
 
 #include "matroxfb_base.h"
 
-int matroxfb_g450_setclk(WPMINFO unsigned int fout, unsigned int pll);
-unsigned int g450_mnp2f(CPMINFO unsigned int mnp);
-void matroxfb_g450_setpll_cond(WPMINFO unsigned int mnp, unsigned int pll);
+int matroxfb_g450_setclk(struct matrox_fb_info *minfo, unsigned int fout,
+                         unsigned int pll);
+unsigned int g450_mnp2f(const struct matrox_fb_info *minfo, unsigned int mnp);
+void matroxfb_g450_setpll_cond(struct matrox_fb_info *minfo, unsigned int mnp,
+                               unsigned int pll);
 
 #endif  /* __G450_PLL_H__ */
diff --git a/drivers/video/matrox/i2c-matroxfb.c b/drivers/video/matrox/i2c-matroxfb.c
index c14e3e2212b3..f3728ab262f8 100644
--- a/drivers/video/matrox/i2c-matroxfb.c
+++ b/drivers/video/matrox/i2c-matroxfb.c
@@ -41,7 +41,7 @@ static int matroxfb_read_gpio(struct matrox_fb_info* minfo) {
         int v;
 
         matroxfb_DAC_lock_irqsave(flags);
-        v = matroxfb_DAC_in(PMINFO DAC_XGENIODATA);
+        v = matroxfb_DAC_in(minfo, DAC_XGENIODATA);
         matroxfb_DAC_unlock_irqrestore(flags);
         return v;
 }
@@ -51,10 +51,10 @@ static void matroxfb_set_gpio(struct matrox_fb_info* minfo, int mask, int val) {
         int v;
 
         matroxfb_DAC_lock_irqsave(flags);
-        v = (matroxfb_DAC_in(PMINFO DAC_XGENIOCTRL) & mask) | val;
-        matroxfb_DAC_out(PMINFO DAC_XGENIOCTRL, v);
+        v = (matroxfb_DAC_in(minfo, DAC_XGENIOCTRL) & mask) | val;
+        matroxfb_DAC_out(minfo, DAC_XGENIOCTRL, v);
         /* We must reset GENIODATA very often... XFree plays with this register */
-        matroxfb_DAC_out(PMINFO DAC_XGENIODATA, 0x00);
+        matroxfb_DAC_out(minfo, DAC_XGENIODATA, 0x00);
         matroxfb_DAC_unlock_irqrestore(flags);
 }
 
@@ -112,7 +112,7 @@ static int i2c_bus_reg(struct i2c_bit_adapter* b, struct matrox_fb_info* minfo,
         i2c_set_adapdata(&b->adapter, b);
         b->adapter.class = class;
         b->adapter.algo_data = &b->bac;
-        b->adapter.dev.parent = &ACCESS_FBINFO(pcidev)->dev;
+        b->adapter.dev.parent = &minfo->pcidev->dev;
         b->bac = matrox_i2c_algo_template;
         b->bac.data = b;
         err = i2c_bit_add_bus(&b->adapter);
@@ -149,11 +149,11 @@ static void* i2c_matroxfb_probe(struct matrox_fb_info* minfo) {
                 return NULL;
 
         matroxfb_DAC_lock_irqsave(flags);
-        matroxfb_DAC_out(PMINFO DAC_XGENIODATA, 0xFF);
-        matroxfb_DAC_out(PMINFO DAC_XGENIOCTRL, 0x00);
+        matroxfb_DAC_out(minfo, DAC_XGENIODATA, 0xFF);
+        matroxfb_DAC_out(minfo, DAC_XGENIOCTRL, 0x00);
         matroxfb_DAC_unlock_irqrestore(flags);
 
-        switch (ACCESS_FBINFO(chip)) {
+        switch (minfo->chip) {
                 case MGA_2064:
                 case MGA_2164:
                         err = i2c_bus_reg(&m2info->ddc1, minfo,
@@ -168,7 +168,7 @@ static void* i2c_matroxfb_probe(struct matrox_fb_info* minfo) {
         }
         if (err)
                 goto fail_ddc1;
-        if (ACCESS_FBINFO(devflags.dualhead)) {
+        if (minfo->devflags.dualhead) {
                 err = i2c_bus_reg(&m2info->ddc2, minfo,
                                   DDC2_DATA, DDC2_CLK,
                                   "DDC:fb%u #1", I2C_CLASS_DDC);
diff --git a/drivers/video/matrox/matroxfb_DAC1064.c b/drivers/video/matrox/matroxfb_DAC1064.c
index a74e5da17aa0..f9fa0fd00292 100644
--- a/drivers/video/matrox/matroxfb_DAC1064.c
+++ b/drivers/video/matrox/matroxfb_DAC1064.c
@@ -33,7 +33,11 @@
 #define DAC1064_OPT_MDIV2       0x00
 #define DAC1064_OPT_RESERVED    0x10
 
-static void DAC1064_calcclock(CPMINFO unsigned int freq, unsigned int fmax, unsigned int* in, unsigned int* feed, unsigned int* post) {
+static void DAC1064_calcclock(const struct matrox_fb_info *minfo,
+                              unsigned int freq, unsigned int fmax,
+                              unsigned int *in, unsigned int *feed,
+                              unsigned int *post)
+{
         unsigned int fvco;
         unsigned int p;
 
@@ -41,7 +45,7 @@ static void DAC1064_calcclock(CPMINFO unsigned int freq, unsigned int fmax, unsi
         
         /* only for devices older than G450 */
 
-        fvco = PLL_calcclock(PMINFO freq, fmax, in, feed, &p);
+        fvco = PLL_calcclock(minfo, freq, fmax, in, feed, &p);
         
         p = (1 << p) - 1;
         if (fvco <= 100000)
@@ -80,32 +84,35 @@ static const unsigned char MGA1064_DAC[] = {
                 0x00,
                 0x00, 0x00, 0xFF, 0xFF};
 
-static void DAC1064_setpclk(WPMINFO unsigned long fout) {
+static void DAC1064_setpclk(struct matrox_fb_info *minfo, unsigned long fout)
+{
         unsigned int m, n, p;
 
         DBG(__func__)
 
-        DAC1064_calcclock(PMINFO fout, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
-        ACCESS_FBINFO(hw).DACclk[0] = m;
-        ACCESS_FBINFO(hw).DACclk[1] = n;
-        ACCESS_FBINFO(hw).DACclk[2] = p;
+        DAC1064_calcclock(minfo, fout, minfo->max_pixel_clock, &m, &n, &p);
+        minfo->hw.DACclk[0] = m;
+        minfo->hw.DACclk[1] = n;
+        minfo->hw.DACclk[2] = p;
 }
 
-static void DAC1064_setmclk(WPMINFO int oscinfo, unsigned long fmem) {
+static void DAC1064_setmclk(struct matrox_fb_info *minfo, int oscinfo,
+                            unsigned long fmem)
+{
         u_int32_t mx;
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+        struct matrox_hw_state *hw = &minfo->hw;
 
         DBG(__func__)
 
-        if (ACCESS_FBINFO(devflags.noinit)) {
+        if (minfo->devflags.noinit) {
                 /* read MCLK and give up... */
-                hw->DACclk[3] = inDAC1064(PMINFO DAC1064_XSYSPLLM);
-                hw->DACclk[4] = inDAC1064(PMINFO DAC1064_XSYSPLLN);
-                hw->DACclk[5] = inDAC1064(PMINFO DAC1064_XSYSPLLP);
+                hw->DACclk[3] = inDAC1064(minfo, DAC1064_XSYSPLLM);
+                hw->DACclk[4] = inDAC1064(minfo, DAC1064_XSYSPLLN);
+                hw->DACclk[5] = inDAC1064(minfo, DAC1064_XSYSPLLP);
                 return;
         }
         mx = hw->MXoptionReg | 0x00000004;
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
         mx &= ~0x000000BB;
         if (oscinfo & DAC1064_OPT_GDIV1)
                 mx |= 0x00000008;
@@ -120,9 +127,9 @@ static void DAC1064_setmclk(WPMINFO int oscinfo, unsigned long fmem) {
 
                 /* powerup system PLL, select PCI clock */
                 mx |= 0x00000020;
-                pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+                pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
                 mx &= ~0x00000004;
-                pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+                pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
 
                 /* !!! you must not access device if MCLK is not running !!!
                    Doing so cause immediate PCI lockup :-( Maybe they should
@@ -131,12 +138,12 @@ static void DAC1064_setmclk(WPMINFO int oscinfo, unsigned long fmem) {
                    perfect... */
                 /* (bit 2 of PCI_OPTION_REG must be 0... and bits 0,1 must not
                    select PLL... because of PLL can be stopped at this time) */
-                DAC1064_calcclock(PMINFO fmem, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
-                outDAC1064(PMINFO DAC1064_XSYSPLLM, hw->DACclk[3] = m);
-                outDAC1064(PMINFO DAC1064_XSYSPLLN, hw->DACclk[4] = n);
-                outDAC1064(PMINFO DAC1064_XSYSPLLP, hw->DACclk[5] = p);
+                DAC1064_calcclock(minfo, fmem, minfo->max_pixel_clock, &m, &n, &p);
+                outDAC1064(minfo, DAC1064_XSYSPLLM, hw->DACclk[3] = m);
+                outDAC1064(minfo, DAC1064_XSYSPLLN, hw->DACclk[4] = n);
+                outDAC1064(minfo, DAC1064_XSYSPLLP, hw->DACclk[5] = p);
                 for (clk = 65536; clk; --clk) {
-                        if (inDAC1064(PMINFO DAC1064_XSYSPLLSTAT) & 0x40)
+                        if (inDAC1064(minfo, DAC1064_XSYSPLLSTAT) & 0x40)
                                 break;
                 }
                 if (!clk)
@@ -147,29 +154,30 @@ static void DAC1064_setmclk(WPMINFO int oscinfo, unsigned long fmem) {
                 /* select specified system clock source */
                 mx |= oscinfo & DAC1064_OPT_SCLK_MASK;
         }
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
         mx &= ~0x00000004;
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
         hw->MXoptionReg = mx;
 }
 
 #ifdef CONFIG_FB_MATROX_G
-static void g450_set_plls(WPMINFO2) {
+static void g450_set_plls(struct matrox_fb_info *minfo)
+{
         u_int32_t c2_ctl;
         unsigned int pxc;
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+        struct matrox_hw_state *hw = &minfo->hw;
         int pixelmnp;
         int videomnp;
         
         c2_ctl = hw->crtc2.ctl & ~0x4007;       /* Clear PLL + enable for CRTC2 */
         c2_ctl |= 0x0001;                       /* Enable CRTC2 */
         hw->DACreg[POS1064_XPWRCTRL] &= ~0x02;  /* Stop VIDEO PLL */
-        pixelmnp = ACCESS_FBINFO(crtc1).mnp;
-        videomnp = ACCESS_FBINFO(crtc2).mnp;
+        pixelmnp = minfo->crtc1.mnp;
+        videomnp = minfo->crtc2.mnp;
         if (videomnp < 0) {
                 c2_ctl &= ~0x0001;                      /* Disable CRTC2 */
                 hw->DACreg[POS1064_XPWRCTRL] &= ~0x10;  /* Powerdown CRTC2 */
-        } else if (ACCESS_FBINFO(crtc2).pixclock == ACCESS_FBINFO(features).pll.ref_freq) {
+        } else if (minfo->crtc2.pixclock == minfo->features.pll.ref_freq) {
                 c2_ctl |=  0x4002;      /* Use reference directly */
         } else if (videomnp == pixelmnp) {
                 c2_ctl |=  0x0004;      /* Use pixel PLL */
@@ -184,27 +192,27 @@ static void g450_set_plls(WPMINFO2) {
                 c2_ctl |=  0x0006;      /* Use video PLL */
                 hw->DACreg[POS1064_XPWRCTRL] |= 0x02;
                 
-                outDAC1064(PMINFO M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
-                matroxfb_g450_setpll_cond(PMINFO videomnp, M_VIDEO_PLL);
+                outDAC1064(minfo, M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
+                matroxfb_g450_setpll_cond(minfo, videomnp, M_VIDEO_PLL);
         }
 
         hw->DACreg[POS1064_XPIXCLKCTRL] &= ~M1064_XPIXCLKCTRL_PLL_UP;
         if (pixelmnp >= 0) {
                 hw->DACreg[POS1064_XPIXCLKCTRL] |= M1064_XPIXCLKCTRL_PLL_UP;
                 
-                outDAC1064(PMINFO M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
-                matroxfb_g450_setpll_cond(PMINFO pixelmnp, M_PIXEL_PLL_C);
+                outDAC1064(minfo, M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
+                matroxfb_g450_setpll_cond(minfo, pixelmnp, M_PIXEL_PLL_C);
         }
         if (c2_ctl != hw->crtc2.ctl) {
                 hw->crtc2.ctl = c2_ctl;
                 mga_outl(0x3C10, c2_ctl);
         }
 
-        pxc = ACCESS_FBINFO(crtc1).pixclock;
-        if (pxc == 0 || ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC2) {
-                pxc = ACCESS_FBINFO(crtc2).pixclock;
+        pxc = minfo->crtc1.pixclock;
+        if (pxc == 0 || minfo->outputs[2].src == MATROXFB_SRC_CRTC2) {
+                pxc = minfo->crtc2.pixclock;
         }
-        if (ACCESS_FBINFO(chip) == MGA_G550) {
+        if (minfo->chip == MGA_G550) {
                 if (pxc < 45000) {
                         hw->DACreg[POS1064_XPANMODE] = 0x00;    /* 0-50 */
                 } else if (pxc < 55000) {
@@ -245,18 +253,19 @@ static void g450_set_plls(WPMINFO2) {
 }
 #endif
 
-void DAC1064_global_init(WPMINFO2) {
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+void DAC1064_global_init(struct matrox_fb_info *minfo)
+{
+        struct matrox_hw_state *hw = &minfo->hw;
 
         hw->DACreg[POS1064_XMISCCTRL] &= M1064_XMISCCTRL_DAC_WIDTHMASK;
         hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_LUT_EN;
         hw->DACreg[POS1064_XPIXCLKCTRL] = M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_PLL;
 #ifdef CONFIG_FB_MATROX_G
-        if (ACCESS_FBINFO(devflags.g450dac)) {
+        if (minfo->devflags.g450dac) {
                 hw->DACreg[POS1064_XPWRCTRL] = 0x1F;    /* powerup everything */
                 hw->DACreg[POS1064_XOUTPUTCONN] = 0x00; /* disable outputs */
                 hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_DAC_EN;
-                switch (ACCESS_FBINFO(outputs[0]).src) {
+                switch (minfo->outputs[0].src) {
                         case MATROXFB_SRC_CRTC1:
                         case MATROXFB_SRC_CRTC2:
                                 hw->DACreg[POS1064_XOUTPUTCONN] |= 0x01;        /* enable output; CRTC1/2 selection is in CRTC2 ctl */
@@ -265,12 +274,12 @@ void DAC1064_global_init(WPMINFO2) {
                                 hw->DACreg[POS1064_XMISCCTRL] &= ~M1064_XMISCCTRL_DAC_EN;
                                 break;
                 }
-                switch (ACCESS_FBINFO(outputs[1]).src) {
+                switch (minfo->outputs[1].src) {
                         case MATROXFB_SRC_CRTC1:
                                 hw->DACreg[POS1064_XOUTPUTCONN] |= 0x04;
                                 break;
                         case MATROXFB_SRC_CRTC2:
-                                if (ACCESS_FBINFO(outputs[1]).mode == MATROXFB_OUTPUT_MODE_MONITOR) {
+                                if (minfo->outputs[1].mode == MATROXFB_OUTPUT_MODE_MONITOR) {
                                         hw->DACreg[POS1064_XOUTPUTCONN] |= 0x08;
                                 } else {
                                         hw->DACreg[POS1064_XOUTPUTCONN] |= 0x0C;
@@ -280,7 +289,7 @@ void DAC1064_global_init(WPMINFO2) {
                                 hw->DACreg[POS1064_XPWRCTRL] &= ~0x01;          /* Poweroff DAC2 */
                                 break;
                 }
-                switch (ACCESS_FBINFO(outputs[2]).src) {
+                switch (minfo->outputs[2].src) {
                         case MATROXFB_SRC_CRTC1:
                                 hw->DACreg[POS1064_XOUTPUTCONN] |= 0x20;
                                 break;
@@ -299,55 +308,57 @@ void DAC1064_global_init(WPMINFO2) {
                                 break;
                 }
                 /* Now set timming related variables... */
-                g450_set_plls(PMINFO2);
+                g450_set_plls(minfo);
         } else
 #endif
         {
-                if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC1) {
+                if (minfo->outputs[1].src == MATROXFB_SRC_CRTC1) {
                         hw->DACreg[POS1064_XPIXCLKCTRL] = M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_EXT;
                         hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_MAFC | G400_XMISCCTRL_VDO_MAFC12;
-                } else if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC2) {
+                } else if (minfo->outputs[1].src == MATROXFB_SRC_CRTC2) {
                         hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_MAFC | G400_XMISCCTRL_VDO_C2_MAFC12;
-                } else if (ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1)
+                } else if (minfo->outputs[2].src == MATROXFB_SRC_CRTC1)
                         hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_PANELLINK | G400_XMISCCTRL_VDO_MAFC12;
                 else
                         hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_DIS;
 
-                if (ACCESS_FBINFO(outputs[0]).src != MATROXFB_SRC_NONE)
+                if (minfo->outputs[0].src != MATROXFB_SRC_NONE)
                         hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_DAC_EN;
         }
 }
 
-void DAC1064_global_restore(WPMINFO2) {
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
-
-        outDAC1064(PMINFO M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
-        outDAC1064(PMINFO M1064_XMISCCTRL, hw->DACreg[POS1064_XMISCCTRL]);
-        if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400) {
-                outDAC1064(PMINFO 0x20, 0x04);
-                outDAC1064(PMINFO 0x1F, ACCESS_FBINFO(devflags.dfp_type));
-                if (ACCESS_FBINFO(devflags.g450dac)) {
-                        outDAC1064(PMINFO M1064_XSYNCCTRL, 0xCC);
-                        outDAC1064(PMINFO M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
-                        outDAC1064(PMINFO M1064_XPANMODE, hw->DACreg[POS1064_XPANMODE]);
-                        outDAC1064(PMINFO M1064_XOUTPUTCONN, hw->DACreg[POS1064_XOUTPUTCONN]);
+void DAC1064_global_restore(struct matrox_fb_info *minfo)
+{
+        struct matrox_hw_state *hw = &minfo->hw;
+
+        outDAC1064(minfo, M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
+        outDAC1064(minfo, M1064_XMISCCTRL, hw->DACreg[POS1064_XMISCCTRL]);
+        if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400) {
+                outDAC1064(minfo, 0x20, 0x04);
+                outDAC1064(minfo, 0x1F, minfo->devflags.dfp_type);
+                if (minfo->devflags.g450dac) {
+                        outDAC1064(minfo, M1064_XSYNCCTRL, 0xCC);
+                        outDAC1064(minfo, M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
+                        outDAC1064(minfo, M1064_XPANMODE, hw->DACreg[POS1064_XPANMODE]);
+                        outDAC1064(minfo, M1064_XOUTPUTCONN, hw->DACreg[POS1064_XOUTPUTCONN]);
                 }
         }
 }
 
-static int DAC1064_init_1(WPMINFO struct my_timming* m) {
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int DAC1064_init_1(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+        struct matrox_hw_state *hw = &minfo->hw;
 
         DBG(__func__)
 
         memcpy(hw->DACreg, MGA1064_DAC, sizeof(MGA1064_DAC_regs));
-        switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+        switch (minfo->fbcon.var.bits_per_pixel) {
                 /* case 4: not supported by MGA1064 DAC */
                 case 8:
                         hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_8BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
                         break;
                 case 16:
-                        if (ACCESS_FBINFO(fbcon).var.green.length == 5)
+                        if (minfo->fbcon.var.green.length == 5)
                                 hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_15BPP_1BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
                         else
                                 hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_16BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
@@ -361,22 +372,23 @@ static int DAC1064_init_1(WPMINFO struct my_timming* m) {
                 default:
                         return 1;       /* unsupported depth */
         }
-        hw->DACreg[POS1064_XVREFCTRL] = ACCESS_FBINFO(features.DAC1064.xvrefctrl);
+        hw->DACreg[POS1064_XVREFCTRL] = minfo->features.DAC1064.xvrefctrl;
         hw->DACreg[POS1064_XGENCTRL] &= ~M1064_XGENCTRL_SYNC_ON_GREEN_MASK;
         hw->DACreg[POS1064_XGENCTRL] |= (m->sync & FB_SYNC_ON_GREEN)?M1064_XGENCTRL_SYNC_ON_GREEN:M1064_XGENCTRL_NO_SYNC_ON_GREEN;
         hw->DACreg[POS1064_XCURADDL] = 0;
         hw->DACreg[POS1064_XCURADDH] = 0;
 
-        DAC1064_global_init(PMINFO2);
+        DAC1064_global_init(minfo);
         return 0;
 }
 
-static int DAC1064_init_2(WPMINFO struct my_timming* m) {
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int DAC1064_init_2(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+        struct matrox_hw_state *hw = &minfo->hw;
 
         DBG(__func__)
 
-        if (ACCESS_FBINFO(fbcon).var.bits_per_pixel > 16) {     /* 256 entries */
+        if (minfo->fbcon.var.bits_per_pixel > 16) {     /* 256 entries */
                 int i;
 
                 for (i = 0; i < 256; i++) {
@@ -384,8 +396,8 @@ static int DAC1064_init_2(WPMINFO struct my_timming* m) {
                         hw->DACpal[i * 3 + 1] = i;
                         hw->DACpal[i * 3 + 2] = i;
                 }
-        } else if (ACCESS_FBINFO(fbcon).var.bits_per_pixel > 8) {
-                if (ACCESS_FBINFO(fbcon).var.green.length == 5) {       /* 0..31, 128..159 */
+        } else if (minfo->fbcon.var.bits_per_pixel > 8) {
+                if (minfo->fbcon.var.green.length == 5) {       /* 0..31, 128..159 */
                         int i;
 
                         for (i = 0; i < 32; i++) {
@@ -413,8 +425,9 @@ static int DAC1064_init_2(WPMINFO struct my_timming* m) {
         return 0;
 }
 
-static void DAC1064_restore_1(WPMINFO2) {
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static void DAC1064_restore_1(struct matrox_fb_info *minfo)
+{
+        struct matrox_hw_state *hw = &minfo->hw;
 
         CRITFLAGS
 
@@ -422,28 +435,29 @@ static void DAC1064_restore_1(WPMINFO2) {
 
         CRITBEGIN
 
-        if ((inDAC1064(PMINFO DAC1064_XSYSPLLM) != hw->DACclk[3]) ||
-            (inDAC1064(PMINFO DAC1064_XSYSPLLN) != hw->DACclk[4]) ||
-            (inDAC1064(PMINFO DAC1064_XSYSPLLP) != hw->DACclk[5])) {
-                outDAC1064(PMINFO DAC1064_XSYSPLLM, hw->DACclk[3]);
-                outDAC1064(PMINFO DAC1064_XSYSPLLN, hw->DACclk[4]);
-                outDAC1064(PMINFO DAC1064_XSYSPLLP, hw->DACclk[5]);
+        if ((inDAC1064(minfo, DAC1064_XSYSPLLM) != hw->DACclk[3]) ||
+            (inDAC1064(minfo, DAC1064_XSYSPLLN) != hw->DACclk[4]) ||
+            (inDAC1064(minfo, DAC1064_XSYSPLLP) != hw->DACclk[5])) {
+                outDAC1064(minfo, DAC1064_XSYSPLLM, hw->DACclk[3]);
+                outDAC1064(minfo, DAC1064_XSYSPLLN, hw->DACclk[4]);
+                outDAC1064(minfo, DAC1064_XSYSPLLP, hw->DACclk[5]);
         }
         {
                 unsigned int i;
 
                 for (i = 0; i < sizeof(MGA1064_DAC_regs); i++) {
                         if ((i != POS1064_XPIXCLKCTRL) && (i != POS1064_XMISCCTRL))
-                                outDAC1064(PMINFO MGA1064_DAC_regs[i], hw->DACreg[i]);
+                                outDAC1064(minfo, MGA1064_DAC_regs[i], hw->DACreg[i]);
                 }
         }
 
-        DAC1064_global_restore(PMINFO2);
+        DAC1064_global_restore(minfo);
 
         CRITEND
 };
 
-static void DAC1064_restore_2(WPMINFO2) {
+static void DAC1064_restore_2(struct matrox_fb_info *minfo)
+{
 #ifdef DEBUG
         unsigned int i;
 #endif
@@ -453,12 +467,12 @@ static void DAC1064_restore_2(WPMINFO2) {
 #ifdef DEBUG
         dprintk(KERN_DEBUG "DAC1064regs ");
         for (i = 0; i < sizeof(MGA1064_DAC_regs); i++) {
-                dprintk("R%02X=%02X ", MGA1064_DAC_regs[i], ACCESS_FBINFO(hw).DACreg[i]);
+                dprintk("R%02X=%02X ", MGA1064_DAC_regs[i], minfo->hw.DACreg[i]);
                 if ((i & 0x7) == 0x7) dprintk(KERN_DEBUG "continuing... ");
         }
         dprintk(KERN_DEBUG "DAC1064clk ");
         for (i = 0; i < 6; i++)
-                dprintk("C%02X=%02X ", i, ACCESS_FBINFO(hw).DACclk[i]);
+                dprintk("C%02X=%02X ", i, minfo->hw.DACclk[i]);
         dprintk("\n");
 #endif
 }
@@ -470,14 +484,14 @@ static int m1064_compute(void* out, struct my_timming* m) {
                 int tmout;
                 CRITFLAGS
 
-                DAC1064_setpclk(PMINFO m->pixclock);
+                DAC1064_setpclk(minfo, m->pixclock);
 
                 CRITBEGIN
 
                 for (i = 0; i < 3; i++)
-                        outDAC1064(PMINFO M1064_XPIXPLLCM + i, ACCESS_FBINFO(hw).DACclk[i]);
+                        outDAC1064(minfo, M1064_XPIXPLLCM + i, minfo->hw.DACclk[i]);
                 for (tmout = 500000; tmout; tmout--) {
-                        if (inDAC1064(PMINFO M1064_XPIXPLLSTAT) & 0x40)
+                        if (inDAC1064(minfo, M1064_XPIXPLLSTAT) & 0x40)
                                 break;
                         udelay(10);
                 };
@@ -500,9 +514,9 @@ static struct matrox_altout m1064 = {
 static int g450_compute(void* out, struct my_timming* m) {
 #define minfo ((struct matrox_fb_info*)out)
         if (m->mnp < 0) {
-                m->mnp = matroxfb_g450_setclk(PMINFO m->pixclock, (m->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+                m->mnp = matroxfb_g450_setclk(minfo, m->pixclock, (m->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
                 if (m->mnp >= 0) {
-                        m->pixclock = g450_mnp2f(PMINFO m->mnp);
+                        m->pixclock = g450_mnp2f(minfo, m->mnp);
                 }
         }
 #undef minfo
@@ -518,13 +532,14 @@ static struct matrox_altout g450out = {
 #endif /* NEED_DAC1064 */
 
 #ifdef CONFIG_FB_MATROX_MYSTIQUE
-static int MGA1064_init(WPMINFO struct my_timming* m) {
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int MGA1064_init(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+        struct matrox_hw_state *hw = &minfo->hw;
 
         DBG(__func__)
 
-        if (DAC1064_init_1(PMINFO m)) return 1;
-        if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+        if (DAC1064_init_1(minfo, m)) return 1;
+        if (matroxfb_vgaHWinit(minfo, m)) return 1;
 
         hw->MiscOutReg = 0xCB;
         if (m->sync & FB_SYNC_HOR_HIGH_ACT)
@@ -534,20 +549,21 @@ static int MGA1064_init(WPMINFO struct my_timming* m) {
         if (m->sync & FB_SYNC_COMP_HIGH_ACT) /* should be only FB_SYNC_COMP */
                 hw->CRTCEXT[3] |= 0x40;
 
-        if (DAC1064_init_2(PMINFO m)) return 1;
+        if (DAC1064_init_2(minfo, m)) return 1;
         return 0;
 }
 #endif
 
 #ifdef CONFIG_FB_MATROX_G
-static int MGAG100_init(WPMINFO struct my_timming* m) {
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int MGAG100_init(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+        struct matrox_hw_state *hw = &minfo->hw;
 
         DBG(__func__)
 
-        if (DAC1064_init_1(PMINFO m)) return 1;
+        if (DAC1064_init_1(minfo, m)) return 1;
         hw->MXoptionReg &= ~0x2000;
-        if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+        if (matroxfb_vgaHWinit(minfo, m)) return 1;
 
         hw->MiscOutReg = 0xEF;
         if (m->sync & FB_SYNC_HOR_HIGH_ACT)
@@ -557,27 +573,28 @@ static int MGAG100_init(WPMINFO struct my_timming* m) {
         if (m->sync & FB_SYNC_COMP_HIGH_ACT) /* should be only FB_SYNC_COMP */
                 hw->CRTCEXT[3] |= 0x40;
 
-        if (DAC1064_init_2(PMINFO m)) return 1;
+        if (DAC1064_init_2(minfo, m)) return 1;
         return 0;
 }
 #endif  /* G */
 
 #ifdef CONFIG_FB_MATROX_MYSTIQUE
-static void MGA1064_ramdac_init(WPMINFO2) {
+static void MGA1064_ramdac_init(struct matrox_fb_info *minfo)
+{
 
         DBG(__func__)
 
-        /* ACCESS_FBINFO(features.DAC1064.vco_freq_min) = 120000; */
-        ACCESS_FBINFO(features.pll.vco_freq_min) = 62000;
-        ACCESS_FBINFO(features.pll.ref_freq)     = 14318;
-        ACCESS_FBINFO(features.pll.feed_div_min) = 100;
-        ACCESS_FBINFO(features.pll.feed_div_max) = 127;
-        ACCESS_FBINFO(features.pll.in_div_min)   = 1;
-        ACCESS_FBINFO(features.pll.in_div_max)   = 31;
-        ACCESS_FBINFO(features.pll.post_shift_max) = 3;
-        ACCESS_FBINFO(features.DAC1064.xvrefctrl) = DAC1064_XVREFCTRL_EXTERNAL;
+        /* minfo->features.DAC1064.vco_freq_min = 120000; */
+        minfo->features.pll.vco_freq_min = 62000;
+        minfo->features.pll.ref_freq     = 14318;
+        minfo->features.pll.feed_div_min = 100;
+        minfo->features.pll.feed_div_max = 127;
+        minfo->features.pll.in_div_min   = 1;
+        minfo->features.pll.in_div_max   = 31;
+        minfo->features.pll.post_shift_max = 3;
+        minfo->features.DAC1064.xvrefctrl = DAC1064_XVREFCTRL_EXTERNAL;
         /* maybe cmdline MCLK= ?, doc says gclk=44MHz, mclk=66MHz... it was 55/83 with old values */
-        DAC1064_setmclk(PMINFO DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PLL, 133333);
+        DAC1064_setmclk(minfo, DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PLL, 133333);
 }
 #endif
 
@@ -589,23 +606,25 @@ static int x7AF4 = 0x10;	/* flags, maybe 0x10 = SDRAM, 0x00 = SGRAM??? */
 static int def50 = 0;   /* reg50, & 0x0F, & 0x3000 (only 0x0000, 0x1000, 0x2000 (0x3000 disallowed and treated as 0) */
 #endif
 
-static void MGAG100_progPixClock(CPMINFO int flags, int m, int n, int p) {
+static void MGAG100_progPixClock(const struct matrox_fb_info *minfo, int flags,
+                                 int m, int n, int p)
+{
         int reg;
         int selClk;
         int clk;
 
         DBG(__func__)
 
-        outDAC1064(PMINFO M1064_XPIXCLKCTRL, inDAC1064(PMINFO M1064_XPIXCLKCTRL) | M1064_XPIXCLKCTRL_DIS |
+        outDAC1064(minfo, M1064_XPIXCLKCTRL, inDAC1064(minfo, M1064_XPIXCLKCTRL) | M1064_XPIXCLKCTRL_DIS |
                    M1064_XPIXCLKCTRL_PLL_UP);
         switch (flags & 3) {
                 case 0:         reg = M1064_XPIXPLLAM; break;
                 case 1:         reg = M1064_XPIXPLLBM; break;
                 default:        reg = M1064_XPIXPLLCM; break;
         }
-        outDAC1064(PMINFO reg++, m);
-        outDAC1064(PMINFO reg++, n);
-        outDAC1064(PMINFO reg, p);
+        outDAC1064(minfo, reg++, m);
+        outDAC1064(minfo, reg++, n);
+        outDAC1064(minfo, reg, p);
         selClk = mga_inb(M_MISC_REG_READ) & ~0xC;
         /* there should be flags & 0x03 & case 0/1/else */
         /* and we should first select source and after that we should wait for PLL */
@@ -617,61 +636,64 @@ static void MGAG100_progPixClock(CPMINFO int flags, int m, int n, int p) {
         }
         mga_outb(M_MISC_REG, selClk);
         for (clk = 500000; clk; clk--) {
-                if (inDAC1064(PMINFO M1064_XPIXPLLSTAT) & 0x40)
+                if (inDAC1064(minfo, M1064_XPIXPLLSTAT) & 0x40)
                         break;
                 udelay(10);
         };
         if (!clk)
                 printk(KERN_ERR "matroxfb: Pixel PLL%c not locked after usual time\n", (reg-M1064_XPIXPLLAM-2)/4 + 'A');
-        selClk = inDAC1064(PMINFO M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_SRC_MASK;
+        selClk = inDAC1064(minfo, M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_SRC_MASK;
         switch (flags & 0x0C) {
                 case 0x00:      selClk |= M1064_XPIXCLKCTRL_SRC_PCI; break;
                 case 0x04:      selClk |= M1064_XPIXCLKCTRL_SRC_PLL; break;
                 default:        selClk |= M1064_XPIXCLKCTRL_SRC_EXT; break;
         }
-        outDAC1064(PMINFO M1064_XPIXCLKCTRL, selClk);
-        outDAC1064(PMINFO M1064_XPIXCLKCTRL, inDAC1064(PMINFO M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_DIS);
+        outDAC1064(minfo, M1064_XPIXCLKCTRL, selClk);
+        outDAC1064(minfo, M1064_XPIXCLKCTRL, inDAC1064(minfo, M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_DIS);
 }
 
-static void MGAG100_setPixClock(CPMINFO int flags, int freq) {
+static void MGAG100_setPixClock(const struct matrox_fb_info *minfo, int flags,
+                                int freq)
+{
         unsigned int m, n, p;
 
         DBG(__func__)
 
-        DAC1064_calcclock(PMINFO freq, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
-        MGAG100_progPixClock(PMINFO flags, m, n, p);
+        DAC1064_calcclock(minfo, freq, minfo->max_pixel_clock, &m, &n, &p);
+        MGAG100_progPixClock(minfo, flags, m, n, p);
 }
 #endif
 
 #ifdef CONFIG_FB_MATROX_MYSTIQUE
-static int MGA1064_preinit(WPMINFO2) {
+static int MGA1064_preinit(struct matrox_fb_info *minfo)
+{
         static const int vxres_mystique[] = { 512,        640, 768,  800,  832,  960,
                                              1024, 1152, 1280,      1600, 1664, 1920,
                                              2048,    0};
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+        struct matrox_hw_state *hw = &minfo->hw;
 
         DBG(__func__)
 
-        /* ACCESS_FBINFO(capable.cfb4) = 0; ... preinitialized by 0 */
-        ACCESS_FBINFO(capable.text) = 1;
-        ACCESS_FBINFO(capable.vxres) = vxres_mystique;
+        /* minfo->capable.cfb4 = 0; ... preinitialized by 0 */
+        minfo->capable.text = 1;
+        minfo->capable.vxres = vxres_mystique;
 
-        ACCESS_FBINFO(outputs[0]).output = &m1064;
-        ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
-        ACCESS_FBINFO(outputs[0]).data = MINFO;
-        ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+        minfo->outputs[0].output = &m1064;
+        minfo->outputs[0].src = minfo->outputs[0].default_src;
+        minfo->outputs[0].data = minfo;
+        minfo->outputs[0].mode = MATROXFB_OUTPUT_MODE_MONITOR;
 
-        if (ACCESS_FBINFO(devflags.noinit))
+        if (minfo->devflags.noinit)
                 return 0;       /* do not modify settings */
         hw->MXoptionReg &= 0xC0000100;
         hw->MXoptionReg |= 0x00094E20;
-        if (ACCESS_FBINFO(devflags.novga))
+        if (minfo->devflags.novga)
                 hw->MXoptionReg &= ~0x00000100;
-        if (ACCESS_FBINFO(devflags.nobios))
+        if (minfo->devflags.nobios)
                 hw->MXoptionReg &= ~0x40000000;
-        if (ACCESS_FBINFO(devflags.nopciretry))
+        if (minfo->devflags.nopciretry)
                 hw->MXoptionReg |=  0x20000000;
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
         mga_setr(M_SEQ_INDEX, 0x01, 0x20);
         mga_outl(M_CTLWTST, 0x00000000);
         udelay(200);
@@ -681,101 +703,105 @@ static int MGA1064_preinit(WPMINFO2) {
         return 0;
 }
 
-static void MGA1064_reset(WPMINFO2) {
+static void MGA1064_reset(struct matrox_fb_info *minfo)
+{
 
         DBG(__func__);
 
-        MGA1064_ramdac_init(PMINFO2);
+        MGA1064_ramdac_init(minfo);
 }
 #endif
 
 #ifdef CONFIG_FB_MATROX_G
-static void g450_mclk_init(WPMINFO2) {
+static void g450_mclk_init(struct matrox_fb_info *minfo)
+{
         /* switch all clocks to PCI source */
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg | 4);
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION3_REG, ACCESS_FBINFO(values).reg.opt3 & ~0x00300C03);
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
-        
-        if (((ACCESS_FBINFO(values).reg.opt3 & 0x000003) == 0x000003) ||
-            ((ACCESS_FBINFO(values).reg.opt3 & 0x000C00) == 0x000C00) ||
-            ((ACCESS_FBINFO(values).reg.opt3 & 0x300000) == 0x300000)) {
-                matroxfb_g450_setclk(PMINFO ACCESS_FBINFO(values.pll.video), M_VIDEO_PLL);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg | 4);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION3_REG, minfo->values.reg.opt3 & ~0x00300C03);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
+
+        if (((minfo->values.reg.opt3 & 0x000003) == 0x000003) ||
+            ((minfo->values.reg.opt3 & 0x000C00) == 0x000C00) ||
+            ((minfo->values.reg.opt3 & 0x300000) == 0x300000)) {
+                matroxfb_g450_setclk(minfo, minfo->values.pll.video, M_VIDEO_PLL);
         } else {
                 unsigned long flags;
                 unsigned int pwr;
                 
                 matroxfb_DAC_lock_irqsave(flags);
-                pwr = inDAC1064(PMINFO M1064_XPWRCTRL) & ~0x02;
-                outDAC1064(PMINFO M1064_XPWRCTRL, pwr);
+                pwr = inDAC1064(minfo, M1064_XPWRCTRL) & ~0x02;
+                outDAC1064(minfo, M1064_XPWRCTRL, pwr);
                 matroxfb_DAC_unlock_irqrestore(flags);
         }
-        matroxfb_g450_setclk(PMINFO ACCESS_FBINFO(values.pll.system), M_SYSTEM_PLL);
+        matroxfb_g450_setclk(minfo, minfo->values.pll.system, M_SYSTEM_PLL);
         
         /* switch clocks to their real PLL source(s) */
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg | 4);
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION3_REG, ACCESS_FBINFO(values).reg.opt3);
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg | 4);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION3_REG, minfo->values.reg.opt3);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
 
 }
 
-static void g450_memory_init(WPMINFO2) {
+static void g450_memory_init(struct matrox_fb_info *minfo)
+{
         /* disable memory refresh */
-        ACCESS_FBINFO(hw).MXoptionReg &= ~0x001F8000;
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+        minfo->hw.MXoptionReg &= ~0x001F8000;
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
         
         /* set memory interface parameters */
-        ACCESS_FBINFO(hw).MXoptionReg &= ~0x00207E00;
-        ACCESS_FBINFO(hw).MXoptionReg |= 0x00207E00 & ACCESS_FBINFO(values).reg.opt;
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, ACCESS_FBINFO(values).reg.opt2);
+        minfo->hw.MXoptionReg &= ~0x00207E00;
+        minfo->hw.MXoptionReg |= 0x00207E00 & minfo->values.reg.opt;
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, minfo->values.reg.opt2);
         
-        mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
+        mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst);
         
         /* first set up memory interface with disabled memory interface clocks */
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MEMMISC_REG, ACCESS_FBINFO(values).reg.memmisc & ~0x80000000U);
-        mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
-        mga_outl(M_MACCESS, ACCESS_FBINFO(values).reg.maccess);
+        pci_write_config_dword(minfo->pcidev, PCI_MEMMISC_REG, minfo->values.reg.memmisc & ~0x80000000U);
+        mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk);
+        mga_outl(M_MACCESS, minfo->values.reg.maccess);
         /* start memory clocks */
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MEMMISC_REG, ACCESS_FBINFO(values).reg.memmisc | 0x80000000U);
+        pci_write_config_dword(minfo->pcidev, PCI_MEMMISC_REG, minfo->values.reg.memmisc | 0x80000000U);
 
         udelay(200);
         
-        if (ACCESS_FBINFO(values).memory.ddr && (!ACCESS_FBINFO(values).memory.emrswen || !ACCESS_FBINFO(values).memory.dll)) {
-                mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk & ~0x1000);
+        if (minfo->values.memory.ddr && (!minfo->values.memory.emrswen || !minfo->values.memory.dll)) {
+                mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk & ~0x1000);
         }
-        mga_outl(M_MACCESS, ACCESS_FBINFO(values).reg.maccess | 0x8000);
+        mga_outl(M_MACCESS, minfo->values.reg.maccess | 0x8000);
         
         udelay(200);
         
-        ACCESS_FBINFO(hw).MXoptionReg |= 0x001F8000 & ACCESS_FBINFO(values).reg.opt;
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+        minfo->hw.MXoptionReg |= 0x001F8000 & minfo->values.reg.opt;
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
         
         /* value is written to memory chips only if old != new */
         mga_outl(M_PLNWT, 0);
         mga_outl(M_PLNWT, ~0);
         
-        if (ACCESS_FBINFO(values).reg.mctlwtst != ACCESS_FBINFO(values).reg.mctlwtst_core) {
-                mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst_core);
+        if (minfo->values.reg.mctlwtst != minfo->values.reg.mctlwtst_core) {
+                mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst_core);
         }
         
 }
 
-static void g450_preinit(WPMINFO2) {
+static void g450_preinit(struct matrox_fb_info *minfo)
+{
         u_int32_t c2ctl;
         u_int8_t curctl;
         u_int8_t c1ctl;
         
-        /* ACCESS_FBINFO(hw).MXoptionReg = minfo->values.reg.opt; */
-        ACCESS_FBINFO(hw).MXoptionReg &= 0xC0000100;
-        ACCESS_FBINFO(hw).MXoptionReg |= 0x00000020;
-        if (ACCESS_FBINFO(devflags.novga))
-                ACCESS_FBINFO(hw).MXoptionReg &= ~0x00000100;
-        if (ACCESS_FBINFO(devflags.nobios))
-                ACCESS_FBINFO(hw).MXoptionReg &= ~0x40000000;
-        if (ACCESS_FBINFO(devflags.nopciretry))
-                ACCESS_FBINFO(hw).MXoptionReg |=  0x20000000;
-        ACCESS_FBINFO(hw).MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x03400040;
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+        /* minfo->hw.MXoptionReg = minfo->values.reg.opt; */
+        minfo->hw.MXoptionReg &= 0xC0000100;
+        minfo->hw.MXoptionReg |= 0x00000020;
+        if (minfo->devflags.novga)
+                minfo->hw.MXoptionReg &= ~0x00000100;
+        if (minfo->devflags.nobios)
+                minfo->hw.MXoptionReg &= ~0x40000000;
+        if (minfo->devflags.nopciretry)
+                minfo->hw.MXoptionReg |=  0x20000000;
+        minfo->hw.MXoptionReg |= minfo->values.reg.opt & 0x03400040;
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
 
         /* Init system clocks */
                 
@@ -783,24 +809,24 @@ static void g450_preinit(WPMINFO2) {
         c2ctl = mga_inl(M_C2CTL);
         mga_outl(M_C2CTL, c2ctl & ~1);
         /* stop cursor */
-        curctl = inDAC1064(PMINFO M1064_XCURCTRL);
-        outDAC1064(PMINFO M1064_XCURCTRL, 0);
+        curctl = inDAC1064(minfo, M1064_XCURCTRL);
+        outDAC1064(minfo, M1064_XCURCTRL, 0);
         /* stop crtc1 */
         c1ctl = mga_readr(M_SEQ_INDEX, 1);
         mga_setr(M_SEQ_INDEX, 1, c1ctl | 0x20);
 
-        g450_mclk_init(PMINFO2);
-        g450_memory_init(PMINFO2);
+        g450_mclk_init(minfo);
+        g450_memory_init(minfo);
         
         /* set legacy VGA clock sources for DOSEmu or VMware... */
-        matroxfb_g450_setclk(PMINFO 25175, M_PIXEL_PLL_A);
-        matroxfb_g450_setclk(PMINFO 28322, M_PIXEL_PLL_B);
+        matroxfb_g450_setclk(minfo, 25175, M_PIXEL_PLL_A);
+        matroxfb_g450_setclk(minfo, 28322, M_PIXEL_PLL_B);
 
         /* restore crtc1 */
         mga_setr(M_SEQ_INDEX, 1, c1ctl);
         
         /* restore cursor */
-        outDAC1064(PMINFO M1064_XCURCTRL, curctl);
+        outDAC1064(minfo, M1064_XCURCTRL, curctl);
 
         /* restore crtc2 */
         mga_outl(M_C2CTL, c2ctl);
@@ -808,11 +834,12 @@ static void g450_preinit(WPMINFO2) {
         return;
 }
 
-static int MGAG100_preinit(WPMINFO2) {
+static int MGAG100_preinit(struct matrox_fb_info *minfo)
+{
         static const int vxres_g100[] = {  512,        640, 768,  800,  832,  960,
                                           1024, 1152, 1280,      1600, 1664, 1920,
                                           2048, 0};
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+        struct matrox_hw_state *hw = &minfo->hw;
 
         u_int32_t reg50;
 #if 0
@@ -822,68 +849,68 @@ static int MGAG100_preinit(WPMINFO2) {
         DBG(__func__)
 
         /* there are some instabilities if in_div > 19 && vco < 61000 */
-        if (ACCESS_FBINFO(devflags.g450dac)) {
-                ACCESS_FBINFO(features.pll.vco_freq_min) = 130000;      /* my sample: >118 */
+        if (minfo->devflags.g450dac) {
+                minfo->features.pll.vco_freq_min = 130000;      /* my sample: >118 */
         } else {
-                ACCESS_FBINFO(features.pll.vco_freq_min) = 62000;
+                minfo->features.pll.vco_freq_min = 62000;
         }
-        if (!ACCESS_FBINFO(features.pll.ref_freq)) {
-                ACCESS_FBINFO(features.pll.ref_freq)     = 27000;
+        if (!minfo->features.pll.ref_freq) {
+                minfo->features.pll.ref_freq     = 27000;
         }
-        ACCESS_FBINFO(features.pll.feed_div_min) = 7;
-        ACCESS_FBINFO(features.pll.feed_div_max) = 127;
-        ACCESS_FBINFO(features.pll.in_div_min)   = 1;
-        ACCESS_FBINFO(features.pll.in_div_max)   = 31;
-        ACCESS_FBINFO(features.pll.post_shift_max) = 3;
-        ACCESS_FBINFO(features.DAC1064.xvrefctrl) = DAC1064_XVREFCTRL_G100_DEFAULT;
-        /* ACCESS_FBINFO(capable.cfb4) = 0; ... preinitialized by 0 */
-        ACCESS_FBINFO(capable.text) = 1;
-        ACCESS_FBINFO(capable.vxres) = vxres_g100;
-        ACCESS_FBINFO(capable.plnwt) = ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG100
-                        ? ACCESS_FBINFO(devflags.sgram) : 1;
+        minfo->features.pll.feed_div_min = 7;
+        minfo->features.pll.feed_div_max = 127;
+        minfo->features.pll.in_div_min   = 1;
+        minfo->features.pll.in_div_max   = 31;
+        minfo->features.pll.post_shift_max = 3;
+        minfo->features.DAC1064.xvrefctrl = DAC1064_XVREFCTRL_G100_DEFAULT;
+        /* minfo->capable.cfb4 = 0; ... preinitialized by 0 */
+        minfo->capable.text = 1;
+        minfo->capable.vxres = vxres_g100;
+        minfo->capable.plnwt = minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG100
+                        ? minfo->devflags.sgram : 1;
 
 #ifdef CONFIG_FB_MATROX_G
-        if (ACCESS_FBINFO(devflags.g450dac)) {
-                ACCESS_FBINFO(outputs[0]).output = &g450out;
+        if (minfo->devflags.g450dac) {
+                minfo->outputs[0].output = &g450out;
         } else
 #endif
         {
-                ACCESS_FBINFO(outputs[0]).output = &m1064;
+                minfo->outputs[0].output = &m1064;
         }
-        ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
-        ACCESS_FBINFO(outputs[0]).data = MINFO;
-        ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+        minfo->outputs[0].src = minfo->outputs[0].default_src;
+        minfo->outputs[0].data = minfo;
+        minfo->outputs[0].mode = MATROXFB_OUTPUT_MODE_MONITOR;
 
-        if (ACCESS_FBINFO(devflags.g450dac)) {
+        if (minfo->devflags.g450dac) {
                 /* we must do this always, BIOS does not do it for us
                    and accelerator dies without it */
                 mga_outl(0x1C0C, 0);
         }
-        if (ACCESS_FBINFO(devflags.noinit))
+        if (minfo->devflags.noinit)
                 return 0;
-        if (ACCESS_FBINFO(devflags.g450dac)) {
-                g450_preinit(PMINFO2);
+        if (minfo->devflags.g450dac) {
+                g450_preinit(minfo);
                 return 0;
         }
         hw->MXoptionReg &= 0xC0000100;
         hw->MXoptionReg |= 0x00000020;
-        if (ACCESS_FBINFO(devflags.novga))
+        if (minfo->devflags.novga)
                 hw->MXoptionReg &= ~0x00000100;
-        if (ACCESS_FBINFO(devflags.nobios))
+        if (minfo->devflags.nobios)
                 hw->MXoptionReg &= ~0x40000000;
-        if (ACCESS_FBINFO(devflags.nopciretry))
+        if (minfo->devflags.nopciretry)
                 hw->MXoptionReg |=  0x20000000;
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
-        DAC1064_setmclk(PMINFO DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PCI, 133333);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
+        DAC1064_setmclk(minfo, DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PCI, 133333);
 
-        if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG100) {
-                pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, &reg50);
+        if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG100) {
+                pci_read_config_dword(minfo->pcidev, PCI_OPTION2_REG, &reg50);
                 reg50 &= ~0x3000;
-                pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+                pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, reg50);
 
                 hw->MXoptionReg |= 0x1080;
-                pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
-                mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
+                pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
+                mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst);
                 udelay(100);
                 mga_outb(0x1C05, 0x00);
                 mga_outb(0x1C05, 0x80);
@@ -893,68 +920,69 @@ static int MGAG100_preinit(WPMINFO2) {
                 udelay(100);
                 reg50 &= ~0xFF;
                 reg50 |=  0x07;
-                pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+                pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, reg50);
                 /* it should help with G100 */
                 mga_outb(M_GRAPHICS_INDEX, 6);
                 mga_outb(M_GRAPHICS_DATA, (mga_inb(M_GRAPHICS_DATA) & 3) | 4);
                 mga_setr(M_EXTVGA_INDEX, 0x03, 0x81);
                 mga_setr(M_EXTVGA_INDEX, 0x04, 0x00);
-                mga_writeb(ACCESS_FBINFO(video.vbase), 0x0000, 0xAA);
-                mga_writeb(ACCESS_FBINFO(video.vbase), 0x0800, 0x55);
-                mga_writeb(ACCESS_FBINFO(video.vbase), 0x4000, 0x55);
+                mga_writeb(minfo->video.vbase, 0x0000, 0xAA);
+                mga_writeb(minfo->video.vbase, 0x0800, 0x55);
+                mga_writeb(minfo->video.vbase, 0x4000, 0x55);
 #if 0
-                if (mga_readb(ACCESS_FBINFO(video.vbase), 0x0000) != 0xAA) {
+                if (mga_readb(minfo->video.vbase, 0x0000) != 0xAA) {
                         hw->MXoptionReg &= ~0x1000;
                 }
 #endif
                 hw->MXoptionReg |= 0x00078020;
-        } else if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG200) {
-                pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, &reg50);
+        } else if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG200) {
+                pci_read_config_dword(minfo->pcidev, PCI_OPTION2_REG, &reg50);
                 reg50 &= ~0x3000;
-                pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+                pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, reg50);
 
-                if (ACCESS_FBINFO(devflags.memtype) == -1)
-                        hw->MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x1C00;
+                if (minfo->devflags.memtype == -1)
+                        hw->MXoptionReg |= minfo->values.reg.opt & 0x1C00;
                 else
-                        hw->MXoptionReg |= (ACCESS_FBINFO(devflags.memtype) & 7) << 10;
-                if (ACCESS_FBINFO(devflags.sgram))
+                        hw->MXoptionReg |= (minfo->devflags.memtype & 7) << 10;
+                if (minfo->devflags.sgram)
                         hw->MXoptionReg |= 0x4000;
-                mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
-                mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+                mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst);
+                mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk);
                 udelay(200);
                 mga_outl(M_MACCESS, 0x00000000);
                 mga_outl(M_MACCESS, 0x00008000);
                 udelay(100);
-                mga_outw(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+                mga_outw(M_MEMRDBK, minfo->values.reg.memrdbk);
                 hw->MXoptionReg |= 0x00078020;
         } else {
-                pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, &reg50);
+                pci_read_config_dword(minfo->pcidev, PCI_OPTION2_REG, &reg50);
                 reg50 &= ~0x00000100;
                 reg50 |=  0x00000000;
-                pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+                pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, reg50);
 
-                if (ACCESS_FBINFO(devflags.memtype) == -1)
-                        hw->MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x1C00;
+                if (minfo->devflags.memtype == -1)
+                        hw->MXoptionReg |= minfo->values.reg.opt & 0x1C00;
                 else
-                        hw->MXoptionReg |= (ACCESS_FBINFO(devflags.memtype) & 7) << 10;
-                if (ACCESS_FBINFO(devflags.sgram))
+                        hw->MXoptionReg |= (minfo->devflags.memtype & 7) << 10;
+                if (minfo->devflags.sgram)
                         hw->MXoptionReg |= 0x4000;
-                mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
-                mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+                mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst);
+                mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk);
                 udelay(200);
                 mga_outl(M_MACCESS, 0x00000000);
                 mga_outl(M_MACCESS, 0x00008000);
                 udelay(100);
-                mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+                mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk);
                 hw->MXoptionReg |= 0x00040020;
         }
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
         return 0;
 }
 
-static void MGAG100_reset(WPMINFO2) {
+static void MGAG100_reset(struct matrox_fb_info *minfo)
+{
         u_int8_t b;
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+        struct matrox_hw_state *hw = &minfo->hw;
 
         DBG(__func__)
 
@@ -964,54 +992,55 @@ static void MGAG100_reset(WPMINFO2) {
 
                 find 1014/22 (IBM/82351); /* if found and bridging Matrox, do some strange stuff */
                 pci_read_config_byte(ibm, PCI_SECONDARY_BUS, &b);
-                if (b == ACCESS_FBINFO(pcidev)->bus->number) {
+                if (b == minfo->pcidev->bus->number) {
                         pci_write_config_byte(ibm, PCI_COMMAND+1, 0);   /* disable back-to-back & SERR */
                         pci_write_config_byte(ibm, 0x41, 0xF4);         /* ??? */
                         pci_write_config_byte(ibm, PCI_IO_BASE, 0xF0);  /* ??? */
                         pci_write_config_byte(ibm, PCI_IO_LIMIT, 0x00); /* ??? */
                 }
 #endif
-                if (!ACCESS_FBINFO(devflags.noinit)) {
+                if (!minfo->devflags.noinit) {
                         if (x7AF4 & 8) {
                                 hw->MXoptionReg |= 0x40;        /* FIXME... */
-                                pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+                                pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
                         }
                         mga_setr(M_EXTVGA_INDEX, 0x06, 0x00);
                 }
         }
-        if (ACCESS_FBINFO(devflags.g450dac)) {
+        if (minfo->devflags.g450dac) {
                 /* either leave MCLK as is... or they were set in preinit */
-                hw->DACclk[3] = inDAC1064(PMINFO DAC1064_XSYSPLLM);
-                hw->DACclk[4] = inDAC1064(PMINFO DAC1064_XSYSPLLN);
-                hw->DACclk[5] = inDAC1064(PMINFO DAC1064_XSYSPLLP);
+                hw->DACclk[3] = inDAC1064(minfo, DAC1064_XSYSPLLM);
+                hw->DACclk[4] = inDAC1064(minfo, DAC1064_XSYSPLLN);
+                hw->DACclk[5] = inDAC1064(minfo, DAC1064_XSYSPLLP);
         } else {
-                DAC1064_setmclk(PMINFO DAC1064_OPT_RESERVED | DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV1 | DAC1064_OPT_SCLK_PLL, 133333);
+                DAC1064_setmclk(minfo, DAC1064_OPT_RESERVED | DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV1 | DAC1064_OPT_SCLK_PLL, 133333);
         }
-        if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400) {
-                if (ACCESS_FBINFO(devflags.dfp_type) == -1) {
-                        ACCESS_FBINFO(devflags.dfp_type) = inDAC1064(PMINFO 0x1F);
+        if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400) {
+                if (minfo->devflags.dfp_type == -1) {
+                        minfo->devflags.dfp_type = inDAC1064(minfo, 0x1F);
                 }
         }
-        if (ACCESS_FBINFO(devflags.noinit))
+        if (minfo->devflags.noinit)
                 return;
-        if (ACCESS_FBINFO(devflags.g450dac)) {
+        if (minfo->devflags.g450dac) {
         } else {
-                MGAG100_setPixClock(PMINFO 4, 25175);
-                MGAG100_setPixClock(PMINFO 5, 28322);
+                MGAG100_setPixClock(minfo, 4, 25175);
+                MGAG100_setPixClock(minfo, 5, 28322);
                 if (x7AF4 & 0x10) {
-                        b = inDAC1064(PMINFO M1064_XGENIODATA) & ~1;
-                        outDAC1064(PMINFO M1064_XGENIODATA, b);
-                        b = inDAC1064(PMINFO M1064_XGENIOCTRL) | 1;
-                        outDAC1064(PMINFO M1064_XGENIOCTRL, b);
+                        b = inDAC1064(minfo, M1064_XGENIODATA) & ~1;
+                        outDAC1064(minfo, M1064_XGENIODATA, b);
+                        b = inDAC1064(minfo, M1064_XGENIOCTRL) | 1;
+                        outDAC1064(minfo, M1064_XGENIOCTRL, b);
                 }
         }
 }
 #endif
 
 #ifdef CONFIG_FB_MATROX_MYSTIQUE
-static void MGA1064_restore(WPMINFO2) {
+static void MGA1064_restore(struct matrox_fb_info *minfo)
+{
         int i;
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+        struct matrox_hw_state *hw = &minfo->hw;
 
         CRITFLAGS
 
@@ -1019,25 +1048,26 @@ static void MGA1064_restore(WPMINFO2) {
 
         CRITBEGIN
 
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
         mga_outb(M_IEN, 0x00);
         mga_outb(M_CACHEFLUSH, 0x00);
 
         CRITEND
 
-        DAC1064_restore_1(PMINFO2);
-        matroxfb_vgaHWrestore(PMINFO2);
-        ACCESS_FBINFO(crtc1.panpos) = -1;
+        DAC1064_restore_1(minfo);
+        matroxfb_vgaHWrestore(minfo);
+        minfo->crtc1.panpos = -1;
         for (i = 0; i < 6; i++)
                 mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
-        DAC1064_restore_2(PMINFO2);
+        DAC1064_restore_2(minfo);
 }
 #endif
 
 #ifdef CONFIG_FB_MATROX_G
-static void MGAG100_restore(WPMINFO2) {
+static void MGAG100_restore(struct matrox_fb_info *minfo)
+{
         int i;
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+        struct matrox_hw_state *hw = &minfo->hw;
 
         CRITFLAGS
 
@@ -1045,19 +1075,17 @@ static void MGAG100_restore(WPMINFO2) {
 
         CRITBEGIN
 
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
         CRITEND
 
-        DAC1064_restore_1(PMINFO2);
-        matroxfb_vgaHWrestore(PMINFO2);
-#ifdef CONFIG_FB_MATROX_32MB
-        if (ACCESS_FBINFO(devflags.support32MB))
+        DAC1064_restore_1(minfo);
+        matroxfb_vgaHWrestore(minfo);
+        if (minfo->devflags.support32MB)
                 mga_setr(M_EXTVGA_INDEX, 8, hw->CRTCEXT[8]);
-#endif
-        ACCESS_FBINFO(crtc1.panpos) = -1;
+        minfo->crtc1.panpos = -1;
         for (i = 0; i < 6; i++)
                 mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
-        DAC1064_restore_2(PMINFO2);
+        DAC1064_restore_2(minfo);
 }
 #endif
 
diff --git a/drivers/video/matrox/matroxfb_DAC1064.h b/drivers/video/matrox/matroxfb_DAC1064.h
index 7a98ce8043d7..c6ed7801efe2 100644
--- a/drivers/video/matrox/matroxfb_DAC1064.h
+++ b/drivers/video/matrox/matroxfb_DAC1064.h
@@ -11,8 +11,8 @@ extern struct matrox_switch matrox_mystique;
 extern struct matrox_switch matrox_G100;
 #endif
 #ifdef NEED_DAC1064
-void DAC1064_global_init(WPMINFO2);
-void DAC1064_global_restore(WPMINFO2);
+void DAC1064_global_init(struct matrox_fb_info *minfo);
+void DAC1064_global_restore(struct matrox_fb_info *minfo);
 #endif
 
 #define M1064_INDEX     0x00
diff --git a/drivers/video/matrox/matroxfb_Ti3026.c b/drivers/video/matrox/matroxfb_Ti3026.c
index 4e825112a601..835aaaae6b96 100644
--- a/drivers/video/matrox/matroxfb_Ti3026.c
+++ b/drivers/video/matrox/matroxfb_Ti3026.c
@@ -279,27 +279,31 @@ static const unsigned char MGADACbpp32[] =
   TVP3026_XCOLKEYCTRL_ZOOM1,
   0x00, 0x00, TVP3026_XCURCTRL_DIS };
 
-static int Ti3026_calcclock(CPMINFO unsigned int freq, unsigned int fmax, int* in, int* feed, int* post) {
+static int Ti3026_calcclock(const struct matrox_fb_info *minfo,
+                            unsigned int freq, unsigned int fmax, int *in,
+                            int *feed, int *post)
+{
         unsigned int fvco;
         unsigned int lin, lfeed, lpost;
 
         DBG(__func__)
 
-        fvco = PLL_calcclock(PMINFO freq, fmax, &lin, &lfeed, &lpost);
+        fvco = PLL_calcclock(minfo, freq, fmax, &lin, &lfeed, &lpost);
         fvco >>= (*post = lpost);
         *in = 64 - lin;
         *feed = 64 - lfeed;
         return fvco;
 }
 
-static int Ti3026_setpclk(WPMINFO int clk) {
+static int Ti3026_setpclk(struct matrox_fb_info *minfo, int clk)
+{
         unsigned int f_pll;
         unsigned int pixfeed, pixin, pixpost;
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+        struct matrox_hw_state *hw = &minfo->hw;
 
         DBG(__func__)
 
-        f_pll = Ti3026_calcclock(PMINFO clk, ACCESS_FBINFO(max_pixel_clock), &pixin, &pixfeed, &pixpost);
+        f_pll = Ti3026_calcclock(minfo, clk, minfo->max_pixel_clock, &pixin, &pixfeed, &pixpost);
 
         hw->DACclk[0] = pixin | 0xC0;
         hw->DACclk[1] = pixfeed;
@@ -309,9 +313,9 @@ static int Ti3026_setpclk(WPMINFO int clk) {
                 unsigned int loopfeed, loopin, looppost, loopdiv, z;
                 unsigned int Bpp;
 
-                Bpp = ACCESS_FBINFO(curr.final_bppShift);
+                Bpp = minfo->curr.final_bppShift;
 
-                if (ACCESS_FBINFO(fbcon).var.bits_per_pixel == 24) {
+                if (minfo->fbcon.var.bits_per_pixel == 24) {
                         loopfeed = 3;           /* set lm to any possible value */
                         loopin = 3 * 32 / Bpp;
                 } else {
@@ -330,18 +334,18 @@ static int Ti3026_setpclk(WPMINFO int clk) {
                         looppost = 3;
                         loopdiv = z/16;
                 }
-                if (ACCESS_FBINFO(fbcon).var.bits_per_pixel == 24) {
+                if (minfo->fbcon.var.bits_per_pixel == 24) {
                         hw->DACclk[3] = ((65 - loopin) & 0x3F) | 0xC0;
                         hw->DACclk[4] = (65 - loopfeed) | 0x80;
-                        if (ACCESS_FBINFO(accel.ramdac_rev) > 0x20) {
-                                if (isInterleave(MINFO))
+                        if (minfo->accel.ramdac_rev > 0x20) {
+                                if (isInterleave(minfo))
                                         hw->DACreg[POS3026_XLATCHCTRL] = TVP3026B_XLATCHCTRL_8_3;
                                 else {
                                         hw->DACclk[4] &= ~0xC0;
                                         hw->DACreg[POS3026_XLATCHCTRL] = TVP3026B_XLATCHCTRL_4_3;
                                 }
                         } else {
-                                if (isInterleave(MINFO))
+                                if (isInterleave(minfo))
                                         ;       /* default... */
                                 else {
                                         hw->DACclk[4] ^= 0xC0;  /* change from 0x80 to 0x40 */
@@ -349,7 +353,7 @@ static int Ti3026_setpclk(WPMINFO int clk) {
                                 }
                         }
                         hw->DACclk[5] = looppost | 0xF8;
-                        if (ACCESS_FBINFO(devflags.mga_24bpp_fix))
+                        if (minfo->devflags.mga_24bpp_fix)
                                 hw->DACclk[5] ^= 0x40;
                 } else {
                         hw->DACclk[3] = ((65 - loopin) & 0x3F) | 0xC0;
@@ -361,14 +365,15 @@ static int Ti3026_setpclk(WPMINFO int clk) {
         return 0;
 }
 
-static int Ti3026_init(WPMINFO struct my_timming* m) {
-        u_int8_t muxctrl = isInterleave(MINFO) ? TVP3026_XMUXCTRL_MEMORY_64BIT : TVP3026_XMUXCTRL_MEMORY_32BIT;
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int Ti3026_init(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+        u_int8_t muxctrl = isInterleave(minfo) ? TVP3026_XMUXCTRL_MEMORY_64BIT : TVP3026_XMUXCTRL_MEMORY_32BIT;
+        struct matrox_hw_state *hw = &minfo->hw;
 
         DBG(__func__)
 
         memcpy(hw->DACreg, MGADACbpp32, sizeof(hw->DACreg));
-        switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+        switch (minfo->fbcon.var.bits_per_pixel) {
                 case 4: hw->DACreg[POS3026_XLATCHCTRL] = TVP3026_XLATCHCTRL_16_1;       /* or _8_1, they are same */
                         hw->DACreg[POS3026_XTRUECOLORCTRL] = TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR;
                         hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_4BIT;
@@ -383,7 +388,7 @@ static int Ti3026_init(WPMINFO struct my_timming* m) {
                         break;
                 case 16:
                         /* XLATCHCTRL should be _4_1 / _2_1... Why is not? (_2_1 is used everytime) */
-                        hw->DACreg[POS3026_XTRUECOLORCTRL] = (ACCESS_FBINFO(fbcon).var.green.length == 5)? (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_ORGB_1555 ) : (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_RGB_565);
+                        hw->DACreg[POS3026_XTRUECOLORCTRL] = (minfo->fbcon.var.green.length == 5) ? (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_ORGB_1555) : (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_RGB_565);
                         hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_16BIT;
                         hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV2;
                         break;
@@ -400,7 +405,7 @@ static int Ti3026_init(WPMINFO struct my_timming* m) {
                 default:
                         return 1;       /* TODO: failed */
         }
-        if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+        if (matroxfb_vgaHWinit(minfo, m)) return 1;
 
         /* set SYNC */
         hw->MiscOutReg = 0xCB;
@@ -412,9 +417,9 @@ static int Ti3026_init(WPMINFO struct my_timming* m) {
                 hw->DACreg[POS3026_XGENCTRL] |= TVP3026_XGENCTRL_SYNC_ON_GREEN;
 
         /* set DELAY */
-        if (ACCESS_FBINFO(video.len) < 0x400000)
+        if (minfo->video.len < 0x400000)
                 hw->CRTCEXT[3] |= 0x08;
-        else if (ACCESS_FBINFO(video.len) > 0x400000)
+        else if (minfo->video.len > 0x400000)
                 hw->CRTCEXT[3] |= 0x10;
 
         /* set HWCURSOR */
@@ -426,14 +431,15 @@ static int Ti3026_init(WPMINFO struct my_timming* m) {
 
         /* set interleaving */
         hw->MXoptionReg &= ~0x00001000;
-        if (isInterleave(MINFO)) hw->MXoptionReg |= 0x00001000;
+        if (isInterleave(minfo)) hw->MXoptionReg |= 0x00001000;
 
         /* set DAC */
-        Ti3026_setpclk(PMINFO m->pixclock);
+        Ti3026_setpclk(minfo, m->pixclock);
         return 0;
 }
 
-static void ti3026_setMCLK(WPMINFO int fout){
+static void ti3026_setMCLK(struct matrox_fb_info *minfo, int fout)
+{
         unsigned int f_pll;
         unsigned int pclk_m, pclk_n, pclk_p;
         unsigned int mclk_m, mclk_n, mclk_p;
@@ -442,29 +448,29 @@ static void ti3026_setMCLK(WPMINFO int fout){
 
         DBG(__func__)
 
-        f_pll = Ti3026_calcclock(PMINFO fout, ACCESS_FBINFO(max_pixel_clock), &mclk_n, &mclk_m, &mclk_p);
+        f_pll = Ti3026_calcclock(minfo, fout, minfo->max_pixel_clock, &mclk_n, &mclk_m, &mclk_p);
 
         /* save pclk */
-        outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
-        pclk_n = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
-        outTi3026(PMINFO TVP3026_XPLLADDR, 0xFD);
-        pclk_m = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
-        outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
-        pclk_p = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+        outTi3026(minfo, TVP3026_XPLLADDR, 0xFC);
+        pclk_n = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+        outTi3026(minfo, TVP3026_XPLLADDR, 0xFD);
+        pclk_m = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+        outTi3026(minfo, TVP3026_XPLLADDR, 0xFE);
+        pclk_p = inTi3026(minfo, TVP3026_XPIXPLLDATA);
 
         /* stop pclk */
-        outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
-        outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+        outTi3026(minfo, TVP3026_XPLLADDR, 0xFE);
+        outTi3026(minfo, TVP3026_XPIXPLLDATA, 0x00);
 
         /* set pclk to new mclk */
-        outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
-        outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_n | 0xC0);
-        outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_m);
-        outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_p | 0xB0);
+        outTi3026(minfo, TVP3026_XPLLADDR, 0xFC);
+        outTi3026(minfo, TVP3026_XPIXPLLDATA, mclk_n | 0xC0);
+        outTi3026(minfo, TVP3026_XPIXPLLDATA, mclk_m);
+        outTi3026(minfo, TVP3026_XPIXPLLDATA, mclk_p | 0xB0);
 
         /* wait for PLL to lock */
         for (tmout = 500000; tmout; tmout--) {
-                if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+                if (inTi3026(minfo, TVP3026_XPIXPLLDATA) & 0x40)
                         break;
                 udelay(10);
         };
@@ -472,23 +478,23 @@ static void ti3026_setMCLK(WPMINFO int fout){
                 printk(KERN_ERR "matroxfb: Temporary pixel PLL not locked after 5 secs\n");
 
         /* output pclk on mclk pin */
-        mclk_ctl = inTi3026(PMINFO TVP3026_XMEMPLLCTRL);
-        outTi3026(PMINFO TVP3026_XMEMPLLCTRL, mclk_ctl & 0xE7);
-        outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_STROBEMKC4);
+        mclk_ctl = inTi3026(minfo, TVP3026_XMEMPLLCTRL);
+        outTi3026(minfo, TVP3026_XMEMPLLCTRL, mclk_ctl & 0xE7);
+        outTi3026(minfo, TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_STROBEMKC4);
 
         /* stop MCLK */
-        outTi3026(PMINFO TVP3026_XPLLADDR, 0xFB);
-        outTi3026(PMINFO TVP3026_XMEMPLLDATA, 0x00);
+        outTi3026(minfo, TVP3026_XPLLADDR, 0xFB);
+        outTi3026(minfo, TVP3026_XMEMPLLDATA, 0x00);
 
         /* set mclk to new freq */
-        outTi3026(PMINFO TVP3026_XPLLADDR, 0xF3);
-        outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_n | 0xC0);
-        outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_m);
-        outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_p | 0xB0);
+        outTi3026(minfo, TVP3026_XPLLADDR, 0xF3);
+        outTi3026(minfo, TVP3026_XMEMPLLDATA, mclk_n | 0xC0);
+        outTi3026(minfo, TVP3026_XMEMPLLDATA, mclk_m);
+        outTi3026(minfo, TVP3026_XMEMPLLDATA, mclk_p | 0xB0);
 
         /* wait for PLL to lock */
         for (tmout = 500000; tmout; tmout--) {
-                if (inTi3026(PMINFO TVP3026_XMEMPLLDATA) & 0x40)
+                if (inTi3026(minfo, TVP3026_XMEMPLLDATA) & 0x40)
                         break;
                 udelay(10);
         }
@@ -496,7 +502,7 @@ static void ti3026_setMCLK(WPMINFO int fout){
                 printk(KERN_ERR "matroxfb: Memory PLL not locked after 5 secs\n");
 
         f_pll = f_pll * 333 / (10000 << mclk_p);
-        if (isMilleniumII(MINFO)) {
+        if (isMilleniumII(minfo)) {
                 rfhcnt = (f_pll - 128) / 256;
                 if (rfhcnt > 15)
                         rfhcnt = 15;
@@ -505,26 +511,26 @@ static void ti3026_setMCLK(WPMINFO int fout){
                 if (rfhcnt > 15)
                         rfhcnt = 0;
         }
-        ACCESS_FBINFO(hw).MXoptionReg = (ACCESS_FBINFO(hw).MXoptionReg & ~0x000F0000) | (rfhcnt << 16);
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+        minfo->hw.MXoptionReg = (minfo->hw.MXoptionReg & ~0x000F0000) | (rfhcnt << 16);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
 
         /* output MCLK to MCLK pin */
-        outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
-        outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl       ) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL | TVP3026_XMEMPLLCTRL_STROBEMKC4);
+        outTi3026(minfo, TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
+        outTi3026(minfo, TVP3026_XMEMPLLCTRL, (mclk_ctl       ) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL | TVP3026_XMEMPLLCTRL_STROBEMKC4);
 
         /* stop PCLK */
-        outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
-        outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+        outTi3026(minfo, TVP3026_XPLLADDR, 0xFE);
+        outTi3026(minfo, TVP3026_XPIXPLLDATA, 0x00);
 
         /* restore pclk */
-        outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
-        outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_n);
-        outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_m);
-        outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_p);
+        outTi3026(minfo, TVP3026_XPLLADDR, 0xFC);
+        outTi3026(minfo, TVP3026_XPIXPLLDATA, pclk_n);
+        outTi3026(minfo, TVP3026_XPIXPLLDATA, pclk_m);
+        outTi3026(minfo, TVP3026_XPIXPLLDATA, pclk_p);
 
         /* wait for PLL to lock */
         for (tmout = 500000; tmout; tmout--) {
-                if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+                if (inTi3026(minfo, TVP3026_XPIXPLLDATA) & 0x40)
                         break;
                 udelay(10);
         }
@@ -532,26 +538,27 @@ static void ti3026_setMCLK(WPMINFO int fout){
                 printk(KERN_ERR "matroxfb: Pixel PLL not locked after 5 secs\n");
 }
 
-static void ti3026_ramdac_init(WPMINFO2) {
-
+static void ti3026_ramdac_init(struct matrox_fb_info *minfo)
+{
         DBG(__func__)
 
-        ACCESS_FBINFO(features.pll.vco_freq_min) = 110000;
-        ACCESS_FBINFO(features.pll.ref_freq)     = 114545;
-        ACCESS_FBINFO(features.pll.feed_div_min) = 2;
-        ACCESS_FBINFO(features.pll.feed_div_max) = 24;
-        ACCESS_FBINFO(features.pll.in_div_min)   = 2;
-        ACCESS_FBINFO(features.pll.in_div_max)   = 63;
-        ACCESS_FBINFO(features.pll.post_shift_max) = 3;
-        if (ACCESS_FBINFO(devflags.noinit))
+        minfo->features.pll.vco_freq_min = 110000;
+        minfo->features.pll.ref_freq     = 114545;
+        minfo->features.pll.feed_div_min = 2;
+        minfo->features.pll.feed_div_max = 24;
+        minfo->features.pll.in_div_min   = 2;
+        minfo->features.pll.in_div_max   = 63;
+        minfo->features.pll.post_shift_max = 3;
+        if (minfo->devflags.noinit)
                 return;
-        ti3026_setMCLK(PMINFO 60000);
+        ti3026_setMCLK(minfo, 60000);
 }
 
-static void Ti3026_restore(WPMINFO2) {
+static void Ti3026_restore(struct matrox_fb_info *minfo)
+{
         int i;
         unsigned char progdac[6];
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+        struct matrox_hw_state *hw = &minfo->hw;
         CRITFLAGS
 
         DBG(__func__)
@@ -565,31 +572,31 @@ static void Ti3026_restore(WPMINFO2) {
 
         CRITBEGIN
 
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
 
         CRITEND
 
-        matroxfb_vgaHWrestore(PMINFO2);
+        matroxfb_vgaHWrestore(minfo);
 
         CRITBEGIN
 
-        ACCESS_FBINFO(crtc1.panpos) = -1;
+        minfo->crtc1.panpos = -1;
         for (i = 0; i < 6; i++)
                 mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
 
         for (i = 0; i < 21; i++) {
-                outTi3026(PMINFO DACseq[i], hw->DACreg[i]);
+                outTi3026(minfo, DACseq[i], hw->DACreg[i]);
         }
 
-        outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
-        progdac[0] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
-        progdac[3] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
-        outTi3026(PMINFO TVP3026_XPLLADDR, 0x15);
-        progdac[1] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
-        progdac[4] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
-        outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
-        progdac[2] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
-        progdac[5] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
+        outTi3026(minfo, TVP3026_XPLLADDR, 0x00);
+        progdac[0] = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+        progdac[3] = inTi3026(minfo, TVP3026_XLOOPPLLDATA);
+        outTi3026(minfo, TVP3026_XPLLADDR, 0x15);
+        progdac[1] = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+        progdac[4] = inTi3026(minfo, TVP3026_XLOOPPLLDATA);
+        outTi3026(minfo, TVP3026_XPLLADDR, 0x2A);
+        progdac[2] = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+        progdac[5] = inTi3026(minfo, TVP3026_XLOOPPLLDATA);
 
         CRITEND
         if (memcmp(hw->DACclk, progdac, 6)) {
@@ -598,20 +605,20 @@ static void Ti3026_restore(WPMINFO2) {
                 /* Maybe even we should call schedule() ? */
 
                 CRITBEGIN
-                outTi3026(PMINFO TVP3026_XCLKCTRL, hw->DACreg[POS3026_XCLKCTRL]);
-                outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
-                outTi3026(PMINFO TVP3026_XLOOPPLLDATA, 0);
-                outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0);
+                outTi3026(minfo, TVP3026_XCLKCTRL, hw->DACreg[POS3026_XCLKCTRL]);
+                outTi3026(minfo, TVP3026_XPLLADDR, 0x2A);
+                outTi3026(minfo, TVP3026_XLOOPPLLDATA, 0);
+                outTi3026(minfo, TVP3026_XPIXPLLDATA, 0);
 
-                outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
+                outTi3026(minfo, TVP3026_XPLLADDR, 0x00);
                 for (i = 0; i < 3; i++)
-                        outTi3026(PMINFO TVP3026_XPIXPLLDATA, hw->DACclk[i]);
+                        outTi3026(minfo, TVP3026_XPIXPLLDATA, hw->DACclk[i]);
                 /* wait for PLL only if PLL clock requested (always for PowerMode, never for VGA) */
                 if (hw->MiscOutReg & 0x08) {
                         int tmout;
-                        outTi3026(PMINFO TVP3026_XPLLADDR, 0x3F);
+                        outTi3026(minfo, TVP3026_XPLLADDR, 0x3F);
                         for (tmout = 500000; tmout; --tmout) {
-                                if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+                                if (inTi3026(minfo, TVP3026_XPIXPLLDATA) & 0x40)
                                         break;
                                 udelay(10);
                         }
@@ -624,18 +631,18 @@ static void Ti3026_restore(WPMINFO2) {
                                 dprintk(KERN_INFO "PixelPLL: %d\n", 500000-tmout);
                         CRITBEGIN
                 }
-                outTi3026(PMINFO TVP3026_XMEMPLLCTRL, hw->DACreg[POS3026_XMEMPLLCTRL]);
-                outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
+                outTi3026(minfo, TVP3026_XMEMPLLCTRL, hw->DACreg[POS3026_XMEMPLLCTRL]);
+                outTi3026(minfo, TVP3026_XPLLADDR, 0x00);
                 for (i = 3; i < 6; i++)
-                        outTi3026(PMINFO TVP3026_XLOOPPLLDATA, hw->DACclk[i]);
+                        outTi3026(minfo, TVP3026_XLOOPPLLDATA, hw->DACclk[i]);
                 CRITEND
                 if ((hw->MiscOutReg & 0x08) && ((hw->DACclk[5] & 0x80) == 0x80)) {
                         int tmout;
 
                         CRITBEGIN
-                        outTi3026(PMINFO TVP3026_XPLLADDR, 0x3F);
+                        outTi3026(minfo, TVP3026_XPLLADDR, 0x3F);
                         for (tmout = 500000; tmout; --tmout) {
-                                if (inTi3026(PMINFO TVP3026_XLOOPPLLDATA) & 0x40)
+                                if (inTi3026(minfo, TVP3026_XLOOPPLLDATA) & 0x40)
                                         break;
                                 udelay(10);
                         }
@@ -660,65 +667,66 @@ static void Ti3026_restore(WPMINFO2) {
 #endif
 }
 
-static void Ti3026_reset(WPMINFO2) {
-
+static void Ti3026_reset(struct matrox_fb_info *minfo)
+{
         DBG(__func__)
 
-        ti3026_ramdac_init(PMINFO2);
+        ti3026_ramdac_init(minfo);
 }
 
 static struct matrox_altout ti3026_output = {
         .name    = "Primary output",
 };
 
-static int Ti3026_preinit(WPMINFO2) {
+static int Ti3026_preinit(struct matrox_fb_info *minfo)
+{
         static const int vxres_mill2[] = { 512,        640, 768,  800,  832,  960,
                                           1024, 1152, 1280,      1600, 1664, 1920,
                                           2048, 0};
         static const int vxres_mill1[] = {             640, 768,  800,        960,
                                           1024, 1152, 1280,      1600,       1920,
                                           2048, 0};
-        struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+        struct matrox_hw_state *hw = &minfo->hw;
 
         DBG(__func__)
 
-        ACCESS_FBINFO(millenium) = 1;
-        ACCESS_FBINFO(milleniumII) = (ACCESS_FBINFO(pcidev)->device != PCI_DEVICE_ID_MATROX_MIL);
-        ACCESS_FBINFO(capable.cfb4) = 1;
-        ACCESS_FBINFO(capable.text) = 1; /* isMilleniumII(MINFO); */
-        ACCESS_FBINFO(capable.vxres) = isMilleniumII(MINFO)?vxres_mill2:vxres_mill1;
+        minfo->millenium = 1;
+        minfo->milleniumII = (minfo->pcidev->device != PCI_DEVICE_ID_MATROX_MIL);
+        minfo->capable.cfb4 = 1;
+        minfo->capable.text = 1; /* isMilleniumII(minfo); */
+        minfo->capable.vxres = isMilleniumII(minfo) ? vxres_mill2 : vxres_mill1;
 
-        ACCESS_FBINFO(outputs[0]).data = MINFO;
-        ACCESS_FBINFO(outputs[0]).output = &ti3026_output;
-        ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
-        ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+        minfo->outputs[0].data = minfo;
+        minfo->outputs[0].output = &ti3026_output;
+        minfo->outputs[0].src = minfo->outputs[0].default_src;
+        minfo->outputs[0].mode = MATROXFB_OUTPUT_MODE_MONITOR;
 
-        if (ACCESS_FBINFO(devflags.noinit))
+        if (minfo->devflags.noinit)
                 return 0;
         /* preserve VGA I/O, BIOS and PPC */
         hw->MXoptionReg &= 0xC0000100;
         hw->MXoptionReg |= 0x002C0000;
-        if (ACCESS_FBINFO(devflags.novga))
+        if (minfo->devflags.novga)
                 hw->MXoptionReg &= ~0x00000100;
-        if (ACCESS_FBINFO(devflags.nobios))
+        if (minfo->devflags.nobios)
                 hw->MXoptionReg &= ~0x40000000;
-        if (ACCESS_FBINFO(devflags.nopciretry))
+        if (minfo->devflags.nopciretry)
                 hw->MXoptionReg |=  0x20000000;
-        pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+        pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
 
-        ACCESS_FBINFO(accel.ramdac_rev) = inTi3026(PMINFO TVP3026_XSILICONREV);
+        minfo->accel.ramdac_rev = inTi3026(minfo, TVP3026_XSILICONREV);
 
-        outTi3026(PMINFO TVP3026_XCLKCTRL, TVP3026_XCLKCTRL_SRC_CLK0VGA | TVP3026_XCLKCTRL_CLKSTOPPED);
-        outTi3026(PMINFO TVP3026_XTRUECOLORCTRL, TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR);
-        outTi3026(PMINFO TVP3026_XMUXCTRL, TVP3026_XMUXCTRL_VGA);
+        outTi3026(minfo, TVP3026_XCLKCTRL, TVP3026_XCLKCTRL_SRC_CLK0VGA | TVP3026_XCLKCTRL_CLKSTOPPED);
+        outTi3026(minfo, TVP3026_XTRUECOLORCTRL, TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR);
+        outTi3026(minfo, TVP3026_XMUXCTRL, TVP3026_XMUXCTRL_VGA);
 
-        outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
-        outTi3026(PMINFO TVP3026_XLOOPPLLDATA, 0x00);
-        outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+        outTi3026(minfo, TVP3026_XPLLADDR, 0x2A);
+        outTi3026(minfo, TVP3026_XLOOPPLLDATA, 0x00);
+        outTi3026(minfo, TVP3026_XPIXPLLDATA, 0x00);
 
         mga_outb(M_MISC_REG, 0x67);
 
-        outTi3026(PMINFO TVP3026_XMEMPLLCTRL, TVP3026_XMEMPLLCTRL_STROBEMKC4 | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
+        outTi3026(minfo, TVP3026_XMEMPLLCTRL, TVP3026_XMEMPLLCTRL_STROBEMKC4 | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
 
         mga_outl(M_RESET, 1);
         udelay(250);
diff --git a/drivers/video/matrox/matroxfb_accel.c b/drivers/video/matrox/matroxfb_accel.c
index 9c3aeee1cc4f..8335a6fe303e 100644
--- a/drivers/video/matrox/matroxfb_accel.c
+++ b/drivers/video/matrox/matroxfb_accel.c
@@ -81,7 +81,7 @@
 #include "matroxfb_Ti3026.h"
 #include "matroxfb_misc.h"
 
-#define curr_ydstorg(x) ACCESS_FBINFO2(x, curr.ydstorg.pixels)
+#define curr_ydstorg(x) ((x)->curr.ydstorg.pixels)
 
 #define mga_ydstlen(y,l) mga_outl(M_YDSTLEN | M_EXEC, ((y) << 16) | (l))
 
@@ -107,7 +107,8 @@ static void matroxfb_imageblit(struct fb_info* info, const struct fb_image* imag
 static void matroxfb_cfb4_fillrect(struct fb_info* info, const struct fb_fillrect* rect);
 static void matroxfb_cfb4_copyarea(struct fb_info* info, const struct fb_copyarea* area);
 
-void matrox_cfbX_init(WPMINFO2) {
+void matrox_cfbX_init(struct matrox_fb_info *minfo)
+{
         u_int32_t maccess;
         u_int32_t mpitch;
         u_int32_t mopmode;
@@ -115,59 +116,59 @@ void matrox_cfbX_init(WPMINFO2) {
 
         DBG(__func__)
 
-        mpitch = ACCESS_FBINFO(fbcon).var.xres_virtual;
+        mpitch = minfo->fbcon.var.xres_virtual;
 
-        ACCESS_FBINFO(fbops).fb_copyarea = cfb_copyarea;
-        ACCESS_FBINFO(fbops).fb_fillrect = cfb_fillrect;
-        ACCESS_FBINFO(fbops).fb_imageblit = cfb_imageblit;
-        ACCESS_FBINFO(fbops).fb_cursor = NULL;
+        minfo->fbops.fb_copyarea = cfb_copyarea;
+        minfo->fbops.fb_fillrect = cfb_fillrect;
+        minfo->fbops.fb_imageblit = cfb_imageblit;
+        minfo->fbops.fb_cursor = NULL;
 
-        accel = (ACCESS_FBINFO(fbcon).var.accel_flags & FB_ACCELF_TEXT) == FB_ACCELF_TEXT;
+        accel = (minfo->fbcon.var.accel_flags & FB_ACCELF_TEXT) == FB_ACCELF_TEXT;
 
-        switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+        switch (minfo->fbcon.var.bits_per_pixel) {
                 case 4:         maccess = 0x00000000;   /* accelerate as 8bpp video */
                                 mpitch = (mpitch >> 1) | 0x8000; /* disable linearization */
                                 mopmode = M_OPMODE_4BPP;
-                                matrox_cfb4_pal(ACCESS_FBINFO(cmap));
+                                matrox_cfb4_pal(minfo->cmap);
                                 if (accel && !(mpitch & 1)) {
-                                        ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_cfb4_copyarea;
-                                        ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_cfb4_fillrect;
+                                        minfo->fbops.fb_copyarea = matroxfb_cfb4_copyarea;
+                                        minfo->fbops.fb_fillrect = matroxfb_cfb4_fillrect;
                                 }
                                 break;
                 case 8:         maccess = 0x00000000;
                                 mopmode = M_OPMODE_8BPP;
-                                matrox_cfb8_pal(ACCESS_FBINFO(cmap));
+                                matrox_cfb8_pal(minfo->cmap);
                                 if (accel) {
-                                        ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
-                                        ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
-                                        ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+                                        minfo->fbops.fb_copyarea = matroxfb_copyarea;
+                                        minfo->fbops.fb_fillrect = matroxfb_fillrect;
+                                        minfo->fbops.fb_imageblit = matroxfb_imageblit;
                                 }
                                 break;
-                case 16:        if (ACCESS_FBINFO(fbcon).var.green.length == 5)
+                case 16:        if (minfo->fbcon.var.green.length == 5)
                                         maccess = 0xC0000001;
                                 else
                                         maccess = 0x40000001;
                                 mopmode = M_OPMODE_16BPP;
                                 if (accel) {
-                                        ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
-                                        ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
-                                        ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+                                        minfo->fbops.fb_copyarea = matroxfb_copyarea;
+                                        minfo->fbops.fb_fillrect = matroxfb_fillrect;
+                                        minfo->fbops.fb_imageblit = matroxfb_imageblit;
                                 }
                                 break;
                 case 24:        maccess = 0x00000003;
                                 mopmode = M_OPMODE_24BPP;
                                 if (accel) {
-                                        ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
-                                        ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
-                                        ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+                                        minfo->fbops.fb_copyarea = matroxfb_copyarea;
+                                        minfo->fbops.fb_fillrect = matroxfb_fillrect;
+                                        minfo->fbops.fb_imageblit = matroxfb_imageblit;
                                 }
                                 break;
                 case 32:        maccess = 0x00000002;
                                 mopmode = M_OPMODE_32BPP;
                                 if (accel) {
-                                        ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
-                                        ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
-                                        ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+                                        minfo->fbops.fb_copyarea = matroxfb_copyarea;
+                                        minfo->fbops.fb_fillrect = matroxfb_fillrect;
+                                        minfo->fbops.fb_imageblit = matroxfb_imageblit;
                                 }
                                 break;
                 default:        maccess = 0x00000000;
@@ -176,10 +177,10 @@ void matrox_cfbX_init(WPMINFO2) {
         }
         mga_fifo(8);
         mga_outl(M_PITCH, mpitch);
-        mga_outl(M_YDSTORG, curr_ydstorg(MINFO));
-        if (ACCESS_FBINFO(capable.plnwt))
+        mga_outl(M_YDSTORG, curr_ydstorg(minfo));
+        if (minfo->capable.plnwt)
                 mga_outl(M_PLNWT, -1);
-        if (ACCESS_FBINFO(capable.srcorg)) {
+        if (minfo->capable.srcorg) {
                 mga_outl(M_SRCORG, 0);
                 mga_outl(M_DSTORG, 0);
         }
@@ -188,14 +189,16 @@ void matrox_cfbX_init(WPMINFO2) {
         mga_outl(M_YTOP, 0);
         mga_outl(M_YBOT, 0x01FFFFFF);
         mga_outl(M_MACCESS, maccess);
-        ACCESS_FBINFO(accel.m_dwg_rect) = M_DWG_TRAP | M_DWG_SOLID | M_DWG_ARZERO | M_DWG_SGNZERO | M_DWG_SHIFTZERO;
-        if (isMilleniumII(MINFO)) ACCESS_FBINFO(accel.m_dwg_rect) |= M_DWG_TRANSC;
-        ACCESS_FBINFO(accel.m_opmode) = mopmode;
+        minfo->accel.m_dwg_rect = M_DWG_TRAP | M_DWG_SOLID | M_DWG_ARZERO | M_DWG_SGNZERO | M_DWG_SHIFTZERO;
+        if (isMilleniumII(minfo)) minfo->accel.m_dwg_rect |= M_DWG_TRANSC;
+        minfo->accel.m_opmode = mopmode;
 }
 
 EXPORT_SYMBOL(matrox_cfbX_init);
 
-static void matrox_accel_bmove(WPMINFO int vxres, int sy, int sx, int dy, int dx, int height, int width) {
+static void matrox_accel_bmove(struct matrox_fb_info *minfo, int vxres, int sy,
+                               int sx, int dy, int dx, int height, int width)
+{
         int start, end;
         CRITFLAGS
 
@@ -209,7 +212,7 @@ static void matrox_accel_bmove(WPMINFO int vxres, int sy, int sx, int dy, int dx
                          M_DWG_BFCOL | M_DWG_REPLACE);
                 mga_outl(M_AR5, vxres);
                 width--;
-                start = sy*vxres+sx+curr_ydstorg(MINFO);
+                start = sy*vxres+sx+curr_ydstorg(minfo);
                 end = start+width;
         } else {
                 mga_fifo(3);
@@ -217,7 +220,7 @@ static void matrox_accel_bmove(WPMINFO int vxres, int sy, int sx, int dy, int dx
                 mga_outl(M_SGN, 5);
                 mga_outl(M_AR5, -vxres);
                 width--;
-                end = (sy+height-1)*vxres+sx+curr_ydstorg(MINFO);
+                end = (sy+height-1)*vxres+sx+curr_ydstorg(minfo);
                 start = end+width;
                 dy += height-1;
         }
@@ -231,7 +234,10 @@ static void matrox_accel_bmove(WPMINFO int vxres, int sy, int sx, int dy, int dx
         CRITEND
 }
 
-static void matrox_accel_bmove_lin(WPMINFO int vxres, int sy, int sx, int dy, int dx, int height, int width) {
+static void matrox_accel_bmove_lin(struct matrox_fb_info *minfo, int vxres,
+                                   int sy, int sx, int dy, int dx, int height,
+                                   int width)
+{
         int start, end;
         CRITFLAGS
 
@@ -245,7 +251,7 @@ static void matrox_accel_bmove_lin(WPMINFO int vxres, int sy, int sx, int dy, in
                         M_DWG_BFCOL | M_DWG_REPLACE);
                 mga_outl(M_AR5, vxres);
                 width--;
-                start = sy*vxres+sx+curr_ydstorg(MINFO);
+                start = sy*vxres+sx+curr_ydstorg(minfo);
                 end = start+width;
         } else {
                 mga_fifo(3);
@@ -253,7 +259,7 @@ static void matrox_accel_bmove_lin(WPMINFO int vxres, int sy, int sx, int dy, in
                 mga_outl(M_SGN, 5);
                 mga_outl(M_AR5, -vxres);
                 width--;
-                end = (sy+height-1)*vxres+sx+curr_ydstorg(MINFO);
+                end = (sy+height-1)*vxres+sx+curr_ydstorg(minfo);
                 start = end+width;
                 dy += height-1;
         }
@@ -269,22 +275,23 @@ static void matrox_accel_bmove_lin(WPMINFO int vxres, int sy, int sx, int dy, in
 }
 
 static void matroxfb_cfb4_copyarea(struct fb_info* info, const struct fb_copyarea* area) {
-        MINFO_FROM_INFO(info);
+        struct matrox_fb_info *minfo = info2minfo(info);
 
         if ((area->sx | area->dx | area->width) & 1)
                 cfb_copyarea(info, area);
         else
-                matrox_accel_bmove_lin(PMINFO ACCESS_FBINFO(fbcon.var.xres_virtual) >> 1, area->sy, area->sx >> 1, area->dy, area->dx >> 1, area->height, area->width >> 1);
+                matrox_accel_bmove_lin(minfo, minfo->fbcon.var.xres_virtual >> 1, area->sy, area->sx >> 1, area->dy, area->dx >> 1, area->height, area->width >> 1);
 }
 
 static void matroxfb_copyarea(struct fb_info* info, const struct fb_copyarea* area) {
-        MINFO_FROM_INFO(info);
+        struct matrox_fb_info *minfo = info2minfo(info);
 
-        matrox_accel_bmove(PMINFO ACCESS_FBINFO(fbcon.var.xres_virtual), area->sy, area->sx, area->dy, area->dx, area->height, area->width);
+        matrox_accel_bmove(minfo, minfo->fbcon.var.xres_virtual, area->sy, area->sx, area->dy, area->dx, area->height, area->width);
 }
 
-static void matroxfb_accel_clear(WPMINFO u_int32_t color, int sy, int sx, int height,
-                int width) {
+static void matroxfb_accel_clear(struct matrox_fb_info *minfo, u_int32_t color,
+                                 int sy, int sx, int height, int width)
+{
         CRITFLAGS
 
         DBG(__func__)
@@ -292,7 +299,7 @@ static void matroxfb_accel_clear(WPMINFO u_int32_t color, int sy, int sx, int he
         CRITBEGIN
 
         mga_fifo(5);
-        mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_REPLACE);
+        mga_outl(M_DWGCTL, minfo->accel.m_dwg_rect | M_DWG_REPLACE);
         mga_outl(M_FCOL, color);
         mga_outl(M_FXBNDRY, ((sx + width) << 16) | sx);
         mga_ydstlen(sy, height);
@@ -302,16 +309,18 @@ static void matroxfb_accel_clear(WPMINFO u_int32_t color, int sy, int sx, int he
 }
 
 static void matroxfb_fillrect(struct fb_info* info, const struct fb_fillrect* rect) {
-        MINFO_FROM_INFO(info);
+        struct matrox_fb_info *minfo = info2minfo(info);
 
         switch (rect->rop) {
                 case ROP_COPY:
-                        matroxfb_accel_clear(PMINFO ((u_int32_t*)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
+                        matroxfb_accel_clear(minfo, ((u_int32_t *)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
                         break;
         }
 }
 
-static void matroxfb_cfb4_clear(WPMINFO u_int32_t bgx, int sy, int sx, int height, int width) {
+static void matroxfb_cfb4_clear(struct matrox_fb_info *minfo, u_int32_t bgx,
+                                int sy, int sx, int height, int width)
+{
         int whattodo;
         CRITFLAGS
 
@@ -333,16 +342,16 @@ static void matroxfb_cfb4_clear(WPMINFO u_int32_t bgx, int sy, int sx, int heigh
         sx >>= 1;
         if (width) {
                 mga_fifo(5);
-                mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_REPLACE2);
+                mga_outl(M_DWGCTL, minfo->accel.m_dwg_rect | M_DWG_REPLACE2);
                 mga_outl(M_FCOL, bgx);
                 mga_outl(M_FXBNDRY, ((sx + width) << 16) | sx);
-                mga_outl(M_YDST, sy * ACCESS_FBINFO(fbcon).var.xres_virtual >> 6);
+                mga_outl(M_YDST, sy * minfo->fbcon.var.xres_virtual >> 6);
                 mga_outl(M_LEN | M_EXEC, height);
                 WaitTillIdle();
         }
         if (whattodo) {
-                u_int32_t step = ACCESS_FBINFO(fbcon).var.xres_virtual >> 1;
-                vaddr_t vbase = ACCESS_FBINFO(video.vbase);
+                u_int32_t step = minfo->fbcon.var.xres_virtual >> 1;
+                vaddr_t vbase = minfo->video.vbase;
                 if (whattodo & 1) {
                         unsigned int uaddr = sy * step + sx - 1;
                         u_int32_t loop;
@@ -367,17 +376,19 @@ static void matroxfb_cfb4_clear(WPMINFO u_int32_t bgx, int sy, int sx, int heigh
 }
 
 static void matroxfb_cfb4_fillrect(struct fb_info* info, const struct fb_fillrect* rect) {
-        MINFO_FROM_INFO(info);
+        struct matrox_fb_info *minfo = info2minfo(info);
 
         switch (rect->rop) {
                 case ROP_COPY:
-                        matroxfb_cfb4_clear(PMINFO ((u_int32_t*)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
+                        matroxfb_cfb4_clear(minfo, ((u_int32_t *)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
                         break;
         }
 }
 
-static void matroxfb_1bpp_imageblit(WPMINFO u_int32_t fgx, u_int32_t bgx,
-                const u_int8_t* chardata, int width, int height, int yy, int xx) {
+static void matroxfb_1bpp_imageblit(struct matrox_fb_info *minfo, u_int32_t fgx,
+                                    u_int32_t bgx, const u_int8_t *chardata,
+                                    int width, int height, int yy, int xx)
+{
         u_int32_t step;
         u_int32_t ydstlen;
         u_int32_t xlen;
@@ -412,7 +423,7 @@ static void matroxfb_1bpp_imageblit(WPMINFO u_int32_t fgx, u_int32_t bgx,
         mga_outl(M_FCOL, fgx);
         mga_outl(M_BCOL, bgx);
         fxbndry = ((xx + width - 1) << 16) | xx;
-        mmio = ACCESS_FBINFO(mmio.vbase);
+        mmio = minfo->mmio.vbase;
 
         mga_fifo(6);
         mga_writel(mmio, M_FXBNDRY, fxbndry);
@@ -467,7 +478,7 @@ static void matroxfb_1bpp_imageblit(WPMINFO u_int32_t fgx, u_int32_t bgx,
 
 
 static void matroxfb_imageblit(struct fb_info* info, const struct fb_image* image) {
-        MINFO_FROM_INFO(info);
+        struct matrox_fb_info *minfo = info2minfo(info);
 
         DBG_HEAVY(__func__);
 
@@ -476,7 +487,7 @@ static void matroxfb_imageblit(struct fb_info* info, const struct fb_image* imag
 
                 fgx = ((u_int32_t*)info->pseudo_palette)[image->fg_color];
                 bgx = ((u_int32_t*)info->pseudo_palette)[image->bg_color];
-                matroxfb_1bpp_imageblit(PMINFO fgx, bgx, image->data, image->width, image->height, image->dy, image->dx);
+                matroxfb_1bpp_imageblit(minfo, fgx, bgx, image->data, image->width, image->height, image->dy, image->dx);
         } else {
                 /* Danger! image->depth is useless: logo painting code always
                    passes framebuffer color depth here, although logo data are
diff --git a/drivers/video/matrox/matroxfb_accel.h b/drivers/video/matrox/matroxfb_accel.h
index f40c314b4c30..1e418e62c22d 100644
--- a/drivers/video/matrox/matroxfb_accel.h
+++ b/drivers/video/matrox/matroxfb_accel.h
@@ -3,6 +3,6 @@
 
 #include "matroxfb_base.h"
 
-void matrox_cfbX_init(WPMINFO2);
+void matrox_cfbX_init(struct matrox_fb_info *minfo);
 
 #endif
diff --git a/drivers/video/matrox/matroxfb_base.c b/drivers/video/matrox/matroxfb_base.c
index 0c1049b308bf..7064fb4427b6 100644
--- a/drivers/video/matrox/matroxfb_base.c
+++ b/drivers/video/matrox/matroxfb_base.c
@@ -154,21 +154,22 @@ static struct fb_var_screeninfo vesafb_defined = {
 
 
 /* --------------------------------------------------------------------- */
-static void update_crtc2(WPMINFO unsigned int pos) {
-        struct matroxfb_dh_fb_info* info = ACCESS_FBINFO(crtc2.info);
+static void update_crtc2(struct matrox_fb_info *minfo, unsigned int pos)
+{
+        struct matroxfb_dh_fb_info *info = minfo->crtc2.info;
 
         /* Make sure that displays are compatible */
-        if (info && (info->fbcon.var.bits_per_pixel == ACCESS_FBINFO(fbcon).var.bits_per_pixel)
-                 && (info->fbcon.var.xres_virtual == ACCESS_FBINFO(fbcon).var.xres_virtual)
-                 && (info->fbcon.var.green.length == ACCESS_FBINFO(fbcon).var.green.length)
+        if (info && (info->fbcon.var.bits_per_pixel == minfo->fbcon.var.bits_per_pixel)
+                 && (info->fbcon.var.xres_virtual == minfo->fbcon.var.xres_virtual)
+                 && (info->fbcon.var.green.length == minfo->fbcon.var.green.length)
                  ) {
-                switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+                switch (minfo->fbcon.var.bits_per_pixel) {
                         case 16:
                         case 32:
                                 pos = pos * 8;
                                 if (info->interlaced) {
                                         mga_outl(0x3C2C, pos);
-                                        mga_outl(0x3C28, pos + ACCESS_FBINFO(fbcon).var.xres_virtual * ACCESS_FBINFO(fbcon).var.bits_per_pixel / 8);
+                                        mga_outl(0x3C28, pos + minfo->fbcon.var.xres_virtual * minfo->fbcon.var.bits_per_pixel / 8);
                                 } else {
                                         mga_outl(0x3C28, pos);
                                 }
@@ -177,17 +178,18 @@ static void update_crtc2(WPMINFO unsigned int pos) {
         }
 }
 
-static void matroxfb_crtc1_panpos(WPMINFO2) {
-        if (ACCESS_FBINFO(crtc1.panpos) >= 0) {
+static void matroxfb_crtc1_panpos(struct matrox_fb_info *minfo)
+{
+        if (minfo->crtc1.panpos >= 0) {
                 unsigned long flags;
                 int panpos;
 
                 matroxfb_DAC_lock_irqsave(flags);
-                panpos = ACCESS_FBINFO(crtc1.panpos);
+                panpos = minfo->crtc1.panpos;
                 if (panpos >= 0) {
                         unsigned int extvga_reg;
 
-                        ACCESS_FBINFO(crtc1.panpos) = -1; /* No update pending anymore */
+                        minfo->crtc1.panpos = -1; /* No update pending anymore */
                         extvga_reg = mga_inb(M_EXTVGA_INDEX);
                         mga_setr(M_EXTVGA_INDEX, 0x00, panpos);
                         if (extvga_reg != 0x00) {
@@ -202,39 +204,39 @@ static irqreturn_t matrox_irq(int irq, void *dev_id)
 {
         u_int32_t status;
         int handled = 0;
-
-        MINFO_FROM(dev_id);
+        struct matrox_fb_info *minfo = dev_id;
 
         status = mga_inl(M_STATUS);
 
         if (status & 0x20) {
                 mga_outl(M_ICLEAR, 0x20);
-                ACCESS_FBINFO(crtc1.vsync.cnt)++;
-                matroxfb_crtc1_panpos(PMINFO2);
-                wake_up_interruptible(&ACCESS_FBINFO(crtc1.vsync.wait));
+                minfo->crtc1.vsync.cnt++;
+                matroxfb_crtc1_panpos(minfo);
+                wake_up_interruptible(&minfo->crtc1.vsync.wait);
                 handled = 1;
         }
         if (status & 0x200) {
                 mga_outl(M_ICLEAR, 0x200);
-                ACCESS_FBINFO(crtc2.vsync.cnt)++;
-                wake_up_interruptible(&ACCESS_FBINFO(crtc2.vsync.wait));
+                minfo->crtc2.vsync.cnt++;
+                wake_up_interruptible(&minfo->crtc2.vsync.wait);
                 handled = 1;
         }
         return IRQ_RETVAL(handled);
 }
 
-int matroxfb_enable_irq(WPMINFO int reenable) {
+int matroxfb_enable_irq(struct matrox_fb_info *minfo, int reenable)
+{
         u_int32_t bm;
 
-        if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+        if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400)
                 bm = 0x220;
         else
                 bm = 0x020;
 
-        if (!test_and_set_bit(0, &ACCESS_FBINFO(irq_flags))) {
-                if (request_irq(ACCESS_FBINFO(pcidev)->irq, matrox_irq,
-                                IRQF_SHARED, "matroxfb", MINFO)) {
-                        clear_bit(0, &ACCESS_FBINFO(irq_flags));
+        if (!test_and_set_bit(0, &minfo->irq_flags)) {
+                if (request_irq(minfo->pcidev->irq, matrox_irq,
+                                IRQF_SHARED, "matroxfb", minfo)) {
+                        clear_bit(0, &minfo->irq_flags);
                         return -EINVAL;
                 }
                 /* Clear any pending field interrupts */
@@ -252,37 +254,39 @@ int matroxfb_enable_irq(WPMINFO int reenable) {
         return 0;
 }
 
-static void matroxfb_disable_irq(WPMINFO2) {
-        if (test_and_clear_bit(0, &ACCESS_FBINFO(irq_flags))) {
+static void matroxfb_disable_irq(struct matrox_fb_info *minfo)
+{
+        if (test_and_clear_bit(0, &minfo->irq_flags)) {
                 /* Flush pending pan-at-vbl request... */
-                matroxfb_crtc1_panpos(PMINFO2);
-                if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+                matroxfb_crtc1_panpos(minfo);
+                if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400)
                         mga_outl(M_IEN, mga_inl(M_IEN) & ~0x220);
                 else
                         mga_outl(M_IEN, mga_inl(M_IEN) & ~0x20);
-                free_irq(ACCESS_FBINFO(pcidev)->irq, MINFO);
+                free_irq(minfo->pcidev->irq, minfo);
         }
 }
 
-int matroxfb_wait_for_sync(WPMINFO u_int32_t crtc) {
+int matroxfb_wait_for_sync(struct matrox_fb_info *minfo, u_int32_t crtc)
+{
         struct matrox_vsync *vs;
         unsigned int cnt;
         int ret;
 
         switch (crtc) {
                 case 0:
-                        vs = &ACCESS_FBINFO(crtc1.vsync);
+                        vs = &minfo->crtc1.vsync;
                         break;
                 case 1:
-                        if (ACCESS_FBINFO(devflags.accelerator) != FB_ACCEL_MATROX_MGAG400) {
+                        if (minfo->devflags.accelerator != FB_ACCEL_MATROX_MGAG400) {
                                 return -ENODEV;
                         }
-                        vs = &ACCESS_FBINFO(crtc2.vsync);
+                        vs = &minfo->crtc2.vsync;
                         break;
                 default:
                         return -ENODEV;
         }
-        ret = matroxfb_enable_irq(PMINFO 0);
+        ret = matroxfb_enable_irq(minfo, 0);
         if (ret) {
                 return ret;
         }
@@ -293,7 +297,7 @@ int matroxfb_wait_for_sync(WPMINFO u_int32_t crtc) {
                 return ret;
         }
         if (ret == 0) {
-                matroxfb_enable_irq(PMINFO 1);
+                matroxfb_enable_irq(minfo, 1);
                 return -ETIMEDOUT;
         }
         return 0;
@@ -301,12 +305,12 @@ int matroxfb_wait_for_sync(WPMINFO u_int32_t crtc) {
 
 /* --------------------------------------------------------------------- */
 
-static void matrox_pan_var(WPMINFO struct fb_var_screeninfo *var) {
+static void matrox_pan_var(struct matrox_fb_info *minfo,
+                           struct fb_var_screeninfo *var)
+{
         unsigned int pos;
         unsigned short p0, p1, p2;
-#ifdef CONFIG_FB_MATROX_32MB
         unsigned int p3;
-#endif
         int vbl;
         unsigned long flags;
 
@@ -314,47 +318,44 @@ static void matrox_pan_var(WPMINFO struct fb_var_screeninfo *var) {
 
         DBG(__func__)
 
-        if (ACCESS_FBINFO(dead))
+        if (minfo->dead)
                 return;
 
-        ACCESS_FBINFO(fbcon).var.xoffset = var->xoffset;
-        ACCESS_FBINFO(fbcon).var.yoffset = var->yoffset;
-        pos = (ACCESS_FBINFO(fbcon).var.yoffset * ACCESS_FBINFO(fbcon).var.xres_virtual + ACCESS_FBINFO(fbcon).var.xoffset) * ACCESS_FBINFO(curr.final_bppShift) / 32;
-        pos += ACCESS_FBINFO(curr.ydstorg.chunks);
-        p0 = ACCESS_FBINFO(hw).CRTC[0x0D] = pos & 0xFF;
-        p1 = ACCESS_FBINFO(hw).CRTC[0x0C] = (pos & 0xFF00) >> 8;
-        p2 = ACCESS_FBINFO(hw).CRTCEXT[0] = (ACCESS_FBINFO(hw).CRTCEXT[0] & 0xB0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
-#ifdef CONFIG_FB_MATROX_32MB
-        p3 = ACCESS_FBINFO(hw).CRTCEXT[8] = pos >> 21;
-#endif
+        minfo->fbcon.var.xoffset = var->xoffset;
+        minfo->fbcon.var.yoffset = var->yoffset;
+        pos = (minfo->fbcon.var.yoffset * minfo->fbcon.var.xres_virtual + minfo->fbcon.var.xoffset) * minfo->curr.final_bppShift / 32;
+        pos += minfo->curr.ydstorg.chunks;
+        p0 = minfo->hw.CRTC[0x0D] = pos & 0xFF;
+        p1 = minfo->hw.CRTC[0x0C] = (pos & 0xFF00) >> 8;
+        p2 = minfo->hw.CRTCEXT[0] = (minfo->hw.CRTCEXT[0] & 0xB0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
+        p3 = minfo->hw.CRTCEXT[8] = pos >> 21;
 
         /* FB_ACTIVATE_VBL and we can acquire interrupts? Honor FB_ACTIVATE_VBL then... */
-        vbl = (var->activate & FB_ACTIVATE_VBL) && (matroxfb_enable_irq(PMINFO 0) == 0);
+        vbl = (var->activate & FB_ACTIVATE_VBL) && (matroxfb_enable_irq(minfo, 0) == 0);
 
         CRITBEGIN
 
         matroxfb_DAC_lock_irqsave(flags);
         mga_setr(M_CRTC_INDEX, 0x0D, p0);
         mga_setr(M_CRTC_INDEX, 0x0C, p1);
-#ifdef CONFIG_FB_MATROX_32MB
-        if (ACCESS_FBINFO(devflags.support32MB))
+        if (minfo->devflags.support32MB)
                 mga_setr(M_EXTVGA_INDEX, 0x08, p3);
-#endif
         if (vbl) {
-                ACCESS_FBINFO(crtc1.panpos) = p2;
+                minfo->crtc1.panpos = p2;
         } else {
                 /* Abort any pending change */
-                ACCESS_FBINFO(crtc1.panpos) = -1;
+                minfo->crtc1.panpos = -1;
                 mga_setr(M_EXTVGA_INDEX, 0x00, p2);
         }
         matroxfb_DAC_unlock_irqrestore(flags);
 
-        update_crtc2(PMINFO pos);
+        update_crtc2(minfo, pos);
 
         CRITEND
 }
 
-static void matroxfb_remove(WPMINFO int dummy) {
+static void matroxfb_remove(struct matrox_fb_info *minfo, int dummy)
+{
         /* Currently we are holding big kernel lock on all dead & usecount updates.
          * Destroy everything after all users release it. Especially do not unregister
          * framebuffer and iounmap memory, neither fbmem nor fbcon-cfb* does not check
@@ -363,25 +364,23 @@ static void matroxfb_remove(WPMINFO int dummy) {
          * write data without causing too much damage...
          */
 
-        ACCESS_FBINFO(dead) = 1;
-        if (ACCESS_FBINFO(usecount)) {
+        minfo->dead = 1;
+        if (minfo->usecount) {
                 /* destroy it later */
                 return;
         }
-        matroxfb_unregister_device(MINFO);
-        unregister_framebuffer(&ACCESS_FBINFO(fbcon));
-        matroxfb_g450_shutdown(PMINFO2);
+        matroxfb_unregister_device(minfo);
+        unregister_framebuffer(&minfo->fbcon);
+        matroxfb_g450_shutdown(minfo);
 #ifdef CONFIG_MTRR
-        if (ACCESS_FBINFO(mtrr.vram_valid))
-                mtrr_del(ACCESS_FBINFO(mtrr.vram), ACCESS_FBINFO(video.base), ACCESS_FBINFO(video.len));
+        if (minfo->mtrr.vram_valid)
+                mtrr_del(minfo->mtrr.vram, minfo->video.base, minfo->video.len);
 #endif
-        mga_iounmap(ACCESS_FBINFO(mmio.vbase));
-        mga_iounmap(ACCESS_FBINFO(video.vbase));
-        release_mem_region(ACCESS_FBINFO(video.base), ACCESS_FBINFO(video.len_maximum));
-        release_mem_region(ACCESS_FBINFO(mmio.base), 16384);
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
+        mga_iounmap(minfo->mmio.vbase);
+        mga_iounmap(minfo->video.vbase);
+        release_mem_region(minfo->video.base, minfo->video.len_maximum);
+        release_mem_region(minfo->mmio.base, 16384);
         kfree(minfo);
-#endif
 }
 
         /*
@@ -390,48 +389,50 @@ static void matroxfb_remove(WPMINFO int dummy) {
 
 static int matroxfb_open(struct fb_info *info, int user)
 {
-        MINFO_FROM_INFO(info);
+        struct matrox_fb_info *minfo = info2minfo(info);
 
         DBG_LOOP(__func__)
 
-        if (ACCESS_FBINFO(dead)) {
+        if (minfo->dead) {
                 return -ENXIO;
         }
-        ACCESS_FBINFO(usecount)++;
+        minfo->usecount++;
         if (user) {
-                ACCESS_FBINFO(userusecount)++;
+                minfo->userusecount++;
         }
         return(0);
 }
 
 static int matroxfb_release(struct fb_info *info, int user)
 {
-        MINFO_FROM_INFO(info);
+        struct matrox_fb_info *minfo = info2minfo(info);
 
         DBG_LOOP(__func__)
 
         if (user) {
-                if (0 == --ACCESS_FBINFO(userusecount)) {
-                        matroxfb_disable_irq(PMINFO2);
+                if (0 == --minfo->userusecount) {
+                        matroxfb_disable_irq(minfo);
                 }
         }
-        if (!(--ACCESS_FBINFO(usecount)) && ACCESS_FBINFO(dead)) {
-                matroxfb_remove(PMINFO 0);
+        if (!(--minfo->usecount) && minfo->dead) {
+                matroxfb_remove(minfo, 0);
         }
         return(0);
 }
 
 static int matroxfb_pan_display(struct fb_var_screeninfo *var,
                 struct fb_info* info) {
-        MINFO_FROM_INFO(info);
+        struct matrox_fb_info *minfo = info2minfo(info);
 
         DBG(__func__)
 
-        matrox_pan_var(PMINFO var);
+        matrox_pan_var(minfo, var);
         return 0;
 }
 
-static int matroxfb_get_final_bppShift(CPMINFO int bpp) {
+static int matroxfb_get_final_bppShift(const struct matrox_fb_info *minfo,
+                                       int bpp)
+{
         int bppshft2;
 
         DBG(__func__)
@@ -440,14 +441,16 @@ static int matroxfb_get_final_bppShift(CPMINFO int bpp) {
         if (!bppshft2) {
                 return 8;
         }
-        if (isInterleave(MINFO))
+        if (isInterleave(minfo))
                 bppshft2 >>= 1;
-        if (ACCESS_FBINFO(devflags.video64bits))
+        if (minfo->devflags.video64bits)
                 bppshft2 >>= 1;
         return bppshft2;
 }
 
-static int matroxfb_test_and_set_rounding(CPMINFO int xres, int bpp) {
+static int matroxfb_test_and_set_rounding(const struct matrox_fb_info *minfo,
+                                          int xres, int bpp)
+{
         int over;
         int rounding;
 
@@ -465,11 +468,11 @@ static int matroxfb_test_and_set_rounding(CPMINFO int xres, int bpp) {
                                 break;
                 default:        rounding = 16;
                                 /* on G400, 16 really does not work */
-                                if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+                                if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400)
                                         rounding = 32;
                                 break;
         }
-        if (isInterleave(MINFO)) {
+        if (isInterleave(minfo)) {
                 rounding *= 2;
         }
         over = xres % rounding;
@@ -478,7 +481,9 @@ static int matroxfb_test_and_set_rounding(CPMINFO int xres, int bpp) {
         return xres;
 }
 
-static int matroxfb_pitch_adjust(CPMINFO int xres, int bpp) {
+static int matroxfb_pitch_adjust(const struct matrox_fb_info *minfo, int xres,
+                                 int bpp)
+{
         const int* width;
         int xres_new;
 
@@ -486,18 +491,18 @@ static int matroxfb_pitch_adjust(CPMINFO int xres, int bpp) {
 
         if (!bpp) return xres;
 
-        width = ACCESS_FBINFO(capable.vxres);
+        width = minfo->capable.vxres;
 
-        if (ACCESS_FBINFO(devflags.precise_width)) {
+        if (minfo->devflags.precise_width) {
                 while (*width) {
-                        if ((*width >= xres) && (matroxfb_test_and_set_rounding(PMINFO *width, bpp) == *width)) {
+                        if ((*width >= xres) && (matroxfb_test_and_set_rounding(minfo, *width, bpp) == *width)) {
                                 break;
                         }
                         width++;
                 }
                 xres_new = *width;
         } else {
-                xres_new = matroxfb_test_and_set_rounding(PMINFO xres, bpp);
+                xres_new = matroxfb_test_and_set_rounding(minfo, xres, bpp);
         }
         return xres_new;
 }
@@ -524,7 +529,10 @@ static int matroxfb_get_cmap_len(struct fb_var_screeninfo *var) {
         return 16;      /* return something reasonable... or panic()? */
 }
 
-static int matroxfb_decode_var(CPMINFO struct fb_var_screeninfo *var, int *visual, int *video_cmap_len, unsigned int* ydstorg) {
+static int matroxfb_decode_var(const struct matrox_fb_info *minfo,
+                               struct fb_var_screeninfo *var, int *visual,
+                               int *video_cmap_len, unsigned int* ydstorg)
+{
         struct RGBT {
                 unsigned char bpp;
                 struct {
@@ -551,7 +559,7 @@ static int matroxfb_decode_var(CPMINFO struct fb_var_screeninfo *var, int *visua
         DBG(__func__)
 
         switch (bpp) {
-                case 4:  if (!ACCESS_FBINFO(capable.cfb4)) return -EINVAL;
+                case 4:  if (!minfo->capable.cfb4) return -EINVAL;
                          break;
                 case 8:  break;
                 case 16: break;
@@ -560,13 +568,13 @@ static int matroxfb_decode_var(CPMINFO struct fb_var_screeninfo *var, int *visua
                 default: return -EINVAL;
         }
         *ydstorg = 0;
-        vramlen = ACCESS_FBINFO(video.len_usable);
+        vramlen = minfo->video.len_usable;
         if (var->yres_virtual < var->yres)
                 var->yres_virtual = var->yres;
         if (var->xres_virtual < var->xres)
                 var->xres_virtual = var->xres;
 
-        var->xres_virtual = matroxfb_pitch_adjust(PMINFO var->xres_virtual, bpp);
+        var->xres_virtual = matroxfb_pitch_adjust(minfo, var->xres_virtual, bpp);
         memlen = var->xres_virtual * bpp * var->yres_virtual / 8;
         if (memlen > vramlen) {
                 var->yres_virtual = vramlen * 8 / (var->xres_virtual * bpp);
@@ -575,7 +583,7 @@ static int matroxfb_decode_var(CPMINFO struct fb_var_screeninfo *var, int *visua
         /* There is hardware bug that no line can cross 4MB boundary */
         /* give up for CFB24, it is impossible to easy workaround it */
         /* for other try to do something */
-        if (!ACCESS_FBINFO(capable.cross4MB) && (memlen > 0x400000)) {
+        if (!minfo->capable.cross4MB && (memlen > 0x400000)) {
                 if (bpp == 24) {
                         /* sorry */
                 } else {
@@ -644,9 +652,7 @@ static int matroxfb_setcolreg(unsigned regno, unsigned red, unsigned green,
                               unsigned blue, unsigned transp,
                               struct fb_info *fb_info)
 {
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
         struct matrox_fb_info* minfo = container_of(fb_info, struct matrox_fb_info, fbcon);
-#endif
 
         DBG(__func__)
 
@@ -657,20 +663,20 @@ static int matroxfb_setcolreg(unsigned regno, unsigned red, unsigned green,
          *  != 0 for invalid regno.
          */
 
-        if (regno >= ACCESS_FBINFO(curr.cmap_len))
+        if (regno >= minfo->curr.cmap_len)
                 return 1;
 
-        if (ACCESS_FBINFO(fbcon).var.grayscale) {
+        if (minfo->fbcon.var.grayscale) {
                 /* gray = 0.30*R + 0.59*G + 0.11*B */
                 red = green = blue = (red * 77 + green * 151 + blue * 28) >> 8;
         }
 
-        red = CNVT_TOHW(red, ACCESS_FBINFO(fbcon).var.red.length);
-        green = CNVT_TOHW(green, ACCESS_FBINFO(fbcon).var.green.length);
-        blue = CNVT_TOHW(blue, ACCESS_FBINFO(fbcon).var.blue.length);
-        transp = CNVT_TOHW(transp, ACCESS_FBINFO(fbcon).var.transp.length);
+        red = CNVT_TOHW(red, minfo->fbcon.var.red.length);
+        green = CNVT_TOHW(green, minfo->fbcon.var.green.length);
+        blue = CNVT_TOHW(blue, minfo->fbcon.var.blue.length);
+        transp = CNVT_TOHW(transp, minfo->fbcon.var.transp.length);
 
-        switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+        switch (minfo->fbcon.var.bits_per_pixel) {
         case 4:
         case 8:
                 mga_outb(M_DAC_REG, regno);
@@ -683,30 +689,30 @@ static int matroxfb_setcolreg(unsigned regno, unsigned red, unsigned green,
                         break;
                 {
                         u_int16_t col =
-                                (red << ACCESS_FBINFO(fbcon).var.red.offset)     |
-                                (green << ACCESS_FBINFO(fbcon).var.green.offset) |
-                                (blue << ACCESS_FBINFO(fbcon).var.blue.offset)   |
-                                (transp << ACCESS_FBINFO(fbcon).var.transp.offset); /* for 1:5:5:5 */
-                        ACCESS_FBINFO(cmap[regno]) = col | (col << 16);
+                                (red << minfo->fbcon.var.red.offset)     |
+                                (green << minfo->fbcon.var.green.offset) |
+                                (blue << minfo->fbcon.var.blue.offset)   |
+                                (transp << minfo->fbcon.var.transp.offset); /* for 1:5:5:5 */
+                        minfo->cmap[regno] = col | (col << 16);
                 }
                 break;
         case 24:
         case 32:
                 if (regno >= 16)
                         break;
-                ACCESS_FBINFO(cmap[regno]) =
-                        (red   << ACCESS_FBINFO(fbcon).var.red.offset)   |
-                        (green << ACCESS_FBINFO(fbcon).var.green.offset) |
-                        (blue  << ACCESS_FBINFO(fbcon).var.blue.offset)  |
-                        (transp << ACCESS_FBINFO(fbcon).var.transp.offset);     /* 8:8:8:8 */
+                minfo->cmap[regno] =
+                        (red   << minfo->fbcon.var.red.offset)   |
+                        (green << minfo->fbcon.var.green.offset) |
+                        (blue  << minfo->fbcon.var.blue.offset)  |
+                        (transp << minfo->fbcon.var.transp.offset);     /* 8:8:8:8 */
                 break;
         }
         return 0;
 }
 
-static void matroxfb_init_fix(WPMINFO2)
+static void matroxfb_init_fix(struct matrox_fb_info *minfo)
 {
-        struct fb_fix_screeninfo *fix = &ACCESS_FBINFO(fbcon).fix;
+        struct fb_fix_screeninfo *fix = &minfo->fbcon.fix;
         DBG(__func__)
 
         strcpy(fix->id,"MATROX");
@@ -714,20 +720,20 @@ static void matroxfb_init_fix(WPMINFO2)
         fix->xpanstep = 8;      /* 8 for 8bpp, 4 for 16bpp, 2 for 32bpp */
         fix->ypanstep = 1;
         fix->ywrapstep = 0;
-        fix->mmio_start = ACCESS_FBINFO(mmio.base);
-        fix->mmio_len = ACCESS_FBINFO(mmio.len);
-        fix->accel = ACCESS_FBINFO(devflags.accelerator);
+        fix->mmio_start = minfo->mmio.base;
+        fix->mmio_len = minfo->mmio.len;
+        fix->accel = minfo->devflags.accelerator;
 }
 
-static void matroxfb_update_fix(WPMINFO2)
+static void matroxfb_update_fix(struct matrox_fb_info *minfo)
 {
-        struct fb_fix_screeninfo *fix = &ACCESS_FBINFO(fbcon).fix;
+        struct fb_fix_screeninfo *fix = &minfo->fbcon.fix;
         DBG(__func__)
 
-        mutex_lock(&ACCESS_FBINFO(fbcon).mm_lock);
-        fix->smem_start = ACCESS_FBINFO(video.base) + ACCESS_FBINFO(curr.ydstorg.bytes);
-        fix->smem_len = ACCESS_FBINFO(video.len_usable) - ACCESS_FBINFO(curr.ydstorg.bytes);
-        mutex_unlock(&ACCESS_FBINFO(fbcon).mm_lock);
+        mutex_lock(&minfo->fbcon.mm_lock);
+        fix->smem_start = minfo->video.base + minfo->curr.ydstorg.bytes;
+        fix->smem_len = minfo->video.len_usable - minfo->curr.ydstorg.bytes;
+        mutex_unlock(&minfo->fbcon.mm_lock);
 }
 
 static int matroxfb_check_var(struct fb_var_screeninfo *var, struct fb_info *info)
@@ -736,12 +742,12 @@ static int matroxfb_check_var(struct fb_var_screeninfo *var, struct fb_info *inf
         int visual;
         int cmap_len;
         unsigned int ydstorg;
-        MINFO_FROM_INFO(info);
+        struct matrox_fb_info *minfo = info2minfo(info);
 
-        if (ACCESS_FBINFO(dead)) {
+        if (minfo->dead) {
                 return -ENXIO;
         }
-        if ((err = matroxfb_decode_var(PMINFO var, &visual, &cmap_len, &ydstorg)) != 0)
+        if ((err = matroxfb_decode_var(minfo, var, &visual, &cmap_len, &ydstorg)) != 0)
                 return err;
         return 0;
 }
@@ -753,35 +759,35 @@ static int matroxfb_set_par(struct fb_info *info)
         int cmap_len;
         unsigned int ydstorg;
         struct fb_var_screeninfo *var;
-        MINFO_FROM_INFO(info);
+        struct matrox_fb_info *minfo = info2minfo(info);
 
         DBG(__func__)
 
-        if (ACCESS_FBINFO(dead)) {
+        if (minfo->dead) {
                 return -ENXIO;
         }
 
         var = &info->var;
-        if ((err = matroxfb_decode_var(PMINFO var, &visual, &cmap_len, &ydstorg)) != 0)
+        if ((err = matroxfb_decode_var(minfo, var, &visual, &cmap_len, &ydstorg)) != 0)
                 return err;
-        ACCESS_FBINFO(fbcon.screen_base) = vaddr_va(ACCESS_FBINFO(video.vbase)) + ydstorg;
-        matroxfb_update_fix(PMINFO2);
-        ACCESS_FBINFO(fbcon).fix.visual = visual;
-        ACCESS_FBINFO(fbcon).fix.type = FB_TYPE_PACKED_PIXELS;
-        ACCESS_FBINFO(fbcon).fix.type_aux = 0;
-        ACCESS_FBINFO(fbcon).fix.line_length = (var->xres_virtual * var->bits_per_pixel) >> 3;
+        minfo->fbcon.screen_base = vaddr_va(minfo->video.vbase) + ydstorg;
+        matroxfb_update_fix(minfo);
+        minfo->fbcon.fix.visual = visual;
+        minfo->fbcon.fix.type = FB_TYPE_PACKED_PIXELS;
+        minfo->fbcon.fix.type_aux = 0;
+        minfo->fbcon.fix.line_length = (var->xres_virtual * var->bits_per_pixel) >> 3;
         {
                 unsigned int pos;
 
-                ACCESS_FBINFO(curr.cmap_len) = cmap_len;
-                ydstorg += ACCESS_FBINFO(devflags.ydstorg);
-                ACCESS_FBINFO(curr.ydstorg.bytes) = ydstorg;
-                ACCESS_FBINFO(curr.ydstorg.chunks) = ydstorg >> (isInterleave(MINFO)?3:2);
+                minfo->curr.cmap_len = cmap_len;
+                ydstorg += minfo->devflags.ydstorg;
+                minfo->curr.ydstorg.bytes = ydstorg;
+                minfo->curr.ydstorg.chunks = ydstorg >> (isInterleave(minfo) ? 3 : 2);
                 if (var->bits_per_pixel == 4)
-                        ACCESS_FBINFO(curr.ydstorg.pixels) = ydstorg;
+                        minfo->curr.ydstorg.pixels = ydstorg;
                 else
-                        ACCESS_FBINFO(curr.ydstorg.pixels) = (ydstorg * 8) / var->bits_per_pixel;
-                ACCESS_FBINFO(curr.final_bppShift) = matroxfb_get_final_bppShift(PMINFO var->bits_per_pixel);
+                        minfo->curr.ydstorg.pixels = (ydstorg * 8) / var->bits_per_pixel;
+                minfo->curr.final_bppShift = matroxfb_get_final_bppShift(minfo, var->bits_per_pixel);
                 {       struct my_timming mt;
                         struct matrox_hw_state* hw;
                         int out;
@@ -797,54 +803,55 @@ static int matroxfb_set_par(struct fb_info *info)
                                 default:        mt.delay = 31 + 8; break;
                         }
 
-                        hw = &ACCESS_FBINFO(hw);
+                        hw = &minfo->hw;
 
-                        down_read(&ACCESS_FBINFO(altout).lock);
+                        down_read(&minfo->altout.lock);
                         for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-                                if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
-                                    ACCESS_FBINFO(outputs[out]).output->compute) {
-                                        ACCESS_FBINFO(outputs[out]).output->compute(ACCESS_FBINFO(outputs[out]).data, &mt);
+                                if (minfo->outputs[out].src == MATROXFB_SRC_CRTC1 &&
+                                    minfo->outputs[out].output->compute) {
+                                        minfo->outputs[out].output->compute(minfo->outputs[out].data, &mt);
                                 }
                         }
-                        up_read(&ACCESS_FBINFO(altout).lock);
-                        ACCESS_FBINFO(crtc1).pixclock = mt.pixclock;
-                        ACCESS_FBINFO(crtc1).mnp = mt.mnp;
-                        ACCESS_FBINFO(hw_switch->init(PMINFO &mt));
-                        pos = (var->yoffset * var->xres_virtual + var->xoffset) * ACCESS_FBINFO(curr.final_bppShift) / 32;
-                        pos += ACCESS_FBINFO(curr.ydstorg.chunks);
+                        up_read(&minfo->altout.lock);
+                        minfo->crtc1.pixclock = mt.pixclock;
+                        minfo->crtc1.mnp = mt.mnp;
+                        minfo->hw_switch->init(minfo, &mt);
+                        pos = (var->yoffset * var->xres_virtual + var->xoffset) * minfo->curr.final_bppShift / 32;
+                        pos += minfo->curr.ydstorg.chunks;
 
                         hw->CRTC[0x0D] = pos & 0xFF;
                         hw->CRTC[0x0C] = (pos & 0xFF00) >> 8;
                         hw->CRTCEXT[0] = (hw->CRTCEXT[0] & 0xF0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
                         hw->CRTCEXT[8] = pos >> 21;
-                        ACCESS_FBINFO(hw_switch->restore(PMINFO2));
-                        update_crtc2(PMINFO pos);
-                        down_read(&ACCESS_FBINFO(altout).lock);
+                        minfo->hw_switch->restore(minfo);
+                        update_crtc2(minfo, pos);
+                        down_read(&minfo->altout.lock);
                         for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-                                if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
-                                    ACCESS_FBINFO(outputs[out]).output->program) {
-                                        ACCESS_FBINFO(outputs[out]).output->program(ACCESS_FBINFO(outputs[out]).data);
+                                if (minfo->outputs[out].src == MATROXFB_SRC_CRTC1 &&
+                                    minfo->outputs[out].output->program) {
+                                        minfo->outputs[out].output->program(minfo->outputs[out].data);
                                 }
                         }
                         for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-                                if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
-                                    ACCESS_FBINFO(outputs[out]).output->start) {
-                                        ACCESS_FBINFO(outputs[out]).output->start(ACCESS_FBINFO(outputs[out]).data);
+                                if (minfo->outputs[out].src == MATROXFB_SRC_CRTC1 &&
+                                    minfo->outputs[out].output->start) {
+                                        minfo->outputs[out].output->start(minfo->outputs[out].data);
                                 }
                         }
-                        up_read(&ACCESS_FBINFO(altout).lock);
-                        matrox_cfbX_init(PMINFO2);
+                        up_read(&minfo->altout.lock);
+                        matrox_cfbX_init(minfo);
                 }
         }
-        ACCESS_FBINFO(initialized) = 1;
+        minfo->initialized = 1;
         return 0;
 }
 
-static int matroxfb_get_vblank(WPMINFO struct fb_vblank *vblank)
+static int matroxfb_get_vblank(struct matrox_fb_info *minfo,
+                               struct fb_vblank *vblank)
 {
         unsigned int sts1;
 
-        matroxfb_enable_irq(PMINFO 0);
+        matroxfb_enable_irq(minfo, 0);
         memset(vblank, 0, sizeof(*vblank));
         vblank->flags = FB_VBLANK_HAVE_VCOUNT | FB_VBLANK_HAVE_VSYNC |
                         FB_VBLANK_HAVE_VBLANK | FB_VBLANK_HAVE_HBLANK;
@@ -857,13 +864,13 @@ static int matroxfb_get_vblank(WPMINFO struct fb_vblank *vblank)
                 vblank->flags |= FB_VBLANK_HBLANKING;
         if (sts1 & 8)
                 vblank->flags |= FB_VBLANK_VSYNCING;
-        if (vblank->vcount >= ACCESS_FBINFO(fbcon).var.yres)
+        if (vblank->vcount >= minfo->fbcon.var.yres)
                 vblank->flags |= FB_VBLANK_VBLANKING;
-        if (test_bit(0, &ACCESS_FBINFO(irq_flags))) {
+        if (test_bit(0, &minfo->irq_flags)) {
                 vblank->flags |= FB_VBLANK_HAVE_COUNT;
                 /* Only one writer, aligned int value...
                    it should work without lock and without atomic_t */
-                vblank->count = ACCESS_FBINFO(crtc1).vsync.cnt;
+                vblank->count = minfo->crtc1.vsync.cnt;
         }
         return 0;
 }
@@ -876,11 +883,11 @@ static int matroxfb_ioctl(struct fb_info *info,
                           unsigned int cmd, unsigned long arg)
 {
         void __user *argp = (void __user *)arg;
-        MINFO_FROM_INFO(info);
+        struct matrox_fb_info *minfo = info2minfo(info);
 
         DBG(__func__)
 
-        if (ACCESS_FBINFO(dead)) {
+        if (minfo->dead) {
                 return -ENXIO;
         }
 
@@ -890,7 +897,7 @@ static int matroxfb_ioctl(struct fb_info *info,
                                 struct fb_vblank vblank;
                                 int err;
 
-                                err = matroxfb_get_vblank(PMINFO &vblank);
+                                err = matroxfb_get_vblank(minfo, &vblank);
                                 if (err)
                                         return err;
                                 if (copy_to_user(argp, &vblank, sizeof(vblank)))
@@ -904,7 +911,7 @@ static int matroxfb_ioctl(struct fb_info *info,
                                 if (get_user(crt, (u_int32_t __user *)arg))
                                         return -EFAULT;
 
-                                return matroxfb_wait_for_sync(PMINFO crt);
+                                return matroxfb_wait_for_sync(minfo, crt);
                         }
                 case MATROXFB_SET_OUTPUT_MODE:
                         {
@@ -916,8 +923,8 @@ static int matroxfb_ioctl(struct fb_info *info,
                                         return -EFAULT;
                                 if (mom.output >= MATROXFB_MAX_OUTPUTS)
                                         return -ENXIO;
-                                down_read(&ACCESS_FBINFO(altout.lock));
-                                oproc = ACCESS_FBINFO(outputs[mom.output]).output;
+                                down_read(&minfo->altout.lock);
+                                oproc = minfo->outputs[mom.output].output;
                                 if (!oproc) {
                                         val = -ENXIO;
                                 } else if (!oproc->verifymode) {
@@ -927,18 +934,18 @@ static int matroxfb_ioctl(struct fb_info *info,
                                                 val = -EINVAL;
                                         }
                                 } else {
-                                        val = oproc->verifymode(ACCESS_FBINFO(outputs[mom.output]).data, mom.mode);
+                                        val = oproc->verifymode(minfo->outputs[mom.output].data, mom.mode);
                                 }
                                 if (!val) {
-                                        if (ACCESS_FBINFO(outputs[mom.output]).mode != mom.mode) {
-                                                ACCESS_FBINFO(outputs[mom.output]).mode = mom.mode;
+                                        if (minfo->outputs[mom.output].mode != mom.mode) {
+                                                minfo->outputs[mom.output].mode = mom.mode;
                                                 val = 1;
                                         }
                                 }
-                                up_read(&ACCESS_FBINFO(altout.lock));
+                                up_read(&minfo->altout.lock);
                                 if (val != 1)
                                         return val;
-                                switch (ACCESS_FBINFO(outputs[mom.output]).src) {
+                                switch (minfo->outputs[mom.output].src) {
                                         case MATROXFB_SRC_CRTC1:
                                                 matroxfb_set_par(info);
                                                 break;
@@ -946,11 +953,11 @@ static int matroxfb_ioctl(struct fb_info *info,
                                                 {
                                                         struct matroxfb_dh_fb_info* crtc2;
 
-                                                        down_read(&ACCESS_FBINFO(crtc2.lock));
-                                                        crtc2 = ACCESS_FBINFO(crtc2.info);
+                                                        down_read(&minfo->crtc2.lock);
+                                                        crtc2 = minfo->crtc2.info;
                                                         if (crtc2)
                                                                 crtc2->fbcon.fbops->fb_set_par(&crtc2->fbcon);
-                                                        up_read(&ACCESS_FBINFO(crtc2.lock));
+                                                        up_read(&minfo->crtc2.lock);
                                                 }
                                                 break;
                                 }
@@ -966,15 +973,15 @@ static int matroxfb_ioctl(struct fb_info *info,
                                         return -EFAULT;
                                 if (mom.output >= MATROXFB_MAX_OUTPUTS)
                                         return -ENXIO;
-                                down_read(&ACCESS_FBINFO(altout.lock));
-                                oproc = ACCESS_FBINFO(outputs[mom.output]).output;
+                                down_read(&minfo->altout.lock);
+                                oproc = minfo->outputs[mom.output].output;
                                 if (!oproc) {
                                         val = -ENXIO;
                                 } else {
-                                        mom.mode = ACCESS_FBINFO(outputs[mom.output]).mode;
+                                        mom.mode = minfo->outputs[mom.output].mode;
                                         val = 0;
                                 }
-                                up_read(&ACCESS_FBINFO(altout.lock));
+                                up_read(&minfo->altout.lock);
                                 if (val)
                                         return val;
                                 if (copy_to_user(argp, &mom, sizeof(mom)))
@@ -993,9 +1000,9 @@ static int matroxfb_ioctl(struct fb_info *info,
                                         if (tmp & (1 << i)) {
                                                 if (i >= MATROXFB_MAX_OUTPUTS)
                                                         return -ENXIO;
-                                                if (!ACCESS_FBINFO(outputs[i]).output)
+                                                if (!minfo->outputs[i].output)
                                                         return -ENXIO;
-                                                switch (ACCESS_FBINFO(outputs[i]).src) {
+                                                switch (minfo->outputs[i].src) {
                                                         case MATROXFB_SRC_NONE:
                                                         case MATROXFB_SRC_CRTC1:
                                                                 break;
@@ -1004,12 +1011,12 @@ static int matroxfb_ioctl(struct fb_info *info,
                                                 }
                                         }
                                 }
-                                if (ACCESS_FBINFO(devflags.panellink)) {
+                                if (minfo->devflags.panellink) {
                                         if (tmp & MATROXFB_OUTPUT_CONN_DFP) {
                                                 if (tmp & MATROXFB_OUTPUT_CONN_SECONDARY)
                                                         return -EINVAL;
                                                 for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
-                                                        if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC2) {
+                                                        if (minfo->outputs[i].src == MATROXFB_SRC_CRTC2) {
                                                                 return -EBUSY;
                                                         }
                                                 }
@@ -1018,13 +1025,13 @@ static int matroxfb_ioctl(struct fb_info *info,
                                 changes = 0;
                                 for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
                                         if (tmp & (1 << i)) {
-                                                if (ACCESS_FBINFO(outputs[i]).src != MATROXFB_SRC_CRTC1) {
+                                                if (minfo->outputs[i].src != MATROXFB_SRC_CRTC1) {
                                                         changes = 1;
-                                                        ACCESS_FBINFO(outputs[i]).src = MATROXFB_SRC_CRTC1;
+                                                        minfo->outputs[i].src = MATROXFB_SRC_CRTC1;
                                                 }
-                                        } else if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC1) {
+                                        } else if (minfo->outputs[i].src == MATROXFB_SRC_CRTC1) {
                                                 changes = 1;
-                                                ACCESS_FBINFO(outputs[i]).src = MATROXFB_SRC_NONE;
+                                                minfo->outputs[i].src = MATROXFB_SRC_NONE;
                                         }
                                 }
                                 if (!changes)
@@ -1038,7 +1045,7 @@ static int matroxfb_ioctl(struct fb_info *info,
                                 int i;
 
                                 for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
-                                        if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC1) {
+                                        if (minfo->outputs[i].src == MATROXFB_SRC_CRTC1) {
                                                 conn |= 1 << i;
                                         }
                                 }
@@ -1052,8 +1059,8 @@ static int matroxfb_ioctl(struct fb_info *info,
                                 int i;
 
                                 for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
-                                        if (ACCESS_FBINFO(outputs[i]).output) {
-                                                switch (ACCESS_FBINFO(outputs[i]).src) {
+                                        if (minfo->outputs[i].output) {
+                                                switch (minfo->outputs[i].src) {
                                                         case MATROXFB_SRC_NONE:
                                                         case MATROXFB_SRC_CRTC1:
                                                                 conn |= 1 << i;
@@ -1061,7 +1068,7 @@ static int matroxfb_ioctl(struct fb_info *info,
                                                 }
                                         }
                                 }
-                                if (ACCESS_FBINFO(devflags.panellink)) {
+                                if (minfo->devflags.panellink) {
                                         if (conn & MATROXFB_OUTPUT_CONN_DFP)
                                                 conn &= ~MATROXFB_OUTPUT_CONN_SECONDARY;
                                         if (conn & MATROXFB_OUTPUT_CONN_SECONDARY)
@@ -1077,7 +1084,7 @@ static int matroxfb_ioctl(struct fb_info *info,
                                 int i;
 
                                 for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
-                                        if (ACCESS_FBINFO(outputs[i]).output) {
+                                        if (minfo->outputs[i].output) {
                                                 conn |= 1 << i;
                                         }
                                 }
@@ -1092,7 +1099,7 @@ static int matroxfb_ioctl(struct fb_info *info,
                                 memset(&r, 0, sizeof(r));
                                 strcpy(r.driver, "matroxfb");
                                 strcpy(r.card, "Matrox");
-                                sprintf(r.bus_info, "PCI:%s", pci_name(ACCESS_FBINFO(pcidev)));
+                                sprintf(r.bus_info, "PCI:%s", pci_name(minfo->pcidev));
                                 r.version = KERNEL_VERSION(1,0,0);
                                 r.capabilities = V4L2_CAP_VIDEO_OUTPUT;
                                 if (copy_to_user(argp, &r, sizeof(r)))
@@ -1108,15 +1115,15 @@ static int matroxfb_ioctl(struct fb_info *info,
                                 if (copy_from_user(&qctrl, argp, sizeof(qctrl)))
                                         return -EFAULT;
 
-                                down_read(&ACCESS_FBINFO(altout).lock);
-                                if (!ACCESS_FBINFO(outputs[1]).output) {
+                                down_read(&minfo->altout.lock);
+                                if (!minfo->outputs[1].output) {
                                         err = -ENXIO;
-                                } else if (ACCESS_FBINFO(outputs[1]).output->getqueryctrl) {
-                                        err = ACCESS_FBINFO(outputs[1]).output->getqueryctrl(ACCESS_FBINFO(outputs[1]).data, &qctrl);
+                                } else if (minfo->outputs[1].output->getqueryctrl) {
+                                        err = minfo->outputs[1].output->getqueryctrl(minfo->outputs[1].data, &qctrl);
                                 } else {
                                         err = -EINVAL;
                                 }
-                                up_read(&ACCESS_FBINFO(altout).lock);
+                                up_read(&minfo->altout.lock);
                                 if (err >= 0 &&
                                     copy_to_user(argp, &qctrl, sizeof(qctrl)))
                                         return -EFAULT;
@@ -1130,15 +1137,15 @@ static int matroxfb_ioctl(struct fb_info *info,
                                 if (copy_from_user(&ctrl, argp, sizeof(ctrl)))
                                         return -EFAULT;
 
-                                down_read(&ACCESS_FBINFO(altout).lock);
-                                if (!ACCESS_FBINFO(outputs[1]).output) {
+                                down_read(&minfo->altout.lock);
+                                if (!minfo->outputs[1].output) {
                                         err = -ENXIO;
-                                } else if (ACCESS_FBINFO(outputs[1]).output->getctrl) {
-                                        err = ACCESS_FBINFO(outputs[1]).output->getctrl(ACCESS_FBINFO(outputs[1]).data, &ctrl);
+                                } else if (minfo->outputs[1].output->getctrl) {
+                                        err = minfo->outputs[1].output->getctrl(minfo->outputs[1].data, &ctrl);
                                 } else {
                                         err = -EINVAL;
                                 }
-                                up_read(&ACCESS_FBINFO(altout).lock);
+                                up_read(&minfo->altout.lock);
                                 if (err >= 0 &&
                                     copy_to_user(argp, &ctrl, sizeof(ctrl)))
                                         return -EFAULT;
@@ -1153,15 +1160,15 @@ static int matroxfb_ioctl(struct fb_info *info,
                                 if (copy_from_user(&ctrl, argp, sizeof(ctrl)))
                                         return -EFAULT;
 
-                                down_read(&ACCESS_FBINFO(altout).lock);
-                                if (!ACCESS_FBINFO(outputs[1]).output) {
+                                down_read(&minfo->altout.lock);
+                                if (!minfo->outputs[1].output) {
                                         err = -ENXIO;
-                                } else if (ACCESS_FBINFO(outputs[1]).output->setctrl) {
-                                        err = ACCESS_FBINFO(outputs[1]).output->setctrl(ACCESS_FBINFO(outputs[1]).data, &ctrl);
+                                } else if (minfo->outputs[1].output->setctrl) {
+                                        err = minfo->outputs[1].output->setctrl(minfo->outputs[1].data, &ctrl);
                                 } else {
                                         err = -EINVAL;
                                 }
-                                up_read(&ACCESS_FBINFO(altout).lock);
+                                up_read(&minfo->altout.lock);
                                 return err;
                         }
         }
@@ -1175,11 +1182,11 @@ static int matroxfb_blank(int blank, struct fb_info *info)
         int seq;
         int crtc;
         CRITFLAGS
-        MINFO_FROM_INFO(info);
+        struct matrox_fb_info *minfo = info2minfo(info);
 
         DBG(__func__)
 
-        if (ACCESS_FBINFO(dead))
+        if (minfo->dead)
                 return 1;
 
         switch (blank) {
@@ -1281,7 +1288,9 @@ static char outputs[8];			/* "matrox:outputs:xxx" */
 static char videomode[64];              /* "matrox:mode:xxxxx" or "matrox:xxxxx" */
 #endif
 
-static int matroxfb_getmemory(WPMINFO unsigned int maxSize, unsigned int *realSize){
+static int matroxfb_getmemory(struct matrox_fb_info *minfo,
+                              unsigned int maxSize, unsigned int *realSize)
+{
         vaddr_t vm;
         unsigned int offs;
         unsigned int offs2;
@@ -1291,7 +1300,7 @@ static int matroxfb_getmemory(WPMINFO unsigned int maxSize, unsigned int *realSi
 
         DBG(__func__)
 
-        vm = ACCESS_FBINFO(video.vbase);
+        vm = minfo->video.vbase;
         maxSize &= ~0x1FFFFF;   /* must be X*2MB (really it must be 2 or X*4MB) */
         /* at least 2MB */
         if (maxSize < 0x0200000) return 0;
@@ -1323,7 +1332,7 @@ static int matroxfb_getmemory(WPMINFO unsigned int maxSize, unsigned int *realSi
 
         *realSize = offs - 0x100000;
 #ifdef CONFIG_FB_MATROX_MILLENIUM
-        ACCESS_FBINFO(interleave) = !(!isMillenium(MINFO) || ((offs - 0x100000) & 0x3FFFFF));
+        minfo->interleave = !(!isMillenium(minfo) || ((offs - 0x100000) & 0x3FFFFF));
 #endif
         return 1;
 }
@@ -1345,13 +1354,9 @@ static struct video_board vbMystique		= {0x0800000, 0x0800000, FB_ACCEL_MATROX_M
 #ifdef CONFIG_FB_MATROX_G
 static struct video_board vbG100                = {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGAG100,       &matrox_G100};
 static struct video_board vbG200                = {0x1000000, 0x1000000, FB_ACCEL_MATROX_MGAG200,       &matrox_G100};
-#ifdef CONFIG_FB_MATROX_32MB
 /* from doc it looks like that accelerator can draw only to low 16MB :-( Direct accesses & displaying are OK for
    whole 32MB */
 static struct video_board vbG400                = {0x2000000, 0x1000000, FB_ACCEL_MATROX_MGAG400,       &matrox_G100};
-#else
-static struct video_board vbG400                = {0x2000000, 0x1000000, FB_ACCEL_MATROX_MGAG400,       &matrox_G100};
-#endif
 #endif
 
 #define DEVF_VIDEO64BIT         0x0001
@@ -1558,16 +1563,17 @@ static struct fb_videomode defaultmode = {
 
 static int hotplug = 0;
 
-static void setDefaultOutputs(WPMINFO2) {
+static void setDefaultOutputs(struct matrox_fb_info *minfo)
+{
         unsigned int i;
         const char* ptr;
 
-        ACCESS_FBINFO(outputs[0]).default_src = MATROXFB_SRC_CRTC1;
-        if (ACCESS_FBINFO(devflags.g450dac)) {
-                ACCESS_FBINFO(outputs[1]).default_src = MATROXFB_SRC_CRTC1;
-                ACCESS_FBINFO(outputs[2]).default_src = MATROXFB_SRC_CRTC1;
+        minfo->outputs[0].default_src = MATROXFB_SRC_CRTC1;
+        if (minfo->devflags.g450dac) {
+                minfo->outputs[1].default_src = MATROXFB_SRC_CRTC1;
+                minfo->outputs[2].default_src = MATROXFB_SRC_CRTC1;
         } else if (dfp) {
-                ACCESS_FBINFO(outputs[2]).default_src = MATROXFB_SRC_CRTC1;
+                minfo->outputs[2].default_src = MATROXFB_SRC_CRTC1;
         }
         ptr = outputs;
         for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
@@ -1577,11 +1583,11 @@ static void setDefaultOutputs(WPMINFO2) {
                         break;
                 }
                 if (c == '0') {
-                        ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_NONE;
+                        minfo->outputs[i].default_src = MATROXFB_SRC_NONE;
                 } else if (c == '1') {
-                        ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_CRTC1;
-                } else if (c == '2' && ACCESS_FBINFO(devflags.crtc2)) {
-                        ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_CRTC2;
+                        minfo->outputs[i].default_src = MATROXFB_SRC_CRTC1;
+                } else if (c == '2' && minfo->devflags.crtc2) {
+                        minfo->outputs[i].default_src = MATROXFB_SRC_CRTC2;
                 } else {
                         printk(KERN_ERR "matroxfb: Unknown outputs setting\n");
                         break;
@@ -1591,7 +1597,8 @@ static void setDefaultOutputs(WPMINFO2) {
         outputs[0] = 0;
 }
 
-static int initMatrox2(WPMINFO struct board* b){
+static int initMatrox2(struct matrox_fb_info *minfo, struct board *b)
+{
         unsigned long ctrlptr_phys = 0;
         unsigned long video_base_phys = 0;
         unsigned int memsize;
@@ -1607,58 +1614,56 @@ static int initMatrox2(WPMINFO struct board* b){
         /* set default values... */
         vesafb_defined.accel_flags = FB_ACCELF_TEXT;
 
-        ACCESS_FBINFO(hw_switch) = b->base->lowlevel;
-        ACCESS_FBINFO(devflags.accelerator) = b->base->accelID;
-        ACCESS_FBINFO(max_pixel_clock) = b->maxclk;
+        minfo->hw_switch = b->base->lowlevel;
+        minfo->devflags.accelerator = b->base->accelID;
+        minfo->max_pixel_clock = b->maxclk;
 
         printk(KERN_INFO "matroxfb: Matrox %s detected\n", b->name);
-        ACCESS_FBINFO(capable.plnwt) = 1;
-        ACCESS_FBINFO(chip) = b->chip;
-        ACCESS_FBINFO(capable.srcorg) = b->flags & DEVF_SRCORG;
-        ACCESS_FBINFO(devflags.video64bits) = b->flags & DEVF_VIDEO64BIT;
+        minfo->capable.plnwt = 1;
+        minfo->chip = b->chip;
+        minfo->capable.srcorg = b->flags & DEVF_SRCORG;
+        minfo->devflags.video64bits = b->flags & DEVF_VIDEO64BIT;
         if (b->flags & DEVF_TEXT4B) {
-                ACCESS_FBINFO(devflags.vgastep) = 4;
-                ACCESS_FBINFO(devflags.textmode) = 4;
-                ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP16;
+                minfo->devflags.vgastep = 4;
+                minfo->devflags.textmode = 4;
+                minfo->devflags.text_type_aux = FB_AUX_TEXT_MGA_STEP16;
         } else if (b->flags & DEVF_TEXT16B) {
-                ACCESS_FBINFO(devflags.vgastep) = 16;
-                ACCESS_FBINFO(devflags.textmode) = 1;
-                ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP16;
+                minfo->devflags.vgastep = 16;
+                minfo->devflags.textmode = 1;
+                minfo->devflags.text_type_aux = FB_AUX_TEXT_MGA_STEP16;
         } else {
-                ACCESS_FBINFO(devflags.vgastep) = 8;
-                ACCESS_FBINFO(devflags.textmode) = 1;
-                ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP8;
-        }
-#ifdef CONFIG_FB_MATROX_32MB
-        ACCESS_FBINFO(devflags.support32MB) = (b->flags & DEVF_SUPPORT32MB) != 0;
-#endif
-        ACCESS_FBINFO(devflags.precise_width) = !(b->flags & DEVF_ANY_VXRES);
-        ACCESS_FBINFO(devflags.crtc2) = (b->flags & DEVF_CRTC2) != 0;
-        ACCESS_FBINFO(devflags.maven_capable) = (b->flags & DEVF_MAVEN_CAPABLE) != 0;
-        ACCESS_FBINFO(devflags.dualhead) = (b->flags & DEVF_DUALHEAD) != 0;
-        ACCESS_FBINFO(devflags.dfp_type) = dfp_type;
-        ACCESS_FBINFO(devflags.g450dac) = (b->flags & DEVF_G450DAC) != 0;
-        ACCESS_FBINFO(devflags.textstep) = ACCESS_FBINFO(devflags.vgastep) * ACCESS_FBINFO(devflags.textmode);
-        ACCESS_FBINFO(devflags.textvram) = 65536 / ACCESS_FBINFO(devflags.textmode);
-        setDefaultOutputs(PMINFO2);
+                minfo->devflags.vgastep = 8;
+                minfo->devflags.textmode = 1;
+                minfo->devflags.text_type_aux = FB_AUX_TEXT_MGA_STEP8;
+        }
+        minfo->devflags.support32MB = (b->flags & DEVF_SUPPORT32MB) != 0;
+        minfo->devflags.precise_width = !(b->flags & DEVF_ANY_VXRES);
+        minfo->devflags.crtc2 = (b->flags & DEVF_CRTC2) != 0;
+        minfo->devflags.maven_capable = (b->flags & DEVF_MAVEN_CAPABLE) != 0;
+        minfo->devflags.dualhead = (b->flags & DEVF_DUALHEAD) != 0;
+        minfo->devflags.dfp_type = dfp_type;
+        minfo->devflags.g450dac = (b->flags & DEVF_G450DAC) != 0;
+        minfo->devflags.textstep = minfo->devflags.vgastep * minfo->devflags.textmode;
+        minfo->devflags.textvram = 65536 / minfo->devflags.textmode;
+        setDefaultOutputs(minfo);
         if (b->flags & DEVF_PANELLINK_CAPABLE) {
-                ACCESS_FBINFO(outputs[2]).data = MINFO;
-                ACCESS_FBINFO(outputs[2]).output = &panellink_output;
-                ACCESS_FBINFO(outputs[2]).src = ACCESS_FBINFO(outputs[2]).default_src;
-                ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
-                ACCESS_FBINFO(devflags.panellink) = 1;
+                minfo->outputs[2].data = minfo;
+                minfo->outputs[2].output = &panellink_output;
+                minfo->outputs[2].src = minfo->outputs[2].default_src;
+                minfo->outputs[2].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+                minfo->devflags.panellink = 1;
         }
 
-        if (ACCESS_FBINFO(capable.cross4MB) < 0)
-                ACCESS_FBINFO(capable.cross4MB) = b->flags & DEVF_CROSS4MB;
+        if (minfo->capable.cross4MB < 0)
+                minfo->capable.cross4MB = b->flags & DEVF_CROSS4MB;
         if (b->flags & DEVF_SWAPS) {
-                ctrlptr_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 1);
-                video_base_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 0);
-                ACCESS_FBINFO(devflags.fbResource) = PCI_BASE_ADDRESS_0;
+                ctrlptr_phys = pci_resource_start(minfo->pcidev, 1);
+                video_base_phys = pci_resource_start(minfo->pcidev, 0);
+                minfo->devflags.fbResource = PCI_BASE_ADDRESS_0;
         } else {
-                ctrlptr_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 0);
-                video_base_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 1);
-                ACCESS_FBINFO(devflags.fbResource) = PCI_BASE_ADDRESS_1;
+                ctrlptr_phys = pci_resource_start(minfo->pcidev, 0);
+                video_base_phys = pci_resource_start(minfo->pcidev, 1);
+                minfo->devflags.fbResource = PCI_BASE_ADDRESS_1;
         }
         err = -EINVAL;
         if (!ctrlptr_phys) {
@@ -1676,7 +1681,7 @@ static int initMatrox2(WPMINFO struct board* b){
         if (!request_mem_region(video_base_phys, memsize, "matroxfb FB")) {
                 goto failCtrlMR;
         }
-        ACCESS_FBINFO(video.len_maximum) = memsize;
+        minfo->video.len_maximum = memsize;
         /* convert mem (autodetect k, M) */
         if (mem < 1024) mem *= 1024;
         if (mem < 0x00100000) mem *= 1024;
@@ -1684,14 +1689,14 @@ static int initMatrox2(WPMINFO struct board* b){
         if (mem && (mem < memsize))
                 memsize = mem;
         err = -ENOMEM;
-        if (mga_ioremap(ctrlptr_phys, 16384, MGA_IOREMAP_MMIO, &ACCESS_FBINFO(mmio.vbase))) {
+        if (mga_ioremap(ctrlptr_phys, 16384, MGA_IOREMAP_MMIO, &minfo->mmio.vbase)) {
                 printk(KERN_ERR "matroxfb: cannot ioremap(%lX, 16384), matroxfb disabled\n", ctrlptr_phys);
                 goto failVideoMR;
         }
-        ACCESS_FBINFO(mmio.base) = ctrlptr_phys;
-        ACCESS_FBINFO(mmio.len) = 16384;
-        ACCESS_FBINFO(video.base) = video_base_phys;
-        if (mga_ioremap(video_base_phys, memsize, MGA_IOREMAP_FB, &ACCESS_FBINFO(video.vbase))) {
+        minfo->mmio.base = ctrlptr_phys;
+        minfo->mmio.len = 16384;
+        minfo->video.base = video_base_phys;
+        if (mga_ioremap(video_base_phys, memsize, MGA_IOREMAP_FB, &minfo->video.vbase)) {
                 printk(KERN_ERR "matroxfb: cannot ioremap(%lX, %d), matroxfb disabled\n",
                         video_base_phys, memsize);
                 goto failCtrlIO;
@@ -1700,63 +1705,63 @@ static int initMatrox2(WPMINFO struct board* b){
                 u_int32_t cmd;
                 u_int32_t mga_option;
 
-                pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, &mga_option);
-                pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_COMMAND, &cmd);
+                pci_read_config_dword(minfo->pcidev, PCI_OPTION_REG, &mga_option);
+                pci_read_config_dword(minfo->pcidev, PCI_COMMAND, &cmd);
                 mga_option &= 0x7FFFFFFF; /* clear BIG_ENDIAN */
                 mga_option |= MX_OPTION_BSWAP;
                 /* disable palette snooping */
                 cmd &= ~PCI_COMMAND_VGA_PALETTE;
                 if (pci_dev_present(intel_82437)) {
-                        if (!(mga_option & 0x20000000) && !ACCESS_FBINFO(devflags.nopciretry)) {
+                        if (!(mga_option & 0x20000000) && !minfo->devflags.nopciretry) {
                                 printk(KERN_WARNING "matroxfb: Disabling PCI retries due to i82437 present\n");
                         }
                         mga_option |= 0x20000000;
-                        ACCESS_FBINFO(devflags.nopciretry) = 1;
+                        minfo->devflags.nopciretry = 1;
                 }
-                pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_COMMAND, cmd);
-                pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mga_option);
-                ACCESS_FBINFO(hw).MXoptionReg = mga_option;
+                pci_write_config_dword(minfo->pcidev, PCI_COMMAND, cmd);
+                pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mga_option);
+                minfo->hw.MXoptionReg = mga_option;
 
                 /* select non-DMA memory for PCI_MGA_DATA, otherwise dump of PCI cfg space can lock PCI bus */
                 /* maybe preinit() candidate, but it is same... for all devices... at this time... */
-                pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MGA_INDEX, 0x00003C00);
+                pci_write_config_dword(minfo->pcidev, PCI_MGA_INDEX, 0x00003C00);
         }
 
         err = -ENXIO;
-        matroxfb_read_pins(PMINFO2);
-        if (ACCESS_FBINFO(hw_switch)->preinit(PMINFO2)) {
+        matroxfb_read_pins(minfo);
+        if (minfo->hw_switch->preinit(minfo)) {
                 goto failVideoIO;
         }
 
         err = -ENOMEM;
-        if (!matroxfb_getmemory(PMINFO memsize, &ACCESS_FBINFO(video.len)) || !ACCESS_FBINFO(video.len)) {
+        if (!matroxfb_getmemory(minfo, memsize, &minfo->video.len) || !minfo->video.len) {
                 printk(KERN_ERR "matroxfb: cannot determine memory size\n");
                 goto failVideoIO;
         }
-        ACCESS_FBINFO(devflags.ydstorg) = 0;
+        minfo->devflags.ydstorg = 0;
 
-        ACCESS_FBINFO(video.base) = video_base_phys;
-        ACCESS_FBINFO(video.len_usable) = ACCESS_FBINFO(video.len);
-        if (ACCESS_FBINFO(video.len_usable) > b->base->maxdisplayable)
-                ACCESS_FBINFO(video.len_usable) = b->base->maxdisplayable;
+        minfo->video.base = video_base_phys;
+        minfo->video.len_usable = minfo->video.len;
+        if (minfo->video.len_usable > b->base->maxdisplayable)
+                minfo->video.len_usable = b->base->maxdisplayable;
 #ifdef CONFIG_MTRR
         if (mtrr) {
-                ACCESS_FBINFO(mtrr.vram) = mtrr_add(video_base_phys, ACCESS_FBINFO(video.len), MTRR_TYPE_WRCOMB, 1);
-                ACCESS_FBINFO(mtrr.vram_valid) = 1;
+                minfo->mtrr.vram = mtrr_add(video_base_phys, minfo->video.len, MTRR_TYPE_WRCOMB, 1);
+                minfo->mtrr.vram_valid = 1;
                 printk(KERN_INFO "matroxfb: MTRR's turned on\n");
         }
 #endif  /* CONFIG_MTRR */
 
-        if (!ACCESS_FBINFO(devflags.novga))
+        if (!minfo->devflags.novga)
                 request_region(0x3C0, 32, "matrox");
-        matroxfb_g450_connect(PMINFO2);
-        ACCESS_FBINFO(hw_switch->reset(PMINFO2));
+        matroxfb_g450_connect(minfo);
+        minfo->hw_switch->reset(minfo);
 
-        ACCESS_FBINFO(fbcon.monspecs.hfmin) = 0;
-        ACCESS_FBINFO(fbcon.monspecs.hfmax) = fh;
-        ACCESS_FBINFO(fbcon.monspecs.vfmin) = 0;
-        ACCESS_FBINFO(fbcon.monspecs.vfmax) = fv;
-        ACCESS_FBINFO(fbcon.monspecs.dpms) = 0; /* TBD */
+        minfo->fbcon.monspecs.hfmin = 0;
+        minfo->fbcon.monspecs.hfmax = fh;
+        minfo->fbcon.monspecs.vfmin = 0;
+        minfo->fbcon.monspecs.vfmax = fv;
+        minfo->fbcon.monspecs.dpms = 0; /* TBD */
 
         /* static settings */
         vesafb_defined.red = colors[depth-1].red;
@@ -1768,24 +1773,24 @@ static int initMatrox2(WPMINFO struct board* b){
         if (noaccel)
                 vesafb_defined.accel_flags &= ~FB_ACCELF_TEXT;
 
-        ACCESS_FBINFO(fbops) = matroxfb_ops;
-        ACCESS_FBINFO(fbcon.fbops) = &ACCESS_FBINFO(fbops);
-        ACCESS_FBINFO(fbcon.pseudo_palette) = ACCESS_FBINFO(cmap);
+        minfo->fbops = matroxfb_ops;
+        minfo->fbcon.fbops = &minfo->fbops;
+        minfo->fbcon.pseudo_palette = minfo->cmap;
         /* after __init time we are like module... no logo */
-        ACCESS_FBINFO(fbcon.flags) = hotplug ? FBINFO_FLAG_MODULE : FBINFO_FLAG_DEFAULT;
-        ACCESS_FBINFO(fbcon.flags) |= FBINFO_PARTIAL_PAN_OK |    /* Prefer panning for scroll under MC viewer/edit */
+        minfo->fbcon.flags = hotplug ? FBINFO_FLAG_MODULE : FBINFO_FLAG_DEFAULT;
+        minfo->fbcon.flags |= FBINFO_PARTIAL_PAN_OK |    /* Prefer panning for scroll under MC viewer/edit */
                                       FBINFO_HWACCEL_COPYAREA |  /* We have hw-assisted bmove */
                                       FBINFO_HWACCEL_FILLRECT |  /* And fillrect */
                                       FBINFO_HWACCEL_IMAGEBLIT | /* And imageblit */
                                       FBINFO_HWACCEL_XPAN |      /* And we support both horizontal */
                                       FBINFO_HWACCEL_YPAN;       /* And vertical panning */
-        ACCESS_FBINFO(video.len_usable) &= PAGE_MASK;
-        fb_alloc_cmap(&ACCESS_FBINFO(fbcon.cmap), 256, 1);
+        minfo->video.len_usable &= PAGE_MASK;
+        fb_alloc_cmap(&minfo->fbcon.cmap, 256, 1);
 
 #ifndef MODULE
         /* mode database is marked __init!!! */
         if (!hotplug) {
-                fb_find_mode(&vesafb_defined, &ACCESS_FBINFO(fbcon), videomode[0]?videomode:NULL,
+                fb_find_mode(&vesafb_defined, &minfo->fbcon, videomode[0] ? videomode : NULL,
                         NULL, 0, &defaultmode, vesafb_defined.bits_per_pixel);
         }
 #endif /* !MODULE */
@@ -1874,52 +1879,52 @@ static int initMatrox2(WPMINFO struct board* b){
                 vesafb_defined.yres_virtual = 65536; /* large enough to be INF, but small enough
                                                         to yres_virtual * xres_virtual < 2^32 */
         }
-        matroxfb_init_fix(PMINFO2);
-        ACCESS_FBINFO(fbcon.screen_base) = vaddr_va(ACCESS_FBINFO(video.vbase));
+        matroxfb_init_fix(minfo);
+        minfo->fbcon.screen_base = vaddr_va(minfo->video.vbase);
         /* Normalize values (namely yres_virtual) */
-        matroxfb_check_var(&vesafb_defined, &ACCESS_FBINFO(fbcon));
+        matroxfb_check_var(&vesafb_defined, &minfo->fbcon);
         /* And put it into "current" var. Do NOT program hardware yet, or we'll not take over
          * vgacon correctly. fbcon_startup will call fb_set_par for us, WITHOUT check_var,
          * and unfortunately it will do it BEFORE vgacon contents is saved, so it won't work
          * anyway. But we at least tried... */
-        ACCESS_FBINFO(fbcon.var) = vesafb_defined;
+        minfo->fbcon.var = vesafb_defined;
         err = -EINVAL;
 
         printk(KERN_INFO "matroxfb: %dx%dx%dbpp (virtual: %dx%d)\n",
                 vesafb_defined.xres, vesafb_defined.yres, vesafb_defined.bits_per_pixel,
                 vesafb_defined.xres_virtual, vesafb_defined.yres_virtual);
         printk(KERN_INFO "matroxfb: framebuffer at 0x%lX, mapped to 0x%p, size %d\n",
-                ACCESS_FBINFO(video.base), vaddr_va(ACCESS_FBINFO(video.vbase)), ACCESS_FBINFO(video.len));
+                minfo->video.base, vaddr_va(minfo->video.vbase), minfo->video.len);
 
 /* We do not have to set currcon to 0... register_framebuffer do it for us on first console
  * and we do not want currcon == 0 for subsequent framebuffers */
 
-        ACCESS_FBINFO(fbcon).device = &ACCESS_FBINFO(pcidev)->dev;
-        if (register_framebuffer(&ACCESS_FBINFO(fbcon)) < 0) {
+        minfo->fbcon.device = &minfo->pcidev->dev;
+        if (register_framebuffer(&minfo->fbcon) < 0) {
                 goto failVideoIO;
         }
         printk("fb%d: %s frame buffer device\n",
-               ACCESS_FBINFO(fbcon.node), ACCESS_FBINFO(fbcon.fix.id));
+               minfo->fbcon.node, minfo->fbcon.fix.id);
 
         /* there is no console on this fb... but we have to initialize hardware
          * until someone tells me what is proper thing to do */
-        if (!ACCESS_FBINFO(initialized)) {
+        if (!minfo->initialized) {
                 printk(KERN_INFO "fb%d: initializing hardware\n",
-                       ACCESS_FBINFO(fbcon.node));
+                       minfo->fbcon.node);
                 /* We have to use FB_ACTIVATE_FORCE, as we had to put vesafb_defined to the fbcon.var
                  * already before, so register_framebuffer works correctly. */
                 vesafb_defined.activate |= FB_ACTIVATE_FORCE;
-                fb_set_var(&ACCESS_FBINFO(fbcon), &vesafb_defined);
+                fb_set_var(&minfo->fbcon, &vesafb_defined);
         }
 
         return 0;
 failVideoIO:;
-        matroxfb_g450_shutdown(PMINFO2);
-        mga_iounmap(ACCESS_FBINFO(video.vbase));
+        matroxfb_g450_shutdown(minfo);
+        mga_iounmap(minfo->video.vbase);
 failCtrlIO:;
-        mga_iounmap(ACCESS_FBINFO(mmio.vbase));
+        mga_iounmap(minfo->mmio.vbase);
 failVideoMR:;
-        release_mem_region(video_base_phys, ACCESS_FBINFO(video.len_maximum));
+        release_mem_region(video_base_phys, minfo->video.len_maximum);
 failCtrlMR:;
         release_mem_region(ctrlptr_phys, 16384);
 fail:;
@@ -1975,7 +1980,7 @@ void matroxfb_unregister_driver(struct matroxfb_driver* drv) {
 static void matroxfb_register_device(struct matrox_fb_info* minfo) {
         struct matroxfb_driver* drv;
         int i = 0;
-        list_add(&ACCESS_FBINFO(next_fb), &matroxfb_list);
+        list_add(&minfo->next_fb, &matroxfb_list);
         for (drv = matroxfb_driver_l(matroxfb_driver_list.next);
              drv != matroxfb_driver_l(&matroxfb_driver_list);
              drv = matroxfb_driver_l(drv->node.next)) {
@@ -1995,7 +2000,7 @@ static void matroxfb_register_device(struct matrox_fb_info* minfo) {
 static void matroxfb_unregister_device(struct matrox_fb_info* minfo) {
         int i;
 
-        list_del(&ACCESS_FBINFO(next_fb));
+        list_del(&minfo->next_fb);
         for (i = 0; i < minfo->drivers_count; i++) {
                 struct matroxfb_driver* drv = minfo->drivers[i];
 
@@ -2011,9 +2016,6 @@ static int matroxfb_probe(struct pci_dev* pdev, const struct pci_device_id* dumm
         struct matrox_fb_info* minfo;
         int err;
         u_int32_t cmd;
-#ifndef CONFIG_FB_MATROX_MULTIHEAD
-        static int registered = 0;
-#endif
         DBG(__func__)
 
         svid = pdev->subsystem_vendor;
@@ -2037,68 +2039,57 @@ static int matroxfb_probe(struct pci_dev* pdev, const struct pci_device_id* dumm
                 return -1;
         }
 
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
         minfo = kmalloc(sizeof(*minfo), GFP_KERNEL);
         if (!minfo)
                 return -1;
-#else
-        if (registered) /* singlehead driver... */
-                return -1;
-        minfo = &matroxfb_global_mxinfo;
-#endif
-        memset(MINFO, 0, sizeof(*MINFO));
+        memset(minfo, 0, sizeof(*minfo));
 
-        ACCESS_FBINFO(pcidev) = pdev;
-        ACCESS_FBINFO(dead) = 0;
-        ACCESS_FBINFO(usecount) = 0;
-        ACCESS_FBINFO(userusecount) = 0;
+        minfo->pcidev = pdev;
+        minfo->dead = 0;
+        minfo->usecount = 0;
+        minfo->userusecount = 0;
 
-        pci_set_drvdata(pdev, MINFO);
+        pci_set_drvdata(pdev, minfo);
         /* DEVFLAGS */
-        ACCESS_FBINFO(devflags.memtype) = memtype;
+        minfo->devflags.memtype = memtype;
         if (memtype != -1)
                 noinit = 0;
         if (cmd & PCI_COMMAND_MEMORY) {
-                ACCESS_FBINFO(devflags.novga) = novga;
-                ACCESS_FBINFO(devflags.nobios) = nobios;
-                ACCESS_FBINFO(devflags.noinit) = noinit;
+                minfo->devflags.novga = novga;
+                minfo->devflags.nobios = nobios;
+                minfo->devflags.noinit = noinit;
                 /* subsequent heads always needs initialization and must not enable BIOS */
                 novga = 1;
                 nobios = 1;
                 noinit = 0;
         } else {
-                ACCESS_FBINFO(devflags.novga) = 1;
-                ACCESS_FBINFO(devflags.nobios) = 1;
-                ACCESS_FBINFO(devflags.noinit) = 0;
-        }
-
-        ACCESS_FBINFO(devflags.nopciretry) = no_pci_retry;
-        ACCESS_FBINFO(devflags.mga_24bpp_fix) = inv24;
-        ACCESS_FBINFO(devflags.precise_width) = option_precise_width;
-        ACCESS_FBINFO(devflags.sgram) = sgram;
-        ACCESS_FBINFO(capable.cross4MB) = cross4MB;
-
-        spin_lock_init(&ACCESS_FBINFO(lock.DAC));
-        spin_lock_init(&ACCESS_FBINFO(lock.accel));
-        init_rwsem(&ACCESS_FBINFO(crtc2.lock));
-        init_rwsem(&ACCESS_FBINFO(altout.lock));
-        mutex_init(&ACCESS_FBINFO(fbcon).mm_lock);
-        ACCESS_FBINFO(irq_flags) = 0;
-        init_waitqueue_head(&ACCESS_FBINFO(crtc1.vsync.wait));
-        init_waitqueue_head(&ACCESS_FBINFO(crtc2.vsync.wait));
-        ACCESS_FBINFO(crtc1.panpos) = -1;
-
-        err = initMatrox2(PMINFO b);
+                minfo->devflags.novga = 1;
+                minfo->devflags.nobios = 1;
+                minfo->devflags.noinit = 0;
+        }
+
+        minfo->devflags.nopciretry = no_pci_retry;
+        minfo->devflags.mga_24bpp_fix = inv24;
+        minfo->devflags.precise_width = option_precise_width;
+        minfo->devflags.sgram = sgram;
+        minfo->capable.cross4MB = cross4MB;
+
+        spin_lock_init(&minfo->lock.DAC);
+        spin_lock_init(&minfo->lock.accel);
+        init_rwsem(&minfo->crtc2.lock);
+        init_rwsem(&minfo->altout.lock);
+        mutex_init(&minfo->fbcon.mm_lock);
+        minfo->irq_flags = 0;
+        init_waitqueue_head(&minfo->crtc1.vsync.wait);
+        init_waitqueue_head(&minfo->crtc2.vsync.wait);
+        minfo->crtc1.panpos = -1;
+
+        err = initMatrox2(minfo, b);
         if (!err) {
-#ifndef CONFIG_FB_MATROX_MULTIHEAD
-                registered = 1;
-#endif
-                matroxfb_register_device(MINFO);
+                matroxfb_register_device(minfo);
                 return 0;
         }
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
         kfree(minfo);
-#endif
         return -1;
 }
 
@@ -2106,7 +2097,7 @@ static void pci_remove_matrox(struct pci_dev* pdev) {
         struct matrox_fb_info* minfo;
 
         minfo = pci_get_drvdata(pdev);
-        matroxfb_remove(PMINFO 1);
+        matroxfb_remove(minfo, 1);
 }
 
 static struct pci_device_id matroxfb_devices[] = {
@@ -2510,13 +2501,8 @@ module_param(inv24, int, 0);
 MODULE_PARM_DESC(inv24, "Inverts clock polarity for 24bpp and loop frequency > 100MHz (default=do not invert polarity)");
 module_param(inverse, int, 0);
 MODULE_PARM_DESC(inverse, "Inverse (0 or 1) (default=0)");
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
 module_param(dev, int, 0);
 MODULE_PARM_DESC(dev, "Multihead support, attach to device ID (0..N) (default=all working)");
-#else
-module_param(dev, int, 0);
-MODULE_PARM_DESC(dev, "Multihead support, attach to device ID (0..N) (default=first working)");
-#endif
 module_param(vesa, int, 0);
 MODULE_PARM_DESC(vesa, "Startup videomode (0x000-0x1FF) (default=0x101)");
 module_param(xres, int, 0);
diff --git a/drivers/video/matrox/matroxfb_base.h b/drivers/video/matrox/matroxfb_base.h
index 95883236c0cd..f3a4e15672d9 100644
--- a/drivers/video/matrox/matroxfb_base.h
+++ b/drivers/video/matrox/matroxfb_base.h
@@ -54,9 +54,6 @@
 #include "../macmodes.h"
 #endif
 
-/* always compile support for 32MB... It cost almost nothing */
-#define CONFIG_FB_MATROX_32MB
-
 #ifdef MATROXFB_DEBUG
 
 #define DEBUG
@@ -464,9 +461,7 @@ struct matrox_fb_info {
                 int             nopciretry;
                 int             noinit;
                 int             sgram;
-#ifdef CONFIG_FB_MATROX_32MB
                 int             support32MB;
-#endif
 
                 int             accelerator;
                 int             text_type_aux;
@@ -524,47 +519,11 @@ struct matrox_fb_info {
 
 #define info2minfo(info) container_of(info, struct matrox_fb_info, fbcon)
 
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
-#define ACCESS_FBINFO2(info, x) (info->x)
-#define ACCESS_FBINFO(x) ACCESS_FBINFO2(minfo,x)
-
-#define MINFO minfo
-
-#define WPMINFO2 struct matrox_fb_info* minfo
-#define WPMINFO  WPMINFO2 ,
-#define CPMINFO2 const struct matrox_fb_info* minfo
-#define CPMINFO  CPMINFO2 ,
-#define PMINFO2  minfo
-#define PMINFO   PMINFO2 ,
-
-#define MINFO_FROM(x)      struct matrox_fb_info* minfo = x
-#else
-
-extern struct matrox_fb_info matroxfb_global_mxinfo;
-
-#define ACCESS_FBINFO(x) (matroxfb_global_mxinfo.x)
-#define ACCESS_FBINFO2(info, x) (matroxfb_global_mxinfo.x)
-
-#define MINFO (&matroxfb_global_mxinfo)
-
-#define WPMINFO2 void
-#define WPMINFO
-#define CPMINFO2 void
-#define CPMINFO
-#define PMINFO2
-#define PMINFO
-
-#define MINFO_FROM(x)
-
-#endif
-
-#define MINFO_FROM_INFO(x) MINFO_FROM(info2minfo(x))
-
 struct matrox_switch {
-        int     (*preinit)(WPMINFO2);
-        void    (*reset)(WPMINFO2);
-        int     (*init)(WPMINFO struct my_timming*);
-        void    (*restore)(WPMINFO2);
+        int     (*preinit)(struct matrox_fb_info *minfo);
+        void    (*reset)(struct matrox_fb_info *minfo);
+        int     (*init)(struct matrox_fb_info *minfo, struct my_timming*);
+        void    (*restore)(struct matrox_fb_info *minfo);
 };
 
 struct matroxfb_driver {
@@ -727,11 +686,11 @@ void matroxfb_unregister_driver(struct matroxfb_driver* drv);
 #endif
 #endif
 
-#define mga_inb(addr)           mga_readb(ACCESS_FBINFO(mmio.vbase), (addr))
-#define mga_inl(addr)           mga_readl(ACCESS_FBINFO(mmio.vbase), (addr))
-#define mga_outb(addr,val)      mga_writeb(ACCESS_FBINFO(mmio.vbase), (addr), (val))
-#define mga_outw(addr,val)      mga_writew(ACCESS_FBINFO(mmio.vbase), (addr), (val))
-#define mga_outl(addr,val)      mga_writel(ACCESS_FBINFO(mmio.vbase), (addr), (val))
+#define mga_inb(addr)           mga_readb(minfo->mmio.vbase, (addr))
+#define mga_inl(addr)           mga_readl(minfo->mmio.vbase, (addr))
+#define mga_outb(addr,val)      mga_writeb(minfo->mmio.vbase, (addr), (val))
+#define mga_outw(addr,val)      mga_writew(minfo->mmio.vbase, (addr), (val))
+#define mga_outl(addr,val)      mga_writel(minfo->mmio.vbase, (addr), (val))
 #define mga_readr(port,idx)     (mga_outb((port),(idx)), mga_inb((port)+1))
 #define mga_setr(addr,port,val) mga_outw(addr, ((val)<<8) | (port))
 
@@ -750,19 +709,20 @@ void matroxfb_unregister_driver(struct matroxfb_driver* drv);
 #define isMilleniumII(x) (0)
 #endif
 
-#define matroxfb_DAC_lock()                   spin_lock(&ACCESS_FBINFO(lock.DAC))
-#define matroxfb_DAC_unlock()                 spin_unlock(&ACCESS_FBINFO(lock.DAC))
-#define matroxfb_DAC_lock_irqsave(flags)      spin_lock_irqsave(&ACCESS_FBINFO(lock.DAC),flags)
-#define matroxfb_DAC_unlock_irqrestore(flags) spin_unlock_irqrestore(&ACCESS_FBINFO(lock.DAC),flags)
-extern void matroxfb_DAC_out(CPMINFO int reg, int val);
-extern int matroxfb_DAC_in(CPMINFO int reg);
+#define matroxfb_DAC_lock()                   spin_lock(&minfo->lock.DAC)
+#define matroxfb_DAC_unlock()                 spin_unlock(&minfo->lock.DAC)
+#define matroxfb_DAC_lock_irqsave(flags)      spin_lock_irqsave(&minfo->lock.DAC, flags)
+#define matroxfb_DAC_unlock_irqrestore(flags) spin_unlock_irqrestore(&minfo->lock.DAC, flags)
+extern void matroxfb_DAC_out(const struct matrox_fb_info *minfo, int reg,
+                             int val);
+extern int matroxfb_DAC_in(const struct matrox_fb_info *minfo, int reg);
 extern void matroxfb_var2my(struct fb_var_screeninfo* fvsi, struct my_timming* mt);
-extern int matroxfb_wait_for_sync(WPMINFO u_int32_t crtc);
-extern int matroxfb_enable_irq(WPMINFO int reenable);
+extern int matroxfb_wait_for_sync(struct matrox_fb_info *minfo, u_int32_t crtc);
+extern int matroxfb_enable_irq(struct matrox_fb_info *minfo, int reenable);
 
 #ifdef MATROXFB_USE_SPINLOCKS
-#define CRITBEGIN  spin_lock_irqsave(&ACCESS_FBINFO(lock.accel), critflags);
-#define CRITEND    spin_unlock_irqrestore(&ACCESS_FBINFO(lock.accel), critflags);
+#define CRITBEGIN  spin_lock_irqsave(&minfo->lock.accel, critflags);
+#define CRITEND    spin_unlock_irqrestore(&minfo->lock.accel, critflags);
 #define CRITFLAGS  unsigned long critflags;
 #else
 #define CRITBEGIN
diff --git a/drivers/video/matrox/matroxfb_crtc2.c b/drivers/video/matrox/matroxfb_crtc2.c
index ebcb5c6b4962..78414baa5a54 100644
--- a/drivers/video/matrox/matroxfb_crtc2.c
+++ b/drivers/video/matrox/matroxfb_crtc2.c
@@ -65,7 +65,7 @@ static void matroxfb_dh_restore(struct matroxfb_dh_fb_info* m2info,
                 unsigned int pos) {
         u_int32_t tmp;
         u_int32_t datactl;
-        MINFO_FROM(m2info->primary_dev);
+        struct matrox_fb_info *minfo = m2info->primary_dev;
 
         switch (mode) {
                 case 15:
@@ -81,11 +81,11 @@ static void matroxfb_dh_restore(struct matroxfb_dh_fb_info* m2info,
         }
         tmp |= 0x00000001;      /* enable CRTC2 */
         datactl = 0;
-        if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC2) {
-                if (ACCESS_FBINFO(devflags.g450dac)) {
+        if (minfo->outputs[1].src == MATROXFB_SRC_CRTC2) {
+                if (minfo->devflags.g450dac) {
                         tmp |= 0x00000006; /* source from secondary pixel PLL */
                         /* no vidrst when in monitor mode */
-                        if (ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+                        if (minfo->outputs[1].mode != MATROXFB_OUTPUT_MODE_MONITOR) {
                                 tmp |=  0xC0001000; /* Enable H/V vidrst */
                         }
                 } else {
@@ -93,11 +93,11 @@ static void matroxfb_dh_restore(struct matroxfb_dh_fb_info* m2info,
                         tmp |= 0xC0000000; /* enable vvidrst & hvidrst */
                         /* MGA TVO is our clock source */
                 }
-        } else if (ACCESS_FBINFO(outputs[0]).src == MATROXFB_SRC_CRTC2) {
+        } else if (minfo->outputs[0].src == MATROXFB_SRC_CRTC2) {
                 tmp |= 0x00000004; /* source from pixclock */
                 /* PIXPLL is our clock source */
         }
-        if (ACCESS_FBINFO(outputs[0]).src == MATROXFB_SRC_CRTC2) {
+        if (minfo->outputs[0].src == MATROXFB_SRC_CRTC2) {
                 tmp |= 0x00100000;      /* connect CRTC2 to DAC */
         }
         if (mt->interlaced) {
@@ -146,7 +146,7 @@ static void matroxfb_dh_restore(struct matroxfb_dh_fb_info* m2info,
                 }
         }
         mga_outl(0x3C10, tmp);
-        ACCESS_FBINFO(hw).crtc2.ctl = tmp;
+        minfo->hw.crtc2.ctl = tmp;
 
         tmp = mt->VDisplay << 16;       /* line compare */
         if (mt->sync & FB_SYNC_HOR_HIGH_ACT)
@@ -157,10 +157,10 @@ static void matroxfb_dh_restore(struct matroxfb_dh_fb_info* m2info,
 }
 
 static void matroxfb_dh_disable(struct matroxfb_dh_fb_info* m2info) {
-        MINFO_FROM(m2info->primary_dev);
+        struct matrox_fb_info *minfo = m2info->primary_dev;
 
         mga_outl(0x3C10, 0x00000004);   /* disable CRTC2, CRTC1->DAC1, PLL as clock source */
-        ACCESS_FBINFO(hw).crtc2.ctl = 0x00000004;
+        minfo->hw.crtc2.ctl = 0x00000004;
 }
 
 static void matroxfb_dh_pan_var(struct matroxfb_dh_fb_info* m2info,
@@ -168,7 +168,7 @@ static void matroxfb_dh_pan_var(struct matroxfb_dh_fb_info* m2info,
         unsigned int pos;
         unsigned int linelen;
         unsigned int pixelsize;
-        MINFO_FROM(m2info->primary_dev);
+        struct matrox_fb_info *minfo = m2info->primary_dev;
 
         m2info->fbcon.var.xoffset = var->xoffset;
         m2info->fbcon.var.yoffset = var->yoffset;
@@ -260,15 +260,15 @@ static int matroxfb_dh_decode_var(struct matroxfb_dh_fb_info* m2info,
 
 static int matroxfb_dh_open(struct fb_info* info, int user) {
 #define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
-        MINFO_FROM(m2info->primary_dev);
+        struct matrox_fb_info *minfo = m2info->primary_dev;
 
-        if (MINFO) {
+        if (minfo) {
                 int err;
 
-                if (ACCESS_FBINFO(dead)) {
+                if (minfo->dead) {
                         return -ENXIO;
                 }
-                err = ACCESS_FBINFO(fbops).fb_open(&ACCESS_FBINFO(fbcon), user);
+                err = minfo->fbops.fb_open(&minfo->fbcon, user);
                 if (err) {
                         return err;
                 }
@@ -280,10 +280,10 @@ static int matroxfb_dh_open(struct fb_info* info, int user) {
 static int matroxfb_dh_release(struct fb_info* info, int user) {
 #define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
         int err = 0;
-        MINFO_FROM(m2info->primary_dev);
+        struct matrox_fb_info *minfo = m2info->primary_dev;
 
-        if (MINFO) {
-                err = ACCESS_FBINFO(fbops).fb_release(&ACCESS_FBINFO(fbcon), user);
+        if (minfo) {
+                err = minfo->fbops.fb_release(&minfo->fbcon, user);
         }
         return err;
 #undef m2info
@@ -326,7 +326,7 @@ static int matroxfb_dh_set_par(struct fb_info* info) {
         int mode;
         int err;
         struct fb_var_screeninfo* var = &info->var;
-        MINFO_FROM(m2info->primary_dev);
+        struct matrox_fb_info *minfo = m2info->primary_dev;
 
         if ((err = matroxfb_dh_decode_var(m2info, var, &visual, &cmap_len, &mode)) != 0)
                 return err;
@@ -352,39 +352,39 @@ static int matroxfb_dh_set_par(struct fb_info* info) {
                 pos = (m2info->fbcon.var.yoffset * m2info->fbcon.var.xres_virtual + m2info->fbcon.var.xoffset) * m2info->fbcon.var.bits_per_pixel >> 3;
                 pos += m2info->video.offbase;
                 cnt = 0;
-                down_read(&ACCESS_FBINFO(altout).lock);
+                down_read(&minfo->altout.lock);
                 for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-                        if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+                        if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2) {
                                 cnt++;
-                                if (ACCESS_FBINFO(outputs[out]).output->compute) {
-                                        ACCESS_FBINFO(outputs[out]).output->compute(ACCESS_FBINFO(outputs[out]).data, &mt);
+                                if (minfo->outputs[out].output->compute) {
+                                        minfo->outputs[out].output->compute(minfo->outputs[out].data, &mt);
                                 }
                         }
                 }
-                ACCESS_FBINFO(crtc2).pixclock = mt.pixclock;
-                ACCESS_FBINFO(crtc2).mnp = mt.mnp;
-                up_read(&ACCESS_FBINFO(altout).lock);
+                minfo->crtc2.pixclock = mt.pixclock;
+                minfo->crtc2.mnp = mt.mnp;
+                up_read(&minfo->altout.lock);
                 if (cnt) {
                         matroxfb_dh_restore(m2info, &mt, mode, pos);
                 } else {
                         matroxfb_dh_disable(m2info);
                 }
-                DAC1064_global_init(PMINFO2);
-                DAC1064_global_restore(PMINFO2);
-                down_read(&ACCESS_FBINFO(altout).lock);
+                DAC1064_global_init(minfo);
+                DAC1064_global_restore(minfo);
+                down_read(&minfo->altout.lock);
                 for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-                        if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2 &&
-                            ACCESS_FBINFO(outputs[out]).output->program) {
-                                ACCESS_FBINFO(outputs[out]).output->program(ACCESS_FBINFO(outputs[out]).data);
+                        if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2 &&
+                            minfo->outputs[out].output->program) {
+                                minfo->outputs[out].output->program(minfo->outputs[out].data);
                         }
                 }
                 for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-                        if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2 &&
-                            ACCESS_FBINFO(outputs[out]).output->start) {
-                                ACCESS_FBINFO(outputs[out]).output->start(ACCESS_FBINFO(outputs[out]).data);
+                        if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2 &&
+                            minfo->outputs[out].output->start) {
+                                minfo->outputs[out].output->start(minfo->outputs[out].data);
                         }
                 }
-                up_read(&ACCESS_FBINFO(altout).lock);
+                up_read(&minfo->altout.lock);
         }
         m2info->initialized = 1;
         return 0;
@@ -399,9 +399,9 @@ static int matroxfb_dh_pan_display(struct fb_var_screeninfo* var, struct fb_info
 }
 
 static int matroxfb_dh_get_vblank(const struct matroxfb_dh_fb_info* m2info, struct fb_vblank* vblank) {
-        MINFO_FROM(m2info->primary_dev);
+        struct matrox_fb_info *minfo = m2info->primary_dev;
 
-        matroxfb_enable_irq(PMINFO 0);
+        matroxfb_enable_irq(minfo, 0);
         memset(vblank, 0, sizeof(*vblank));
         vblank->flags = FB_VBLANK_HAVE_VCOUNT | FB_VBLANK_HAVE_VBLANK;
         /* mask out reserved bits + field number (odd/even) */
@@ -409,11 +409,11 @@ static int matroxfb_dh_get_vblank(const struct matroxfb_dh_fb_info* m2info, stru
         /* compatibility stuff */
         if (vblank->vcount >= m2info->fbcon.var.yres)
                 vblank->flags |= FB_VBLANK_VBLANKING;
-        if (test_bit(0, &ACCESS_FBINFO(irq_flags))) {
+        if (test_bit(0, &minfo->irq_flags)) {
                 vblank->flags |= FB_VBLANK_HAVE_COUNT;
                 /* Only one writer, aligned int value...
                    it should work without lock and without atomic_t */
-                vblank->count = ACCESS_FBINFO(crtc2).vsync.cnt;
+                vblank->count = minfo->crtc2.vsync.cnt;
         }
         return 0;
 }
@@ -423,7 +423,7 @@ static int matroxfb_dh_ioctl(struct fb_info *info,
                 unsigned long arg)
 {
 #define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
-        MINFO_FROM(m2info->primary_dev);
+        struct matrox_fb_info *minfo = m2info->primary_dev;
 
         DBG(__func__)
 
@@ -449,13 +449,13 @@ static int matroxfb_dh_ioctl(struct fb_info *info,
 
                                 if (crt != 0)
                                         return -ENODEV;
-                                return matroxfb_wait_for_sync(PMINFO 1);
+                                return matroxfb_wait_for_sync(minfo, 1);
                         }
                 case MATROXFB_SET_OUTPUT_MODE:
                 case MATROXFB_GET_OUTPUT_MODE:
                 case MATROXFB_GET_ALL_OUTPUTS:
                         {
-                                return ACCESS_FBINFO(fbcon.fbops)->fb_ioctl(&ACCESS_FBINFO(fbcon), cmd, arg);
+                                return minfo->fbcon.fbops->fb_ioctl(&minfo->fbcon, cmd, arg);
                         }
                 case MATROXFB_SET_OUTPUT_CONNECTION:
                         {
@@ -469,9 +469,9 @@ static int matroxfb_dh_ioctl(struct fb_info *info,
                                         if (tmp & (1 << out)) {
                                                 if (out >= MATROXFB_MAX_OUTPUTS)
                                                         return -ENXIO;
-                                                if (!ACCESS_FBINFO(outputs[out]).output)
+                                                if (!minfo->outputs[out].output)
                                                         return -ENXIO;
-                                                switch (ACCESS_FBINFO(outputs[out]).src) {
+                                                switch (minfo->outputs[out].src) {
                                                         case MATROXFB_SRC_NONE:
                                                         case MATROXFB_SRC_CRTC2:
                                                                 break;
@@ -480,22 +480,22 @@ static int matroxfb_dh_ioctl(struct fb_info *info,
                                                 }
                                         }
                                 }
-                                if (ACCESS_FBINFO(devflags.panellink)) {
+                                if (minfo->devflags.panellink) {
                                         if (tmp & MATROXFB_OUTPUT_CONN_DFP)
                                                 return -EINVAL;
-                                        if ((ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1) && tmp)
+                                        if ((minfo->outputs[2].src == MATROXFB_SRC_CRTC1) && tmp)
                                                 return -EBUSY;
                                 }
                                 changes = 0;
                                 for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
                                         if (tmp & (1 << out)) {
-                                                if (ACCESS_FBINFO(outputs[out]).src != MATROXFB_SRC_CRTC2) {
+                                                if (minfo->outputs[out].src != MATROXFB_SRC_CRTC2) {
                                                         changes = 1;
-                                                        ACCESS_FBINFO(outputs[out]).src = MATROXFB_SRC_CRTC2;
+                                                        minfo->outputs[out].src = MATROXFB_SRC_CRTC2;
                                                 }
-                                        } else if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+                                        } else if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2) {
                                                 changes = 1;
-                                                ACCESS_FBINFO(outputs[out]).src = MATROXFB_SRC_NONE;
+                                                minfo->outputs[out].src = MATROXFB_SRC_NONE;
                                         }
                                 }
                                 if (!changes)
@@ -509,7 +509,7 @@ static int matroxfb_dh_ioctl(struct fb_info *info,
                                 int out;
 
                                 for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-                                        if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+                                        if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2) {
                                                 conn |= 1 << out;
                                         }
                                 }
@@ -523,8 +523,8 @@ static int matroxfb_dh_ioctl(struct fb_info *info,
                                 int out;
 
                                 for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-                                        if (ACCESS_FBINFO(outputs[out]).output) {
-                                                switch (ACCESS_FBINFO(outputs[out]).src) {
+                                        if (minfo->outputs[out].output) {
+                                                switch (minfo->outputs[out].src) {
                                                         case MATROXFB_SRC_NONE:
                                                         case MATROXFB_SRC_CRTC2:
                                                                 tmp |= 1 << out;
@@ -532,9 +532,9 @@ static int matroxfb_dh_ioctl(struct fb_info *info,
                                                 }
                                         }
                                 }
-                                if (ACCESS_FBINFO(devflags.panellink)) {
+                                if (minfo->devflags.panellink) {
                                         tmp &= ~MATROXFB_OUTPUT_CONN_DFP;
-                                        if (ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1) {
+                                        if (minfo->outputs[2].src == MATROXFB_SRC_CRTC1) {
                                                 tmp = 0;
                                         }
                                 }
@@ -595,7 +595,9 @@ static struct fb_var_screeninfo matroxfb_dh_defined = {
                 0, {0,0,0,0,0}
 };
 
-static int matroxfb_dh_regit(CPMINFO struct matroxfb_dh_fb_info* m2info) {
+static int matroxfb_dh_regit(const struct matrox_fb_info *minfo,
+                             struct matroxfb_dh_fb_info *m2info)
+{
 #define minfo (m2info->primary_dev)
         void* oldcrtc2;
 
@@ -611,21 +613,21 @@ static int matroxfb_dh_regit(CPMINFO struct matroxfb_dh_fb_info* m2info) {
         if (mem < 64*1024)
                 mem *= 1024;
         mem &= ~0x00000FFF;     /* PAGE_MASK? */
-        if (ACCESS_FBINFO(video.len_usable) + mem <= ACCESS_FBINFO(video.len))
-                m2info->video.offbase = ACCESS_FBINFO(video.len) - mem;
-        else if (ACCESS_FBINFO(video.len) < mem) {
+        if (minfo->video.len_usable + mem <= minfo->video.len)
+                m2info->video.offbase = minfo->video.len - mem;
+        else if (minfo->video.len < mem) {
                 return -ENOMEM;
         } else { /* check yres on first head... */
                 m2info->video.borrowed = mem;
-                ACCESS_FBINFO(video.len_usable) -= mem;
-                m2info->video.offbase = ACCESS_FBINFO(video.len_usable);
+                minfo->video.len_usable -= mem;
+                m2info->video.offbase = minfo->video.len_usable;
         }
-        m2info->video.base = ACCESS_FBINFO(video.base) + m2info->video.offbase;
+        m2info->video.base = minfo->video.base + m2info->video.offbase;
         m2info->video.len = m2info->video.len_usable = m2info->video.len_maximum = mem;
-        m2info->video.vbase.vaddr = vaddr_va(ACCESS_FBINFO(video.vbase)) + m2info->video.offbase;
-        m2info->mmio.base = ACCESS_FBINFO(mmio.base);
-        m2info->mmio.vbase = ACCESS_FBINFO(mmio.vbase);
-        m2info->mmio.len = ACCESS_FBINFO(mmio.len);
+        m2info->video.vbase.vaddr = vaddr_va(minfo->video.vbase) + m2info->video.offbase;
+        m2info->mmio.base = minfo->mmio.base;
+        m2info->mmio.vbase = minfo->mmio.vbase;
+        m2info->mmio.len = minfo->mmio.len;
 
         matroxfb_dh_init_fix(m2info);
         if (register_framebuffer(&m2info->fbcon)) {
@@ -633,10 +635,10 @@ static int matroxfb_dh_regit(CPMINFO struct matroxfb_dh_fb_info* m2info) {
         }
         if (!m2info->initialized)
                 fb_set_var(&m2info->fbcon, &matroxfb_dh_defined);
-        down_write(&ACCESS_FBINFO(crtc2.lock));
-        oldcrtc2 = ACCESS_FBINFO(crtc2.info);
-        ACCESS_FBINFO(crtc2.info) = m2info;
-        up_write(&ACCESS_FBINFO(crtc2.lock));
+        down_write(&minfo->crtc2.lock);
+        oldcrtc2 = minfo->crtc2.info;
+        minfo->crtc2.info = m2info;
+        up_write(&minfo->crtc2.lock);
         if (oldcrtc2) {
                 printk(KERN_ERR "matroxfb_crtc2: Internal consistency check failed: crtc2 already present: %p\n",
                         oldcrtc2);
@@ -649,12 +651,12 @@ static int matroxfb_dh_regit(CPMINFO struct matroxfb_dh_fb_info* m2info) {
 
 static int matroxfb_dh_registerfb(struct matroxfb_dh_fb_info* m2info) {
 #define minfo (m2info->primary_dev)
-        if (matroxfb_dh_regit(PMINFO m2info)) {
+        if (matroxfb_dh_regit(minfo, m2info)) {
                 printk(KERN_ERR "matroxfb_crtc2: secondary head failed to register\n");
                 return -1;
         }
         printk(KERN_INFO "matroxfb_crtc2: secondary head of fb%u was registered as fb%u\n",
-                ACCESS_FBINFO(fbcon.node), m2info->fbcon.node);
+                minfo->fbcon.node, m2info->fbcon.node);
         m2info->fbcon_registered = 1;
         return 0;
 #undef minfo
@@ -666,11 +668,11 @@ static void matroxfb_dh_deregisterfb(struct matroxfb_dh_fb_info* m2info) {
                 int id;
                 struct matroxfb_dh_fb_info* crtc2;
 
-                down_write(&ACCESS_FBINFO(crtc2.lock));
-                crtc2 = ACCESS_FBINFO(crtc2.info);
+                down_write(&minfo->crtc2.lock);
+                crtc2 = minfo->crtc2.info;
                 if (crtc2 == m2info)
-                        ACCESS_FBINFO(crtc2.info) = NULL;
-                up_write(&ACCESS_FBINFO(crtc2.lock));
+                        minfo->crtc2.info = NULL;
+                up_write(&minfo->crtc2.lock);
                 if (crtc2 != m2info) {
                         printk(KERN_ERR "matroxfb_crtc2: Internal consistency check failed: crtc2 mismatch at unload: %p != %p\n",
                                 crtc2, m2info);
@@ -680,7 +682,7 @@ static void matroxfb_dh_deregisterfb(struct matroxfb_dh_fb_info* m2info) {
                 id = m2info->fbcon.node;
                 unregister_framebuffer(&m2info->fbcon);
                 /* return memory back to primary head */
-                ACCESS_FBINFO(video.len_usable) += m2info->video.borrowed;
+                minfo->video.len_usable += m2info->video.borrowed;
                 printk(KERN_INFO "matroxfb_crtc2: fb%u unregistered\n", id);
                 m2info->fbcon_registered = 0;
         }
@@ -691,14 +693,14 @@ static void* matroxfb_crtc2_probe(struct matrox_fb_info* minfo) {
         struct matroxfb_dh_fb_info* m2info;
 
         /* hardware is CRTC2 incapable... */
-        if (!ACCESS_FBINFO(devflags.crtc2))
+        if (!minfo->devflags.crtc2)
                 return NULL;
         m2info = kzalloc(sizeof(*m2info), GFP_KERNEL);
         if (!m2info) {
                 printk(KERN_ERR "matroxfb_crtc2: Not enough memory for CRTC2 control structs\n");
                 return NULL;
         }
-        m2info->primary_dev = MINFO;
+        m2info->primary_dev = minfo;
         if (matroxfb_dh_registerfb(m2info)) {
                 kfree(m2info);
                 printk(KERN_ERR "matroxfb_crtc2: CRTC2 framebuffer failed to register\n");
diff --git a/drivers/video/matrox/matroxfb_g450.c b/drivers/video/matrox/matroxfb_g450.c
index 6209a761f674..cff0546ea6fd 100644
--- a/drivers/video/matrox/matroxfb_g450.c
+++ b/drivers/video/matrox/matroxfb_g450.c
@@ -80,52 +80,59 @@ static int get_ctrl_id(__u32 v4l2_id) {
         return -EINVAL;
 }
 
-static inline int* get_ctrl_ptr(WPMINFO unsigned int idx) {
-        return (int*)((char*)MINFO + g450_controls[idx].control);
+static inline int *get_ctrl_ptr(struct matrox_fb_info *minfo, unsigned int idx)
+{
+        return (int*)((char*)minfo + g450_controls[idx].control);
 }
 
-static void tvo_fill_defaults(WPMINFO2) {
+static void tvo_fill_defaults(struct matrox_fb_info *minfo)
+{
         unsigned int i;
         
         for (i = 0; i < G450CTRLS; i++) {
-                *get_ctrl_ptr(PMINFO i) = g450_controls[i].desc.default_value;
+                *get_ctrl_ptr(minfo, i) = g450_controls[i].desc.default_value;
         }
 }
 
-static int cve2_get_reg(WPMINFO int reg) {
+static int cve2_get_reg(struct matrox_fb_info *minfo, int reg)
+{
         unsigned long flags;
         int val;
         
         matroxfb_DAC_lock_irqsave(flags);
-        matroxfb_DAC_out(PMINFO 0x87, reg);
-        val = matroxfb_DAC_in(PMINFO 0x88);
+        matroxfb_DAC_out(minfo, 0x87, reg);
+        val = matroxfb_DAC_in(minfo, 0x88);
         matroxfb_DAC_unlock_irqrestore(flags);
         return val;
 }
 
-static void cve2_set_reg(WPMINFO int reg, int val) {
+static void cve2_set_reg(struct matrox_fb_info *minfo, int reg, int val)
+{
         unsigned long flags;
 
         matroxfb_DAC_lock_irqsave(flags);
-        matroxfb_DAC_out(PMINFO 0x87, reg);
-        matroxfb_DAC_out(PMINFO 0x88, val);
+        matroxfb_DAC_out(minfo, 0x87, reg);
+        matroxfb_DAC_out(minfo, 0x88, val);
         matroxfb_DAC_unlock_irqrestore(flags);
 }
 
-static void cve2_set_reg10(WPMINFO int reg, int val) {
+static void cve2_set_reg10(struct matrox_fb_info *minfo, int reg, int val)
+{
         unsigned long flags;
 
         matroxfb_DAC_lock_irqsave(flags);
-        matroxfb_DAC_out(PMINFO 0x87, reg);
-        matroxfb_DAC_out(PMINFO 0x88, val >> 2);
-        matroxfb_DAC_out(PMINFO 0x87, reg + 1);
-        matroxfb_DAC_out(PMINFO 0x88, val & 3);
+        matroxfb_DAC_out(minfo, 0x87, reg);
+        matroxfb_DAC_out(minfo, 0x88, val >> 2);
+        matroxfb_DAC_out(minfo, 0x87, reg + 1);
+        matroxfb_DAC_out(minfo, 0x88, val & 3);
         matroxfb_DAC_unlock_irqrestore(flags);
 }
 
-static void g450_compute_bwlevel(CPMINFO int *bl, int *wl) {
-        const int b = ACCESS_FBINFO(altout.tvo_params.brightness) + BLMIN;
-        const int c = ACCESS_FBINFO(altout.tvo_params.contrast);
+static void g450_compute_bwlevel(const struct matrox_fb_info *minfo, int *bl,
+                                 int *wl)
+{
+        const int b = minfo->altout.tvo_params.brightness + BLMIN;
+        const int c = minfo->altout.tvo_params.contrast;
 
         *bl = max(b - c, BLMIN);
         *wl = min(b + c, WLMAX);
@@ -154,7 +161,7 @@ static int g450_query_ctrl(void* md, struct v4l2_queryctrl *p) {
 
 static int g450_set_ctrl(void* md, struct v4l2_control *p) {
         int i;
-        MINFO_FROM(md);
+        struct matrox_fb_info *minfo = md;
         
         i = get_ctrl_id(p->id);
         if (i < 0) return -EINVAL;
@@ -162,7 +169,7 @@ static int g450_set_ctrl(void* md, struct v4l2_control *p) {
         /*
          * Check if changed.
          */
-        if (p->value == *get_ctrl_ptr(PMINFO i)) return 0;
+        if (p->value == *get_ctrl_ptr(minfo, i)) return 0;
 
         /*
          * Check limits.
@@ -173,31 +180,31 @@ static int g450_set_ctrl(void* md, struct v4l2_control *p) {
         /*
          * Store new value.
          */
-        *get_ctrl_ptr(PMINFO i) = p->value;
+        *get_ctrl_ptr(minfo, i) = p->value;
 
         switch (p->id) {
                 case V4L2_CID_BRIGHTNESS:
                 case V4L2_CID_CONTRAST:
                         {
                                 int blacklevel, whitelevel;
-                                g450_compute_bwlevel(PMINFO &blacklevel, &whitelevel);
-                                cve2_set_reg10(PMINFO 0x0e, blacklevel);
-                                cve2_set_reg10(PMINFO 0x1e, whitelevel);
+                                g450_compute_bwlevel(minfo, &blacklevel, &whitelevel);
+                                cve2_set_reg10(minfo, 0x0e, blacklevel);
+                                cve2_set_reg10(minfo, 0x1e, whitelevel);
                         }
                         break;
                 case V4L2_CID_SATURATION:
-                        cve2_set_reg(PMINFO 0x20, p->value);
-                        cve2_set_reg(PMINFO 0x22, p->value);
+                        cve2_set_reg(minfo, 0x20, p->value);
+                        cve2_set_reg(minfo, 0x22, p->value);
                         break;
                 case V4L2_CID_HUE:
-                        cve2_set_reg(PMINFO 0x25, p->value);
+                        cve2_set_reg(minfo, 0x25, p->value);
                         break;
                 case MATROXFB_CID_TESTOUT:
                         {
-                                unsigned char val = cve2_get_reg (PMINFO 0x05);
+                                unsigned char val = cve2_get_reg(minfo, 0x05);
                                 if (p->value) val |=  0x02;
                                 else          val &= ~0x02;
-                                cve2_set_reg(PMINFO 0x05, val);
+                                cve2_set_reg(minfo, 0x05, val);
                         }
                         break;
         }
@@ -208,11 +215,11 @@ static int g450_set_ctrl(void* md, struct v4l2_control *p) {
 
 static int g450_get_ctrl(void* md, struct v4l2_control *p) {
         int i;
-        MINFO_FROM(md);
+        struct matrox_fb_info *minfo = md;
         
         i = get_ctrl_id(p->id);
         if (i < 0) return -EINVAL;
-        p->value = *get_ctrl_ptr(PMINFO i);
+        p->value = *get_ctrl_ptr(minfo, i);
         return 0;
 }
 
@@ -226,7 +233,9 @@ struct output_desc {
         unsigned int    v_total;
 };
 
-static void computeRegs(WPMINFO struct mavenregs* r, struct my_timming* mt, const struct output_desc* outd) {
+static void computeRegs(struct matrox_fb_info *minfo, struct mavenregs *r,
+                        struct my_timming *mt, const struct output_desc *outd)
+{
         u_int32_t chromasc;
         u_int32_t hlen;
         u_int32_t hsl;
@@ -251,10 +260,10 @@ static void computeRegs(WPMINFO struct mavenregs* r, struct my_timming* mt, cons
 
         dprintk(KERN_DEBUG "Want %u kHz pixclock\n", (unsigned int)piic);
         
-        mnp = matroxfb_g450_setclk(PMINFO piic, M_VIDEO_PLL);
+        mnp = matroxfb_g450_setclk(minfo, piic, M_VIDEO_PLL);
         
         mt->mnp = mnp;
-        mt->pixclock = g450_mnp2f(PMINFO mnp);
+        mt->pixclock = g450_mnp2f(minfo, mnp);
 
         dprintk(KERN_DEBUG "MNP=%08X\n", mnp);
 
@@ -490,65 +499,67 @@ static void cve2_init_TVdata(int norm, struct mavenregs* data, const struct outp
         return;
 }
 
-#define LR(x) cve2_set_reg(PMINFO (x), m->regs[(x)])
-static void cve2_init_TV(WPMINFO const struct mavenregs* m) {
+#define LR(x) cve2_set_reg(minfo, (x), m->regs[(x)])
+static void cve2_init_TV(struct matrox_fb_info *minfo,
+                         const struct mavenregs *m)
+{
         int i;
 
         LR(0x80);
         LR(0x82); LR(0x83);
         LR(0x84); LR(0x85);
         
-        cve2_set_reg(PMINFO 0x3E, 0x01);
+        cve2_set_reg(minfo, 0x3E, 0x01);
         
         for (i = 0; i < 0x3E; i++) {
                 LR(i);
         }
-        cve2_set_reg(PMINFO 0x3E, 0x00);
+        cve2_set_reg(minfo, 0x3E, 0x00);
 }
 
 static int matroxfb_g450_compute(void* md, struct my_timming* mt) {
-        MINFO_FROM(md);
+        struct matrox_fb_info *minfo = md;
 
-        dprintk(KERN_DEBUG "Computing, mode=%u\n", ACCESS_FBINFO(outputs[1]).mode);
+        dprintk(KERN_DEBUG "Computing, mode=%u\n", minfo->outputs[1].mode);
 
         if (mt->crtc == MATROXFB_SRC_CRTC2 &&
-            ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+            minfo->outputs[1].mode != MATROXFB_OUTPUT_MODE_MONITOR) {
                 const struct output_desc* outd;
 
-                cve2_init_TVdata(ACCESS_FBINFO(outputs[1]).mode, &ACCESS_FBINFO(hw).maven, &outd);
+                cve2_init_TVdata(minfo->outputs[1].mode, &minfo->hw.maven, &outd);
                 {
                         int blacklevel, whitelevel;
-                        g450_compute_bwlevel(PMINFO &blacklevel, &whitelevel);
-                        ACCESS_FBINFO(hw).maven.regs[0x0E] = blacklevel >> 2;
-                        ACCESS_FBINFO(hw).maven.regs[0x0F] = blacklevel & 3;
-                        ACCESS_FBINFO(hw).maven.regs[0x1E] = whitelevel >> 2;
-                        ACCESS_FBINFO(hw).maven.regs[0x1F] = whitelevel & 3;
+                        g450_compute_bwlevel(minfo, &blacklevel, &whitelevel);
+                        minfo->hw.maven.regs[0x0E] = blacklevel >> 2;
+                        minfo->hw.maven.regs[0x0F] = blacklevel & 3;
+                        minfo->hw.maven.regs[0x1E] = whitelevel >> 2;
+                        minfo->hw.maven.regs[0x1F] = whitelevel & 3;
 
-                        ACCESS_FBINFO(hw).maven.regs[0x20] =
-                        ACCESS_FBINFO(hw).maven.regs[0x22] = ACCESS_FBINFO(altout.tvo_params.saturation);
+                        minfo->hw.maven.regs[0x20] =
+                        minfo->hw.maven.regs[0x22] = minfo->altout.tvo_params.saturation;
 
-                        ACCESS_FBINFO(hw).maven.regs[0x25] = ACCESS_FBINFO(altout.tvo_params.hue);
+                        minfo->hw.maven.regs[0x25] = minfo->altout.tvo_params.hue;
 
-                        if (ACCESS_FBINFO(altout.tvo_params.testout)) {
-                                ACCESS_FBINFO(hw).maven.regs[0x05] |= 0x02;
+                        if (minfo->altout.tvo_params.testout) {
+                                minfo->hw.maven.regs[0x05] |= 0x02;
                         }
                 }
-                computeRegs(PMINFO &ACCESS_FBINFO(hw).maven, mt, outd);
+                computeRegs(minfo, &minfo->hw.maven, mt, outd);
         } else if (mt->mnp < 0) {
                 /* We must program clocks before CRTC2, otherwise interlaced mode
                    startup may fail */
-                mt->mnp = matroxfb_g450_setclk(PMINFO mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
-                mt->pixclock = g450_mnp2f(PMINFO mt->mnp);
+                mt->mnp = matroxfb_g450_setclk(minfo, mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+                mt->pixclock = g450_mnp2f(minfo, mt->mnp);
         }
         dprintk(KERN_DEBUG "Pixclock = %u\n", mt->pixclock);
         return 0;
 }
 
 static int matroxfb_g450_program(void* md) {
-        MINFO_FROM(md);
+        struct matrox_fb_info *minfo = md;
         
-        if (ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
-                cve2_init_TV(PMINFO &ACCESS_FBINFO(hw).maven);
+        if (minfo->outputs[1].mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+                cve2_init_TV(minfo, &minfo->hw.maven);
         }
         return 0;
 }
@@ -564,11 +575,11 @@ static int matroxfb_g450_verify_mode(void* md, u_int32_t arg) {
 }
 
 static int g450_dvi_compute(void* md, struct my_timming* mt) {
-        MINFO_FROM(md);
+        struct matrox_fb_info *minfo = md;
 
         if (mt->mnp < 0) {
-                mt->mnp = matroxfb_g450_setclk(PMINFO mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
-                mt->pixclock = g450_mnp2f(PMINFO mt->mnp);
+                mt->mnp = matroxfb_g450_setclk(minfo, mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+                mt->pixclock = g450_mnp2f(minfo, mt->mnp);
         }
         return 0;
 }
@@ -588,34 +599,36 @@ static struct matrox_altout matroxfb_g450_dvi = {
         .compute        = g450_dvi_compute,
 };
 
-void matroxfb_g450_connect(WPMINFO2) {
-        if (ACCESS_FBINFO(devflags.g450dac)) {
-                down_write(&ACCESS_FBINFO(altout.lock));
-                tvo_fill_defaults(PMINFO2);
-                ACCESS_FBINFO(outputs[1]).src = ACCESS_FBINFO(outputs[1]).default_src;
-                ACCESS_FBINFO(outputs[1]).data = MINFO;
-                ACCESS_FBINFO(outputs[1]).output = &matroxfb_g450_altout;
-                ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
-                ACCESS_FBINFO(outputs[2]).src = ACCESS_FBINFO(outputs[2]).default_src;
-                ACCESS_FBINFO(outputs[2]).data = MINFO;
-                ACCESS_FBINFO(outputs[2]).output = &matroxfb_g450_dvi;
-                ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
-                up_write(&ACCESS_FBINFO(altout.lock));
+void matroxfb_g450_connect(struct matrox_fb_info *minfo)
+{
+        if (minfo->devflags.g450dac) {
+                down_write(&minfo->altout.lock);
+                tvo_fill_defaults(minfo);
+                minfo->outputs[1].src = minfo->outputs[1].default_src;
+                minfo->outputs[1].data = minfo;
+                minfo->outputs[1].output = &matroxfb_g450_altout;
+                minfo->outputs[1].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+                minfo->outputs[2].src = minfo->outputs[2].default_src;
+                minfo->outputs[2].data = minfo;
+                minfo->outputs[2].output = &matroxfb_g450_dvi;
+                minfo->outputs[2].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+                up_write(&minfo->altout.lock);
         }
 }
 
-void matroxfb_g450_shutdown(WPMINFO2) {
-        if (ACCESS_FBINFO(devflags.g450dac)) {
-                down_write(&ACCESS_FBINFO(altout.lock));
-                ACCESS_FBINFO(outputs[1]).src = MATROXFB_SRC_NONE;
-                ACCESS_FBINFO(outputs[1]).output = NULL;
-                ACCESS_FBINFO(outputs[1]).data = NULL;
-                ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
-                ACCESS_FBINFO(outputs[2]).src = MATROXFB_SRC_NONE;
-                ACCESS_FBINFO(outputs[2]).output = NULL;
-                ACCESS_FBINFO(outputs[2]).data = NULL;
-                ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
-                up_write(&ACCESS_FBINFO(altout.lock));
+void matroxfb_g450_shutdown(struct matrox_fb_info *minfo)
+{
+        if (minfo->devflags.g450dac) {
+                down_write(&minfo->altout.lock);
+                minfo->outputs[1].src = MATROXFB_SRC_NONE;
+                minfo->outputs[1].output = NULL;
+                minfo->outputs[1].data = NULL;
+                minfo->outputs[1].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+                minfo->outputs[2].src = MATROXFB_SRC_NONE;
+                minfo->outputs[2].output = NULL;
+                minfo->outputs[2].data = NULL;
+                minfo->outputs[2].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+                up_write(&minfo->altout.lock);
         }
 }
 
diff --git a/drivers/video/matrox/matroxfb_g450.h b/drivers/video/matrox/matroxfb_g450.h
index a0822a6033e5..3a3e654444b8 100644
--- a/drivers/video/matrox/matroxfb_g450.h
+++ b/drivers/video/matrox/matroxfb_g450.h
@@ -4,11 +4,11 @@
 #include "matroxfb_base.h"
 
 #ifdef CONFIG_FB_MATROX_G
-void matroxfb_g450_connect(WPMINFO2);
-void matroxfb_g450_shutdown(WPMINFO2);
+void matroxfb_g450_connect(struct matrox_fb_info *minfo);
+void matroxfb_g450_shutdown(struct matrox_fb_info *minfo);
 #else
-static inline void matroxfb_g450_connect(WPMINFO2) { };
-static inline void matroxfb_g450_shutdown(WPMINFO2) { };
+static inline void matroxfb_g450_connect(struct matrox_fb_info *minfo) { };
+static inline void matroxfb_g450_shutdown(struct matrox_fb_info *minfo) { };
 #endif
 
 #endif /* __MATROXFB_G450_H__ */
diff --git a/drivers/video/matrox/matroxfb_maven.c b/drivers/video/matrox/matroxfb_maven.c
index 042408a8c631..91af9159111f 100644
--- a/drivers/video/matrox/matroxfb_maven.c
+++ b/drivers/video/matrox/matroxfb_maven.c
@@ -458,9 +458,9 @@ static void maven_init_TVdata(const struct maven_data* md, struct mavenregs* dat
                 0x00,   /* 3E written multiple times */
                 0x00,   /* never written */
         }, MATROXFB_OUTPUT_MODE_NTSC, 525, 60 };
-        MINFO_FROM(md->primary_head);
+        struct matrox_fb_info *minfo = md->primary_head;
 
-        if (ACCESS_FBINFO(outputs[1]).mode == MATROXFB_OUTPUT_MODE_PAL)
+        if (minfo->outputs[1].mode == MATROXFB_OUTPUT_MODE_PAL)
                 *data = palregs;
         else
                 *data = ntscregs;
@@ -496,11 +496,11 @@ static void maven_init_TVdata(const struct maven_data* md, struct mavenregs* dat
         /* Set saturation */
         {
                 data->regs[0x20] =
-                data->regs[0x22] = ACCESS_FBINFO(altout.tvo_params.saturation);
+                data->regs[0x22] = minfo->altout.tvo_params.saturation;
         }
  
         /* Set HUE */
-        data->regs[0x25] = ACCESS_FBINFO(altout.tvo_params.hue);
+        data->regs[0x25] = minfo->altout.tvo_params.hue;
         return;
 }
 
@@ -741,9 +741,9 @@ static inline int maven_compute_timming(struct maven_data* md,
                 struct mavenregs* m) {
         unsigned int tmpi;
         unsigned int a, bv, c;
-        MINFO_FROM(md->primary_head);
+        struct matrox_fb_info *minfo = md->primary_head;
 
-        m->mode = ACCESS_FBINFO(outputs[1]).mode;
+        m->mode = minfo->outputs[1].mode;
         if (m->mode != MATROXFB_OUTPUT_MODE_MONITOR) {
                 unsigned int lmargin;
                 unsigned int umargin;
@@ -1132,7 +1132,7 @@ static int maven_get_control (struct maven_data* md,
 static int maven_out_compute(void* md, struct my_timming* mt) {
 #define mdinfo ((struct maven_data*)md)
 #define minfo (mdinfo->primary_head)
-        return maven_compute_timming(md, mt, &ACCESS_FBINFO(hw).maven);
+        return maven_compute_timming(md, mt, &minfo->hw.maven);
 #undef minfo
 #undef mdinfo
 }
@@ -1140,7 +1140,7 @@ static int maven_out_compute(void* md, struct my_timming* mt) {
 static int maven_out_program(void* md) {
 #define mdinfo ((struct maven_data*)md)
 #define minfo (mdinfo->primary_head)
-        return maven_program_timming(md, &ACCESS_FBINFO(hw).maven);
+        return maven_program_timming(md, &minfo->hw.maven);
 #undef minfo
 #undef mdinfo
 }
@@ -1184,16 +1184,18 @@ static struct matrox_altout maven_altout = {
 
 static int maven_init_client(struct i2c_client* clnt) {
         struct maven_data* md = i2c_get_clientdata(clnt);
-        MINFO_FROM(container_of(clnt->adapter, struct i2c_bit_adapter, adapter)->minfo);
+        struct matrox_fb_info *minfo = container_of(clnt->adapter,
+                                                    struct i2c_bit_adapter,
+                                                    adapter)->minfo;
 
-        md->primary_head = MINFO;
+        md->primary_head = minfo;
         md->client = clnt;
-        down_write(&ACCESS_FBINFO(altout.lock));
-        ACCESS_FBINFO(outputs[1]).output = &maven_altout;
-        ACCESS_FBINFO(outputs[1]).src = ACCESS_FBINFO(outputs[1]).default_src;
-        ACCESS_FBINFO(outputs[1]).data = md;
-        ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
-        up_write(&ACCESS_FBINFO(altout.lock));
+        down_write(&minfo->altout.lock);
+        minfo->outputs[1].output = &maven_altout;
+        minfo->outputs[1].src = minfo->outputs[1].default_src;
+        minfo->outputs[1].data = md;
+        minfo->outputs[1].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+        up_write(&minfo->altout.lock);
         if (maven_get_reg(clnt, 0xB2) < 0x14) {
                 md->version = MGATVO_B;
                 /* Tweak some things for this old chip */
@@ -1218,14 +1220,14 @@ static int maven_shutdown_client(struct i2c_client* clnt) {
         struct maven_data* md = i2c_get_clientdata(clnt);
 
         if (md->primary_head) {
-                MINFO_FROM(md->primary_head);
-
-                down_write(&ACCESS_FBINFO(altout.lock));
-                ACCESS_FBINFO(outputs[1]).src = MATROXFB_SRC_NONE;
-                ACCESS_FBINFO(outputs[1]).output = NULL;
-                ACCESS_FBINFO(outputs[1]).data = NULL;
-                ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
-                up_write(&ACCESS_FBINFO(altout.lock));
+                struct matrox_fb_info *minfo = md->primary_head;
+
+                down_write(&minfo->altout.lock);
+                minfo->outputs[1].src = MATROXFB_SRC_NONE;
+                minfo->outputs[1].output = NULL;
+                minfo->outputs[1].data = NULL;
+                minfo->outputs[1].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+                up_write(&minfo->altout.lock);
                 md->primary_head = NULL;
         }
         return 0;
diff --git a/drivers/video/matrox/matroxfb_misc.c b/drivers/video/matrox/matroxfb_misc.c
index 5b5f072fc1a8..9948ca2a3046 100644
--- a/drivers/video/matrox/matroxfb_misc.c
+++ b/drivers/video/matrox/matroxfb_misc.c
@@ -89,13 +89,15 @@
 #include <linux/interrupt.h>
 #include <linux/matroxfb.h>
 
-void matroxfb_DAC_out(CPMINFO int reg, int val) {
+void matroxfb_DAC_out(const struct matrox_fb_info *minfo, int reg, int val)
+{
         DBG_REG(__func__)
         mga_outb(M_RAMDAC_BASE+M_X_INDEX, reg);
         mga_outb(M_RAMDAC_BASE+M_X_DATAREG, val);
 }
 
-int matroxfb_DAC_in(CPMINFO int reg) {
+int matroxfb_DAC_in(const struct matrox_fb_info *minfo, int reg)
+{
         DBG_REG(__func__)
         mga_outb(M_RAMDAC_BASE+M_X_INDEX, reg);
         return mga_inb(M_RAMDAC_BASE+M_X_DATAREG);
@@ -184,13 +186,14 @@ int matroxfb_PLL_calcclock(const struct matrox_pll_features* pll, unsigned int f
         return bestvco;
 }
 
-int matroxfb_vgaHWinit(WPMINFO struct my_timming* m) {
+int matroxfb_vgaHWinit(struct matrox_fb_info *minfo, struct my_timming *m)
+{
         unsigned int hd, hs, he, hbe, ht;
         unsigned int vd, vs, ve, vt, lc;
         unsigned int wd;
         unsigned int divider;
         int i;
-        struct matrox_hw_state * const hw = &ACCESS_FBINFO(hw);
+        struct matrox_hw_state * const hw = &minfo->hw;
 
         DBG(__func__)
 
@@ -240,7 +243,7 @@ int matroxfb_vgaHWinit(WPMINFO struct my_timming* m) {
         /* standard timmings are in 8pixels, but for interleaved we cannot */
         /* do it for 4bpp (because of (4bpp >> 1(interleaved))/4 == 0) */
         /* using 16 or more pixels per unit can save us */
-        divider = ACCESS_FBINFO(curr.final_bppShift);
+        divider = minfo->curr.final_bppShift;
         while (divider & 3) {
                 hd >>= 1;
                 hs >>= 1;
@@ -270,7 +273,7 @@ int matroxfb_vgaHWinit(WPMINFO struct my_timming* m) {
         if (((ht & 0x07) == 0x06) || ((ht & 0x0F) == 0x04))
                 ht++;
         hbe = ht;
-        wd = ACCESS_FBINFO(fbcon).var.xres_virtual * ACCESS_FBINFO(curr.final_bppShift) / 64;
+        wd = minfo->fbcon.var.xres_virtual * minfo->curr.final_bppShift / 64;
 
         hw->CRTCEXT[0] = 0;
         hw->CRTCEXT[5] = 0;
@@ -287,7 +290,7 @@ int matroxfb_vgaHWinit(WPMINFO struct my_timming* m) {
                           ((hs      & 0x100) >> 6) | /* sync start */
                            (hbe     & 0x040);    /* end hor. blanking */
         /* FIXME: Enable vidrst only on G400, and only if TV-out is used */
-        if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC1)
+        if (minfo->outputs[1].src == MATROXFB_SRC_CRTC1)
                 hw->CRTCEXT[1] |= 0x88;         /* enable horizontal and vertical vidrst */
         hw->CRTCEXT[2] =  ((vt & 0xC00) >> 10) |
                           ((vd & 0x400) >>  8) |        /* disp end */
@@ -331,9 +334,10 @@ int matroxfb_vgaHWinit(WPMINFO struct my_timming* m) {
         return 0;
 };
 
-void matroxfb_vgaHWrestore(WPMINFO2) {
+void matroxfb_vgaHWrestore(struct matrox_fb_info *minfo)
+{
         int i;
-        struct matrox_hw_state * const hw = &ACCESS_FBINFO(hw);
+        struct matrox_hw_state * const hw = &minfo->hw;
         CRITFLAGS
 
         DBG(__func__)
@@ -522,7 +526,9 @@ static void parse_bios(unsigned char __iomem* vbios, struct matrox_bios* bd) {
 #endif
 }
 
-static int parse_pins1(WPMINFO const struct matrox_bios* bd) {
+static int parse_pins1(struct matrox_fb_info *minfo,
+                       const struct matrox_bios *bd)
+{
         unsigned int maxdac;
 
         switch (bd->pins[22]) {
@@ -533,173 +539,188 @@ static int parse_pins1(WPMINFO const struct matrox_bios* bd) {
         if (get_unaligned_le16(bd->pins + 24)) {
                 maxdac = get_unaligned_le16(bd->pins + 24) * 10;
         }
-        MINFO->limits.pixel.vcomax = maxdac;
-        MINFO->values.pll.system = get_unaligned_le16(bd->pins + 28) ?
+        minfo->limits.pixel.vcomax = maxdac;
+        minfo->values.pll.system = get_unaligned_le16(bd->pins + 28) ?
                 get_unaligned_le16(bd->pins + 28) * 10 : 50000;
         /* ignore 4MB, 8MB, module clocks */
-        MINFO->features.pll.ref_freq = 14318;
-        MINFO->values.reg.mctlwtst      = 0x00030101;
+        minfo->features.pll.ref_freq = 14318;
+        minfo->values.reg.mctlwtst      = 0x00030101;
         return 0;
 }
 
-static void default_pins1(WPMINFO2) {
+static void default_pins1(struct matrox_fb_info *minfo)
+{
         /* Millennium */
-        MINFO->limits.pixel.vcomax      = 220000;
-        MINFO->values.pll.system        =  50000;
-        MINFO->features.pll.ref_freq    =  14318;
-        MINFO->values.reg.mctlwtst      = 0x00030101;
+        minfo->limits.pixel.vcomax      = 220000;
+        minfo->values.pll.system        =  50000;
+        minfo->features.pll.ref_freq    =  14318;
+        minfo->values.reg.mctlwtst      = 0x00030101;
 }
 
-static int parse_pins2(WPMINFO const struct matrox_bios* bd) {
-        MINFO->limits.pixel.vcomax      =
-        MINFO->limits.system.vcomax     = (bd->pins[41] == 0xFF) ? 230000 : ((bd->pins[41] + 100) * 1000);
-        MINFO->values.reg.mctlwtst      = ((bd->pins[51] & 0x01) ? 0x00000001 : 0) |
+static int parse_pins2(struct matrox_fb_info *minfo,
+                       const struct matrox_bios *bd)
+{
+        minfo->limits.pixel.vcomax      =
+        minfo->limits.system.vcomax     = (bd->pins[41] == 0xFF) ? 230000 : ((bd->pins[41] + 100) * 1000);
+        minfo->values.reg.mctlwtst      = ((bd->pins[51] & 0x01) ? 0x00000001 : 0) |
                                           ((bd->pins[51] & 0x02) ? 0x00000100 : 0) |
                                           ((bd->pins[51] & 0x04) ? 0x00010000 : 0) |
                                           ((bd->pins[51] & 0x08) ? 0x00020000 : 0);
-        MINFO->values.pll.system        = (bd->pins[43] == 0xFF) ? 50000 : ((bd->pins[43] + 100) * 1000);
-        MINFO->features.pll.ref_freq    = 14318;
+        minfo->values.pll.system        = (bd->pins[43] == 0xFF) ? 50000 : ((bd->pins[43] + 100) * 1000);
+        minfo->features.pll.ref_freq    = 14318;
         return 0;
 }
 
-static void default_pins2(WPMINFO2) {
+static void default_pins2(struct matrox_fb_info *minfo)
+{
         /* Millennium II, Mystique */
-        MINFO->limits.pixel.vcomax      =
-        MINFO->limits.system.vcomax     = 230000;
-        MINFO->values.reg.mctlwtst      = 0x00030101;
-        MINFO->values.pll.system        =  50000;
-        MINFO->features.pll.ref_freq    =  14318;
+        minfo->limits.pixel.vcomax      =
+        minfo->limits.system.vcomax     = 230000;
+        minfo->values.reg.mctlwtst      = 0x00030101;
+        minfo->values.pll.system        =  50000;
+        minfo->features.pll.ref_freq    =  14318;
 }
 
-static int parse_pins3(WPMINFO const struct matrox_bios* bd) {
-        MINFO->limits.pixel.vcomax      =
-        MINFO->limits.system.vcomax     = (bd->pins[36] == 0xFF) ? 230000                       : ((bd->pins[36] + 100) * 1000);
-        MINFO->values.reg.mctlwtst      = get_unaligned_le32(bd->pins + 48) == 0xFFFFFFFF ?
+static int parse_pins3(struct matrox_fb_info *minfo,
+                       const struct matrox_bios *bd)
+{
+        minfo->limits.pixel.vcomax      =
+        minfo->limits.system.vcomax     = (bd->pins[36] == 0xFF) ? 230000                       : ((bd->pins[36] + 100) * 1000);
+        minfo->values.reg.mctlwtst      = get_unaligned_le32(bd->pins + 48) == 0xFFFFFFFF ?
                 0x01250A21 : get_unaligned_le32(bd->pins + 48);
         /* memory config */
-        MINFO->values.reg.memrdbk       = ((bd->pins[57] << 21) & 0x1E000000) |
+        minfo->values.reg.memrdbk       = ((bd->pins[57] << 21) & 0x1E000000) |
                                           ((bd->pins[57] << 22) & 0x00C00000) |
                                           ((bd->pins[56] <<  1) & 0x000001E0) |
                                           ( bd->pins[56]        & 0x0000000F);
-        MINFO->values.reg.opt           = (bd->pins[54] & 7) << 10;
-        MINFO->values.reg.opt2          = bd->pins[58] << 12;
-        MINFO->features.pll.ref_freq    = (bd->pins[52] & 0x20) ? 14318 : 27000;
+        minfo->values.reg.opt           = (bd->pins[54] & 7) << 10;
+        minfo->values.reg.opt2          = bd->pins[58] << 12;
+        minfo->features.pll.ref_freq    = (bd->pins[52] & 0x20) ? 14318 : 27000;
         return 0;
 }
 
-static void default_pins3(WPMINFO2) {
+static void default_pins3(struct matrox_fb_info *minfo)
+{
         /* G100, G200 */
-        MINFO->limits.pixel.vcomax      =
-        MINFO->limits.system.vcomax     = 230000;
-        MINFO->values.reg.mctlwtst      = 0x01250A21;
-        MINFO->values.reg.memrdbk       = 0x00000000;
-        MINFO->values.reg.opt           = 0x00000C00;
-        MINFO->values.reg.opt2          = 0x00000000;
-        MINFO->features.pll.ref_freq    =  27000;
+        minfo->limits.pixel.vcomax      =
+        minfo->limits.system.vcomax     = 230000;
+        minfo->values.reg.mctlwtst      = 0x01250A21;
+        minfo->values.reg.memrdbk       = 0x00000000;
+        minfo->values.reg.opt           = 0x00000C00;
+        minfo->values.reg.opt2          = 0x00000000;
+        minfo->features.pll.ref_freq    =  27000;
 }
 
-static int parse_pins4(WPMINFO const struct matrox_bios* bd) {
-        MINFO->limits.pixel.vcomax      = (bd->pins[ 39] == 0xFF) ? 230000                      : bd->pins[ 39] * 4000;
-        MINFO->limits.system.vcomax     = (bd->pins[ 38] == 0xFF) ? MINFO->limits.pixel.vcomax  : bd->pins[ 38] * 4000;
-        MINFO->values.reg.mctlwtst      = get_unaligned_le32(bd->pins + 71);
-        MINFO->values.reg.memrdbk       = ((bd->pins[87] << 21) & 0x1E000000) |
+static int parse_pins4(struct matrox_fb_info *minfo,
+                       const struct matrox_bios *bd)
+{
+        minfo->limits.pixel.vcomax      = (bd->pins[ 39] == 0xFF) ? 230000                      : bd->pins[ 39] * 4000;
+        minfo->limits.system.vcomax     = (bd->pins[ 38] == 0xFF) ? minfo->limits.pixel.vcomax  : bd->pins[ 38] * 4000;
+        minfo->values.reg.mctlwtst      = get_unaligned_le32(bd->pins + 71);
+        minfo->values.reg.memrdbk       = ((bd->pins[87] << 21) & 0x1E000000) |
                                           ((bd->pins[87] << 22) & 0x00C00000) |
                                           ((bd->pins[86] <<  1) & 0x000001E0) |
                                           ( bd->pins[86]        & 0x0000000F);
-        MINFO->values.reg.opt           = ((bd->pins[53] << 15) & 0x00400000) |
+        minfo->values.reg.opt           = ((bd->pins[53] << 15) & 0x00400000) |
                                           ((bd->pins[53] << 22) & 0x10000000) |
                                           ((bd->pins[53] <<  7) & 0x00001C00);
-        MINFO->values.reg.opt3          = get_unaligned_le32(bd->pins + 67);
-        MINFO->values.pll.system        = (bd->pins[ 65] == 0xFF) ? 200000                      : bd->pins[ 65] * 4000;
-        MINFO->features.pll.ref_freq    = (bd->pins[ 92] & 0x01) ? 14318 : 27000;
+        minfo->values.reg.opt3          = get_unaligned_le32(bd->pins + 67);
+        minfo->values.pll.system        = (bd->pins[ 65] == 0xFF) ? 200000                      : bd->pins[ 65] * 4000;
+        minfo->features.pll.ref_freq    = (bd->pins[ 92] & 0x01) ? 14318 : 27000;
         return 0;
 }
 
-static void default_pins4(WPMINFO2) {
+static void default_pins4(struct matrox_fb_info *minfo)
+{
         /* G400 */
-        MINFO->limits.pixel.vcomax      =
-        MINFO->limits.system.vcomax     = 252000;
-        MINFO->values.reg.mctlwtst      = 0x04A450A1;
-        MINFO->values.reg.memrdbk       = 0x000000E7;
-        MINFO->values.reg.opt           = 0x10000400;
-        MINFO->values.reg.opt3          = 0x0190A419;
-        MINFO->values.pll.system        = 200000;
-        MINFO->features.pll.ref_freq    = 27000;
+        minfo->limits.pixel.vcomax      =
+        minfo->limits.system.vcomax     = 252000;
+        minfo->values.reg.mctlwtst      = 0x04A450A1;
+        minfo->values.reg.memrdbk       = 0x000000E7;
+        minfo->values.reg.opt           = 0x10000400;
+        minfo->values.reg.opt3          = 0x0190A419;
+        minfo->values.pll.system        = 200000;
+        minfo->features.pll.ref_freq    = 27000;
 }
 
-static int parse_pins5(WPMINFO const struct matrox_bios* bd) {
+static int parse_pins5(struct matrox_fb_info *minfo,
+                       const struct matrox_bios *bd)
+{
         unsigned int mult;
         
         mult = bd->pins[4]?8000:6000;
         
-        MINFO->limits.pixel.vcomax      = (bd->pins[ 38] == 0xFF) ? 600000                      : bd->pins[ 38] * mult;
-        MINFO->limits.system.vcomax     = (bd->pins[ 36] == 0xFF) ? MINFO->limits.pixel.vcomax  : bd->pins[ 36] * mult;
-        MINFO->limits.video.vcomax      = (bd->pins[ 37] == 0xFF) ? MINFO->limits.system.vcomax : bd->pins[ 37] * mult;
-        MINFO->limits.pixel.vcomin      = (bd->pins[123] == 0xFF) ? 256000                      : bd->pins[123] * mult;
-        MINFO->limits.system.vcomin     = (bd->pins[121] == 0xFF) ? MINFO->limits.pixel.vcomin  : bd->pins[121] * mult;
-        MINFO->limits.video.vcomin      = (bd->pins[122] == 0xFF) ? MINFO->limits.system.vcomin : bd->pins[122] * mult;
-        MINFO->values.pll.system        =
-        MINFO->values.pll.video         = (bd->pins[ 92] == 0xFF) ? 284000                      : bd->pins[ 92] * 4000;
-        MINFO->values.reg.opt           = get_unaligned_le32(bd->pins + 48);
-        MINFO->values.reg.opt2          = get_unaligned_le32(bd->pins + 52);
-        MINFO->values.reg.opt3          = get_unaligned_le32(bd->pins + 94);
-        MINFO->values.reg.mctlwtst      = get_unaligned_le32(bd->pins + 98);
-        MINFO->values.reg.memmisc       = get_unaligned_le32(bd->pins + 102);
-        MINFO->values.reg.memrdbk       = get_unaligned_le32(bd->pins + 106);
-        MINFO->features.pll.ref_freq    = (bd->pins[110] & 0x01) ? 14318 : 27000;
-        MINFO->values.memory.ddr        = (bd->pins[114] & 0x60) == 0x20;
-        MINFO->values.memory.dll        = (bd->pins[115] & 0x02) != 0;
-        MINFO->values.memory.emrswen    = (bd->pins[115] & 0x01) != 0;
-        MINFO->values.reg.maccess       = MINFO->values.memory.emrswen ? 0x00004000 : 0x00000000;
+        minfo->limits.pixel.vcomax      = (bd->pins[ 38] == 0xFF) ? 600000                      : bd->pins[ 38] * mult;
+        minfo->limits.system.vcomax     = (bd->pins[ 36] == 0xFF) ? minfo->limits.pixel.vcomax  : bd->pins[ 36] * mult;
+        minfo->limits.video.vcomax      = (bd->pins[ 37] == 0xFF) ? minfo->limits.system.vcomax : bd->pins[ 37] * mult;
+        minfo->limits.pixel.vcomin      = (bd->pins[123] == 0xFF) ? 256000                      : bd->pins[123] * mult;
+        minfo->limits.system.vcomin     = (bd->pins[121] == 0xFF) ? minfo->limits.pixel.vcomin  : bd->pins[121] * mult;
+        minfo->limits.video.vcomin      = (bd->pins[122] == 0xFF) ? minfo->limits.system.vcomin : bd->pins[122] * mult;
+        minfo->values.pll.system        =
+        minfo->values.pll.video         = (bd->pins[ 92] == 0xFF) ? 284000                      : bd->pins[ 92] * 4000;
+        minfo->values.reg.opt           = get_unaligned_le32(bd->pins + 48);
+        minfo->values.reg.opt2          = get_unaligned_le32(bd->pins + 52);
+        minfo->values.reg.opt3          = get_unaligned_le32(bd->pins + 94);
+        minfo->values.reg.mctlwtst      = get_unaligned_le32(bd->pins + 98);
+        minfo->values.reg.memmisc       = get_unaligned_le32(bd->pins + 102);
+        minfo->values.reg.memrdbk       = get_unaligned_le32(bd->pins + 106);
+        minfo->features.pll.ref_freq    = (bd->pins[110] & 0x01) ? 14318 : 27000;
+        minfo->values.memory.ddr        = (bd->pins[114] & 0x60) == 0x20;
+        minfo->values.memory.dll        = (bd->pins[115] & 0x02) != 0;
+        minfo->values.memory.emrswen    = (bd->pins[115] & 0x01) != 0;
+        minfo->values.reg.maccess       = minfo->values.memory.emrswen ? 0x00004000 : 0x00000000;
         if (bd->pins[115] & 4) {
-                MINFO->values.reg.mctlwtst_core = MINFO->values.reg.mctlwtst;
+                minfo->values.reg.mctlwtst_core = minfo->values.reg.mctlwtst;
         } else {
                 u_int32_t wtst_xlat[] = { 0, 1, 5, 6, 7, 5, 2, 3 };
-                MINFO->values.reg.mctlwtst_core = (MINFO->values.reg.mctlwtst & ~7) |
-                                                  wtst_xlat[MINFO->values.reg.mctlwtst & 7];
+                minfo->values.reg.mctlwtst_core = (minfo->values.reg.mctlwtst & ~7) |
+                                                  wtst_xlat[minfo->values.reg.mctlwtst & 7];
         }
-        MINFO->max_pixel_clock_panellink = bd->pins[47] * 4000;
+        minfo->max_pixel_clock_panellink = bd->pins[47] * 4000;
         return 0;
 }
 
-static void default_pins5(WPMINFO2) {
+static void default_pins5(struct matrox_fb_info *minfo)
+{
         /* Mine 16MB G450 with SDRAM DDR */
-        MINFO->limits.pixel.vcomax      =
-        MINFO->limits.system.vcomax     =
-        MINFO->limits.video.vcomax      = 600000;
-        MINFO->limits.pixel.vcomin      =
-        MINFO->limits.system.vcomin     =
-        MINFO->limits.video.vcomin      = 256000;
-        MINFO->values.pll.system        =
-        MINFO->values.pll.video         = 284000;
-        MINFO->values.reg.opt           = 0x404A1160;
-        MINFO->values.reg.opt2          = 0x0000AC00;
-        MINFO->values.reg.opt3          = 0x0090A409;
-        MINFO->values.reg.mctlwtst_core =
-        MINFO->values.reg.mctlwtst      = 0x0C81462B;
-        MINFO->values.reg.memmisc       = 0x80000004;
-        MINFO->values.reg.memrdbk       = 0x01001103;
-        MINFO->features.pll.ref_freq    = 27000;
-        MINFO->values.memory.ddr        = 1;
-        MINFO->values.memory.dll        = 1;
-        MINFO->values.memory.emrswen    = 1;
-        MINFO->values.reg.maccess       = 0x00004000;
+        minfo->limits.pixel.vcomax      =
+        minfo->limits.system.vcomax     =
+        minfo->limits.video.vcomax      = 600000;
+        minfo->limits.pixel.vcomin      =
+        minfo->limits.system.vcomin     =
+        minfo->limits.video.vcomin      = 256000;
+        minfo->values.pll.system        =
+        minfo->values.pll.video         = 284000;
+        minfo->values.reg.opt           = 0x404A1160;
+        minfo->values.reg.opt2          = 0x0000AC00;
+        minfo->values.reg.opt3          = 0x0090A409;
+        minfo->values.reg.mctlwtst_core =
+        minfo->values.reg.mctlwtst      = 0x0C81462B;
+        minfo->values.reg.memmisc       = 0x80000004;
+        minfo->values.reg.memrdbk       = 0x01001103;
+        minfo->features.pll.ref_freq    = 27000;
+        minfo->values.memory.ddr        = 1;
+        minfo->values.memory.dll        = 1;
+        minfo->values.memory.emrswen    = 1;
+        minfo->values.reg.maccess       = 0x00004000;
 }
 
-static int matroxfb_set_limits(WPMINFO const struct matrox_bios* bd) {
+static int matroxfb_set_limits(struct matrox_fb_info *minfo,
+                               const struct matrox_bios *bd)
+{
         unsigned int pins_version;
         static const unsigned int pinslen[] = { 64, 64, 64, 128, 128 };
 
-        switch (ACCESS_FBINFO(chip)) {
-                case MGA_2064:  default_pins1(PMINFO2); break;
+        switch (minfo->chip) {
+                case MGA_2064:  default_pins1(minfo); break;
                 case MGA_2164:
                 case MGA_1064:
-                case MGA_1164:  default_pins2(PMINFO2); break;
+                case MGA_1164:  default_pins2(minfo); break;
                 case MGA_G100:
-                case MGA_G200:  default_pins3(PMINFO2); break;
-                case MGA_G400:  default_pins4(PMINFO2); break;
+                case MGA_G200:  default_pins3(minfo); break;
+                case MGA_G400:  default_pins4(minfo); break;
                 case MGA_G450:
-                case MGA_G550:  default_pins5(PMINFO2); break;
+                case MGA_G550:  default_pins5(minfo); break;
         }
         if (!bd->bios_valid) {
                 printk(KERN_INFO "matroxfb: Your Matrox device does not have BIOS\n");
@@ -724,38 +745,39 @@ static int matroxfb_set_limits(WPMINFO const struct matrox_bios* bd) {
         }
         switch (pins_version) {
                 case 1:
-                        return parse_pins1(PMINFO bd);
+                        return parse_pins1(minfo, bd);
                 case 2:
-                        return parse_pins2(PMINFO bd);
+                        return parse_pins2(minfo, bd);
                 case 3:
-                        return parse_pins3(PMINFO bd);
+                        return parse_pins3(minfo, bd);
                 case 4:
-                        return parse_pins4(PMINFO bd);
+                        return parse_pins4(minfo, bd);
                 case 5:
-                        return parse_pins5(PMINFO bd);
+                        return parse_pins5(minfo, bd);
                 default:
                         printk(KERN_DEBUG "matroxfb: Powerup info version %u is not yet supported\n", pins_version);
                         return -1;
         }
 }
 
-void matroxfb_read_pins(WPMINFO2) {
+void matroxfb_read_pins(struct matrox_fb_info *minfo)
+{
         u32 opt;
         u32 biosbase;
         u32 fbbase;
-        struct pci_dev* pdev = ACCESS_FBINFO(pcidev);
+        struct pci_dev *pdev = minfo->pcidev;
         
-        memset(&ACCESS_FBINFO(bios), 0, sizeof(ACCESS_FBINFO(bios)));
+        memset(&minfo->bios, 0, sizeof(minfo->bios));
         pci_read_config_dword(pdev, PCI_OPTION_REG, &opt);
         pci_write_config_dword(pdev, PCI_OPTION_REG, opt | PCI_OPTION_ENABLE_ROM);
         pci_read_config_dword(pdev, PCI_ROM_ADDRESS, &biosbase);
-        pci_read_config_dword(pdev, ACCESS_FBINFO(devflags.fbResource), &fbbase);
+        pci_read_config_dword(pdev, minfo->devflags.fbResource, &fbbase);
         pci_write_config_dword(pdev, PCI_ROM_ADDRESS, (fbbase & PCI_ROM_ADDRESS_MASK) | PCI_ROM_ADDRESS_ENABLE);
-        parse_bios(vaddr_va(ACCESS_FBINFO(video).vbase), &ACCESS_FBINFO(bios));
+        parse_bios(vaddr_va(minfo->video.vbase), &minfo->bios);
         pci_write_config_dword(pdev, PCI_ROM_ADDRESS, biosbase);
         pci_write_config_dword(pdev, PCI_OPTION_REG, opt);
 #ifdef CONFIG_X86
-        if (!ACCESS_FBINFO(bios).bios_valid) {
+        if (!minfo->bios.bios_valid) {
                 unsigned char __iomem* b;
 
                 b = ioremap(0x000C0000, 65536);
@@ -769,25 +791,21 @@ void matroxfb_read_pins(WPMINFO2) {
                                 printk(KERN_INFO "matroxfb: Legacy BIOS is for %04X:%04X, while this device is %04X:%04X\n",
                                         ven, dev, pdev->vendor, pdev->device);
                         } else {
-                                parse_bios(b, &ACCESS_FBINFO(bios));
+                                parse_bios(b, &minfo->bios);
                         }
                         iounmap(b);
                 }
         }
 #endif
-        matroxfb_set_limits(PMINFO &ACCESS_FBINFO(bios));
+        matroxfb_set_limits(minfo, &minfo->bios);
         printk(KERN_INFO "PInS memtype = %u\n",
-               (ACCESS_FBINFO(values).reg.opt & 0x1C00) >> 10);
+               (minfo->values.reg.opt & 0x1C00) >> 10);
 }
 
 EXPORT_SYMBOL(matroxfb_DAC_in);
 EXPORT_SYMBOL(matroxfb_DAC_out);
 EXPORT_SYMBOL(matroxfb_var2my);
 EXPORT_SYMBOL(matroxfb_PLL_calcclock);
-#ifndef CONFIG_FB_MATROX_MULTIHEAD
-struct matrox_fb_info matroxfb_global_mxinfo;
-EXPORT_SYMBOL(matroxfb_global_mxinfo);
-#endif
 EXPORT_SYMBOL(matroxfb_vgaHWinit);              /* DAC1064, Ti3026 */
 EXPORT_SYMBOL(matroxfb_vgaHWrestore);           /* DAC1064, Ti3026 */
 EXPORT_SYMBOL(matroxfb_read_pins);
diff --git a/drivers/video/matrox/matroxfb_misc.h b/drivers/video/matrox/matroxfb_misc.h
index cb62cc0ead96..351c823f1f74 100644
--- a/drivers/video/matrox/matroxfb_misc.h
+++ b/drivers/video/matrox/matroxfb_misc.h
@@ -6,13 +6,16 @@
 /* also for modules */
 int matroxfb_PLL_calcclock(const struct matrox_pll_features* pll, unsigned int freq, unsigned int fmax,
         unsigned int* in, unsigned int* feed, unsigned int* post);
-static inline int PLL_calcclock(CPMINFO unsigned int freq, unsigned int fmax,
-                unsigned int* in, unsigned int* feed, unsigned int* post) {
-        return matroxfb_PLL_calcclock(&ACCESS_FBINFO(features.pll), freq, fmax, in, feed, post);
+static inline int PLL_calcclock(const struct matrox_fb_info *minfo,
+                                unsigned int freq, unsigned int fmax,
+                                unsigned int *in, unsigned int *feed,
+                                unsigned int *post)
+{
+        return matroxfb_PLL_calcclock(&minfo->features.pll, freq, fmax, in, feed, post);
 }
 
-int matroxfb_vgaHWinit(WPMINFO struct my_timming* m);
-void matroxfb_vgaHWrestore(WPMINFO2);
-void matroxfb_read_pins(WPMINFO2);
+int matroxfb_vgaHWinit(struct matrox_fb_info *minfo, struct my_timming* m);
+void matroxfb_vgaHWrestore(struct matrox_fb_info *minfo);
+void matroxfb_read_pins(struct matrox_fb_info *minfo);
 
 #endif  /* __MATROXFB_MISC_H__ */
diff --git a/drivers/video/msm/Makefile b/drivers/video/msm/Makefile
new file mode 100644
index 000000000000..802d6ae523fb
--- /dev/null
+++ b/drivers/video/msm/Makefile
@@ -0,0 +1,19 @@
+
+# core framebuffer
+#
+obj-y := msm_fb.o
+
+# MDP DMA/PPP engine
+#
+obj-y += mdp.o mdp_scale_tables.o mdp_ppp.o
+
+# MDDI interface
+#
+obj-y += mddi.o
+
+# MDDI client/panel drivers
+#
+obj-y += mddi_client_dummy.o
+obj-y += mddi_client_toshiba.o
+obj-y += mddi_client_nt35399.o
+
diff --git a/drivers/video/msm/mddi.c b/drivers/video/msm/mddi.c
new file mode 100644
index 000000000000..f2de5a1acd6d
--- /dev/null
+++ b/drivers/video/msm/mddi.c
@@ -0,0 +1,828 @@
+/*
+ * MSM MDDI Transport
+ *
+ * Copyright (C) 2007 Google Incorporated
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ */
+
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/dma-mapping.h>
+#include <linux/interrupt.h>
+#include <linux/platform_device.h>
+#include <linux/delay.h>
+#include <linux/spinlock.h>
+#include <linux/clk.h>
+#include <linux/io.h>
+#include <mach/msm_iomap.h>
+#include <mach/irqs.h>
+#include <mach/board.h>
+#include <linux/delay.h>
+
+#include <mach/msm_fb.h>
+#include "mddi_hw.h"
+
+#define FLAG_DISABLE_HIBERNATION 0x0001
+#define FLAG_HAVE_CAPS           0x0002
+#define FLAG_HAS_VSYNC_IRQ       0x0004
+#define FLAG_HAVE_STATUS         0x0008
+
+#define CMD_GET_CLIENT_CAP     0x0601
+#define CMD_GET_CLIENT_STATUS  0x0602
+
+union mddi_rev {
+        unsigned char raw[MDDI_REV_BUFFER_SIZE];
+        struct mddi_rev_packet hdr;
+        struct mddi_client_status status;
+        struct mddi_client_caps caps;
+        struct mddi_register_access reg;
+};
+
+struct reg_read_info {
+        struct completion done;
+        uint32_t reg;
+        uint32_t status;
+        uint32_t result;
+};
+
+struct mddi_info {
+        uint16_t flags;
+        uint16_t version;
+        char __iomem *base;
+        int irq;
+        struct clk *clk;
+        struct msm_mddi_client_data client_data;
+
+        /* buffer for rev encap packets */
+        void *rev_data;
+        dma_addr_t rev_addr;
+        struct mddi_llentry *reg_write_data;
+        dma_addr_t reg_write_addr;
+        struct mddi_llentry *reg_read_data;
+        dma_addr_t reg_read_addr;
+        size_t rev_data_curr;
+
+        spinlock_t int_lock;
+        uint32_t int_enable;
+        uint32_t got_int;
+        wait_queue_head_t int_wait;
+
+        struct mutex reg_write_lock;
+        struct mutex reg_read_lock;
+        struct reg_read_info *reg_read;
+
+        struct mddi_client_caps caps;
+        struct mddi_client_status status;
+
+        void (*power_client)(struct msm_mddi_client_data *, int);
+
+        /* client device published to bind us to the
+         * appropriate mddi_client driver
+         */
+        char client_name[20];
+
+        struct platform_device client_pdev;
+};
+
+static void mddi_init_rev_encap(struct mddi_info *mddi);
+
+#define mddi_readl(r) readl(mddi->base + (MDDI_##r))
+#define mddi_writel(v, r) writel((v), mddi->base + (MDDI_##r))
+
+void mddi_activate_link(struct msm_mddi_client_data *cdata)
+{
+        struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+                                              client_data);
+
+        mddi_writel(MDDI_CMD_LINK_ACTIVE, CMD);
+}
+
+static void mddi_handle_link_list_done(struct mddi_info *mddi)
+{
+}
+
+static void mddi_reset_rev_encap_ptr(struct mddi_info *mddi)
+{
+        printk(KERN_INFO "mddi: resetting rev ptr\n");
+        mddi->rev_data_curr = 0;
+        mddi_writel(mddi->rev_addr, REV_PTR);
+        mddi_writel(mddi->rev_addr, REV_PTR);
+        mddi_writel(MDDI_CMD_FORCE_NEW_REV_PTR, CMD);
+}
+
+static void mddi_handle_rev_data(struct mddi_info *mddi, union mddi_rev *rev)
+{
+        int i;
+        struct reg_read_info *ri;
+
+        if ((rev->hdr.length <= MDDI_REV_BUFFER_SIZE - 2) &&
+           (rev->hdr.length >= sizeof(struct mddi_rev_packet) - 2)) {
+
+                switch (rev->hdr.type) {
+                case TYPE_CLIENT_CAPS:
+                        memcpy(&mddi->caps, &rev->caps,
+                               sizeof(struct mddi_client_caps));
+                        mddi->flags |= FLAG_HAVE_CAPS;
+                        wake_up(&mddi->int_wait);
+                        break;
+                case TYPE_CLIENT_STATUS:
+                        memcpy(&mddi->status, &rev->status,
+                               sizeof(struct mddi_client_status));
+                        mddi->flags |= FLAG_HAVE_STATUS;
+                        wake_up(&mddi->int_wait);
+                        break;
+                case TYPE_REGISTER_ACCESS:
+                        ri = mddi->reg_read;
+                        if (ri == 0) {
+                                printk(KERN_INFO "rev: got reg %x = %x without "
+                                                 " pending read\n",
+                                       rev->reg.register_address,
+                                       rev->reg.register_data_list);
+                                break;
+                        }
+                        if (ri->reg != rev->reg.register_address) {
+                                printk(KERN_INFO "rev: got reg %x = %x for "
+                                                 "wrong register, expected "
+                                                 "%x\n",
+                                       rev->reg.register_address,
+                                       rev->reg.register_data_list, ri->reg);
+                                break;
+                        }
+                        mddi->reg_read = NULL;
+                        ri->status = 0;
+                        ri->result = rev->reg.register_data_list;
+                        complete(&ri->done);
+                        break;
+                default:
+                        printk(KERN_INFO "rev: unknown reverse packet: "
+                                         "len=%04x type=%04x CURR_REV_PTR=%x\n",
+                               rev->hdr.length, rev->hdr.type,
+                               mddi_readl(CURR_REV_PTR));
+                        for (i = 0; i < rev->hdr.length + 2; i++) {
+                                if ((i % 16) == 0)
+                                        printk(KERN_INFO "\n");
+                                printk(KERN_INFO " %02x", rev->raw[i]);
+                        }
+                        printk(KERN_INFO "\n");
+                        mddi_reset_rev_encap_ptr(mddi);
+                }
+        } else {
+                printk(KERN_INFO "bad rev length, %d, CURR_REV_PTR %x\n",
+                       rev->hdr.length, mddi_readl(CURR_REV_PTR));
+                mddi_reset_rev_encap_ptr(mddi);
+        }
+}
+
+static void mddi_wait_interrupt(struct mddi_info *mddi, uint32_t intmask);
+
+static void mddi_handle_rev_data_avail(struct mddi_info *mddi)
+{
+        union mddi_rev *rev = mddi->rev_data;
+        uint32_t rev_data_count;
+        uint32_t rev_crc_err_count;
+        int i;
+        struct reg_read_info *ri;
+        size_t prev_offset;
+        uint16_t length;
+
+        union mddi_rev *crev = mddi->rev_data + mddi->rev_data_curr;
+
+        /* clear the interrupt */
+        mddi_writel(MDDI_INT_REV_DATA_AVAIL, INT);
+        rev_data_count = mddi_readl(REV_PKT_CNT);
+        rev_crc_err_count = mddi_readl(REV_CRC_ERR);
+        if (rev_data_count > 1)
+                printk(KERN_INFO "rev_data_count %d\n", rev_data_count);
+
+        if (rev_crc_err_count) {
+                printk(KERN_INFO "rev_crc_err_count %d, INT %x\n",
+                       rev_crc_err_count,  mddi_readl(INT));
+                ri = mddi->reg_read;
+                if (ri == 0) {
+                        printk(KERN_INFO "rev: got crc error without pending "
+                               "read\n");
+                } else {
+                        mddi->reg_read = NULL;
+                        ri->status = -EIO;
+                        ri->result = -1;
+                        complete(&ri->done);
+                }
+        }
+
+        if (rev_data_count == 0)
+                return;
+
+        prev_offset = mddi->rev_data_curr;
+
+        length = *((uint8_t *)mddi->rev_data + mddi->rev_data_curr);
+        mddi->rev_data_curr++;
+        if (mddi->rev_data_curr == MDDI_REV_BUFFER_SIZE)
+                mddi->rev_data_curr = 0;
+        length += *((uint8_t *)mddi->rev_data + mddi->rev_data_curr) << 8;
+        mddi->rev_data_curr += 1 + length;
+        if (mddi->rev_data_curr >= MDDI_REV_BUFFER_SIZE)
+                mddi->rev_data_curr =
+                        mddi->rev_data_curr % MDDI_REV_BUFFER_SIZE;
+
+        if (length > MDDI_REV_BUFFER_SIZE - 2) {
+                printk(KERN_INFO "mddi: rev data length greater than buffer"
+                        "size\n");
+                mddi_reset_rev_encap_ptr(mddi);
+                return;
+        }
+
+        if (prev_offset + 2 + length >= MDDI_REV_BUFFER_SIZE) {
+                union mddi_rev tmprev;
+                size_t rem = MDDI_REV_BUFFER_SIZE - prev_offset;
+                memcpy(&tmprev.raw[0], mddi->rev_data + prev_offset, rem);
+                memcpy(&tmprev.raw[rem], mddi->rev_data, 2 + length - rem);
+                mddi_handle_rev_data(mddi, &tmprev);
+        } else {
+                mddi_handle_rev_data(mddi, crev);
+        }
+
+        if (prev_offset < MDDI_REV_BUFFER_SIZE / 2 &&
+            mddi->rev_data_curr >= MDDI_REV_BUFFER_SIZE / 2) {
+                mddi_writel(mddi->rev_addr, REV_PTR);
+        }
+}
+
+static irqreturn_t mddi_isr(int irq, void *data)
+{
+        struct msm_mddi_client_data *cdata = data;
+        struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+                                              client_data);
+        uint32_t active, status;
+
+        spin_lock(&mddi->int_lock);
+
+        active = mddi_readl(INT);
+        status = mddi_readl(STAT);
+
+        mddi_writel(active, INT);
+
+        /* ignore any interrupts we have disabled */
+        active &= mddi->int_enable;
+
+        mddi->got_int |= active;
+        wake_up(&mddi->int_wait);
+
+        if (active & MDDI_INT_PRI_LINK_LIST_DONE) {
+                mddi->int_enable &= (~MDDI_INT_PRI_LINK_LIST_DONE);
+                mddi_handle_link_list_done(mddi);
+        }
+        if (active & MDDI_INT_REV_DATA_AVAIL)
+                mddi_handle_rev_data_avail(mddi);
+
+        if (active & ~MDDI_INT_NEED_CLEAR)
+                mddi->int_enable &= ~(active & ~MDDI_INT_NEED_CLEAR);
+
+        if (active & MDDI_INT_LINK_ACTIVE) {
+                mddi->int_enable &= (~MDDI_INT_LINK_ACTIVE);
+                mddi->int_enable |= MDDI_INT_IN_HIBERNATION;
+        }
+
+        if (active & MDDI_INT_IN_HIBERNATION) {
+                mddi->int_enable &= (~MDDI_INT_IN_HIBERNATION);
+                mddi->int_enable |= MDDI_INT_LINK_ACTIVE;
+        }
+
+        mddi_writel(mddi->int_enable, INTEN);
+        spin_unlock(&mddi->int_lock);
+
+        return IRQ_HANDLED;
+}
+
+static long mddi_wait_interrupt_timeout(struct mddi_info *mddi,
+                                        uint32_t intmask, int timeout)
+{
+        unsigned long irq_flags;
+
+        spin_lock_irqsave(&mddi->int_lock, irq_flags);
+        mddi->got_int &= ~intmask;
+        mddi->int_enable |= intmask;
+        mddi_writel(mddi->int_enable, INTEN);
+        spin_unlock_irqrestore(&mddi->int_lock, irq_flags);
+        return wait_event_timeout(mddi->int_wait, mddi->got_int & intmask,
+                                  timeout);
+}
+
+static void mddi_wait_interrupt(struct mddi_info *mddi, uint32_t intmask)
+{
+        if (mddi_wait_interrupt_timeout(mddi, intmask, HZ/10) == 0)
+                printk(KERN_INFO KERN_ERR "mddi_wait_interrupt %d, timeout "
+                       "waiting for %x, INT = %x, STAT = %x gotint = %x\n",
+                       current->pid, intmask, mddi_readl(INT), mddi_readl(STAT),
+                       mddi->got_int);
+}
+
+static void mddi_init_rev_encap(struct mddi_info *mddi)
+{
+        memset(mddi->rev_data, 0xee, MDDI_REV_BUFFER_SIZE);
+        mddi_writel(mddi->rev_addr, REV_PTR);
+        mddi_writel(MDDI_CMD_FORCE_NEW_REV_PTR, CMD);
+        mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+}
+
+void mddi_set_auto_hibernate(struct msm_mddi_client_data *cdata, int on)
+{
+        struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+                                              client_data);
+        mddi_writel(MDDI_CMD_POWERDOWN, CMD);
+        mddi_wait_interrupt(mddi, MDDI_INT_IN_HIBERNATION);
+        mddi_writel(MDDI_CMD_HIBERNATE | !!on, CMD);
+        mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+}
+
+
+static uint16_t mddi_init_registers(struct mddi_info *mddi)
+{
+        mddi_writel(0x0001, VERSION);
+        mddi_writel(MDDI_HOST_BYTES_PER_SUBFRAME, BPS);
+        mddi_writel(0x0003, SPM); /* subframes per media */
+        mddi_writel(0x0005, TA1_LEN);
+        mddi_writel(MDDI_HOST_TA2_LEN, TA2_LEN);
+        mddi_writel(0x0096, DRIVE_HI);
+        /* 0x32 normal, 0x50 for Toshiba display */
+        mddi_writel(0x0050, DRIVE_LO);
+        mddi_writel(0x003C, DISP_WAKE); /* wakeup counter */
+        mddi_writel(MDDI_HOST_REV_RATE_DIV, REV_RATE_DIV);
+
+        mddi_writel(MDDI_REV_BUFFER_SIZE, REV_SIZE);
+        mddi_writel(MDDI_MAX_REV_PKT_SIZE, REV_ENCAP_SZ);
+
+        /* disable periodic rev encap */
+        mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP, CMD);
+        mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+
+        if (mddi_readl(PAD_CTL) == 0) {
+                /* If we are turning on band gap, need to wait 5us before
+                 * turning on the rest of the PAD */
+                mddi_writel(0x08000, PAD_CTL);
+                udelay(5);
+        }
+
+        /* Recommendation from PAD hw team */
+        mddi_writel(0xa850f, PAD_CTL);
+
+
+        /* Need an even number for counts */
+        mddi_writel(0x60006, DRIVER_START_CNT);
+
+        mddi_set_auto_hibernate(&mddi->client_data, 0);
+
+        mddi_writel(MDDI_CMD_DISP_IGNORE, CMD);
+        mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+
+        mddi_init_rev_encap(mddi);
+        return mddi_readl(CORE_VER) & 0xffff;
+}
+
+static void mddi_suspend(struct msm_mddi_client_data *cdata)
+{
+        struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+                                              client_data);
+        /* turn off the client */
+        if (mddi->power_client)
+                mddi->power_client(&mddi->client_data, 0);
+        /* turn off the link */
+        mddi_writel(MDDI_CMD_RESET, CMD);
+        mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+        /* turn off the clock */
+        clk_disable(mddi->clk);
+}
+
+static void mddi_resume(struct msm_mddi_client_data *cdata)
+{
+        struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+                                              client_data);
+        mddi_set_auto_hibernate(&mddi->client_data, 0);
+        /* turn on the client */
+        if (mddi->power_client)
+                mddi->power_client(&mddi->client_data, 1);
+        /* turn on the clock */
+        clk_enable(mddi->clk);
+        /* set up the local registers */
+        mddi->rev_data_curr = 0;
+        mddi_init_registers(mddi);
+        mddi_writel(mddi->int_enable, INTEN);
+        mddi_writel(MDDI_CMD_LINK_ACTIVE, CMD);
+        mddi_writel(MDDI_CMD_SEND_RTD, CMD);
+        mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+        mddi_set_auto_hibernate(&mddi->client_data, 1);
+}
+
+static int __init mddi_get_client_caps(struct mddi_info *mddi)
+{
+        int i, j;
+
+        /* clear any stale interrupts */
+        mddi_writel(0xffffffff, INT);
+
+        mddi->int_enable = MDDI_INT_LINK_ACTIVE |
+                           MDDI_INT_IN_HIBERNATION |
+                           MDDI_INT_PRI_LINK_LIST_DONE |
+                           MDDI_INT_REV_DATA_AVAIL |
+                           MDDI_INT_REV_OVERFLOW |
+                           MDDI_INT_REV_OVERWRITE |
+                           MDDI_INT_RTD_FAILURE;
+        mddi_writel(mddi->int_enable, INTEN);
+
+        mddi_writel(MDDI_CMD_LINK_ACTIVE, CMD);
+        mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+
+        for (j = 0; j < 3; j++) {
+                /* the toshiba vga panel does not respond to get
+                 * caps unless you SEND_RTD, but the first SEND_RTD
+                 * will fail...
+                 */
+                for (i = 0; i < 4; i++) {
+                        uint32_t stat;
+
+                        mddi_writel(MDDI_CMD_SEND_RTD, CMD);
+                        mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+                        stat = mddi_readl(STAT);
+                        printk(KERN_INFO "mddi cmd send rtd: int %x, stat %x, "
+                                        "rtd val %x\n", mddi_readl(INT), stat,
+                                        mddi_readl(RTD_VAL));
+                        if ((stat & MDDI_STAT_RTD_MEAS_FAIL) == 0)
+                                break;
+                        msleep(1);
+                }
+
+                mddi_writel(CMD_GET_CLIENT_CAP, CMD);
+                mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+                wait_event_timeout(mddi->int_wait, mddi->flags & FLAG_HAVE_CAPS,
+                                   HZ / 100);
+
+                if (mddi->flags & FLAG_HAVE_CAPS)
+                        break;
+                printk(KERN_INFO KERN_ERR "mddi_init, timeout waiting for "
+                                "caps\n");
+        }
+        return mddi->flags & FLAG_HAVE_CAPS;
+}
+
+/* link must be active when this is called */
+int mddi_check_status(struct mddi_info *mddi)
+{
+        int ret = -1, retry = 3;
+        mutex_lock(&mddi->reg_read_lock);
+        mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP | 1, CMD);
+        mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+
+        do {
+                mddi->flags &= ~FLAG_HAVE_STATUS;
+                mddi_writel(CMD_GET_CLIENT_STATUS, CMD);
+                mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+                wait_event_timeout(mddi->int_wait,
+                                   mddi->flags & FLAG_HAVE_STATUS,
+                                   HZ / 100);
+
+                if (mddi->flags & FLAG_HAVE_STATUS) {
+                        if (mddi->status.crc_error_count)
+                                printk(KERN_INFO "mddi status: crc_error "
+                                        "count: %d\n",
+                                        mddi->status.crc_error_count);
+                        else
+                                ret = 0;
+                        break;
+                } else
+                        printk(KERN_INFO "mddi status: failed to get client "
+                                "status\n");
+                mddi_writel(MDDI_CMD_SEND_RTD, CMD);
+                mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+        } while (--retry);
+
+        mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP | 0, CMD);
+        mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+        mutex_unlock(&mddi->reg_read_lock);
+        return ret;
+}
+
+
+void mddi_remote_write(struct msm_mddi_client_data *cdata, uint32_t val,
+                       uint32_t reg)
+{
+        struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+                                              client_data);
+        struct mddi_llentry *ll;
+        struct mddi_register_access *ra;
+
+        mutex_lock(&mddi->reg_write_lock);
+
+        ll = mddi->reg_write_data;
+
+        ra = &(ll->u.r);
+        ra->length = 14 + 4;
+        ra->type = TYPE_REGISTER_ACCESS;
+        ra->client_id = 0;
+        ra->read_write_info = MDDI_WRITE | 1;
+        ra->crc16 = 0;
+
+        ra->register_address = reg;
+        ra->register_data_list = val;
+
+        ll->flags = 1;
+        ll->header_count = 14;
+        ll->data_count = 4;
+        ll->data = mddi->reg_write_addr + offsetof(struct mddi_llentry,
+                                                   u.r.register_data_list);
+        ll->next = 0;
+        ll->reserved = 0;
+
+        mddi_writel(mddi->reg_write_addr, PRI_PTR);
+
+        mddi_wait_interrupt(mddi, MDDI_INT_PRI_LINK_LIST_DONE);
+        mutex_unlock(&mddi->reg_write_lock);
+}
+
+uint32_t mddi_remote_read(struct msm_mddi_client_data *cdata, uint32_t reg)
+{
+        struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+                                              client_data);
+        struct mddi_llentry *ll;
+        struct mddi_register_access *ra;
+        struct reg_read_info ri;
+        unsigned s;
+        int retry_count = 2;
+        unsigned long irq_flags;
+
+        mutex_lock(&mddi->reg_read_lock);
+
+        ll = mddi->reg_read_data;
+
+        ra = &(ll->u.r);
+        ra->length = 14;
+        ra->type = TYPE_REGISTER_ACCESS;
+        ra->client_id = 0;
+        ra->read_write_info = MDDI_READ | 1;
+        ra->crc16 = 0;
+
+        ra->register_address = reg;
+
+        ll->flags = 0x11;
+        ll->header_count = 14;
+        ll->data_count = 0;
+        ll->data = 0;
+        ll->next = 0;
+        ll->reserved = 0;
+
+        s = mddi_readl(STAT);
+
+        ri.reg = reg;
+        ri.status = -1;
+
+        do {
+                init_completion(&ri.done);
+                mddi->reg_read = &ri;
+                mddi_writel(mddi->reg_read_addr, PRI_PTR);
+
+                mddi_wait_interrupt(mddi, MDDI_INT_PRI_LINK_LIST_DONE);
+
+                /* Enable Periodic Reverse Encapsulation. */
+                mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP | 1, CMD);
+                mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+                if (wait_for_completion_timeout(&ri.done, HZ/10) == 0 &&
+                    !ri.done.done) {
+                        printk(KERN_INFO "mddi_remote_read(%x) timeout "
+                                         "(%d %d %d)\n",
+                               reg, ri.status, ri.result, ri.done.done);
+                        spin_lock_irqsave(&mddi->int_lock, irq_flags);
+                        mddi->reg_read = NULL;
+                        spin_unlock_irqrestore(&mddi->int_lock, irq_flags);
+                        ri.status = -1;
+                        ri.result = -1;
+                }
+                if (ri.status == 0)
+                        break;
+
+                mddi_writel(MDDI_CMD_SEND_RTD, CMD);
+                mddi_writel(MDDI_CMD_LINK_ACTIVE, CMD);
+                mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+                printk(KERN_INFO "mddi_remote_read: failed, sent "
+                       "MDDI_CMD_SEND_RTD: int %x, stat %x, rtd val %x "
+                       "curr_rev_ptr %x\n", mddi_readl(INT), mddi_readl(STAT),
+                       mddi_readl(RTD_VAL), mddi_readl(CURR_REV_PTR));
+        } while (retry_count-- > 0);
+        /* Disable Periodic Reverse Encapsulation. */
+        mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP | 0, CMD);
+        mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+        mddi->reg_read = NULL;
+        mutex_unlock(&mddi->reg_read_lock);
+        return ri.result;
+}
+
+static struct mddi_info mddi_info[2];
+
+static int __init mddi_clk_setup(struct platform_device *pdev,
+                                 struct mddi_info *mddi,
+                                 unsigned long clk_rate)
+{
+        int ret;
+
+        /* set up the clocks */
+        mddi->clk = clk_get(&pdev->dev, "mddi_clk");
+        if (IS_ERR(mddi->clk)) {
+                printk(KERN_INFO "mddi: failed to get clock\n");
+                return PTR_ERR(mddi->clk);
+        }
+        ret =  clk_enable(mddi->clk);
+        if (ret)
+                goto fail;
+        ret = clk_set_rate(mddi->clk, clk_rate);
+        if (ret)
+                goto fail;
+        return 0;
+
+fail:
+        clk_put(mddi->clk);
+        return ret;
+}
+
+static int __init mddi_rev_data_setup(struct mddi_info *mddi)
+{
+        void *dma;
+        dma_addr_t dma_addr;
+
+        /* set up dma buffer */
+        dma = dma_alloc_coherent(NULL, 0x1000, &dma_addr, GFP_KERNEL);
+        if (dma == 0)
+                return -ENOMEM;
+        mddi->rev_data = dma;
+        mddi->rev_data_curr = 0;
+        mddi->rev_addr = dma_addr;
+        mddi->reg_write_data = dma + MDDI_REV_BUFFER_SIZE;
+        mddi->reg_write_addr = dma_addr + MDDI_REV_BUFFER_SIZE;
+        mddi->reg_read_data = mddi->reg_write_data + 1;
+        mddi->reg_read_addr = mddi->reg_write_addr +
+                              sizeof(*mddi->reg_write_data);
+        return 0;
+}
+
+static int __init mddi_probe(struct platform_device *pdev)
+{
+        struct msm_mddi_platform_data *pdata = pdev->dev.platform_data;
+        struct mddi_info *mddi = &mddi_info[pdev->id];
+        struct resource *resource;
+        int ret, i;
+
+        resource = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+        if (!resource) {
+                printk(KERN_ERR "mddi: no associated mem resource!\n");
+                return -ENOMEM;
+        }
+        mddi->base = ioremap(resource->start, resource->end - resource->start);
+        if (!mddi->base) {
+                printk(KERN_ERR "mddi: failed to remap base!\n");
+                ret = -EINVAL;
+                goto error_ioremap;
+        }
+        resource = platform_get_resource(pdev, IORESOURCE_IRQ, 0);
+        if (!resource) {
+                printk(KERN_ERR "mddi: no associated irq resource!\n");
+                ret = -EINVAL;
+                goto error_get_irq_resource;
+        }
+        mddi->irq = resource->start;
+        printk(KERN_INFO "mddi: init() base=0x%p irq=%d\n", mddi->base,
+               mddi->irq);
+        mddi->power_client = pdata->power_client;
+
+        mutex_init(&mddi->reg_write_lock);
+        mutex_init(&mddi->reg_read_lock);
+        spin_lock_init(&mddi->int_lock);
+        init_waitqueue_head(&mddi->int_wait);
+
+        ret = mddi_clk_setup(pdev, mddi, pdata->clk_rate);
+        if (ret) {
+                printk(KERN_ERR "mddi: failed to setup clock!\n");
+                goto error_clk_setup;
+        }
+
+        ret = mddi_rev_data_setup(mddi);
+        if (ret) {
+                printk(KERN_ERR "mddi: failed to setup rev data!\n");
+                goto error_rev_data;
+        }
+
+        mddi->int_enable = 0;
+        mddi_writel(mddi->int_enable, INTEN);
+        ret = request_irq(mddi->irq, mddi_isr, IRQF_DISABLED, "mddi",
+                          &mddi->client_data);
+        if (ret) {
+                printk(KERN_ERR "mddi: failed to request enable irq!\n");
+                goto error_request_irq;
+        }
+
+        /* turn on the mddi client bridge chip */
+        if (mddi->power_client)
+                mddi->power_client(&mddi->client_data, 1);
+
+        /* initialize the mddi registers */
+        mddi_set_auto_hibernate(&mddi->client_data, 0);
+        mddi_writel(MDDI_CMD_RESET, CMD);
+        mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+        mddi->version = mddi_init_registers(mddi);
+        if (mddi->version < 0x20) {
+                printk(KERN_ERR "mddi: unsupported version 0x%x\n",
+                       mddi->version);
+                ret = -ENODEV;
+                goto error_mddi_version;
+        }
+
+        /* read the capabilities off the client */
+        if (!mddi_get_client_caps(mddi)) {
+                printk(KERN_INFO "mddi: no client found\n");
+                /* power down the panel */
+                mddi_writel(MDDI_CMD_POWERDOWN, CMD);
+                printk(KERN_INFO "mddi powerdown: stat %x\n", mddi_readl(STAT));
+                msleep(100);
+                printk(KERN_INFO "mddi powerdown: stat %x\n", mddi_readl(STAT));
+                return 0;
+        }
+        mddi_set_auto_hibernate(&mddi->client_data, 1);
+
+        if (mddi->caps.Mfr_Name == 0 && mddi->caps.Product_Code == 0)
+                pdata->fixup(&mddi->caps.Mfr_Name, &mddi->caps.Product_Code);
+
+        mddi->client_pdev.id = 0;
+        for (i = 0; i < pdata->num_clients; i++) {
+                if (pdata->client_platform_data[i].product_id ==
+                    (mddi->caps.Mfr_Name << 16 | mddi->caps.Product_Code)) {
+                        mddi->client_data.private_client_data =
+                                pdata->client_platform_data[i].client_data;
+                        mddi->client_pdev.name =
+                                pdata->client_platform_data[i].name;
+                        mddi->client_pdev.id =
+                                pdata->client_platform_data[i].id;
+                        /* XXX: possibly set clock */
+                        break;
+                }
+        }
+
+        if (i >= pdata->num_clients)
+                mddi->client_pdev.name = "mddi_c_dummy";
+        printk(KERN_INFO "mddi: registering panel %s\n",
+                mddi->client_pdev.name);
+
+        mddi->client_data.suspend = mddi_suspend;
+        mddi->client_data.resume = mddi_resume;
+        mddi->client_data.activate_link = mddi_activate_link;
+        mddi->client_data.remote_write = mddi_remote_write;
+        mddi->client_data.remote_read = mddi_remote_read;
+        mddi->client_data.auto_hibernate = mddi_set_auto_hibernate;
+        mddi->client_data.fb_resource = pdata->fb_resource;
+        if (pdev->id == 0)
+                mddi->client_data.interface_type = MSM_MDDI_PMDH_INTERFACE;
+        else if (pdev->id == 1)
+                mddi->client_data.interface_type = MSM_MDDI_EMDH_INTERFACE;
+        else {
+                printk(KERN_ERR "mddi: can not determine interface %d!\n",
+                       pdev->id);
+                ret = -EINVAL;
+                goto error_mddi_interface;
+        }
+
+        mddi->client_pdev.dev.platform_data = &mddi->client_data;
+        printk(KERN_INFO "mddi: publish: %s\n", mddi->client_name);
+        platform_device_register(&mddi->client_pdev);
+        return 0;
+
+error_mddi_interface:
+error_mddi_version:
+        free_irq(mddi->irq, 0);
+error_request_irq:
+        dma_free_coherent(NULL, 0x1000, mddi->rev_data, mddi->rev_addr);
+error_rev_data:
+error_clk_setup:
+error_get_irq_resource:
+        iounmap(mddi->base);
+error_ioremap:
+
+        printk(KERN_INFO "mddi: mddi_init() failed (%d)\n", ret);
+        return ret;
+}
+
+
+static struct platform_driver mddi_driver = {
+        .probe = mddi_probe,
+        .driver = { .name = "msm_mddi" },
+};
+
+static int __init _mddi_init(void)
+{
+        return platform_driver_register(&mddi_driver);
+}
+
+module_init(_mddi_init);
diff --git a/drivers/video/msm/mddi_client_dummy.c b/drivers/video/msm/mddi_client_dummy.c
new file mode 100644
index 000000000000..ebbae87885b6
--- /dev/null
+++ b/drivers/video/msm/mddi_client_dummy.c
@@ -0,0 +1,97 @@
+/* drivers/video/msm_fb/mddi_client_dummy.c
+ *
+ * Support for "dummy" mddi client devices which require no
+ * special initialization code.
+ *
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/platform_device.h>
+
+#include <mach/msm_fb.h>
+
+struct panel_info {
+        struct platform_device pdev;
+        struct msm_panel_data panel_data;
+};
+
+static int mddi_dummy_suspend(struct msm_panel_data *panel_data)
+{
+        return 0;
+}
+
+static int mddi_dummy_resume(struct msm_panel_data *panel_data)
+{
+        return 0;
+}
+
+static int mddi_dummy_blank(struct msm_panel_data *panel_data)
+{
+        return 0;
+}
+
+static int mddi_dummy_unblank(struct msm_panel_data *panel_data)
+{
+        return 0;
+}
+
+static int mddi_dummy_probe(struct platform_device *pdev)
+{
+        struct msm_mddi_client_data *client_data = pdev->dev.platform_data;
+        struct panel_info *panel =
+                kzalloc(sizeof(struct panel_info), GFP_KERNEL);
+        int ret;
+        if (!panel)
+                return -ENOMEM;
+        platform_set_drvdata(pdev, panel);
+        panel->panel_data.suspend = mddi_dummy_suspend;
+        panel->panel_data.resume = mddi_dummy_resume;
+        panel->panel_data.blank = mddi_dummy_blank;
+        panel->panel_data.unblank = mddi_dummy_unblank;
+        panel->panel_data.caps = MSMFB_CAP_PARTIAL_UPDATES;
+        panel->pdev.name = "msm_panel";
+        panel->pdev.id = pdev->id;
+        platform_device_add_resources(&panel->pdev,
+                                      client_data->fb_resource, 1);
+        panel->panel_data.fb_data = client_data->private_client_data;
+        panel->pdev.dev.platform_data = &panel->panel_data;
+        ret = platform_device_register(&panel->pdev);
+        if (ret) {
+                kfree(panel);
+                return ret;
+        }
+        return 0;
+}
+
+static int mddi_dummy_remove(struct platform_device *pdev)
+{
+        struct panel_info *panel = platform_get_drvdata(pdev);
+        kfree(panel);
+        return 0;
+}
+
+static struct platform_driver mddi_client_dummy = {
+        .probe = mddi_dummy_probe,
+        .remove = mddi_dummy_remove,
+        .driver = { .name = "mddi_c_dummy" },
+};
+
+static int __init mddi_client_dummy_init(void)
+{
+        platform_driver_register(&mddi_client_dummy);
+        return 0;
+}
+
+module_init(mddi_client_dummy_init);
+
diff --git a/drivers/video/msm/mddi_client_nt35399.c b/drivers/video/msm/mddi_client_nt35399.c
new file mode 100644
index 000000000000..9c78050ac799
--- /dev/null
+++ b/drivers/video/msm/mddi_client_nt35399.c
@@ -0,0 +1,255 @@
+/* drivers/video/msm_fb/mddi_client_nt35399.c
+ *
+ * Support for Novatek NT35399 MDDI client of Sapphire
+ *
+ * Copyright (C) 2008 HTC Incorporated
+ * Author: Solomon Chiu (solomon_chiu@htc.com)
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/platform_device.h>
+#include <linux/interrupt.h>
+#include <linux/gpio.h>
+#include <mach/msm_fb.h>
+
+static DECLARE_WAIT_QUEUE_HEAD(nt35399_vsync_wait);
+
+struct panel_info {
+        struct msm_mddi_client_data *client_data;
+        struct platform_device pdev;
+        struct msm_panel_data panel_data;
+        struct msmfb_callback *fb_callback;
+        struct work_struct panel_work;
+        struct workqueue_struct *fb_wq;
+        int nt35399_got_int;
+};
+
+static void
+nt35399_request_vsync(struct msm_panel_data *panel_data,
+                      struct msmfb_callback *callback)
+{
+        struct panel_info *panel = container_of(panel_data, struct panel_info,
+                                                panel_data);
+        struct msm_mddi_client_data *client_data = panel->client_data;
+
+        panel->fb_callback = callback;
+        if (panel->nt35399_got_int) {
+                panel->nt35399_got_int = 0;
+                client_data->activate_link(client_data); /* clears interrupt */
+        }
+}
+
+static void nt35399_wait_vsync(struct msm_panel_data *panel_data)
+{
+        struct panel_info *panel = container_of(panel_data, struct panel_info,
+                                                panel_data);
+        struct msm_mddi_client_data *client_data = panel->client_data;
+
+        if (panel->nt35399_got_int) {
+                panel->nt35399_got_int = 0;
+                client_data->activate_link(client_data); /* clears interrupt */
+        }
+
+        if (wait_event_timeout(nt35399_vsync_wait, panel->nt35399_got_int,
+                                HZ/2) == 0)
+                printk(KERN_ERR "timeout waiting for VSYNC\n");
+
+        panel->nt35399_got_int = 0;
+        /* interrupt clears when screen dma starts */
+}
+
+static int nt35399_suspend(struct msm_panel_data *panel_data)
+{
+        struct panel_info *panel = container_of(panel_data, struct panel_info,
+                                                panel_data);
+        struct msm_mddi_client_data *client_data = panel->client_data;
+
+        struct msm_mddi_bridge_platform_data *bridge_data =
+                client_data->private_client_data;
+        int ret;
+
+        ret = bridge_data->uninit(bridge_data, client_data);
+        if (ret) {
+                printk(KERN_INFO "mddi nt35399 client: non zero return from "
+                        "uninit\n");
+                return ret;
+        }
+        client_data->suspend(client_data);
+        return 0;
+}
+
+static int nt35399_resume(struct msm_panel_data *panel_data)
+{
+        struct panel_info *panel = container_of(panel_data, struct panel_info,
+                                                panel_data);
+        struct msm_mddi_client_data *client_data = panel->client_data;
+
+        struct msm_mddi_bridge_platform_data *bridge_data =
+                client_data->private_client_data;
+        int ret;
+
+        client_data->resume(client_data);
+        ret = bridge_data->init(bridge_data, client_data);
+        if (ret)
+                return ret;
+        return 0;
+}
+
+static int nt35399_blank(struct msm_panel_data *panel_data)
+{
+        struct panel_info *panel = container_of(panel_data, struct panel_info,
+                                                panel_data);
+        struct msm_mddi_client_data *client_data = panel->client_data;
+        struct msm_mddi_bridge_platform_data *bridge_data =
+                client_data->private_client_data;
+
+        return bridge_data->blank(bridge_data, client_data);
+}
+
+static int nt35399_unblank(struct msm_panel_data *panel_data)
+{
+        struct panel_info *panel = container_of(panel_data, struct panel_info,
+                                                panel_data);
+        struct msm_mddi_client_data *client_data = panel->client_data;
+        struct msm_mddi_bridge_platform_data *bridge_data =
+                client_data->private_client_data;
+
+        return bridge_data->unblank(bridge_data, client_data);
+}
+
+irqreturn_t nt35399_vsync_interrupt(int irq, void *data)
+{
+        struct panel_info *panel = data;
+
+        panel->nt35399_got_int = 1;
+
+        if (panel->fb_callback) {
+                panel->fb_callback->func(panel->fb_callback);
+                panel->fb_callback = NULL;
+        }
+
+        wake_up(&nt35399_vsync_wait);
+
+        return IRQ_HANDLED;
+}
+
+static int setup_vsync(struct panel_info *panel, int init)
+{
+        int ret;
+        int gpio = 97;
+        unsigned int irq;
+
+        if (!init) {
+                ret = 0;
+                goto uninit;
+        }
+        ret = gpio_request(gpio, "vsync");
+        if (ret)
+                goto err_request_gpio_failed;
+
+        ret = gpio_direction_input(gpio);
+        if (ret)
+                goto err_gpio_direction_input_failed;
+
+        ret = irq = gpio_to_irq(gpio);
+        if (ret < 0)
+                goto err_get_irq_num_failed;
+
+        ret = request_irq(irq, nt35399_vsync_interrupt, IRQF_TRIGGER_RISING,
+                          "vsync", panel);
+        if (ret)
+                goto err_request_irq_failed;
+
+        printk(KERN_INFO "vsync on gpio %d now %d\n",
+               gpio, gpio_get_value(gpio));
+        return 0;
+
+uninit:
+        free_irq(gpio_to_irq(gpio), panel->client_data);
+err_request_irq_failed:
+err_get_irq_num_failed:
+err_gpio_direction_input_failed:
+        gpio_free(gpio);
+err_request_gpio_failed:
+        return ret;
+}
+
+static int mddi_nt35399_probe(struct platform_device *pdev)
+{
+        struct msm_mddi_client_data *client_data = pdev->dev.platform_data;
+        struct msm_mddi_bridge_platform_data *bridge_data =
+                client_data->private_client_data;
+
+        int ret;
+
+        struct panel_info *panel = kzalloc(sizeof(struct panel_info),
+                                           GFP_KERNEL);
+
+        printk(KERN_DEBUG "%s: enter.\n", __func__);
+
+        if (!panel)
+                return -ENOMEM;
+        platform_set_drvdata(pdev, panel);
+
+        ret = setup_vsync(panel, 1);
+        if (ret) {
+                dev_err(&pdev->dev, "mddi_nt35399_setup_vsync failed\n");
+                return ret;
+        }
+
+        panel->client_data = client_data;
+        panel->panel_data.suspend = nt35399_suspend;
+        panel->panel_data.resume = nt35399_resume;
+        panel->panel_data.wait_vsync = nt35399_wait_vsync;
+        panel->panel_data.request_vsync = nt35399_request_vsync;
+        panel->panel_data.blank = nt35399_blank;
+        panel->panel_data.unblank = nt35399_unblank;
+        panel->panel_data.fb_data = &bridge_data->fb_data;
+        panel->panel_data.caps = 0;
+
+        panel->pdev.name = "msm_panel";
+        panel->pdev.id = pdev->id;
+        panel->pdev.resource = client_data->fb_resource;
+        panel->pdev.num_resources = 1;
+        panel->pdev.dev.platform_data = &panel->panel_data;
+
+        if (bridge_data->init)
+                bridge_data->init(bridge_data, client_data);
+
+        platform_device_register(&panel->pdev);
+
+        return 0;
+}
+
+static int mddi_nt35399_remove(struct platform_device *pdev)
+{
+        struct panel_info *panel = platform_get_drvdata(pdev);
+
+        setup_vsync(panel, 0);
+        kfree(panel);
+        return 0;
+}
+
+static struct platform_driver mddi_client_0bda_8a47 = {
+        .probe = mddi_nt35399_probe,
+        .remove = mddi_nt35399_remove,
+        .driver = { .name = "mddi_c_0bda_8a47" },
+};
+
+static int __init mddi_client_nt35399_init(void)
+{
+        return platform_driver_register(&mddi_client_0bda_8a47);
+}
+
+module_init(mddi_client_nt35399_init);
+
diff --git a/drivers/video/msm/mddi_client_toshiba.c b/drivers/video/msm/mddi_client_toshiba.c
new file mode 100644
index 000000000000..80d0f5fdf0b1
--- /dev/null
+++ b/drivers/video/msm/mddi_client_toshiba.c
@@ -0,0 +1,283 @@
+/* drivers/video/msm_fb/mddi_client_toshiba.c
+ *
+ * Support for Toshiba TC358720XBG mddi client devices which require no
+ * special initialization code.
+ *
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/platform_device.h>
+#include <linux/interrupt.h>
+#include <linux/gpio.h>
+#include <mach/msm_fb.h>
+
+
+#define LCD_CONTROL_BLOCK_BASE 0x110000
+#define CMN         (LCD_CONTROL_BLOCK_BASE|0x10)
+#define INTFLG      (LCD_CONTROL_BLOCK_BASE|0x18)
+#define HCYCLE      (LCD_CONTROL_BLOCK_BASE|0x34)
+#define HDE_START   (LCD_CONTROL_BLOCK_BASE|0x3C)
+#define VPOS        (LCD_CONTROL_BLOCK_BASE|0xC0)
+#define MPLFBUF     (LCD_CONTROL_BLOCK_BASE|0x20)
+#define WAKEUP      (LCD_CONTROL_BLOCK_BASE|0x54)
+#define WSYN_DLY    (LCD_CONTROL_BLOCK_BASE|0x58)
+#define REGENB      (LCD_CONTROL_BLOCK_BASE|0x5C)
+
+#define BASE5 0x150000
+#define BASE6 0x160000
+#define BASE7 0x170000
+
+#define GPIOIEV     (BASE5 + 0x10)
+#define GPIOIE      (BASE5 + 0x14)
+#define GPIORIS     (BASE5 + 0x18)
+#define GPIOMIS     (BASE5 + 0x1C)
+#define GPIOIC      (BASE5 + 0x20)
+
+#define INTMASK     (BASE6 + 0x0C)
+#define INTMASK_VWAKEOUT (1U << 0)
+#define INTMASK_VWAKEOUT_ACTIVE_LOW (1U << 8)
+#define GPIOSEL     (BASE7 + 0x00)
+#define GPIOSEL_VWAKEINT (1U << 0)
+
+static DECLARE_WAIT_QUEUE_HEAD(toshiba_vsync_wait);
+
+struct panel_info {
+        struct msm_mddi_client_data *client_data;
+        struct platform_device pdev;
+        struct msm_panel_data panel_data;
+        struct msmfb_callback *toshiba_callback;
+        int toshiba_got_int;
+};
+
+
+static void toshiba_request_vsync(struct msm_panel_data *panel_data,
+                                  struct msmfb_callback *callback)
+{
+        struct panel_info *panel = container_of(panel_data, struct panel_info,
+                                                panel_data);
+        struct msm_mddi_client_data *client_data = panel->client_data;
+
+        panel->toshiba_callback = callback;
+        if (panel->toshiba_got_int) {
+                panel->toshiba_got_int = 0;
+                client_data->activate_link(client_data);
+        }
+}
+
+static void toshiba_clear_vsync(struct msm_panel_data *panel_data)
+{
+        struct panel_info *panel = container_of(panel_data, struct panel_info,
+                                                panel_data);
+        struct msm_mddi_client_data *client_data = panel->client_data;
+
+        client_data->activate_link(client_data);
+}
+
+static void toshiba_wait_vsync(struct msm_panel_data *panel_data)
+{
+        struct panel_info *panel = container_of(panel_data, struct panel_info,
+                                                panel_data);
+        struct msm_mddi_client_data *client_data = panel->client_data;
+
+        if (panel->toshiba_got_int) {
+                panel->toshiba_got_int = 0;
+                client_data->activate_link(client_data); /* clears interrupt */
+        }
+        if (wait_event_timeout(toshiba_vsync_wait, panel->toshiba_got_int,
+                                HZ/2) == 0)
+                printk(KERN_ERR "timeout waiting for VSYNC\n");
+        panel->toshiba_got_int = 0;
+        /* interrupt clears when screen dma starts */
+}
+
+static int toshiba_suspend(struct msm_panel_data *panel_data)
+{
+        struct panel_info *panel = container_of(panel_data, struct panel_info,
+                                                panel_data);
+        struct msm_mddi_client_data *client_data = panel->client_data;
+
+        struct msm_mddi_bridge_platform_data *bridge_data =
+                client_data->private_client_data;
+        int ret;
+
+        ret = bridge_data->uninit(bridge_data, client_data);
+        if (ret) {
+                printk(KERN_INFO "mddi toshiba client: non zero return from "
+                        "uninit\n");
+                return ret;
+        }
+        client_data->suspend(client_data);
+        return 0;
+}
+
+static int toshiba_resume(struct msm_panel_data *panel_data)
+{
+        struct panel_info *panel = container_of(panel_data, struct panel_info,
+                                                panel_data);
+        struct msm_mddi_client_data *client_data = panel->client_data;
+
+        struct msm_mddi_bridge_platform_data *bridge_data =
+                client_data->private_client_data;
+        int ret;
+
+        client_data->resume(client_data);
+        ret = bridge_data->init(bridge_data, client_data);
+        if (ret)
+                return ret;
+        return 0;
+}
+
+static int toshiba_blank(struct msm_panel_data *panel_data)
+{
+        struct panel_info *panel = container_of(panel_data, struct panel_info,
+                                                panel_data);
+        struct msm_mddi_client_data *client_data = panel->client_data;
+        struct msm_mddi_bridge_platform_data *bridge_data =
+                client_data->private_client_data;
+
+        return bridge_data->blank(bridge_data, client_data);
+}
+
+static int toshiba_unblank(struct msm_panel_data *panel_data)
+{
+        struct panel_info *panel = container_of(panel_data, struct panel_info,
+                                                panel_data);
+        struct msm_mddi_client_data *client_data = panel->client_data;
+        struct msm_mddi_bridge_platform_data *bridge_data =
+                client_data->private_client_data;
+
+        return bridge_data->unblank(bridge_data, client_data);
+}
+
+irqreturn_t toshiba_vsync_interrupt(int irq, void *data)
+{
+        struct panel_info *panel = data;
+
+        panel->toshiba_got_int = 1;
+        if (panel->toshiba_callback) {
+                panel->toshiba_callback->func(panel->toshiba_callback);
+                panel->toshiba_callback = 0;
+        }
+        wake_up(&toshiba_vsync_wait);
+        return IRQ_HANDLED;
+}
+
+static int setup_vsync(struct panel_info *panel,
+                       int init)
+{
+        int ret;
+        int gpio = 97;
+        unsigned int irq;
+
+        if (!init) {
+                ret = 0;
+                goto uninit;
+        }
+        ret = gpio_request(gpio, "vsync");
+        if (ret)
+                goto err_request_gpio_failed;
+
+        ret = gpio_direction_input(gpio);
+        if (ret)
+                goto err_gpio_direction_input_failed;
+
+        ret = irq = gpio_to_irq(gpio);
+        if (ret < 0)
+                goto err_get_irq_num_failed;
+
+        ret = request_irq(irq, toshiba_vsync_interrupt, IRQF_TRIGGER_RISING,
+                          "vsync", panel);
+        if (ret)
+                goto err_request_irq_failed;
+        printk(KERN_INFO "vsync on gpio %d now %d\n",
+               gpio, gpio_get_value(gpio));
+        return 0;
+
+uninit:
+        free_irq(gpio_to_irq(gpio), panel);
+err_request_irq_failed:
+err_get_irq_num_failed:
+err_gpio_direction_input_failed:
+        gpio_free(gpio);
+err_request_gpio_failed:
+        return ret;
+}
+
+static int mddi_toshiba_probe(struct platform_device *pdev)
+{
+        int ret;
+        struct msm_mddi_client_data *client_data = pdev->dev.platform_data;
+        struct msm_mddi_bridge_platform_data *bridge_data =
+                client_data->private_client_data;
+        struct panel_info *panel =
+                kzalloc(sizeof(struct panel_info), GFP_KERNEL);
+        if (!panel)
+                return -ENOMEM;
+        platform_set_drvdata(pdev, panel);
+
+        /* mddi_remote_write(mddi, 0, WAKEUP); */
+        client_data->remote_write(client_data, GPIOSEL_VWAKEINT, GPIOSEL);
+        client_data->remote_write(client_data, INTMASK_VWAKEOUT, INTMASK);
+
+        ret = setup_vsync(panel, 1);
+        if (ret) {
+                dev_err(&pdev->dev, "mddi_bridge_setup_vsync failed\n");
+                return ret;
+        }
+
+        panel->client_data = client_data;
+        panel->panel_data.suspend = toshiba_suspend;
+        panel->panel_data.resume = toshiba_resume;
+        panel->panel_data.wait_vsync = toshiba_wait_vsync;
+        panel->panel_data.request_vsync = toshiba_request_vsync;
+        panel->panel_data.clear_vsync = toshiba_clear_vsync;
+        panel->panel_data.blank = toshiba_blank;
+        panel->panel_data.unblank = toshiba_unblank;
+        panel->panel_data.fb_data =  &bridge_data->fb_data;
+        panel->panel_data.caps = MSMFB_CAP_PARTIAL_UPDATES;
+
+        panel->pdev.name = "msm_panel";
+        panel->pdev.id = pdev->id;
+        panel->pdev.resource = client_data->fb_resource;
+        panel->pdev.num_resources = 1;
+        panel->pdev.dev.platform_data = &panel->panel_data;
+        bridge_data->init(bridge_data, client_data);
+        platform_device_register(&panel->pdev);
+
+        return 0;
+}
+
+static int mddi_toshiba_remove(struct platform_device *pdev)
+{
+        struct panel_info *panel = platform_get_drvdata(pdev);
+
+        setup_vsync(panel, 0);
+        kfree(panel);
+        return 0;
+}
+
+static struct platform_driver mddi_client_d263_0000 = {
+        .probe = mddi_toshiba_probe,
+        .remove = mddi_toshiba_remove,
+        .driver = { .name = "mddi_c_d263_0000" },
+};
+
+static int __init mddi_client_toshiba_init(void)
+{
+        platform_driver_register(&mddi_client_d263_0000);
+        return 0;
+}
+
+module_init(mddi_client_toshiba_init);
+
diff --git a/drivers/video/msm/mddi_hw.h b/drivers/video/msm/mddi_hw.h
new file mode 100644
index 000000000000..45cc01fc1e7f
--- /dev/null
+++ b/drivers/video/msm/mddi_hw.h
@@ -0,0 +1,305 @@
+/* drivers/video/msm_fb/mddi_hw.h
+ *
+ * MSM MDDI Hardware Registers and Structures
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+#ifndef _MDDI_HW_H_
+#define _MDDI_HW_H_
+
+#include <linux/types.h>
+
+#define MDDI_CMD                0x0000
+#define MDDI_VERSION            0x0004
+#define MDDI_PRI_PTR            0x0008
+#define MDDI_SEC_PTR            0x000c
+#define MDDI_BPS                0x0010
+#define MDDI_SPM                0x0014
+#define MDDI_INT                0x0018
+#define MDDI_INTEN              0x001c
+#define MDDI_REV_PTR            0x0020
+#define MDDI_REV_SIZE           0x0024
+#define MDDI_STAT               0x0028
+#define MDDI_REV_RATE_DIV       0x002c
+#define MDDI_REV_CRC_ERR        0x0030
+#define MDDI_TA1_LEN            0x0034
+#define MDDI_TA2_LEN            0x0038
+#define MDDI_TEST_BUS           0x003c
+#define MDDI_TEST               0x0040
+#define MDDI_REV_PKT_CNT        0x0044
+#define MDDI_DRIVE_HI           0x0048
+#define MDDI_DRIVE_LO           0x004c
+#define MDDI_DISP_WAKE          0x0050
+#define MDDI_REV_ENCAP_SZ       0x0054
+#define MDDI_RTD_VAL            0x0058
+#define MDDI_PAD_CTL            0x0068
+#define MDDI_DRIVER_START_CNT   0x006c
+#define MDDI_NEXT_PRI_PTR       0x0070
+#define MDDI_NEXT_SEC_PTR       0x0074
+#define MDDI_MISR_CTL           0x0078
+#define MDDI_MISR_DATA          0x007c
+#define MDDI_SF_CNT             0x0080
+#define MDDI_MF_CNT             0x0084
+#define MDDI_CURR_REV_PTR       0x0088
+#define MDDI_CORE_VER           0x008c
+
+#define MDDI_INT_PRI_PTR_READ       0x0001
+#define MDDI_INT_SEC_PTR_READ       0x0002
+#define MDDI_INT_REV_DATA_AVAIL     0x0004
+#define MDDI_INT_DISP_REQ           0x0008
+#define MDDI_INT_PRI_UNDERFLOW      0x0010
+#define MDDI_INT_SEC_UNDERFLOW      0x0020
+#define MDDI_INT_REV_OVERFLOW       0x0040
+#define MDDI_INT_CRC_ERROR          0x0080
+#define MDDI_INT_MDDI_IN            0x0100
+#define MDDI_INT_PRI_OVERWRITE      0x0200
+#define MDDI_INT_SEC_OVERWRITE      0x0400
+#define MDDI_INT_REV_OVERWRITE      0x0800
+#define MDDI_INT_DMA_FAILURE        0x1000
+#define MDDI_INT_LINK_ACTIVE        0x2000
+#define MDDI_INT_IN_HIBERNATION     0x4000
+#define MDDI_INT_PRI_LINK_LIST_DONE 0x8000
+#define MDDI_INT_SEC_LINK_LIST_DONE 0x10000
+#define MDDI_INT_NO_CMD_PKTS_PEND   0x20000
+#define MDDI_INT_RTD_FAILURE        0x40000
+#define MDDI_INT_REV_PKT_RECEIVED   0x80000
+#define MDDI_INT_REV_PKTS_AVAIL     0x100000
+
+#define MDDI_INT_NEED_CLEAR ( \
+        MDDI_INT_REV_DATA_AVAIL | \
+        MDDI_INT_PRI_UNDERFLOW | \
+        MDDI_INT_SEC_UNDERFLOW | \
+        MDDI_INT_REV_OVERFLOW | \
+        MDDI_INT_CRC_ERROR | \
+        MDDI_INT_REV_PKT_RECEIVED)
+
+
+#define MDDI_STAT_LINK_ACTIVE        0x0001
+#define MDDI_STAT_NEW_REV_PTR        0x0002
+#define MDDI_STAT_NEW_PRI_PTR        0x0004
+#define MDDI_STAT_NEW_SEC_PTR        0x0008
+#define MDDI_STAT_IN_HIBERNATION     0x0010
+#define MDDI_STAT_PRI_LINK_LIST_DONE 0x0020
+#define MDDI_STAT_SEC_LINK_LIST_DONE 0x0040
+#define MDDI_STAT_PENDING_TIMING_PKT 0x0080
+#define MDDI_STAT_PENDING_REV_ENCAP  0x0100
+#define MDDI_STAT_PENDING_POWERDOWN  0x0200
+#define MDDI_STAT_RTD_MEAS_FAIL      0x0800
+#define MDDI_STAT_CLIENT_WAKEUP_REQ  0x1000
+
+
+#define MDDI_CMD_POWERDOWN           0x0100
+#define MDDI_CMD_POWERUP             0x0200
+#define MDDI_CMD_HIBERNATE           0x0300
+#define MDDI_CMD_RESET               0x0400
+#define MDDI_CMD_DISP_IGNORE         0x0501
+#define MDDI_CMD_DISP_LISTEN         0x0500
+#define MDDI_CMD_SEND_REV_ENCAP      0x0600
+#define MDDI_CMD_GET_CLIENT_CAP      0x0601
+#define MDDI_CMD_GET_CLIENT_STATUS   0x0602
+#define MDDI_CMD_SEND_RTD            0x0700
+#define MDDI_CMD_LINK_ACTIVE         0x0900
+#define MDDI_CMD_PERIODIC_REV_ENCAP  0x0A00
+#define MDDI_CMD_FORCE_NEW_REV_PTR   0x0C00
+
+
+
+#define MDDI_VIDEO_REV_PKT_SIZE              0x40
+#define MDDI_CLIENT_CAPABILITY_REV_PKT_SIZE  0x60
+#define MDDI_MAX_REV_PKT_SIZE                0x60
+
+/* #define MDDI_REV_BUFFER_SIZE 128 */
+#define MDDI_REV_BUFFER_SIZE (MDDI_MAX_REV_PKT_SIZE * 4)
+
+/* MDP sends 256 pixel packets, so lower value hibernates more without
+ * significantly increasing latency of waiting for next subframe */
+#define MDDI_HOST_BYTES_PER_SUBFRAME  0x3C00
+#define MDDI_HOST_TA2_LEN       0x000c
+#define MDDI_HOST_REV_RATE_DIV  0x0002
+
+
+struct __attribute__((packed)) mddi_rev_packet {
+        uint16_t length;
+        uint16_t type;
+        uint16_t client_id;
+};
+
+struct __attribute__((packed)) mddi_client_status {
+        uint16_t length;
+        uint16_t type;
+        uint16_t client_id;
+        uint16_t reverse_link_request;  /* bytes needed in rev encap message */
+        uint8_t  crc_error_count;
+        uint8_t  capability_change;
+        uint16_t graphics_busy_flags;
+        uint16_t crc16;
+};
+
+struct __attribute__((packed)) mddi_client_caps {
+        uint16_t length; /* length, exclusive of this field */
+        uint16_t type; /* 66 */
+        uint16_t client_id;
+
+        uint16_t Protocol_Version;
+        uint16_t Minimum_Protocol_Version;
+        uint16_t Data_Rate_Capability;
+        uint8_t  Interface_Type_Capability;
+        uint8_t  Number_of_Alt_Displays;
+        uint16_t PostCal_Data_Rate;
+        uint16_t Bitmap_Width;
+        uint16_t Bitmap_Height;
+        uint16_t Display_Window_Width;
+        uint16_t Display_Window_Height;
+        uint32_t Color_Map_Size;
+        uint16_t Color_Map_RGB_Width;
+        uint16_t RGB_Capability;
+        uint8_t  Monochrome_Capability;
+        uint8_t  Reserved_1;
+        uint16_t Y_Cb_Cr_Capability;
+        uint16_t Bayer_Capability;
+        uint16_t Alpha_Cursor_Image_Planes;
+        uint32_t Client_Feature_Capability_Indicators;
+        uint8_t  Maximum_Video_Frame_Rate_Capability;
+        uint8_t  Minimum_Video_Frame_Rate_Capability;
+        uint16_t Minimum_Sub_frame_Rate;
+        uint16_t Audio_Buffer_Depth;
+        uint16_t Audio_Channel_Capability;
+        uint16_t Audio_Sample_Rate_Capability;
+        uint8_t  Audio_Sample_Resolution;
+        uint8_t  Mic_Audio_Sample_Resolution;
+        uint16_t Mic_Sample_Rate_Capability;
+        uint8_t  Keyboard_Data_Format;
+        uint8_t  pointing_device_data_format;
+        uint16_t content_protection_type;
+        uint16_t Mfr_Name;
+        uint16_t Product_Code;
+        uint16_t Reserved_3;
+        uint32_t Serial_Number;
+        uint8_t  Week_of_Manufacture;
+        uint8_t  Year_of_Manufacture;
+
+        uint16_t crc16;
+} mddi_client_capability_type;
+
+
+struct __attribute__((packed)) mddi_video_stream {
+        uint16_t length;
+        uint16_t type; /* 16 */
+        uint16_t client_id; /* 0 */
+
+        uint16_t video_data_format_descriptor;
+/* format of each pixel in the Pixel Data in the present stream in the
+ * present packet.
+ * If bits [15:13] = 000 monochrome
+ * If bits [15:13] = 001 color pixels (palette).
+ * If bits [15:13] = 010 color pixels in raw RGB
+ * If bits [15:13] = 011 data in 4:2:2 Y Cb Cr format
+ * If bits [15:13] = 100 Bayer pixels
+ */
+
+        uint16_t pixel_data_attributes;
+/* interpreted as follows:
+ * Bits [1:0] = 11  pixel data is displayed to both eyes
+ * Bits [1:0] = 10  pixel data is routed to the left eye only.
+ * Bits [1:0] = 01  pixel data is routed to the right eye only.
+ * Bits [1:0] = 00  pixel data is routed to the alternate display.
+ * Bit 2 is 0  Pixel Data is in the standard progressive format.
+ * Bit 2 is 1  Pixel Data is in interlace format.
+ * Bit 3 is 0  Pixel Data is in the standard progressive format.
+ * Bit 3 is 1  Pixel Data is in alternate pixel format.
+ * Bit 4 is 0  Pixel Data is to or from the display frame buffer.
+ * Bit 4 is 1  Pixel Data is to or from the camera.
+ * Bit 5 is 0  pixel data contains the next consecutive row of pixels.
+ * Bit 5 is 1  X Left Edge, Y Top Edge, X Right Edge, Y Bottom Edge,
+ *             X Start, and Y Start parameters are not defined and
+ *             shall be ignored by the client.
+ * Bits [7:6] = 01  Pixel data is written to the offline image buffer.
+ * Bits [7:6] = 00  Pixel data is written to the buffer to refresh display.
+ * Bits [7:6] = 11  Pixel data is written to all image buffers.
+ * Bits [7:6] = 10  Invalid. Reserved for future use.
+ * Bits 8 through 11 alternate display number.
+ * Bits 12 through 14 are reserved for future use and shall be set to zero.
+ * Bit 15 is 1 the row of pixels is the last row of pixels in a frame.
+ */
+
+        uint16_t x_left_edge;
+        uint16_t y_top_edge;
+        /* X,Y coordinate of the top left edge of the screen window */
+
+        uint16_t x_right_edge;
+        uint16_t y_bottom_edge;
+        /* X,Y coordinate of the bottom right edge of the window being
+         * updated. */
+
+        uint16_t x_start;
+        uint16_t y_start;
+        /* (X Start, Y Start) is the first pixel in the Pixel Data field
+         * below. */
+
+        uint16_t pixel_count;
+        /* number of pixels in the Pixel Data field below. */
+
+        uint16_t parameter_CRC;
+        /* 16-bit CRC of all bytes from the Packet Length to the Pixel Count. */
+
+        uint16_t reserved;
+        /* 16-bit variable to make structure align on 4 byte boundary */
+};
+
+#define TYPE_VIDEO_STREAM      16
+#define TYPE_CLIENT_CAPS       66
+#define TYPE_REGISTER_ACCESS   146
+#define TYPE_CLIENT_STATUS     70
+
+struct __attribute__((packed)) mddi_register_access {
+        uint16_t length;
+        uint16_t type; /* 146 */
+        uint16_t client_id;
+
+        uint16_t read_write_info;
+        /* Bits 13:0  a 14-bit unsigned integer that specifies the number of
+         *            32-bit Register Data List items to be transferred in the
+         *            Register Data List field.
+         * Bits[15:14] = 00  Write to register(s);
+         * Bits[15:14] = 10  Read from register(s);
+         * Bits[15:14] = 11  Response to a Read.
+         * Bits[15:14] = 01  this value is reserved for future use. */
+#define MDDI_WRITE     (0 << 14)
+#define MDDI_READ      (2 << 14)
+#define MDDI_READ_RESP (3 << 14)
+
+        uint32_t register_address;
+        /* the register address that is to be written to or read from. */
+
+        uint16_t crc16;
+
+        uint32_t register_data_list;
+        /* list of 4-byte register data values for/from client registers */
+};
+
+struct __attribute__((packed)) mddi_llentry {
+        uint16_t flags;
+        uint16_t header_count;
+        uint16_t data_count;
+        dma_addr_t data; /* 32 bit */
+        struct mddi_llentry *next;
+        uint16_t reserved;
+        union {
+                struct mddi_video_stream v;
+                struct mddi_register_access r;
+                uint32_t _[12];
+        } u;
+};
+
+#endif
diff --git a/drivers/video/msm/mdp.c b/drivers/video/msm/mdp.c
new file mode 100644
index 000000000000..99636a2b20f2
--- /dev/null
+++ b/drivers/video/msm/mdp.c
@@ -0,0 +1,538 @@
+/* drivers/video/msm_fb/mdp.c
+ *
+ * MSM MDP Interface (used by framebuffer core)
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/kernel.h>
+#include <linux/fb.h>
+#include <linux/msm_mdp.h>
+#include <linux/interrupt.h>
+#include <linux/wait.h>
+#include <linux/clk.h>
+#include <linux/file.h>
+#ifdef CONFIG_ANDROID_PMEM
+#include <linux/android_pmem.h>
+#endif
+#include <linux/major.h>
+
+#include <mach/msm_iomap.h>
+#include <mach/msm_fb.h>
+#include <linux/platform_device.h>
+
+#include "mdp_hw.h"
+
+struct class *mdp_class;
+
+#define MDP_CMD_DEBUG_ACCESS_BASE (0x10000)
+
+static uint16_t mdp_default_ccs[] = {
+        0x254, 0x000, 0x331, 0x254, 0xF38, 0xE61, 0x254, 0x409, 0x000,
+        0x010, 0x080, 0x080
+};
+
+static DECLARE_WAIT_QUEUE_HEAD(mdp_dma2_waitqueue);
+static DECLARE_WAIT_QUEUE_HEAD(mdp_ppp_waitqueue);
+static struct msmfb_callback *dma_callback;
+static struct clk *clk;
+static unsigned int mdp_irq_mask;
+static DEFINE_SPINLOCK(mdp_lock);
+DEFINE_MUTEX(mdp_mutex);
+
+static int enable_mdp_irq(struct mdp_info *mdp, uint32_t mask)
+{
+        unsigned long irq_flags;
+        int ret = 0;
+
+        BUG_ON(!mask);
+
+        spin_lock_irqsave(&mdp_lock, irq_flags);
+        /* if the mask bits are already set return an error, this interrupt
+         * is already enabled */
+        if (mdp_irq_mask & mask) {
+                printk(KERN_ERR "mdp irq already on already on %x %x\n",
+                       mdp_irq_mask, mask);
+                ret = -1;
+        }
+        /* if the mdp irq is not already enabled enable it */
+        if (!mdp_irq_mask) {
+                if (clk)
+                        clk_enable(clk);
+                enable_irq(mdp->irq);
+        }
+
+        /* update the irq mask to reflect the fact that the interrupt is
+         * enabled */
+        mdp_irq_mask |= mask;
+        spin_unlock_irqrestore(&mdp_lock, irq_flags);
+        return ret;
+}
+
+static int locked_disable_mdp_irq(struct mdp_info *mdp, uint32_t mask)
+{
+        /* this interrupt is already disabled! */
+        if (!(mdp_irq_mask & mask)) {
+                printk(KERN_ERR "mdp irq already off %x %x\n",
+                       mdp_irq_mask, mask);
+                return -1;
+        }
+        /* update the irq mask to reflect the fact that the interrupt is
+         * disabled */
+        mdp_irq_mask &= ~(mask);
+        /* if no one is waiting on the interrupt, disable it */
+        if (!mdp_irq_mask) {
+                disable_irq(mdp->irq);
+                if (clk)
+                        clk_disable(clk);
+        }
+        return 0;
+}
+
+static int disable_mdp_irq(struct mdp_info *mdp, uint32_t mask)
+{
+        unsigned long irq_flags;
+        int ret;
+
+        spin_lock_irqsave(&mdp_lock, irq_flags);
+        ret = locked_disable_mdp_irq(mdp, mask);
+        spin_unlock_irqrestore(&mdp_lock, irq_flags);
+        return ret;
+}
+
+static irqreturn_t mdp_isr(int irq, void *data)
+{
+        uint32_t status;
+        unsigned long irq_flags;
+        struct mdp_info *mdp = data;
+
+        spin_lock_irqsave(&mdp_lock, irq_flags);
+
+        status = mdp_readl(mdp, MDP_INTR_STATUS);
+        mdp_writel(mdp, status, MDP_INTR_CLEAR);
+
+        status &= mdp_irq_mask;
+        if (status & DL0_DMA2_TERM_DONE) {
+                if (dma_callback) {
+                        dma_callback->func(dma_callback);
+                        dma_callback = NULL;
+                }
+                wake_up(&mdp_dma2_waitqueue);
+        }
+
+        if (status & DL0_ROI_DONE)
+                wake_up(&mdp_ppp_waitqueue);
+
+        if (status)
+                locked_disable_mdp_irq(mdp, status);
+
+        spin_unlock_irqrestore(&mdp_lock, irq_flags);
+        return IRQ_HANDLED;
+}
+
+static uint32_t mdp_check_mask(uint32_t mask)
+{
+        uint32_t ret;
+        unsigned long irq_flags;
+
+        spin_lock_irqsave(&mdp_lock, irq_flags);
+        ret = mdp_irq_mask & mask;
+        spin_unlock_irqrestore(&mdp_lock, irq_flags);
+        return ret;
+}
+
+static int mdp_wait(struct mdp_info *mdp, uint32_t mask, wait_queue_head_t *wq)
+{
+        int ret = 0;
+        unsigned long irq_flags;
+
+        wait_event_timeout(*wq, !mdp_check_mask(mask), HZ);
+
+        spin_lock_irqsave(&mdp_lock, irq_flags);
+        if (mdp_irq_mask & mask) {
+                locked_disable_mdp_irq(mdp, mask);
+                printk(KERN_WARNING "timeout waiting for mdp to complete %x\n",
+                       mask);
+                ret = -ETIMEDOUT;
+        }
+        spin_unlock_irqrestore(&mdp_lock, irq_flags);
+
+        return ret;
+}
+
+void mdp_dma_wait(struct mdp_device *mdp_dev)
+{
+#define MDP_MAX_TIMEOUTS 20
+        static int timeout_count;
+        struct mdp_info *mdp = container_of(mdp_dev, struct mdp_info, mdp_dev);
+
+        if (mdp_wait(mdp, DL0_DMA2_TERM_DONE, &mdp_dma2_waitqueue) == -ETIMEDOUT)
+                timeout_count++;
+        else
+                timeout_count = 0;
+
+        if (timeout_count > MDP_MAX_TIMEOUTS) {
+                printk(KERN_ERR "mdp: dma failed %d times, somethings wrong!\n",
+                       MDP_MAX_TIMEOUTS);
+                BUG();
+        }
+}
+
+static int mdp_ppp_wait(struct mdp_info *mdp)
+{
+        return mdp_wait(mdp, DL0_ROI_DONE, &mdp_ppp_waitqueue);
+}
+
+void mdp_dma_to_mddi(struct mdp_info *mdp, uint32_t addr, uint32_t stride,
+                     uint32_t width, uint32_t height, uint32_t x, uint32_t y,
+                     struct msmfb_callback *callback)
+{
+        uint32_t dma2_cfg;
+        uint16_t ld_param = 0; /* 0=PRIM, 1=SECD, 2=EXT */
+
+        if (enable_mdp_irq(mdp, DL0_DMA2_TERM_DONE)) {
+                printk(KERN_ERR "mdp_dma_to_mddi: busy\n");
+                return;
+        }
+
+        dma_callback = callback;
+
+        dma2_cfg = DMA_PACK_TIGHT |
+                DMA_PACK_ALIGN_LSB |
+                DMA_PACK_PATTERN_RGB |
+                DMA_OUT_SEL_AHB |
+                DMA_IBUF_NONCONTIGUOUS;
+
+        dma2_cfg |= DMA_IBUF_FORMAT_RGB565;
+
+        dma2_cfg |= DMA_OUT_SEL_MDDI;
+
+        dma2_cfg |= DMA_MDDI_DMAOUT_LCD_SEL_PRIMARY;
+
+        dma2_cfg |= DMA_DITHER_EN;
+
+        /* setup size, address, and stride */
+        mdp_writel(mdp, (height << 16) | (width),
+                   MDP_CMD_DEBUG_ACCESS_BASE + 0x0184);
+        mdp_writel(mdp, addr, MDP_CMD_DEBUG_ACCESS_BASE + 0x0188);
+        mdp_writel(mdp, stride, MDP_CMD_DEBUG_ACCESS_BASE + 0x018C);
+
+        /* 666 18BPP */
+        dma2_cfg |= DMA_DSTC0G_6BITS | DMA_DSTC1B_6BITS | DMA_DSTC2R_6BITS;
+
+        /* set y & x offset and MDDI transaction parameters */
+        mdp_writel(mdp, (y << 16) | (x), MDP_CMD_DEBUG_ACCESS_BASE + 0x0194);
+        mdp_writel(mdp, ld_param, MDP_CMD_DEBUG_ACCESS_BASE + 0x01a0);
+        mdp_writel(mdp, (MDDI_VDO_PACKET_DESC << 16) | MDDI_VDO_PACKET_PRIM,
+                   MDP_CMD_DEBUG_ACCESS_BASE + 0x01a4);
+
+        mdp_writel(mdp, dma2_cfg, MDP_CMD_DEBUG_ACCESS_BASE + 0x0180);
+
+        /* start DMA2 */
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0044);
+}
+
+void mdp_dma(struct mdp_device *mdp_dev, uint32_t addr, uint32_t stride,
+             uint32_t width, uint32_t height, uint32_t x, uint32_t y,
+             struct msmfb_callback *callback, int interface)
+{
+        struct mdp_info *mdp = container_of(mdp_dev, struct mdp_info, mdp_dev);
+
+        if (interface == MSM_MDDI_PMDH_INTERFACE) {
+                mdp_dma_to_mddi(mdp, addr, stride, width, height, x, y,
+                                callback);
+        }
+}
+
+int get_img(struct mdp_img *img, struct fb_info *info,
+            unsigned long *start, unsigned long *len,
+            struct file **filep)
+{
+        int put_needed, ret = 0;
+        struct file *file;
+        unsigned long vstart;
+
+#ifdef CONFIG_ANDROID_PMEM
+        if (!get_pmem_file(img->memory_id, start, &vstart, len, filep))
+                return 0;
+#endif
+
+        file = fget_light(img->memory_id, &put_needed);
+        if (file == NULL)
+                return -1;
+
+        if (MAJOR(file->f_dentry->d_inode->i_rdev) == FB_MAJOR) {
+                *start = info->fix.smem_start;
+                *len = info->fix.smem_len;
+        } else
+                ret = -1;
+        fput_light(file, put_needed);
+
+        return ret;
+}
+
+void put_img(struct file *src_file, struct file *dst_file)
+{
+#ifdef CONFIG_ANDROID_PMEM
+        if (src_file)
+                put_pmem_file(src_file);
+        if (dst_file)
+                put_pmem_file(dst_file);
+#endif
+}
+
+int mdp_blit(struct mdp_device *mdp_dev, struct fb_info *fb,
+             struct mdp_blit_req *req)
+{
+        int ret;
+        unsigned long src_start = 0, src_len = 0, dst_start = 0, dst_len = 0;
+        struct mdp_info *mdp = container_of(mdp_dev, struct mdp_info, mdp_dev);
+        struct file *src_file = 0, *dst_file = 0;
+
+        /* WORKAROUND FOR HARDWARE BUG IN BG TILE FETCH */
+        if (unlikely(req->src_rect.h == 0 ||
+                     req->src_rect.w == 0)) {
+                printk(KERN_ERR "mpd_ppp: src img of zero size!\n");
+                return -EINVAL;
+        }
+        if (unlikely(req->dst_rect.h == 0 ||
+                     req->dst_rect.w == 0))
+                return -EINVAL;
+
+        /* do this first so that if this fails, the caller can always
+         * safely call put_img */
+        if (unlikely(get_img(&req->src, fb, &src_start, &src_len, &src_file))) {
+                printk(KERN_ERR "mpd_ppp: could not retrieve src image from "
+                                "memory\n");
+                return -EINVAL;
+        }
+
+        if (unlikely(get_img(&req->dst, fb, &dst_start, &dst_len, &dst_file))) {
+                printk(KERN_ERR "mpd_ppp: could not retrieve dst image from "
+                                "memory\n");
+#ifdef CONFIG_ANDROID_PMEM
+                put_pmem_file(src_file);
+#endif
+                return -EINVAL;
+        }
+        mutex_lock(&mdp_mutex);
+
+        /* transp_masking unimplemented */
+        req->transp_mask = MDP_TRANSP_NOP;
+        if (unlikely((req->transp_mask != MDP_TRANSP_NOP ||
+                      req->alpha != MDP_ALPHA_NOP ||
+                      HAS_ALPHA(req->src.format)) &&
+                     (req->flags & MDP_ROT_90 &&
+                      req->dst_rect.w <= 16 && req->dst_rect.h >= 16))) {
+                int i;
+                unsigned int tiles = req->dst_rect.h / 16;
+                unsigned int remainder = req->dst_rect.h % 16;
+                req->src_rect.w = 16*req->src_rect.w / req->dst_rect.h;
+                req->dst_rect.h = 16;
+                for (i = 0; i < tiles; i++) {
+                        enable_mdp_irq(mdp, DL0_ROI_DONE);
+                        ret = mdp_ppp_blit(mdp, req, src_file, src_start,
+                                           src_len, dst_file, dst_start,
+                                           dst_len);
+                        if (ret)
+                                goto err_bad_blit;
+                        ret = mdp_ppp_wait(mdp);
+                        if (ret)
+                                goto err_wait_failed;
+                        req->dst_rect.y += 16;
+                        req->src_rect.x += req->src_rect.w;
+                }
+                if (!remainder)
+                        goto end;
+                req->src_rect.w = remainder*req->src_rect.w / req->dst_rect.h;
+                req->dst_rect.h = remainder;
+        }
+        enable_mdp_irq(mdp, DL0_ROI_DONE);
+        ret = mdp_ppp_blit(mdp, req, src_file, src_start, src_len, dst_file,
+                           dst_start,
+                           dst_len);
+        if (ret)
+                goto err_bad_blit;
+        ret = mdp_ppp_wait(mdp);
+        if (ret)
+                goto err_wait_failed;
+end:
+        put_img(src_file, dst_file);
+        mutex_unlock(&mdp_mutex);
+        return 0;
+err_bad_blit:
+        disable_mdp_irq(mdp, DL0_ROI_DONE);
+err_wait_failed:
+        put_img(src_file, dst_file);
+        mutex_unlock(&mdp_mutex);
+        return ret;
+}
+
+void mdp_set_grp_disp(struct mdp_device *mdp_dev, unsigned disp_id)
+{
+        struct mdp_info *mdp = container_of(mdp_dev, struct mdp_info, mdp_dev);
+
+        disp_id &= 0xf;
+        mdp_writel(mdp, disp_id, MDP_FULL_BYPASS_WORD43);
+}
+
+int register_mdp_client(struct class_interface *cint)
+{
+        if (!mdp_class) {
+                pr_err("mdp: no mdp_class when registering mdp client\n");
+                return -ENODEV;
+        }
+        cint->class = mdp_class;
+        return class_interface_register(cint);
+}
+
+#include "mdp_csc_table.h"
+#include "mdp_scale_tables.h"
+
+int mdp_probe(struct platform_device *pdev)
+{
+        struct resource *resource;
+        int ret;
+        int n;
+        struct mdp_info *mdp;
+
+        resource = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+        if (!resource) {
+                pr_err("mdp: can not get mdp mem resource!\n");
+                return -ENOMEM;
+        }
+
+        mdp = kzalloc(sizeof(struct mdp_info), GFP_KERNEL);
+        if (!mdp)
+                return -ENOMEM;
+
+        mdp->irq = platform_get_irq(pdev, 0);
+        if (mdp->irq < 0) {
+                pr_err("mdp: can not get mdp irq\n");
+                ret = mdp->irq;
+                goto error_get_irq;
+        }
+
+        mdp->base = ioremap(resource->start,
+                            resource->end - resource->start);
+        if (mdp->base == 0) {
+                printk(KERN_ERR "msmfb: cannot allocate mdp regs!\n");
+                ret = -ENOMEM;
+                goto error_ioremap;
+        }
+
+        mdp->mdp_dev.dma = mdp_dma;
+        mdp->mdp_dev.dma_wait = mdp_dma_wait;
+        mdp->mdp_dev.blit = mdp_blit;
+        mdp->mdp_dev.set_grp_disp = mdp_set_grp_disp;
+
+        clk = clk_get(&pdev->dev, "mdp_clk");
+        if (IS_ERR(clk)) {
+                printk(KERN_INFO "mdp: failed to get mdp clk");
+                return PTR_ERR(clk);
+        }
+
+        ret = request_irq(mdp->irq, mdp_isr, IRQF_DISABLED, "msm_mdp", mdp);
+        if (ret)
+                goto error_request_irq;
+        disable_irq(mdp->irq);
+        mdp_irq_mask = 0;
+
+        /* debug interface write access */
+        mdp_writel(mdp, 1, 0x60);
+
+        mdp_writel(mdp, MDP_ANY_INTR_MASK, MDP_INTR_ENABLE);
+        mdp_writel(mdp, 1, MDP_EBI2_PORTMAP_MODE);
+
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01f8);
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01fc);
+
+        for (n = 0; n < ARRAY_SIZE(csc_table); n++)
+                mdp_writel(mdp, csc_table[n].val, csc_table[n].reg);
+
+        /* clear up unused fg/main registers */
+        /* comp.plane 2&3 ystride */
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0120);
+
+        /* unpacked pattern */
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x012c);
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0130);
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0134);
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0158);
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x015c);
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0160);
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0170);
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0174);
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x017c);
+
+        /* comp.plane 2 & 3 */
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0114);
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0118);
+
+        /* clear unused bg registers */
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01c8);
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01d0);
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01dc);
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01e0);
+        mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01e4);
+
+        for (n = 0; n < ARRAY_SIZE(mdp_upscale_table); n++)
+                mdp_writel(mdp, mdp_upscale_table[n].val,
+                       mdp_upscale_table[n].reg);
+
+        for (n = 0; n < 9; n++)
+                mdp_writel(mdp, mdp_default_ccs[n], 0x40440 + 4 * n);
+        mdp_writel(mdp, mdp_default_ccs[9], 0x40500 + 4 * 0);
+        mdp_writel(mdp, mdp_default_ccs[10], 0x40500 + 4 * 0);
+        mdp_writel(mdp, mdp_default_ccs[11], 0x40500 + 4 * 0);
+
+        /* register mdp device */
+        mdp->mdp_dev.dev.parent = &pdev->dev;
+        mdp->mdp_dev.dev.class = mdp_class;
+        snprintf(mdp->mdp_dev.dev.bus_id, BUS_ID_SIZE, "mdp%d", pdev->id);
+
+        /* if you can remove the platform device you'd have to implement
+         * this:
+        mdp_dev.release = mdp_class; */
+
+        ret = device_register(&mdp->mdp_dev.dev);
+        if (ret)
+                goto error_device_register;
+        return 0;
+
+error_device_register:
+        free_irq(mdp->irq, mdp);
+error_request_irq:
+        iounmap(mdp->base);
+error_get_irq:
+error_ioremap:
+        kfree(mdp);
+        return ret;
+}
+
+static struct platform_driver msm_mdp_driver = {
+        .probe = mdp_probe,
+        .driver = {.name = "msm_mdp"},
+};
+
+static int __init mdp_init(void)
+{
+        mdp_class = class_create(THIS_MODULE, "msm_mdp");
+        if (IS_ERR(mdp_class)) {
+                printk(KERN_ERR "Error creating mdp class\n");
+                return PTR_ERR(mdp_class);
+        }
+        return platform_driver_register(&msm_mdp_driver);
+}
+
+subsys_initcall(mdp_init);
diff --git a/drivers/video/msm/mdp_csc_table.h b/drivers/video/msm/mdp_csc_table.h
new file mode 100644
index 000000000000..d1cde30ead52
--- /dev/null
+++ b/drivers/video/msm/mdp_csc_table.h
@@ -0,0 +1,582 @@
+/* drivers/video/msm_fb/mdp_csc_table.h
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+static struct {
+        uint32_t reg;
+        uint32_t val;
+} csc_table[] = {
+        { 0x40400, 0x83 },
+        { 0x40404, 0x102 },
+        { 0x40408, 0x32 },
+        { 0x4040c, 0xffffffb5 },
+        { 0x40410, 0xffffff6c },
+        { 0x40414, 0xe1 },
+        { 0x40418, 0xe1 },
+        { 0x4041c, 0xffffff45 },
+        { 0x40420, 0xffffffdc },
+        { 0x40440, 0x254 },
+        { 0x40444, 0x0 },
+        { 0x40448, 0x331 },
+        { 0x4044c, 0x254 },
+        { 0x40450, 0xffffff38 },
+        { 0x40454, 0xfffffe61 },
+        { 0x40458, 0x254 },
+        { 0x4045c, 0x409 },
+        { 0x40460, 0x0 },
+        { 0x40480, 0x5d },
+        { 0x40484, 0x13a },
+        { 0x40488, 0x20 },
+        { 0x4048c, 0xffffffcd },
+        { 0x40490, 0xffffff54 },
+        { 0x40494, 0xe1 },
+        { 0x40498, 0xe1 },
+        { 0x4049c, 0xffffff35 },
+        { 0x404a0, 0xffffffec },
+        { 0x404c0, 0x254 },
+        { 0x404c4, 0x0 },
+        { 0x404c8, 0x396 },
+        { 0x404cc, 0x254 },
+        { 0x404d0, 0xffffff94 },
+        { 0x404d4, 0xfffffef0 },
+        { 0x404d8, 0x254 },
+        { 0x404dc, 0x43a },
+        { 0x404e0, 0x0 },
+        { 0x40500, 0x10 },
+        { 0x40504, 0x80 },
+        { 0x40508, 0x80 },
+        { 0x40540, 0x10 },
+        { 0x40544, 0x80 },
+        { 0x40548, 0x80 },
+        { 0x40580, 0x10 },
+        { 0x40584, 0xeb },
+        { 0x40588, 0x10 },
+        { 0x4058c, 0xf0 },
+        { 0x405c0, 0x10 },
+        { 0x405c4, 0xeb },
+        { 0x405c8, 0x10 },
+        { 0x405cc, 0xf0 },
+        { 0x40800, 0x0 },
+        { 0x40804, 0x151515 },
+        { 0x40808, 0x1d1d1d },
+        { 0x4080c, 0x232323 },
+        { 0x40810, 0x272727 },
+        { 0x40814, 0x2b2b2b },
+        { 0x40818, 0x2f2f2f },
+        { 0x4081c, 0x333333 },
+        { 0x40820, 0x363636 },
+        { 0x40824, 0x393939 },
+        { 0x40828, 0x3b3b3b },
+        { 0x4082c, 0x3e3e3e },
+        { 0x40830, 0x404040 },
+        { 0x40834, 0x434343 },
+        { 0x40838, 0x454545 },
+        { 0x4083c, 0x474747 },
+        { 0x40840, 0x494949 },
+        { 0x40844, 0x4b4b4b },
+        { 0x40848, 0x4d4d4d },
+        { 0x4084c, 0x4f4f4f },
+        { 0x40850, 0x515151 },
+        { 0x40854, 0x535353 },
+        { 0x40858, 0x555555 },
+        { 0x4085c, 0x565656 },
+        { 0x40860, 0x585858 },
+        { 0x40864, 0x5a5a5a },
+        { 0x40868, 0x5b5b5b },
+        { 0x4086c, 0x5d5d5d },
+        { 0x40870, 0x5e5e5e },
+        { 0x40874, 0x606060 },
+        { 0x40878, 0x616161 },
+        { 0x4087c, 0x636363 },
+        { 0x40880, 0x646464 },
+        { 0x40884, 0x666666 },
+        { 0x40888, 0x676767 },
+        { 0x4088c, 0x686868 },
+        { 0x40890, 0x6a6a6a },
+        { 0x40894, 0x6b6b6b },
+        { 0x40898, 0x6c6c6c },
+        { 0x4089c, 0x6e6e6e },
+        { 0x408a0, 0x6f6f6f },
+        { 0x408a4, 0x707070 },
+        { 0x408a8, 0x717171 },
+        { 0x408ac, 0x727272 },
+        { 0x408b0, 0x747474 },
+        { 0x408b4, 0x757575 },
+        { 0x408b8, 0x767676 },
+        { 0x408bc, 0x777777 },
+        { 0x408c0, 0x787878 },
+        { 0x408c4, 0x797979 },
+        { 0x408c8, 0x7a7a7a },
+        { 0x408cc, 0x7c7c7c },
+        { 0x408d0, 0x7d7d7d },
+        { 0x408d4, 0x7e7e7e },
+        { 0x408d8, 0x7f7f7f },
+        { 0x408dc, 0x808080 },
+        { 0x408e0, 0x818181 },
+        { 0x408e4, 0x828282 },
+        { 0x408e8, 0x838383 },
+        { 0x408ec, 0x848484 },
+        { 0x408f0, 0x858585 },
+        { 0x408f4, 0x868686 },
+        { 0x408f8, 0x878787 },
+        { 0x408fc, 0x888888 },
+        { 0x40900, 0x898989 },
+        { 0x40904, 0x8a8a8a },
+        { 0x40908, 0x8b8b8b },
+        { 0x4090c, 0x8c8c8c },
+        { 0x40910, 0x8d8d8d },
+        { 0x40914, 0x8e8e8e },
+        { 0x40918, 0x8f8f8f },
+        { 0x4091c, 0x8f8f8f },
+        { 0x40920, 0x909090 },
+        { 0x40924, 0x919191 },
+        { 0x40928, 0x929292 },
+        { 0x4092c, 0x939393 },
+        { 0x40930, 0x949494 },
+        { 0x40934, 0x959595 },
+        { 0x40938, 0x969696 },
+        { 0x4093c, 0x969696 },
+        { 0x40940, 0x979797 },
+        { 0x40944, 0x989898 },
+        { 0x40948, 0x999999 },
+        { 0x4094c, 0x9a9a9a },
+        { 0x40950, 0x9b9b9b },
+        { 0x40954, 0x9c9c9c },
+        { 0x40958, 0x9c9c9c },
+        { 0x4095c, 0x9d9d9d },
+        { 0x40960, 0x9e9e9e },
+        { 0x40964, 0x9f9f9f },
+        { 0x40968, 0xa0a0a0 },
+        { 0x4096c, 0xa0a0a0 },
+        { 0x40970, 0xa1a1a1 },
+        { 0x40974, 0xa2a2a2 },
+        { 0x40978, 0xa3a3a3 },
+        { 0x4097c, 0xa4a4a4 },
+        { 0x40980, 0xa4a4a4 },
+        { 0x40984, 0xa5a5a5 },
+        { 0x40988, 0xa6a6a6 },
+        { 0x4098c, 0xa7a7a7 },
+        { 0x40990, 0xa7a7a7 },
+        { 0x40994, 0xa8a8a8 },
+        { 0x40998, 0xa9a9a9 },
+        { 0x4099c, 0xaaaaaa },
+        { 0x409a0, 0xaaaaaa },
+        { 0x409a4, 0xababab },
+        { 0x409a8, 0xacacac },
+        { 0x409ac, 0xadadad },
+        { 0x409b0, 0xadadad },
+        { 0x409b4, 0xaeaeae },
+        { 0x409b8, 0xafafaf },
+        { 0x409bc, 0xafafaf },
+        { 0x409c0, 0xb0b0b0 },
+        { 0x409c4, 0xb1b1b1 },
+        { 0x409c8, 0xb2b2b2 },
+        { 0x409cc, 0xb2b2b2 },
+        { 0x409d0, 0xb3b3b3 },
+        { 0x409d4, 0xb4b4b4 },
+        { 0x409d8, 0xb4b4b4 },
+        { 0x409dc, 0xb5b5b5 },
+        { 0x409e0, 0xb6b6b6 },
+        { 0x409e4, 0xb6b6b6 },
+        { 0x409e8, 0xb7b7b7 },
+        { 0x409ec, 0xb8b8b8 },
+        { 0x409f0, 0xb8b8b8 },
+        { 0x409f4, 0xb9b9b9 },
+        { 0x409f8, 0xbababa },
+        { 0x409fc, 0xbababa },
+        { 0x40a00, 0xbbbbbb },
+        { 0x40a04, 0xbcbcbc },
+        { 0x40a08, 0xbcbcbc },
+        { 0x40a0c, 0xbdbdbd },
+        { 0x40a10, 0xbebebe },
+        { 0x40a14, 0xbebebe },
+        { 0x40a18, 0xbfbfbf },
+        { 0x40a1c, 0xc0c0c0 },
+        { 0x40a20, 0xc0c0c0 },
+        { 0x40a24, 0xc1c1c1 },
+        { 0x40a28, 0xc1c1c1 },
+        { 0x40a2c, 0xc2c2c2 },
+        { 0x40a30, 0xc3c3c3 },
+        { 0x40a34, 0xc3c3c3 },
+        { 0x40a38, 0xc4c4c4 },
+        { 0x40a3c, 0xc5c5c5 },
+        { 0x40a40, 0xc5c5c5 },
+        { 0x40a44, 0xc6c6c6 },
+        { 0x40a48, 0xc6c6c6 },
+        { 0x40a4c, 0xc7c7c7 },
+        { 0x40a50, 0xc8c8c8 },
+        { 0x40a54, 0xc8c8c8 },
+        { 0x40a58, 0xc9c9c9 },
+        { 0x40a5c, 0xc9c9c9 },
+        { 0x40a60, 0xcacaca },
+        { 0x40a64, 0xcbcbcb },
+        { 0x40a68, 0xcbcbcb },
+        { 0x40a6c, 0xcccccc },
+        { 0x40a70, 0xcccccc },
+        { 0x40a74, 0xcdcdcd },
+        { 0x40a78, 0xcecece },
+        { 0x40a7c, 0xcecece },
+        { 0x40a80, 0xcfcfcf },
+        { 0x40a84, 0xcfcfcf },
+        { 0x40a88, 0xd0d0d0 },
+        { 0x40a8c, 0xd0d0d0 },
+        { 0x40a90, 0xd1d1d1 },
+        { 0x40a94, 0xd2d2d2 },
+        { 0x40a98, 0xd2d2d2 },
+        { 0x40a9c, 0xd3d3d3 },
+        { 0x40aa0, 0xd3d3d3 },
+        { 0x40aa4, 0xd4d4d4 },
+        { 0x40aa8, 0xd4d4d4 },
+        { 0x40aac, 0xd5d5d5 },
+        { 0x40ab0, 0xd6d6d6 },
+        { 0x40ab4, 0xd6d6d6 },
+        { 0x40ab8, 0xd7d7d7 },
+        { 0x40abc, 0xd7d7d7 },
+        { 0x40ac0, 0xd8d8d8 },
+        { 0x40ac4, 0xd8d8d8 },
+        { 0x40ac8, 0xd9d9d9 },
+        { 0x40acc, 0xd9d9d9 },
+        { 0x40ad0, 0xdadada },
+        { 0x40ad4, 0xdbdbdb },
+        { 0x40ad8, 0xdbdbdb },
+        { 0x40adc, 0xdcdcdc },
+        { 0x40ae0, 0xdcdcdc },
+        { 0x40ae4, 0xdddddd },
+        { 0x40ae8, 0xdddddd },
+        { 0x40aec, 0xdedede },
+        { 0x40af0, 0xdedede },
+        { 0x40af4, 0xdfdfdf },
+        { 0x40af8, 0xdfdfdf },
+        { 0x40afc, 0xe0e0e0 },
+        { 0x40b00, 0xe0e0e0 },
+        { 0x40b04, 0xe1e1e1 },
+        { 0x40b08, 0xe1e1e1 },
+        { 0x40b0c, 0xe2e2e2 },
+        { 0x40b10, 0xe3e3e3 },
+        { 0x40b14, 0xe3e3e3 },
+        { 0x40b18, 0xe4e4e4 },
+        { 0x40b1c, 0xe4e4e4 },
+        { 0x40b20, 0xe5e5e5 },
+        { 0x40b24, 0xe5e5e5 },
+        { 0x40b28, 0xe6e6e6 },
+        { 0x40b2c, 0xe6e6e6 },
+        { 0x40b30, 0xe7e7e7 },
+        { 0x40b34, 0xe7e7e7 },
+        { 0x40b38, 0xe8e8e8 },
+        { 0x40b3c, 0xe8e8e8 },
+        { 0x40b40, 0xe9e9e9 },
+        { 0x40b44, 0xe9e9e9 },
+        { 0x40b48, 0xeaeaea },
+        { 0x40b4c, 0xeaeaea },
+        { 0x40b50, 0xebebeb },
+        { 0x40b54, 0xebebeb },
+        { 0x40b58, 0xececec },
+        { 0x40b5c, 0xececec },
+        { 0x40b60, 0xededed },
+        { 0x40b64, 0xededed },
+        { 0x40b68, 0xeeeeee },
+        { 0x40b6c, 0xeeeeee },
+        { 0x40b70, 0xefefef },
+        { 0x40b74, 0xefefef },
+        { 0x40b78, 0xf0f0f0 },
+        { 0x40b7c, 0xf0f0f0 },
+        { 0x40b80, 0xf1f1f1 },
+        { 0x40b84, 0xf1f1f1 },
+        { 0x40b88, 0xf2f2f2 },
+        { 0x40b8c, 0xf2f2f2 },
+        { 0x40b90, 0xf2f2f2 },
+        { 0x40b94, 0xf3f3f3 },
+        { 0x40b98, 0xf3f3f3 },
+        { 0x40b9c, 0xf4f4f4 },
+        { 0x40ba0, 0xf4f4f4 },
+        { 0x40ba4, 0xf5f5f5 },
+        { 0x40ba8, 0xf5f5f5 },
+        { 0x40bac, 0xf6f6f6 },
+        { 0x40bb0, 0xf6f6f6 },
+        { 0x40bb4, 0xf7f7f7 },
+        { 0x40bb8, 0xf7f7f7 },
+        { 0x40bbc, 0xf8f8f8 },
+        { 0x40bc0, 0xf8f8f8 },
+        { 0x40bc4, 0xf9f9f9 },
+        { 0x40bc8, 0xf9f9f9 },
+        { 0x40bcc, 0xfafafa },
+        { 0x40bd0, 0xfafafa },
+        { 0x40bd4, 0xfafafa },
+        { 0x40bd8, 0xfbfbfb },
+        { 0x40bdc, 0xfbfbfb },
+        { 0x40be0, 0xfcfcfc },
+        { 0x40be4, 0xfcfcfc },
+        { 0x40be8, 0xfdfdfd },
+        { 0x40bec, 0xfdfdfd },
+        { 0x40bf0, 0xfefefe },
+        { 0x40bf4, 0xfefefe },
+        { 0x40bf8, 0xffffff },
+        { 0x40bfc, 0xffffff },
+        { 0x40c00, 0x0 },
+        { 0x40c04, 0x0 },
+        { 0x40c08, 0x0 },
+        { 0x40c0c, 0x0 },
+        { 0x40c10, 0x0 },
+        { 0x40c14, 0x0 },
+        { 0x40c18, 0x0 },
+        { 0x40c1c, 0x0 },
+        { 0x40c20, 0x0 },
+        { 0x40c24, 0x0 },
+        { 0x40c28, 0x0 },
+        { 0x40c2c, 0x0 },
+        { 0x40c30, 0x0 },
+        { 0x40c34, 0x0 },
+        { 0x40c38, 0x0 },
+        { 0x40c3c, 0x0 },
+        { 0x40c40, 0x10101 },
+        { 0x40c44, 0x10101 },
+        { 0x40c48, 0x10101 },
+        { 0x40c4c, 0x10101 },
+        { 0x40c50, 0x10101 },
+        { 0x40c54, 0x10101 },
+        { 0x40c58, 0x10101 },
+        { 0x40c5c, 0x10101 },
+        { 0x40c60, 0x10101 },
+        { 0x40c64, 0x10101 },
+        { 0x40c68, 0x20202 },
+        { 0x40c6c, 0x20202 },
+        { 0x40c70, 0x20202 },
+        { 0x40c74, 0x20202 },
+        { 0x40c78, 0x20202 },
+        { 0x40c7c, 0x20202 },
+        { 0x40c80, 0x30303 },
+        { 0x40c84, 0x30303 },
+        { 0x40c88, 0x30303 },
+        { 0x40c8c, 0x30303 },
+        { 0x40c90, 0x30303 },
+        { 0x40c94, 0x40404 },
+        { 0x40c98, 0x40404 },
+        { 0x40c9c, 0x40404 },
+        { 0x40ca0, 0x40404 },
+        { 0x40ca4, 0x40404 },
+        { 0x40ca8, 0x50505 },
+        { 0x40cac, 0x50505 },
+        { 0x40cb0, 0x50505 },
+        { 0x40cb4, 0x50505 },
+        { 0x40cb8, 0x60606 },
+        { 0x40cbc, 0x60606 },
+        { 0x40cc0, 0x60606 },
+        { 0x40cc4, 0x70707 },
+        { 0x40cc8, 0x70707 },
+        { 0x40ccc, 0x70707 },
+        { 0x40cd0, 0x70707 },
+        { 0x40cd4, 0x80808 },
+        { 0x40cd8, 0x80808 },
+        { 0x40cdc, 0x80808 },
+        { 0x40ce0, 0x90909 },
+        { 0x40ce4, 0x90909 },
+        { 0x40ce8, 0xa0a0a },
+        { 0x40cec, 0xa0a0a },
+        { 0x40cf0, 0xa0a0a },
+        { 0x40cf4, 0xb0b0b },
+        { 0x40cf8, 0xb0b0b },
+        { 0x40cfc, 0xb0b0b },
+        { 0x40d00, 0xc0c0c },
+        { 0x40d04, 0xc0c0c },
+        { 0x40d08, 0xd0d0d },
+        { 0x40d0c, 0xd0d0d },
+        { 0x40d10, 0xe0e0e },
+        { 0x40d14, 0xe0e0e },
+        { 0x40d18, 0xe0e0e },
+        { 0x40d1c, 0xf0f0f },
+        { 0x40d20, 0xf0f0f },
+        { 0x40d24, 0x101010 },
+        { 0x40d28, 0x101010 },
+        { 0x40d2c, 0x111111 },
+        { 0x40d30, 0x111111 },
+        { 0x40d34, 0x121212 },
+        { 0x40d38, 0x121212 },
+        { 0x40d3c, 0x131313 },
+        { 0x40d40, 0x131313 },
+        { 0x40d44, 0x141414 },
+        { 0x40d48, 0x151515 },
+        { 0x40d4c, 0x151515 },
+        { 0x40d50, 0x161616 },
+        { 0x40d54, 0x161616 },
+        { 0x40d58, 0x171717 },
+        { 0x40d5c, 0x171717 },
+        { 0x40d60, 0x181818 },
+        { 0x40d64, 0x191919 },
+        { 0x40d68, 0x191919 },
+        { 0x40d6c, 0x1a1a1a },
+        { 0x40d70, 0x1b1b1b },
+        { 0x40d74, 0x1b1b1b },
+        { 0x40d78, 0x1c1c1c },
+        { 0x40d7c, 0x1c1c1c },
+        { 0x40d80, 0x1d1d1d },
+        { 0x40d84, 0x1e1e1e },
+        { 0x40d88, 0x1f1f1f },
+        { 0x40d8c, 0x1f1f1f },
+        { 0x40d90, 0x202020 },
+        { 0x40d94, 0x212121 },
+        { 0x40d98, 0x212121 },
+        { 0x40d9c, 0x222222 },
+        { 0x40da0, 0x232323 },
+        { 0x40da4, 0x242424 },
+        { 0x40da8, 0x242424 },
+        { 0x40dac, 0x252525 },
+        { 0x40db0, 0x262626 },
+        { 0x40db4, 0x272727 },
+        { 0x40db8, 0x272727 },
+        { 0x40dbc, 0x282828 },
+        { 0x40dc0, 0x292929 },
+        { 0x40dc4, 0x2a2a2a },
+        { 0x40dc8, 0x2b2b2b },
+        { 0x40dcc, 0x2c2c2c },
+        { 0x40dd0, 0x2c2c2c },
+        { 0x40dd4, 0x2d2d2d },
+        { 0x40dd8, 0x2e2e2e },
+        { 0x40ddc, 0x2f2f2f },
+        { 0x40de0, 0x303030 },
+        { 0x40de4, 0x313131 },
+        { 0x40de8, 0x323232 },
+        { 0x40dec, 0x333333 },
+        { 0x40df0, 0x333333 },
+        { 0x40df4, 0x343434 },
+        { 0x40df8, 0x353535 },
+        { 0x40dfc, 0x363636 },
+        { 0x40e00, 0x373737 },
+        { 0x40e04, 0x383838 },
+        { 0x40e08, 0x393939 },
+        { 0x40e0c, 0x3a3a3a },
+        { 0x40e10, 0x3b3b3b },
+        { 0x40e14, 0x3c3c3c },
+        { 0x40e18, 0x3d3d3d },
+        { 0x40e1c, 0x3e3e3e },
+        { 0x40e20, 0x3f3f3f },
+        { 0x40e24, 0x404040 },
+        { 0x40e28, 0x414141 },
+        { 0x40e2c, 0x424242 },
+        { 0x40e30, 0x434343 },
+        { 0x40e34, 0x444444 },
+        { 0x40e38, 0x464646 },
+        { 0x40e3c, 0x474747 },
+        { 0x40e40, 0x484848 },
+        { 0x40e44, 0x494949 },
+        { 0x40e48, 0x4a4a4a },
+        { 0x40e4c, 0x4b4b4b },
+        { 0x40e50, 0x4c4c4c },
+        { 0x40e54, 0x4d4d4d },
+        { 0x40e58, 0x4f4f4f },
+        { 0x40e5c, 0x505050 },
+        { 0x40e60, 0x515151 },
+        { 0x40e64, 0x525252 },
+        { 0x40e68, 0x535353 },
+        { 0x40e6c, 0x545454 },
+        { 0x40e70, 0x565656 },
+        { 0x40e74, 0x575757 },
+        { 0x40e78, 0x585858 },
+        { 0x40e7c, 0x595959 },
+        { 0x40e80, 0x5b5b5b },
+        { 0x40e84, 0x5c5c5c },
+        { 0x40e88, 0x5d5d5d },
+        { 0x40e8c, 0x5e5e5e },
+        { 0x40e90, 0x606060 },
+        { 0x40e94, 0x616161 },
+        { 0x40e98, 0x626262 },
+        { 0x40e9c, 0x646464 },
+        { 0x40ea0, 0x656565 },
+        { 0x40ea4, 0x666666 },
+        { 0x40ea8, 0x686868 },
+        { 0x40eac, 0x696969 },
+        { 0x40eb0, 0x6a6a6a },
+        { 0x40eb4, 0x6c6c6c },
+        { 0x40eb8, 0x6d6d6d },
+        { 0x40ebc, 0x6f6f6f },
+        { 0x40ec0, 0x707070 },
+        { 0x40ec4, 0x717171 },
+        { 0x40ec8, 0x737373 },
+        { 0x40ecc, 0x747474 },
+        { 0x40ed0, 0x767676 },
+        { 0x40ed4, 0x777777 },
+        { 0x40ed8, 0x797979 },
+        { 0x40edc, 0x7a7a7a },
+        { 0x40ee0, 0x7c7c7c },
+        { 0x40ee4, 0x7d7d7d },
+        { 0x40ee8, 0x7f7f7f },
+        { 0x40eec, 0x808080 },
+        { 0x40ef0, 0x828282 },
+        { 0x40ef4, 0x838383 },
+        { 0x40ef8, 0x858585 },
+        { 0x40efc, 0x868686 },
+        { 0x40f00, 0x888888 },
+        { 0x40f04, 0x898989 },
+        { 0x40f08, 0x8b8b8b },
+        { 0x40f0c, 0x8d8d8d },
+        { 0x40f10, 0x8e8e8e },
+        { 0x40f14, 0x909090 },
+        { 0x40f18, 0x919191 },
+        { 0x40f1c, 0x939393 },
+        { 0x40f20, 0x959595 },
+        { 0x40f24, 0x969696 },
+        { 0x40f28, 0x989898 },
+        { 0x40f2c, 0x9a9a9a },
+        { 0x40f30, 0x9b9b9b },
+        { 0x40f34, 0x9d9d9d },
+        { 0x40f38, 0x9f9f9f },
+        { 0x40f3c, 0xa1a1a1 },
+        { 0x40f40, 0xa2a2a2 },
+        { 0x40f44, 0xa4a4a4 },
+        { 0x40f48, 0xa6a6a6 },
+        { 0x40f4c, 0xa7a7a7 },
+        { 0x40f50, 0xa9a9a9 },
+        { 0x40f54, 0xababab },
+        { 0x40f58, 0xadadad },
+        { 0x40f5c, 0xafafaf },
+        { 0x40f60, 0xb0b0b0 },
+        { 0x40f64, 0xb2b2b2 },
+        { 0x40f68, 0xb4b4b4 },
+        { 0x40f6c, 0xb6b6b6 },
+        { 0x40f70, 0xb8b8b8 },
+        { 0x40f74, 0xbababa },
+        { 0x40f78, 0xbbbbbb },
+        { 0x40f7c, 0xbdbdbd },
+        { 0x40f80, 0xbfbfbf },
+        { 0x40f84, 0xc1c1c1 },
+        { 0x40f88, 0xc3c3c3 },
+        { 0x40f8c, 0xc5c5c5 },
+        { 0x40f90, 0xc7c7c7 },
+        { 0x40f94, 0xc9c9c9 },
+        { 0x40f98, 0xcbcbcb },
+        { 0x40f9c, 0xcdcdcd },
+        { 0x40fa0, 0xcfcfcf },
+        { 0x40fa4, 0xd1d1d1 },
+        { 0x40fa8, 0xd3d3d3 },
+        { 0x40fac, 0xd5d5d5 },
+        { 0x40fb0, 0xd7d7d7 },
+        { 0x40fb4, 0xd9d9d9 },
+        { 0x40fb8, 0xdbdbdb },
+        { 0x40fbc, 0xdddddd },
+        { 0x40fc0, 0xdfdfdf },
+        { 0x40fc4, 0xe1e1e1 },
+        { 0x40fc8, 0xe3e3e3 },
+        { 0x40fcc, 0xe5e5e5 },
+        { 0x40fd0, 0xe7e7e7 },
+        { 0x40fd4, 0xe9e9e9 },
+        { 0x40fd8, 0xebebeb },
+        { 0x40fdc, 0xeeeeee },
+        { 0x40fe0, 0xf0f0f0 },
+        { 0x40fe4, 0xf2f2f2 },
+        { 0x40fe8, 0xf4f4f4 },
+        { 0x40fec, 0xf6f6f6 },
+        { 0x40ff0, 0xf8f8f8 },
+        { 0x40ff4, 0xfbfbfb },
+        { 0x40ff8, 0xfdfdfd },
+        { 0x40ffc, 0xffffff },
+};
diff --git a/drivers/video/msm/mdp_hw.h b/drivers/video/msm/mdp_hw.h
new file mode 100644
index 000000000000..4e3deb4e592b
--- /dev/null
+++ b/drivers/video/msm/mdp_hw.h
@@ -0,0 +1,621 @@
+/* drivers/video/msm_fb/mdp_hw.h
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+#ifndef _MDP_HW_H_
+#define _MDP_HW_H_
+
+#include <mach/msm_iomap.h>
+#include <mach/msm_fb.h>
+
+struct mdp_info {
+        struct mdp_device mdp_dev;
+        char * __iomem base;
+        int irq;
+};
+struct mdp_blit_req;
+struct mdp_device;
+int mdp_ppp_blit(const struct mdp_info *mdp, struct mdp_blit_req *req,
+                 struct file *src_file, unsigned long src_start,
+                 unsigned long src_len, struct file *dst_file,
+                 unsigned long dst_start, unsigned long dst_len);
+#define mdp_writel(mdp, value, offset) writel(value, mdp->base + offset)
+#define mdp_readl(mdp, offset) readl(mdp->base + offset)
+
+#define MDP_SYNC_CONFIG_0                (0x00000)
+#define MDP_SYNC_CONFIG_1                (0x00004)
+#define MDP_SYNC_CONFIG_2                (0x00008)
+#define MDP_SYNC_STATUS_0                (0x0000c)
+#define MDP_SYNC_STATUS_1                (0x00010)
+#define MDP_SYNC_STATUS_2                (0x00014)
+#define MDP_SYNC_THRESH_0                (0x00018)
+#define MDP_SYNC_THRESH_1                (0x0001c)
+#define MDP_INTR_ENABLE                  (0x00020)
+#define MDP_INTR_STATUS                  (0x00024)
+#define MDP_INTR_CLEAR                   (0x00028)
+#define MDP_DISPLAY0_START               (0x00030)
+#define MDP_DISPLAY1_START               (0x00034)
+#define MDP_DISPLAY_STATUS               (0x00038)
+#define MDP_EBI2_LCD0                    (0x0003c)
+#define MDP_EBI2_LCD1                    (0x00040)
+#define MDP_DISPLAY0_ADDR                (0x00054)
+#define MDP_DISPLAY1_ADDR                (0x00058)
+#define MDP_EBI2_PORTMAP_MODE            (0x0005c)
+#define MDP_MODE                         (0x00060)
+#define MDP_TV_OUT_STATUS                (0x00064)
+#define MDP_HW_VERSION                   (0x00070)
+#define MDP_SW_RESET                     (0x00074)
+#define MDP_AXI_ERROR_MASTER_STOP        (0x00078)
+#define MDP_SEL_CLK_OR_HCLK_TEST_BUS     (0x0007c)
+#define MDP_PRIMARY_VSYNC_OUT_CTRL       (0x00080)
+#define MDP_SECONDARY_VSYNC_OUT_CTRL     (0x00084)
+#define MDP_EXTERNAL_VSYNC_OUT_CTRL      (0x00088)
+#define MDP_VSYNC_CTRL                   (0x0008c)
+#define MDP_CGC_EN                       (0x00100)
+#define MDP_CMD_STATUS                   (0x10008)
+#define MDP_PROFILE_EN                   (0x10010)
+#define MDP_PROFILE_COUNT                (0x10014)
+#define MDP_DMA_START                    (0x10044)
+#define MDP_FULL_BYPASS_WORD0            (0x10100)
+#define MDP_FULL_BYPASS_WORD1            (0x10104)
+#define MDP_COMMAND_CONFIG               (0x10104)
+#define MDP_FULL_BYPASS_WORD2            (0x10108)
+#define MDP_FULL_BYPASS_WORD3            (0x1010c)
+#define MDP_FULL_BYPASS_WORD4            (0x10110)
+#define MDP_FULL_BYPASS_WORD6            (0x10118)
+#define MDP_FULL_BYPASS_WORD7            (0x1011c)
+#define MDP_FULL_BYPASS_WORD8            (0x10120)
+#define MDP_FULL_BYPASS_WORD9            (0x10124)
+#define MDP_PPP_SOURCE_CONFIG            (0x10124)
+#define MDP_FULL_BYPASS_WORD10           (0x10128)
+#define MDP_FULL_BYPASS_WORD11           (0x1012c)
+#define MDP_FULL_BYPASS_WORD12           (0x10130)
+#define MDP_FULL_BYPASS_WORD13           (0x10134)
+#define MDP_FULL_BYPASS_WORD14           (0x10138)
+#define MDP_PPP_OPERATION_CONFIG         (0x10138)
+#define MDP_FULL_BYPASS_WORD15           (0x1013c)
+#define MDP_FULL_BYPASS_WORD16           (0x10140)
+#define MDP_FULL_BYPASS_WORD17           (0x10144)
+#define MDP_FULL_BYPASS_WORD18           (0x10148)
+#define MDP_FULL_BYPASS_WORD19           (0x1014c)
+#define MDP_FULL_BYPASS_WORD20           (0x10150)
+#define MDP_PPP_DESTINATION_CONFIG       (0x10150)
+#define MDP_FULL_BYPASS_WORD21           (0x10154)
+#define MDP_FULL_BYPASS_WORD22           (0x10158)
+#define MDP_FULL_BYPASS_WORD23           (0x1015c)
+#define MDP_FULL_BYPASS_WORD24           (0x10160)
+#define MDP_FULL_BYPASS_WORD25           (0x10164)
+#define MDP_FULL_BYPASS_WORD26           (0x10168)
+#define MDP_FULL_BYPASS_WORD27           (0x1016c)
+#define MDP_FULL_BYPASS_WORD29           (0x10174)
+#define MDP_FULL_BYPASS_WORD30           (0x10178)
+#define MDP_FULL_BYPASS_WORD31           (0x1017c)
+#define MDP_FULL_BYPASS_WORD32           (0x10180)
+#define MDP_DMA_CONFIG                   (0x10180)
+#define MDP_FULL_BYPASS_WORD33           (0x10184)
+#define MDP_FULL_BYPASS_WORD34           (0x10188)
+#define MDP_FULL_BYPASS_WORD35           (0x1018c)
+#define MDP_FULL_BYPASS_WORD37           (0x10194)
+#define MDP_FULL_BYPASS_WORD39           (0x1019c)
+#define MDP_FULL_BYPASS_WORD40           (0x101a0)
+#define MDP_FULL_BYPASS_WORD41           (0x101a4)
+#define MDP_FULL_BYPASS_WORD43           (0x101ac)
+#define MDP_FULL_BYPASS_WORD46           (0x101b8)
+#define MDP_FULL_BYPASS_WORD47           (0x101bc)
+#define MDP_FULL_BYPASS_WORD48           (0x101c0)
+#define MDP_FULL_BYPASS_WORD49           (0x101c4)
+#define MDP_FULL_BYPASS_WORD50           (0x101c8)
+#define MDP_FULL_BYPASS_WORD51           (0x101cc)
+#define MDP_FULL_BYPASS_WORD52           (0x101d0)
+#define MDP_FULL_BYPASS_WORD53           (0x101d4)
+#define MDP_FULL_BYPASS_WORD54           (0x101d8)
+#define MDP_FULL_BYPASS_WORD55           (0x101dc)
+#define MDP_FULL_BYPASS_WORD56           (0x101e0)
+#define MDP_FULL_BYPASS_WORD57           (0x101e4)
+#define MDP_FULL_BYPASS_WORD58           (0x101e8)
+#define MDP_FULL_BYPASS_WORD59           (0x101ec)
+#define MDP_FULL_BYPASS_WORD60           (0x101f0)
+#define MDP_VSYNC_THRESHOLD              (0x101f0)
+#define MDP_FULL_BYPASS_WORD61           (0x101f4)
+#define MDP_FULL_BYPASS_WORD62           (0x101f8)
+#define MDP_FULL_BYPASS_WORD63           (0x101fc)
+#define MDP_TFETCH_TEST_MODE             (0x20004)
+#define MDP_TFETCH_STATUS                (0x20008)
+#define MDP_TFETCH_TILE_COUNT            (0x20010)
+#define MDP_TFETCH_FETCH_COUNT           (0x20014)
+#define MDP_TFETCH_CONSTANT_COLOR        (0x20040)
+#define MDP_CSC_BYPASS                   (0x40004)
+#define MDP_SCALE_COEFF_LSB              (0x5fffc)
+#define MDP_TV_OUT_CTL                   (0xc0000)
+#define MDP_TV_OUT_FIR_COEFF             (0xc0004)
+#define MDP_TV_OUT_BUF_ADDR              (0xc0008)
+#define MDP_TV_OUT_CC_DATA               (0xc000c)
+#define MDP_TV_OUT_SOBEL                 (0xc0010)
+#define MDP_TV_OUT_Y_CLAMP               (0xc0018)
+#define MDP_TV_OUT_CB_CLAMP              (0xc001c)
+#define MDP_TV_OUT_CR_CLAMP              (0xc0020)
+#define MDP_TEST_MODE_CLK                (0xd0000)
+#define MDP_TEST_MISR_RESET_CLK          (0xd0004)
+#define MDP_TEST_EXPORT_MISR_CLK         (0xd0008)
+#define MDP_TEST_MISR_CURR_VAL_CLK       (0xd000c)
+#define MDP_TEST_MODE_HCLK               (0xd0100)
+#define MDP_TEST_MISR_RESET_HCLK         (0xd0104)
+#define MDP_TEST_EXPORT_MISR_HCLK        (0xd0108)
+#define MDP_TEST_MISR_CURR_VAL_HCLK      (0xd010c)
+#define MDP_TEST_MODE_DCLK               (0xd0200)
+#define MDP_TEST_MISR_RESET_DCLK         (0xd0204)
+#define MDP_TEST_EXPORT_MISR_DCLK        (0xd0208)
+#define MDP_TEST_MISR_CURR_VAL_DCLK      (0xd020c)
+#define MDP_TEST_CAPTURED_DCLK           (0xd0210)
+#define MDP_TEST_MISR_CAPT_VAL_DCLK      (0xd0214)
+#define MDP_LCDC_CTL                     (0xe0000)
+#define MDP_LCDC_HSYNC_CTL               (0xe0004)
+#define MDP_LCDC_VSYNC_CTL               (0xe0008)
+#define MDP_LCDC_ACTIVE_HCTL             (0xe000c)
+#define MDP_LCDC_ACTIVE_VCTL             (0xe0010)
+#define MDP_LCDC_BORDER_CLR              (0xe0014)
+#define MDP_LCDC_H_BLANK                 (0xe0018)
+#define MDP_LCDC_V_BLANK                 (0xe001c)
+#define MDP_LCDC_UNDERFLOW_CLR           (0xe0020)
+#define MDP_LCDC_HSYNC_SKEW              (0xe0024)
+#define MDP_LCDC_TEST_CTL                (0xe0028)
+#define MDP_LCDC_LINE_IRQ                (0xe002c)
+#define MDP_LCDC_CTL_POLARITY            (0xe0030)
+#define MDP_LCDC_DMA_CONFIG              (0xe1000)
+#define MDP_LCDC_DMA_SIZE                (0xe1004)
+#define MDP_LCDC_DMA_IBUF_ADDR           (0xe1008)
+#define MDP_LCDC_DMA_IBUF_Y_STRIDE       (0xe100c)
+
+
+#define MDP_DMA2_TERM 0x1
+#define MDP_DMA3_TERM 0x2
+#define MDP_PPP_TERM 0x3
+
+/* MDP_INTR_ENABLE */
+#define DL0_ROI_DONE           (1<<0)
+#define DL1_ROI_DONE           (1<<1)
+#define DL0_DMA2_TERM_DONE     (1<<2)
+#define DL1_DMA2_TERM_DONE     (1<<3)
+#define DL0_PPP_TERM_DONE      (1<<4)
+#define DL1_PPP_TERM_DONE      (1<<5)
+#define TV_OUT_DMA3_DONE       (1<<6)
+#define TV_ENC_UNDERRUN        (1<<7)
+#define DL0_FETCH_DONE         (1<<11)
+#define DL1_FETCH_DONE         (1<<12)
+
+#define MDP_PPP_BUSY_STATUS (DL0_ROI_DONE| \
+                           DL1_ROI_DONE| \
+                           DL0_PPP_TERM_DONE| \
+                           DL1_PPP_TERM_DONE)
+
+#define MDP_ANY_INTR_MASK (DL0_ROI_DONE| \
+                           DL1_ROI_DONE| \
+                           DL0_DMA2_TERM_DONE| \
+                           DL1_DMA2_TERM_DONE| \
+                           DL0_PPP_TERM_DONE| \
+                           DL1_PPP_TERM_DONE| \
+                           DL0_FETCH_DONE| \
+                           DL1_FETCH_DONE| \
+                           TV_ENC_UNDERRUN)
+
+#define MDP_TOP_LUMA       16
+#define MDP_TOP_CHROMA     0
+#define MDP_BOTTOM_LUMA    19
+#define MDP_BOTTOM_CHROMA  3
+#define MDP_LEFT_LUMA      22
+#define MDP_LEFT_CHROMA    6
+#define MDP_RIGHT_LUMA     25
+#define MDP_RIGHT_CHROMA   9
+
+#define CLR_G 0x0
+#define CLR_B 0x1
+#define CLR_R 0x2
+#define CLR_ALPHA 0x3
+
+#define CLR_Y  CLR_G
+#define CLR_CB CLR_B
+#define CLR_CR CLR_R
+
+/* from lsb to msb */
+#define MDP_GET_PACK_PATTERN(a, x, y, z, bit) \
+        (((a)<<(bit*3))|((x)<<(bit*2))|((y)<<bit)|(z))
+
+/* MDP_SYNC_CONFIG_0/1/2 */
+#define MDP_SYNCFG_HGT_LOC 22
+#define MDP_SYNCFG_VSYNC_EXT_EN (1<<21)
+#define MDP_SYNCFG_VSYNC_INT_EN (1<<20)
+
+/* MDP_SYNC_THRESH_0 */
+#define MDP_PRIM_BELOW_LOC 0
+#define MDP_PRIM_ABOVE_LOC 8
+
+/* MDP_{PRIMARY,SECONDARY,EXTERNAL}_VSYNC_OUT_CRL */
+#define VSYNC_PULSE_EN (1<<31)
+#define VSYNC_PULSE_INV (1<<30)
+
+/* MDP_VSYNC_CTRL */
+#define DISP0_VSYNC_MAP_VSYNC0 0
+#define DISP0_VSYNC_MAP_VSYNC1 (1<<0)
+#define DISP0_VSYNC_MAP_VSYNC2 ((1<<0)|(1<<1))
+
+#define DISP1_VSYNC_MAP_VSYNC0 0
+#define DISP1_VSYNC_MAP_VSYNC1 (1<<2)
+#define DISP1_VSYNC_MAP_VSYNC2 ((1<<2)|(1<<3))
+
+#define PRIMARY_LCD_SYNC_EN (1<<4)
+#define PRIMARY_LCD_SYNC_DISABLE 0
+
+#define SECONDARY_LCD_SYNC_EN (1<<5)
+#define SECONDARY_LCD_SYNC_DISABLE 0
+
+#define EXTERNAL_LCD_SYNC_EN (1<<6)
+#define EXTERNAL_LCD_SYNC_DISABLE 0
+
+/* MDP_VSYNC_THRESHOLD / MDP_FULL_BYPASS_WORD60 */
+#define VSYNC_THRESHOLD_ABOVE_LOC 0
+#define VSYNC_THRESHOLD_BELOW_LOC 16
+#define VSYNC_ANTI_TEAR_EN (1<<31)
+
+/* MDP_COMMAND_CONFIG / MDP_FULL_BYPASS_WORD1 */
+#define MDP_CMD_DBGBUS_EN (1<<0)
+
+/* MDP_PPP_SOURCE_CONFIG / MDP_FULL_BYPASS_WORD9&53 */
+#define PPP_SRC_C0G_8BIT ((1<<1)|(1<<0))
+#define PPP_SRC_C1B_8BIT ((1<<3)|(1<<2))
+#define PPP_SRC_C2R_8BIT ((1<<5)|(1<<4))
+#define PPP_SRC_C3A_8BIT ((1<<7)|(1<<6))
+
+#define PPP_SRC_C0G_6BIT (1<<1)
+#define PPP_SRC_C1B_6BIT (1<<3)
+#define PPP_SRC_C2R_6BIT (1<<5)
+
+#define PPP_SRC_C0G_5BIT (1<<0)
+#define PPP_SRC_C1B_5BIT (1<<2)
+#define PPP_SRC_C2R_5BIT (1<<4)
+
+#define PPP_SRC_C3ALPHA_EN (1<<8)
+
+#define PPP_SRC_BPP_1BYTES 0
+#define PPP_SRC_BPP_2BYTES (1<<9)
+#define PPP_SRC_BPP_3BYTES (1<<10)
+#define PPP_SRC_BPP_4BYTES ((1<<10)|(1<<9))
+
+#define PPP_SRC_BPP_ROI_ODD_X (1<<11)
+#define PPP_SRC_BPP_ROI_ODD_Y (1<<12)
+#define PPP_SRC_INTERLVD_2COMPONENTS (1<<13)
+#define PPP_SRC_INTERLVD_3COMPONENTS (1<<14)
+#define PPP_SRC_INTERLVD_4COMPONENTS ((1<<14)|(1<<13))
+
+
+/* RGB666 unpack format
+** TIGHT means R6+G6+B6 together
+** LOOSE means R6+2 +G6+2+ B6+2 (with MSB)
+**          or 2+R6 +2+G6 +2+B6 (with LSB)
+*/
+#define PPP_SRC_PACK_TIGHT (1<<17)
+#define PPP_SRC_PACK_LOOSE 0
+#define PPP_SRC_PACK_ALIGN_LSB 0
+#define PPP_SRC_PACK_ALIGN_MSB (1<<18)
+
+#define PPP_SRC_PLANE_INTERLVD 0
+#define PPP_SRC_PLANE_PSEUDOPLNR (1<<20)
+
+#define PPP_SRC_WMV9_MODE (1<<21)
+
+/* MDP_PPP_OPERATION_CONFIG / MDP_FULL_BYPASS_WORD14 */
+#define PPP_OP_SCALE_X_ON (1<<0)
+#define PPP_OP_SCALE_Y_ON (1<<1)
+
+#define PPP_OP_CONVERT_RGB2YCBCR 0
+#define PPP_OP_CONVERT_YCBCR2RGB (1<<2)
+#define PPP_OP_CONVERT_ON (1<<3)
+
+#define PPP_OP_CONVERT_MATRIX_PRIMARY 0
+#define PPP_OP_CONVERT_MATRIX_SECONDARY (1<<4)
+
+#define PPP_OP_LUT_C0_ON (1<<5)
+#define PPP_OP_LUT_C1_ON (1<<6)
+#define PPP_OP_LUT_C2_ON (1<<7)
+
+/* rotate or blend enable */
+#define PPP_OP_ROT_ON (1<<8)
+
+#define PPP_OP_ROT_90 (1<<9)
+#define PPP_OP_FLIP_LR (1<<10)
+#define PPP_OP_FLIP_UD (1<<11)
+
+#define PPP_OP_BLEND_ON (1<<12)
+
+#define PPP_OP_BLEND_SRCPIXEL_ALPHA 0
+#define PPP_OP_BLEND_DSTPIXEL_ALPHA (1<<13)
+#define PPP_OP_BLEND_CONSTANT_ALPHA (1<<14)
+#define PPP_OP_BLEND_SRCPIXEL_TRANSP ((1<<13)|(1<<14))
+
+#define PPP_OP_BLEND_ALPHA_BLEND_NORMAL 0
+#define PPP_OP_BLEND_ALPHA_BLEND_REVERSE (1<<15)
+
+#define PPP_OP_DITHER_EN (1<<16)
+
+#define PPP_OP_COLOR_SPACE_RGB 0
+#define PPP_OP_COLOR_SPACE_YCBCR (1<<17)
+
+#define PPP_OP_SRC_CHROMA_RGB 0
+#define PPP_OP_SRC_CHROMA_H2V1 (1<<18)
+#define PPP_OP_SRC_CHROMA_H1V2 (1<<19)
+#define PPP_OP_SRC_CHROMA_420 ((1<<18)|(1<<19))
+#define PPP_OP_SRC_CHROMA_COSITE 0
+#define PPP_OP_SRC_CHROMA_OFFSITE (1<<20)
+
+#define PPP_OP_DST_CHROMA_RGB 0
+#define PPP_OP_DST_CHROMA_H2V1 (1<<21)
+#define PPP_OP_DST_CHROMA_H1V2 (1<<22)
+#define PPP_OP_DST_CHROMA_420 ((1<<21)|(1<<22))
+#define PPP_OP_DST_CHROMA_COSITE 0
+#define PPP_OP_DST_CHROMA_OFFSITE (1<<23)
+
+#define PPP_BLEND_ALPHA_TRANSP (1<<24)
+
+#define PPP_OP_BG_CHROMA_RGB 0
+#define PPP_OP_BG_CHROMA_H2V1 (1<<25)
+#define PPP_OP_BG_CHROMA_H1V2 (1<<26)
+#define PPP_OP_BG_CHROMA_420 ((1<<25)|(1<<26))
+#define PPP_OP_BG_CHROMA_SITE_COSITE 0
+#define PPP_OP_BG_CHROMA_SITE_OFFSITE (1<<27)
+
+/* MDP_PPP_DESTINATION_CONFIG / MDP_FULL_BYPASS_WORD20 */
+#define PPP_DST_C0G_8BIT ((1<<0)|(1<<1))
+#define PPP_DST_C1B_8BIT ((1<<3)|(1<<2))
+#define PPP_DST_C2R_8BIT ((1<<5)|(1<<4))
+#define PPP_DST_C3A_8BIT ((1<<7)|(1<<6))
+
+#define PPP_DST_C0G_6BIT (1<<1)
+#define PPP_DST_C1B_6BIT (1<<3)
+#define PPP_DST_C2R_6BIT (1<<5)
+
+#define PPP_DST_C0G_5BIT (1<<0)
+#define PPP_DST_C1B_5BIT (1<<2)
+#define PPP_DST_C2R_5BIT (1<<4)
+
+#define PPP_DST_C3A_8BIT ((1<<7)|(1<<6))
+#define PPP_DST_C3ALPHA_EN (1<<8)
+
+#define PPP_DST_INTERLVD_2COMPONENTS (1<<9)
+#define PPP_DST_INTERLVD_3COMPONENTS (1<<10)
+#define PPP_DST_INTERLVD_4COMPONENTS ((1<<10)|(1<<9))
+#define PPP_DST_INTERLVD_6COMPONENTS ((1<<11)|(1<<9))
+
+#define PPP_DST_PACK_LOOSE 0
+#define PPP_DST_PACK_TIGHT (1<<13)
+#define PPP_DST_PACK_ALIGN_LSB 0
+#define PPP_DST_PACK_ALIGN_MSB (1<<14)
+
+#define PPP_DST_OUT_SEL_AXI 0
+#define PPP_DST_OUT_SEL_MDDI (1<<15)
+
+#define PPP_DST_BPP_2BYTES (1<<16)
+#define PPP_DST_BPP_3BYTES (1<<17)
+#define PPP_DST_BPP_4BYTES ((1<<17)|(1<<16))
+
+#define PPP_DST_PLANE_INTERLVD 0
+#define PPP_DST_PLANE_PLANAR (1<<18)
+#define PPP_DST_PLANE_PSEUDOPLNR (1<<19)
+
+#define PPP_DST_TO_TV (1<<20)
+
+#define PPP_DST_MDDI_PRIMARY 0
+#define PPP_DST_MDDI_SECONDARY (1<<21)
+#define PPP_DST_MDDI_EXTERNAL (1<<22)
+
+/* image configurations by image type */
+#define PPP_CFG_MDP_RGB_565(dir)       (PPP_##dir##_C2R_5BIT | \
+                                        PPP_##dir##_C0G_6BIT | \
+                                        PPP_##dir##_C1B_5BIT | \
+                                        PPP_##dir##_BPP_2BYTES | \
+                                        PPP_##dir##_INTERLVD_3COMPONENTS | \
+                                        PPP_##dir##_PACK_TIGHT | \
+                                        PPP_##dir##_PACK_ALIGN_LSB | \
+                                        PPP_##dir##_PLANE_INTERLVD)
+
+#define PPP_CFG_MDP_RGB_888(dir)       (PPP_##dir##_C2R_8BIT | \
+                                        PPP_##dir##_C0G_8BIT | \
+                                        PPP_##dir##_C1B_8BIT | \
+                                        PPP_##dir##_BPP_3BYTES | \
+                                        PPP_##dir##_INTERLVD_3COMPONENTS | \
+                                        PPP_##dir##_PACK_TIGHT | \
+                                        PPP_##dir##_PACK_ALIGN_LSB | \
+                                        PPP_##dir##_PLANE_INTERLVD)
+
+#define PPP_CFG_MDP_ARGB_8888(dir)     (PPP_##dir##_C2R_8BIT | \
+                                        PPP_##dir##_C0G_8BIT | \
+                                        PPP_##dir##_C1B_8BIT | \
+                                        PPP_##dir##_C3A_8BIT | \
+                                        PPP_##dir##_C3ALPHA_EN | \
+                                        PPP_##dir##_BPP_4BYTES | \
+                                        PPP_##dir##_INTERLVD_4COMPONENTS | \
+                                        PPP_##dir##_PACK_TIGHT | \
+                                        PPP_##dir##_PACK_ALIGN_LSB | \
+                                        PPP_##dir##_PLANE_INTERLVD)
+
+#define PPP_CFG_MDP_XRGB_8888(dir) PPP_CFG_MDP_ARGB_8888(dir)
+#define PPP_CFG_MDP_RGBA_8888(dir) PPP_CFG_MDP_ARGB_8888(dir)
+#define PPP_CFG_MDP_BGRA_8888(dir) PPP_CFG_MDP_ARGB_8888(dir)
+
+#define PPP_CFG_MDP_Y_CBCR_H2V2(dir)   (PPP_##dir##_C2R_8BIT | \
+                                        PPP_##dir##_C0G_8BIT | \
+                                        PPP_##dir##_C1B_8BIT | \
+                                        PPP_##dir##_C3A_8BIT | \
+                                        PPP_##dir##_BPP_2BYTES | \
+                                        PPP_##dir##_INTERLVD_2COMPONENTS | \
+                                        PPP_##dir##_PACK_TIGHT | \
+                                        PPP_##dir##_PACK_ALIGN_LSB | \
+                                        PPP_##dir##_PLANE_PSEUDOPLNR)
+
+#define PPP_CFG_MDP_Y_CRCB_H2V2(dir)    PPP_CFG_MDP_Y_CBCR_H2V2(dir)
+
+#define PPP_CFG_MDP_YCRYCB_H2V1(dir)   (PPP_##dir##_C2R_8BIT | \
+                                        PPP_##dir##_C0G_8BIT | \
+                                        PPP_##dir##_C1B_8BIT | \
+                                        PPP_##dir##_C3A_8BIT | \
+                                        PPP_##dir##_BPP_2BYTES | \
+                                        PPP_##dir##_INTERLVD_4COMPONENTS | \
+                                        PPP_##dir##_PACK_TIGHT | \
+                                        PPP_##dir##_PACK_ALIGN_LSB |\
+                                        PPP_##dir##_PLANE_INTERLVD)
+
+#define PPP_CFG_MDP_Y_CBCR_H2V1(dir)   (PPP_##dir##_C2R_8BIT | \
+                                        PPP_##dir##_C0G_8BIT | \
+                                        PPP_##dir##_C1B_8BIT | \
+                                        PPP_##dir##_C3A_8BIT | \
+                                        PPP_##dir##_BPP_2BYTES |   \
+                                        PPP_##dir##_INTERLVD_2COMPONENTS |  \
+                                        PPP_##dir##_PACK_TIGHT | \
+                                        PPP_##dir##_PACK_ALIGN_LSB | \
+                                        PPP_##dir##_PLANE_PSEUDOPLNR)
+
+#define PPP_CFG_MDP_Y_CRCB_H2V1(dir)    PPP_CFG_MDP_Y_CBCR_H2V1(dir)
+
+#define PPP_PACK_PATTERN_MDP_RGB_565 \
+        MDP_GET_PACK_PATTERN(0, CLR_R, CLR_G, CLR_B, 8)
+#define PPP_PACK_PATTERN_MDP_RGB_888 PPP_PACK_PATTERN_MDP_RGB_565
+#define PPP_PACK_PATTERN_MDP_XRGB_8888 \
+        MDP_GET_PACK_PATTERN(CLR_ALPHA, CLR_R, CLR_G, CLR_B, 8)
+#define PPP_PACK_PATTERN_MDP_ARGB_8888 PPP_PACK_PATTERN_MDP_XRGB_8888
+#define PPP_PACK_PATTERN_MDP_RGBA_8888 \
+        MDP_GET_PACK_PATTERN(CLR_ALPHA, CLR_B, CLR_G, CLR_R, 8)
+#define PPP_PACK_PATTERN_MDP_BGRA_8888 \
+        MDP_GET_PACK_PATTERN(CLR_ALPHA, CLR_R, CLR_G, CLR_B, 8)
+#define PPP_PACK_PATTERN_MDP_Y_CBCR_H2V1 \
+        MDP_GET_PACK_PATTERN(0, 0, CLR_CB, CLR_CR, 8)
+#define PPP_PACK_PATTERN_MDP_Y_CBCR_H2V2 PPP_PACK_PATTERN_MDP_Y_CBCR_H2V1
+#define PPP_PACK_PATTERN_MDP_Y_CRCB_H2V1 \
+        MDP_GET_PACK_PATTERN(0, 0, CLR_CR, CLR_CB, 8)
+#define PPP_PACK_PATTERN_MDP_Y_CRCB_H2V2 PPP_PACK_PATTERN_MDP_Y_CRCB_H2V1
+#define PPP_PACK_PATTERN_MDP_YCRYCB_H2V1 \
+        MDP_GET_PACK_PATTERN(CLR_Y, CLR_R, CLR_Y, CLR_B, 8)
+
+#define PPP_CHROMA_SAMP_MDP_RGB_565(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_RGB_888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_XRGB_8888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_ARGB_8888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_RGBA_8888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_BGRA_8888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_Y_CBCR_H2V1(dir) PPP_OP_##dir##_CHROMA_H2V1
+#define PPP_CHROMA_SAMP_MDP_Y_CBCR_H2V2(dir) PPP_OP_##dir##_CHROMA_420
+#define PPP_CHROMA_SAMP_MDP_Y_CRCB_H2V1(dir) PPP_OP_##dir##_CHROMA_H2V1
+#define PPP_CHROMA_SAMP_MDP_Y_CRCB_H2V2(dir) PPP_OP_##dir##_CHROMA_420
+#define PPP_CHROMA_SAMP_MDP_YCRYCB_H2V1(dir) PPP_OP_##dir##_CHROMA_H2V1
+
+/* Helpful array generation macros */
+#define PPP_ARRAY0(name) \
+        [MDP_RGB_565] = PPP_##name##_MDP_RGB_565,\
+        [MDP_RGB_888] = PPP_##name##_MDP_RGB_888,\
+        [MDP_XRGB_8888] = PPP_##name##_MDP_XRGB_8888,\
+        [MDP_ARGB_8888] = PPP_##name##_MDP_ARGB_8888,\
+        [MDP_RGBA_8888] = PPP_##name##_MDP_RGBA_8888,\
+        [MDP_BGRA_8888] = PPP_##name##_MDP_BGRA_8888,\
+        [MDP_Y_CBCR_H2V1] = PPP_##name##_MDP_Y_CBCR_H2V1,\
+        [MDP_Y_CBCR_H2V2] = PPP_##name##_MDP_Y_CBCR_H2V2,\
+        [MDP_Y_CRCB_H2V1] = PPP_##name##_MDP_Y_CRCB_H2V1,\
+        [MDP_Y_CRCB_H2V2] = PPP_##name##_MDP_Y_CRCB_H2V2,\
+        [MDP_YCRYCB_H2V1] = PPP_##name##_MDP_YCRYCB_H2V1
+
+#define PPP_ARRAY1(name, dir) \
+        [MDP_RGB_565] = PPP_##name##_MDP_RGB_565(dir),\
+        [MDP_RGB_888] = PPP_##name##_MDP_RGB_888(dir),\
+        [MDP_XRGB_8888] = PPP_##name##_MDP_XRGB_8888(dir),\
+        [MDP_ARGB_8888] = PPP_##name##_MDP_ARGB_8888(dir),\
+        [MDP_RGBA_8888] = PPP_##name##_MDP_RGBA_8888(dir),\
+        [MDP_BGRA_8888] = PPP_##name##_MDP_BGRA_8888(dir),\
+        [MDP_Y_CBCR_H2V1] = PPP_##name##_MDP_Y_CBCR_H2V1(dir),\
+        [MDP_Y_CBCR_H2V2] = PPP_##name##_MDP_Y_CBCR_H2V2(dir),\
+        [MDP_Y_CRCB_H2V1] = PPP_##name##_MDP_Y_CRCB_H2V1(dir),\
+        [MDP_Y_CRCB_H2V2] = PPP_##name##_MDP_Y_CRCB_H2V2(dir),\
+        [MDP_YCRYCB_H2V1] = PPP_##name##_MDP_YCRYCB_H2V1(dir)
+
+#define IS_YCRCB(img) ((img == MDP_Y_CRCB_H2V2) | (img == MDP_Y_CBCR_H2V2) | \
+                       (img == MDP_Y_CRCB_H2V1) | (img == MDP_Y_CBCR_H2V1) | \
+                       (img == MDP_YCRYCB_H2V1))
+#define IS_RGB(img) ((img == MDP_RGB_565) | (img == MDP_RGB_888) | \
+                     (img == MDP_ARGB_8888) | (img == MDP_RGBA_8888) | \
+                     (img == MDP_XRGB_8888) | (img == MDP_BGRA_8888))
+#define HAS_ALPHA(img) ((img == MDP_ARGB_8888) | (img == MDP_RGBA_8888) | \
+                        (img == MDP_BGRA_8888))
+
+#define IS_PSEUDOPLNR(img) ((img == MDP_Y_CRCB_H2V2) | \
+                            (img == MDP_Y_CBCR_H2V2) | \
+                            (img == MDP_Y_CRCB_H2V1) | \
+                            (img == MDP_Y_CBCR_H2V1))
+
+/* Mappings from addr to purpose */
+#define PPP_ADDR_SRC_ROI                MDP_FULL_BYPASS_WORD2
+#define PPP_ADDR_SRC0                   MDP_FULL_BYPASS_WORD3
+#define PPP_ADDR_SRC1                   MDP_FULL_BYPASS_WORD4
+#define PPP_ADDR_SRC_YSTRIDE            MDP_FULL_BYPASS_WORD7
+#define PPP_ADDR_SRC_CFG                MDP_FULL_BYPASS_WORD9
+#define PPP_ADDR_SRC_PACK_PATTERN       MDP_FULL_BYPASS_WORD10
+#define PPP_ADDR_OPERATION              MDP_FULL_BYPASS_WORD14
+#define PPP_ADDR_PHASEX_INIT            MDP_FULL_BYPASS_WORD15
+#define PPP_ADDR_PHASEY_INIT            MDP_FULL_BYPASS_WORD16
+#define PPP_ADDR_PHASEX_STEP            MDP_FULL_BYPASS_WORD17
+#define PPP_ADDR_PHASEY_STEP            MDP_FULL_BYPASS_WORD18
+#define PPP_ADDR_ALPHA_TRANSP           MDP_FULL_BYPASS_WORD19
+#define PPP_ADDR_DST_CFG                MDP_FULL_BYPASS_WORD20
+#define PPP_ADDR_DST_PACK_PATTERN       MDP_FULL_BYPASS_WORD21
+#define PPP_ADDR_DST_ROI                MDP_FULL_BYPASS_WORD25
+#define PPP_ADDR_DST0                   MDP_FULL_BYPASS_WORD26
+#define PPP_ADDR_DST1                   MDP_FULL_BYPASS_WORD27
+#define PPP_ADDR_DST_YSTRIDE            MDP_FULL_BYPASS_WORD30
+#define PPP_ADDR_EDGE                   MDP_FULL_BYPASS_WORD46
+#define PPP_ADDR_BG0                    MDP_FULL_BYPASS_WORD48
+#define PPP_ADDR_BG1                    MDP_FULL_BYPASS_WORD49
+#define PPP_ADDR_BG_YSTRIDE             MDP_FULL_BYPASS_WORD51
+#define PPP_ADDR_BG_CFG                 MDP_FULL_BYPASS_WORD53
+#define PPP_ADDR_BG_PACK_PATTERN        MDP_FULL_BYPASS_WORD54
+
+/* MDP_DMA_CONFIG / MDP_FULL_BYPASS_WORD32 */
+#define DMA_DSTC0G_6BITS (1<<1)
+#define DMA_DSTC1B_6BITS (1<<3)
+#define DMA_DSTC2R_6BITS (1<<5)
+#define DMA_DSTC0G_5BITS (1<<0)
+#define DMA_DSTC1B_5BITS (1<<2)
+#define DMA_DSTC2R_5BITS (1<<4)
+
+#define DMA_PACK_TIGHT (1<<6)
+#define DMA_PACK_LOOSE 0
+#define DMA_PACK_ALIGN_LSB 0
+#define DMA_PACK_ALIGN_MSB (1<<7)
+#define DMA_PACK_PATTERN_RGB \
+        (MDP_GET_PACK_PATTERN(0, CLR_R, CLR_G, CLR_B, 2)<<8)
+
+#define DMA_OUT_SEL_AHB  0
+#define DMA_OUT_SEL_MDDI (1<<14)
+#define DMA_AHBM_LCD_SEL_PRIMARY 0
+#define DMA_AHBM_LCD_SEL_SECONDARY (1<<15)
+#define DMA_IBUF_C3ALPHA_EN (1<<16)
+#define DMA_DITHER_EN (1<<17)
+
+#define DMA_MDDI_DMAOUT_LCD_SEL_PRIMARY 0
+#define DMA_MDDI_DMAOUT_LCD_SEL_SECONDARY (1<<18)
+#define DMA_MDDI_DMAOUT_LCD_SEL_EXTERNAL (1<<19)
+
+#define DMA_IBUF_FORMAT_RGB565 (1<<20)
+#define DMA_IBUF_FORMAT_RGB888_OR_ARGB8888 0
+
+#define DMA_IBUF_NONCONTIGUOUS (1<<21)
+
+/* MDDI REGISTER ? */
+#define MDDI_VDO_PACKET_DESC  0x5666
+#define MDDI_VDO_PACKET_PRIM  0xC3
+#define MDDI_VDO_PACKET_SECD  0xC0
+
+#endif
diff --git a/drivers/video/msm/mdp_ppp.c b/drivers/video/msm/mdp_ppp.c
new file mode 100644
index 000000000000..ba2c4673b648
--- /dev/null
+++ b/drivers/video/msm/mdp_ppp.c
@@ -0,0 +1,750 @@
+/* drivers/video/msm/mdp_ppp.c
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+#include <linux/fb.h>
+#include <linux/file.h>
+#include <linux/delay.h>
+#include <linux/msm_mdp.h>
+#include <linux/android_pmem.h>
+#include <mach/msm_fb.h>
+
+#include "mdp_hw.h"
+#include "mdp_scale_tables.h"
+
+#define DLOG(x...) do {} while (0)
+
+#define MDP_DOWNSCALE_BLUR (MDP_DOWNSCALE_MAX + 1)
+static int downscale_y_table = MDP_DOWNSCALE_MAX;
+static int downscale_x_table = MDP_DOWNSCALE_MAX;
+
+struct mdp_regs {
+        uint32_t src0;
+        uint32_t src1;
+        uint32_t dst0;
+        uint32_t dst1;
+        uint32_t src_cfg;
+        uint32_t dst_cfg;
+        uint32_t src_pack;
+        uint32_t dst_pack;
+        uint32_t src_rect;
+        uint32_t dst_rect;
+        uint32_t src_ystride;
+        uint32_t dst_ystride;
+        uint32_t op;
+        uint32_t src_bpp;
+        uint32_t dst_bpp;
+        uint32_t edge;
+        uint32_t phasex_init;
+        uint32_t phasey_init;
+        uint32_t phasex_step;
+        uint32_t phasey_step;
+};
+
+static uint32_t pack_pattern[] = {
+        PPP_ARRAY0(PACK_PATTERN)
+};
+
+static uint32_t src_img_cfg[] = {
+        PPP_ARRAY1(CFG, SRC)
+};
+
+static uint32_t dst_img_cfg[] = {
+        PPP_ARRAY1(CFG, DST)
+};
+
+static uint32_t bytes_per_pixel[] = {
+        [MDP_RGB_565] = 2,
+        [MDP_RGB_888] = 3,
+        [MDP_XRGB_8888] = 4,
+        [MDP_ARGB_8888] = 4,
+        [MDP_RGBA_8888] = 4,
+        [MDP_BGRA_8888] = 4,
+        [MDP_Y_CBCR_H2V1] = 1,
+        [MDP_Y_CBCR_H2V2] = 1,
+        [MDP_Y_CRCB_H2V1] = 1,
+        [MDP_Y_CRCB_H2V2] = 1,
+        [MDP_YCRYCB_H2V1] = 2
+};
+
+static uint32_t dst_op_chroma[] = {
+        PPP_ARRAY1(CHROMA_SAMP, DST)
+};
+
+static uint32_t src_op_chroma[] = {
+        PPP_ARRAY1(CHROMA_SAMP, SRC)
+};
+
+static uint32_t bg_op_chroma[] = {
+        PPP_ARRAY1(CHROMA_SAMP, BG)
+};
+
+static void rotate_dst_addr_x(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+        regs->dst0 += (req->dst_rect.w -
+                       min((uint32_t)16, req->dst_rect.w)) * regs->dst_bpp;
+        regs->dst1 += (req->dst_rect.w -
+                       min((uint32_t)16, req->dst_rect.w)) * regs->dst_bpp;
+}
+
+static void rotate_dst_addr_y(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+        regs->dst0 += (req->dst_rect.h -
+                       min((uint32_t)16, req->dst_rect.h)) *
+                       regs->dst_ystride;
+        regs->dst1 += (req->dst_rect.h -
+                       min((uint32_t)16, req->dst_rect.h)) *
+                       regs->dst_ystride;
+}
+
+static void blit_rotate(struct mdp_blit_req *req,
+                        struct mdp_regs *regs)
+{
+        if (req->flags == MDP_ROT_NOP)
+                return;
+
+        regs->op |= PPP_OP_ROT_ON;
+        if ((req->flags & MDP_ROT_90 || req->flags & MDP_FLIP_LR) &&
+            !(req->flags & MDP_ROT_90 && req->flags & MDP_FLIP_LR))
+                rotate_dst_addr_x(req, regs);
+        if (req->flags & MDP_ROT_90)
+                regs->op |= PPP_OP_ROT_90;
+        if (req->flags & MDP_FLIP_UD) {
+                regs->op |= PPP_OP_FLIP_UD;
+                rotate_dst_addr_y(req, regs);
+        }
+        if (req->flags & MDP_FLIP_LR)
+                regs->op |= PPP_OP_FLIP_LR;
+}
+
+static void blit_convert(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+        if (req->src.format == req->dst.format)
+                return;
+        if (IS_RGB(req->src.format) && IS_YCRCB(req->dst.format)) {
+                regs->op |= PPP_OP_CONVERT_RGB2YCBCR | PPP_OP_CONVERT_ON;
+        } else if (IS_YCRCB(req->src.format) && IS_RGB(req->dst.format)) {
+                regs->op |= PPP_OP_CONVERT_YCBCR2RGB | PPP_OP_CONVERT_ON;
+                if (req->dst.format == MDP_RGB_565)
+                        regs->op |= PPP_OP_CONVERT_MATRIX_SECONDARY;
+        }
+}
+
+#define GET_BIT_RANGE(value, high, low) \
+        (((1 << (high - low + 1)) - 1) & (value >> low))
+static uint32_t transp_convert(struct mdp_blit_req *req)
+{
+        uint32_t transp = 0;
+        if (req->src.format == MDP_RGB_565) {
+                /* pad each value to 8 bits by copying the high bits into the
+                 * low end, convert RGB to RBG by switching low 2 components */
+                transp |= ((GET_BIT_RANGE(req->transp_mask, 15, 11) << 3) |
+                           (GET_BIT_RANGE(req->transp_mask, 15, 13))) << 16;
+
+                transp |= ((GET_BIT_RANGE(req->transp_mask, 4, 0) << 3) |
+                           (GET_BIT_RANGE(req->transp_mask, 4, 2))) << 8;
+
+                transp |= (GET_BIT_RANGE(req->transp_mask, 10, 5) << 2) |
+                          (GET_BIT_RANGE(req->transp_mask, 10, 9));
+        } else {
+                /* convert RGB to RBG */
+                transp |= (GET_BIT_RANGE(req->transp_mask, 15, 8)) |
+                          (GET_BIT_RANGE(req->transp_mask, 23, 16) << 16) |
+                          (GET_BIT_RANGE(req->transp_mask, 7, 0) << 8);
+        }
+        return transp;
+}
+#undef GET_BIT_RANGE
+
+static void blit_blend(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+        /* TRANSP BLEND */
+        if (req->transp_mask != MDP_TRANSP_NOP) {
+                req->transp_mask = transp_convert(req);
+                if (req->alpha != MDP_ALPHA_NOP) {
+                        /* use blended transparancy mode
+                         * pixel = (src == transp) ? dst : blend
+                         * blend is combo of blend_eq_sel and
+                         * blend_alpha_sel */
+                        regs->op |= PPP_OP_ROT_ON | PPP_OP_BLEND_ON |
+                                PPP_OP_BLEND_ALPHA_BLEND_NORMAL |
+                                PPP_OP_BLEND_CONSTANT_ALPHA |
+                                PPP_BLEND_ALPHA_TRANSP;
+                } else {
+                        /* simple transparancy mode
+                         * pixel = (src == transp) ? dst : src */
+                        regs->op |= PPP_OP_ROT_ON | PPP_OP_BLEND_ON |
+                                PPP_OP_BLEND_SRCPIXEL_TRANSP;
+                }
+        }
+
+        req->alpha &= 0xff;
+        /* ALPHA BLEND */
+        if (HAS_ALPHA(req->src.format)) {
+                regs->op |= PPP_OP_ROT_ON | PPP_OP_BLEND_ON |
+                        PPP_OP_BLEND_SRCPIXEL_ALPHA;
+        } else if (req->alpha < MDP_ALPHA_NOP) {
+                /* just blend by alpha */
+                regs->op |= PPP_OP_ROT_ON | PPP_OP_BLEND_ON |
+                        PPP_OP_BLEND_ALPHA_BLEND_NORMAL |
+                        PPP_OP_BLEND_CONSTANT_ALPHA;
+        }
+
+        regs->op |= bg_op_chroma[req->dst.format];
+}
+
+#define ONE_HALF        (1LL << 32)
+#define ONE             (1LL << 33)
+#define TWO             (2LL << 33)
+#define THREE           (3LL << 33)
+#define FRAC_MASK (ONE - 1)
+#define INT_MASK (~FRAC_MASK)
+
+static int scale_params(uint32_t dim_in, uint32_t dim_out, uint32_t origin,
+                        uint32_t *phase_init, uint32_t *phase_step)
+{
+        /* to improve precicsion calculations are done in U31.33 and converted
+         * to U3.29 at the end */
+        int64_t k1, k2, k3, k4, tmp;
+        uint64_t n, d, os, os_p, od, od_p, oreq;
+        unsigned rpa = 0;
+        int64_t ip64, delta;
+
+        if (dim_out % 3 == 0)
+                rpa = !(dim_in % (dim_out / 3));
+
+        n = ((uint64_t)dim_out) << 34;
+        d = dim_in;
+        if (!d)
+                return -1;
+        do_div(n, d);
+        k3 = (n + 1) >> 1;
+        if ((k3 >> 4) < (1LL << 27) || (k3 >> 4) > (1LL << 31)) {
+                DLOG("crap bad scale\n");
+                return -1;
+        }
+        n = ((uint64_t)dim_in) << 34;
+        d = (uint64_t)dim_out;
+        if (!d)
+                return -1;
+        do_div(n, d);
+        k1 = (n + 1) >> 1;
+        k2 = (k1 - ONE) >> 1;
+
+        *phase_init = (int)(k2 >> 4);
+        k4 = (k3 - ONE) >> 1;
+
+        if (rpa) {
+                os = ((uint64_t)origin << 33) - ONE_HALF;
+                tmp = (dim_out * os) + ONE_HALF;
+                if (!dim_in)
+                        return -1;
+                do_div(tmp, dim_in);
+                od = tmp - ONE_HALF;
+        } else {
+                os = ((uint64_t)origin << 1) - 1;
+                od = (((k3 * os) >> 1) + k4);
+        }
+
+        od_p = od & INT_MASK;
+        if (od_p != od)
+                od_p += ONE;
+
+        if (rpa) {
+                tmp = (dim_in * od_p) + ONE_HALF;
+                if (!dim_in)
+                        return -1;
+                do_div(tmp, dim_in);
+                os_p = tmp - ONE_HALF;
+        } else {
+                os_p = ((k1 * (od_p >> 33)) + k2);
+        }
+
+        oreq = (os_p & INT_MASK) - ONE;
+
+        ip64 = os_p - oreq;
+        delta = ((int64_t)(origin) << 33) - oreq;
+        ip64 -= delta;
+        /* limit to valid range before the left shift */
+        delta = (ip64 & (1LL << 63)) ? 4 : -4;
+        delta <<= 33;
+        while (abs((int)(ip64 >> 33)) > 4)
+                ip64 += delta;
+        *phase_init = (int)(ip64 >> 4);
+        *phase_step = (uint32_t)(k1 >> 4);
+        return 0;
+}
+
+static void load_scale_table(const struct mdp_info *mdp,
+                             struct mdp_table_entry *table, int len)
+{
+        int i;
+        for (i = 0; i < len; i++)
+                mdp_writel(mdp, table[i].val, table[i].reg);
+}
+
+enum {
+IMG_LEFT,
+IMG_RIGHT,
+IMG_TOP,
+IMG_BOTTOM,
+};
+
+static void get_edge_info(uint32_t src, uint32_t src_coord, uint32_t dst,
+                          uint32_t *interp1, uint32_t *interp2,
+                          uint32_t *repeat1, uint32_t *repeat2) {
+        if (src > 3 * dst) {
+                *interp1 = 0;
+                *interp2 = src - 1;
+                *repeat1 = 0;
+                *repeat2 = 0;
+        } else if (src == 3 * dst) {
+                *interp1 = 0;
+                *interp2 = src;
+                *repeat1 = 0;
+                *repeat2 = 1;
+        } else if (src > dst && src < 3 * dst) {
+                *interp1 = -1;
+                *interp2 = src;
+                *repeat1 = 1;
+                *repeat2 = 1;
+        } else if (src == dst) {
+                *interp1 = -1;
+                *interp2 = src + 1;
+                *repeat1 = 1;
+                *repeat2 = 2;
+        } else {
+                *interp1 = -2;
+                *interp2 = src + 1;
+                *repeat1 = 2;
+                *repeat2 = 2;
+        }
+        *interp1 += src_coord;
+        *interp2 += src_coord;
+}
+
+static int get_edge_cond(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+        int32_t luma_interp[4];
+        int32_t luma_repeat[4];
+        int32_t chroma_interp[4];
+        int32_t chroma_bound[4];
+        int32_t chroma_repeat[4];
+        uint32_t dst_w, dst_h;
+
+        memset(&luma_interp, 0, sizeof(int32_t) * 4);
+        memset(&luma_repeat, 0, sizeof(int32_t) * 4);
+        memset(&chroma_interp, 0, sizeof(int32_t) * 4);
+        memset(&chroma_bound, 0, sizeof(int32_t) * 4);
+        memset(&chroma_repeat, 0, sizeof(int32_t) * 4);
+        regs->edge = 0;
+
+        if (req->flags & MDP_ROT_90) {
+                dst_w = req->dst_rect.h;
+                dst_h = req->dst_rect.w;
+        } else {
+                dst_w = req->dst_rect.w;
+                dst_h = req->dst_rect.h;
+        }
+
+        if (regs->op & (PPP_OP_SCALE_Y_ON | PPP_OP_SCALE_X_ON)) {
+                get_edge_info(req->src_rect.h, req->src_rect.y, dst_h,
+                              &luma_interp[IMG_TOP], &luma_interp[IMG_BOTTOM],
+                              &luma_repeat[IMG_TOP], &luma_repeat[IMG_BOTTOM]);
+                get_edge_info(req->src_rect.w, req->src_rect.x, dst_w,
+                              &luma_interp[IMG_LEFT], &luma_interp[IMG_RIGHT],
+                              &luma_repeat[IMG_LEFT], &luma_repeat[IMG_RIGHT]);
+        } else {
+                luma_interp[IMG_LEFT] = req->src_rect.x;
+                luma_interp[IMG_RIGHT] = req->src_rect.x + req->src_rect.w - 1;
+                luma_interp[IMG_TOP] = req->src_rect.y;
+                luma_interp[IMG_BOTTOM] = req->src_rect.y + req->src_rect.h - 1;
+                luma_repeat[IMG_LEFT] = 0;
+                luma_repeat[IMG_TOP] = 0;
+                luma_repeat[IMG_RIGHT] = 0;
+                luma_repeat[IMG_BOTTOM] = 0;
+        }
+
+        chroma_interp[IMG_LEFT] = luma_interp[IMG_LEFT];
+        chroma_interp[IMG_RIGHT] = luma_interp[IMG_RIGHT];
+        chroma_interp[IMG_TOP] = luma_interp[IMG_TOP];
+        chroma_interp[IMG_BOTTOM] = luma_interp[IMG_BOTTOM];
+
+        chroma_bound[IMG_LEFT] = req->src_rect.x;
+        chroma_bound[IMG_RIGHT] = req->src_rect.x + req->src_rect.w - 1;
+        chroma_bound[IMG_TOP] = req->src_rect.y;
+        chroma_bound[IMG_BOTTOM] = req->src_rect.y + req->src_rect.h - 1;
+
+        if (IS_YCRCB(req->src.format)) {
+                chroma_interp[IMG_LEFT] = chroma_interp[IMG_LEFT] >> 1;
+                chroma_interp[IMG_RIGHT] = (chroma_interp[IMG_RIGHT] + 1) >> 1;
+
+                chroma_bound[IMG_LEFT] = chroma_bound[IMG_LEFT] >> 1;
+                chroma_bound[IMG_RIGHT] = chroma_bound[IMG_RIGHT] >> 1;
+        }
+
+        if (req->src.format == MDP_Y_CBCR_H2V2 ||
+            req->src.format == MDP_Y_CRCB_H2V2) {
+                chroma_interp[IMG_TOP] = (chroma_interp[IMG_TOP] - 1) >> 1;
+                chroma_interp[IMG_BOTTOM] = (chroma_interp[IMG_BOTTOM] + 1)
+                                            >> 1;
+                chroma_bound[IMG_TOP] = (chroma_bound[IMG_TOP] + 1) >> 1;
+                chroma_bound[IMG_BOTTOM] = chroma_bound[IMG_BOTTOM] >> 1;
+        }
+
+        chroma_repeat[IMG_LEFT] = chroma_bound[IMG_LEFT] -
+                                  chroma_interp[IMG_LEFT];
+        chroma_repeat[IMG_RIGHT] = chroma_interp[IMG_RIGHT] -
+                                  chroma_bound[IMG_RIGHT];
+        chroma_repeat[IMG_TOP] = chroma_bound[IMG_TOP] -
+                                  chroma_interp[IMG_TOP];
+        chroma_repeat[IMG_BOTTOM] = chroma_interp[IMG_BOTTOM] -
+                                  chroma_bound[IMG_BOTTOM];
+
+        if (chroma_repeat[IMG_LEFT] < 0 || chroma_repeat[IMG_LEFT] > 3 ||
+            chroma_repeat[IMG_RIGHT] < 0 || chroma_repeat[IMG_RIGHT] > 3 ||
+            chroma_repeat[IMG_TOP] < 0 || chroma_repeat[IMG_TOP] > 3 ||
+            chroma_repeat[IMG_BOTTOM] < 0 || chroma_repeat[IMG_BOTTOM] > 3 ||
+            luma_repeat[IMG_LEFT] < 0 || luma_repeat[IMG_LEFT] > 3 ||
+            luma_repeat[IMG_RIGHT] < 0 || luma_repeat[IMG_RIGHT] > 3 ||
+            luma_repeat[IMG_TOP] < 0 || luma_repeat[IMG_TOP] > 3 ||
+            luma_repeat[IMG_BOTTOM] < 0 || luma_repeat[IMG_BOTTOM] > 3)
+                return -1;
+
+        regs->edge |= (chroma_repeat[IMG_LEFT] & 3) << MDP_LEFT_CHROMA;
+        regs->edge |= (chroma_repeat[IMG_RIGHT] & 3) << MDP_RIGHT_CHROMA;
+        regs->edge |= (chroma_repeat[IMG_TOP] & 3) << MDP_TOP_CHROMA;
+        regs->edge |= (chroma_repeat[IMG_BOTTOM] & 3) << MDP_BOTTOM_CHROMA;
+        regs->edge |= (luma_repeat[IMG_LEFT] & 3) << MDP_LEFT_LUMA;
+        regs->edge |= (luma_repeat[IMG_RIGHT] & 3) << MDP_RIGHT_LUMA;
+        regs->edge |= (luma_repeat[IMG_TOP] & 3) << MDP_TOP_LUMA;
+        regs->edge |= (luma_repeat[IMG_BOTTOM] & 3) << MDP_BOTTOM_LUMA;
+        return 0;
+}
+
+static int blit_scale(const struct mdp_info *mdp, struct mdp_blit_req *req,
+                      struct mdp_regs *regs)
+{
+        uint32_t phase_init_x, phase_init_y, phase_step_x, phase_step_y;
+        uint32_t scale_factor_x, scale_factor_y;
+        uint32_t downscale;
+        uint32_t dst_w, dst_h;
+
+        if (req->flags & MDP_ROT_90) {
+                dst_w = req->dst_rect.h;
+                dst_h = req->dst_rect.w;
+        } else {
+                dst_w = req->dst_rect.w;
+                dst_h = req->dst_rect.h;
+        }
+        if ((req->src_rect.w == dst_w)  && (req->src_rect.h == dst_h) &&
+            !(req->flags & MDP_BLUR)) {
+                regs->phasex_init = 0;
+                regs->phasey_init = 0;
+                regs->phasex_step = 0;
+                regs->phasey_step = 0;
+                return 0;
+        }
+
+        if (scale_params(req->src_rect.w, dst_w, 1, &phase_init_x,
+                         &phase_step_x) ||
+            scale_params(req->src_rect.h, dst_h, 1, &phase_init_y,
+                         &phase_step_y))
+                return -1;
+
+        scale_factor_x = (dst_w * 10) / req->src_rect.w;
+        scale_factor_y = (dst_h * 10) / req->src_rect.h;
+
+        if (scale_factor_x > 8)
+                downscale = MDP_DOWNSCALE_PT8TO1;
+        else if (scale_factor_x > 6)
+                downscale = MDP_DOWNSCALE_PT6TOPT8;
+        else if (scale_factor_x > 4)
+                downscale = MDP_DOWNSCALE_PT4TOPT6;
+        else
+                downscale = MDP_DOWNSCALE_PT2TOPT4;
+        if (downscale != downscale_x_table) {
+                load_scale_table(mdp, mdp_downscale_x_table[downscale], 64);
+                downscale_x_table = downscale;
+        }
+
+        if (scale_factor_y > 8)
+                downscale = MDP_DOWNSCALE_PT8TO1;
+        else if (scale_factor_y > 6)
+                downscale = MDP_DOWNSCALE_PT6TOPT8;
+        else if (scale_factor_y > 4)
+                downscale = MDP_DOWNSCALE_PT4TOPT6;
+        else
+                downscale = MDP_DOWNSCALE_PT2TOPT4;
+        if (downscale != downscale_y_table) {
+                load_scale_table(mdp, mdp_downscale_y_table[downscale], 64);
+                downscale_y_table = downscale;
+        }
+
+        regs->phasex_init = phase_init_x;
+        regs->phasey_init = phase_init_y;
+        regs->phasex_step = phase_step_x;
+        regs->phasey_step = phase_step_y;
+        regs->op |= (PPP_OP_SCALE_Y_ON | PPP_OP_SCALE_X_ON);
+        return 0;
+
+}
+
+static void blit_blur(const struct mdp_info *mdp, struct mdp_blit_req *req,
+                      struct mdp_regs *regs)
+{
+        if (!(req->flags & MDP_BLUR))
+                return;
+
+        if (!(downscale_x_table == MDP_DOWNSCALE_BLUR &&
+              downscale_y_table == MDP_DOWNSCALE_BLUR)) {
+                load_scale_table(mdp, mdp_gaussian_blur_table, 128);
+                downscale_x_table = MDP_DOWNSCALE_BLUR;
+                downscale_y_table = MDP_DOWNSCALE_BLUR;
+        }
+
+        regs->op |= (PPP_OP_SCALE_Y_ON | PPP_OP_SCALE_X_ON);
+}
+
+
+#define IMG_LEN(rect_h, w, rect_w, bpp) (((rect_h) * w) * bpp)
+
+#define Y_TO_CRCB_RATIO(format) \
+        ((format == MDP_Y_CBCR_H2V2 || format == MDP_Y_CRCB_H2V2) ?  2 :\
+         (format == MDP_Y_CBCR_H2V1 || format == MDP_Y_CRCB_H2V1) ?  1 : 1)
+
+static void get_len(struct mdp_img *img, struct mdp_rect *rect, uint32_t bpp,
+                    uint32_t *len0, uint32_t *len1)
+{
+        *len0 = IMG_LEN(rect->h, img->width, rect->w, bpp);
+        if (IS_PSEUDOPLNR(img->format))
+                *len1 = *len0/Y_TO_CRCB_RATIO(img->format);
+        else
+                *len1 = 0;
+}
+
+static int valid_src_dst(unsigned long src_start, unsigned long src_len,
+                         unsigned long dst_start, unsigned long dst_len,
+                         struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+        unsigned long src_min_ok = src_start;
+        unsigned long src_max_ok = src_start + src_len;
+        unsigned long dst_min_ok = dst_start;
+        unsigned long dst_max_ok = dst_start + dst_len;
+        uint32_t src0_len, src1_len, dst0_len, dst1_len;
+        get_len(&req->src, &req->src_rect, regs->src_bpp, &src0_len,
+                 &src1_len);
+        get_len(&req->dst, &req->dst_rect, regs->dst_bpp, &dst0_len,
+                 &dst1_len);
+
+        if (regs->src0 < src_min_ok || regs->src0 > src_max_ok ||
+            regs->src0 + src0_len > src_max_ok) {
+                DLOG("invalid_src %x %x %lx %lx\n", regs->src0,
+                      src0_len, src_min_ok, src_max_ok);
+                return 0;
+        }
+        if (regs->src_cfg & PPP_SRC_PLANE_PSEUDOPLNR) {
+                if (regs->src1 < src_min_ok || regs->src1 > src_max_ok ||
+                    regs->src1 + src1_len > src_max_ok) {
+                        DLOG("invalid_src1");
+                        return 0;
+                }
+        }
+        if (regs->dst0 < dst_min_ok || regs->dst0 > dst_max_ok ||
+            regs->dst0 + dst0_len > dst_max_ok) {
+                DLOG("invalid_dst");
+                return 0;
+        }
+        if (regs->dst_cfg & PPP_SRC_PLANE_PSEUDOPLNR) {
+                if (regs->dst1 < dst_min_ok || regs->dst1 > dst_max_ok ||
+                    regs->dst1 + dst1_len > dst_max_ok) {
+                        DLOG("invalid_dst1");
+                        return 0;
+                }
+        }
+        return 1;
+}
+
+
+static void flush_imgs(struct mdp_blit_req *req, struct mdp_regs *regs,
+                       struct file *src_file, struct file *dst_file)
+{
+#ifdef CONFIG_ANDROID_PMEM
+        uint32_t src0_len, src1_len, dst0_len, dst1_len;
+
+        /* flush src images to memory before dma to mdp */
+        get_len(&req->src, &req->src_rect, regs->src_bpp, &src0_len,
+                &src1_len);
+        flush_pmem_file(src_file, req->src.offset, src0_len);
+        if (IS_PSEUDOPLNR(req->src.format))
+                flush_pmem_file(src_file, req->src.offset + src0_len,
+                                src1_len);
+
+        /* flush dst images */
+        get_len(&req->dst, &req->dst_rect, regs->dst_bpp, &dst0_len,
+                &dst1_len);
+        flush_pmem_file(dst_file, req->dst.offset, dst0_len);
+        if (IS_PSEUDOPLNR(req->dst.format))
+                flush_pmem_file(dst_file, req->dst.offset + dst0_len,
+                                dst1_len);
+#endif
+}
+
+static void get_chroma_addr(struct mdp_img *img, struct mdp_rect *rect,
+                            uint32_t base, uint32_t bpp, uint32_t cfg,
+                            uint32_t *addr, uint32_t *ystride)
+{
+        uint32_t compress_v = Y_TO_CRCB_RATIO(img->format);
+        uint32_t compress_h = 2;
+        uint32_t  offset;
+
+        if (IS_PSEUDOPLNR(img->format)) {
+                offset = (rect->x / compress_h) * compress_h;
+                offset += rect->y == 0 ? 0 :
+                          ((rect->y + 1) / compress_v) * img->width;
+                *addr = base + (img->width * img->height * bpp);
+                *addr += offset * bpp;
+                *ystride |= *ystride << 16;
+        } else {
+                *addr = 0;
+        }
+}
+
+static int send_blit(const struct mdp_info *mdp, struct mdp_blit_req *req,
+                     struct mdp_regs *regs, struct file *src_file,
+                     struct file *dst_file)
+{
+        mdp_writel(mdp, 1, 0x060);
+        mdp_writel(mdp, regs->src_rect, PPP_ADDR_SRC_ROI);
+        mdp_writel(mdp, regs->src0, PPP_ADDR_SRC0);
+        mdp_writel(mdp, regs->src1, PPP_ADDR_SRC1);
+        mdp_writel(mdp, regs->src_ystride, PPP_ADDR_SRC_YSTRIDE);
+        mdp_writel(mdp, regs->src_cfg, PPP_ADDR_SRC_CFG);
+        mdp_writel(mdp, regs->src_pack, PPP_ADDR_SRC_PACK_PATTERN);
+
+        mdp_writel(mdp, regs->op, PPP_ADDR_OPERATION);
+        mdp_writel(mdp, regs->phasex_init, PPP_ADDR_PHASEX_INIT);
+        mdp_writel(mdp, regs->phasey_init, PPP_ADDR_PHASEY_INIT);
+        mdp_writel(mdp, regs->phasex_step, PPP_ADDR_PHASEX_STEP);
+        mdp_writel(mdp, regs->phasey_step, PPP_ADDR_PHASEY_STEP);
+
+        mdp_writel(mdp, (req->alpha << 24) | (req->transp_mask & 0xffffff),
+               PPP_ADDR_ALPHA_TRANSP);
+
+        mdp_writel(mdp, regs->dst_cfg, PPP_ADDR_DST_CFG);
+        mdp_writel(mdp, regs->dst_pack, PPP_ADDR_DST_PACK_PATTERN);
+        mdp_writel(mdp, regs->dst_rect, PPP_ADDR_DST_ROI);
+        mdp_writel(mdp, regs->dst0, PPP_ADDR_DST0);
+        mdp_writel(mdp, regs->dst1, PPP_ADDR_DST1);
+        mdp_writel(mdp, regs->dst_ystride, PPP_ADDR_DST_YSTRIDE);
+
+        mdp_writel(mdp, regs->edge, PPP_ADDR_EDGE);
+        if (regs->op & PPP_OP_BLEND_ON) {
+                mdp_writel(mdp, regs->dst0, PPP_ADDR_BG0);
+                mdp_writel(mdp, regs->dst1, PPP_ADDR_BG1);
+                mdp_writel(mdp, regs->dst_ystride, PPP_ADDR_BG_YSTRIDE);
+                mdp_writel(mdp, src_img_cfg[req->dst.format], PPP_ADDR_BG_CFG);
+                mdp_writel(mdp, pack_pattern[req->dst.format],
+                           PPP_ADDR_BG_PACK_PATTERN);
+        }
+        flush_imgs(req, regs, src_file, dst_file);
+        mdp_writel(mdp, 0x1000, MDP_DISPLAY0_START);
+        return 0;
+}
+
+int mdp_ppp_blit(const struct mdp_info *mdp, struct mdp_blit_req *req,
+                 struct file *src_file, unsigned long src_start, unsigned long src_len,
+                 struct file *dst_file, unsigned long dst_start, unsigned long dst_len)
+{
+        struct mdp_regs regs = {0};
+
+        if (unlikely(req->src.format >= MDP_IMGTYPE_LIMIT ||
+                     req->dst.format >= MDP_IMGTYPE_LIMIT)) {
+                printk(KERN_ERR "mpd_ppp: img is of wrong format\n");
+                return -EINVAL;
+        }
+
+        if (unlikely(req->src_rect.x > req->src.width ||
+                     req->src_rect.y > req->src.height ||
+                     req->dst_rect.x > req->dst.width ||
+                     req->dst_rect.y > req->dst.height)) {
+                printk(KERN_ERR "mpd_ppp: img rect is outside of img!\n");
+                return -EINVAL;
+        }
+
+        /* set the src image configuration */
+        regs.src_cfg = src_img_cfg[req->src.format];
+        regs.src_cfg |= (req->src_rect.x & 0x1) ? PPP_SRC_BPP_ROI_ODD_X : 0;
+        regs.src_cfg |= (req->src_rect.y & 0x1) ? PPP_SRC_BPP_ROI_ODD_Y : 0;
+        regs.src_rect = (req->src_rect.h << 16) | req->src_rect.w;
+        regs.src_pack = pack_pattern[req->src.format];
+
+        /* set the dest image configuration */
+        regs.dst_cfg = dst_img_cfg[req->dst.format] | PPP_DST_OUT_SEL_AXI;
+        regs.dst_rect = (req->dst_rect.h << 16) | req->dst_rect.w;
+        regs.dst_pack = pack_pattern[req->dst.format];
+
+        /* set src, bpp, start pixel and ystride */
+        regs.src_bpp = bytes_per_pixel[req->src.format];
+        regs.src0 = src_start + req->src.offset;
+        regs.src_ystride = req->src.width * regs.src_bpp;
+        get_chroma_addr(&req->src, &req->src_rect, regs.src0, regs.src_bpp,
+                        regs.src_cfg, &regs.src1, &regs.src_ystride);
+        regs.src0 += (req->src_rect.x + (req->src_rect.y * req->src.width)) *
+                      regs.src_bpp;
+
+        /* set dst, bpp, start pixel and ystride */
+        regs.dst_bpp = bytes_per_pixel[req->dst.format];
+        regs.dst0 = dst_start + req->dst.offset;
+        regs.dst_ystride = req->dst.width * regs.dst_bpp;
+        get_chroma_addr(&req->dst, &req->dst_rect, regs.dst0, regs.dst_bpp,
+                        regs.dst_cfg, &regs.dst1, &regs.dst_ystride);
+        regs.dst0 += (req->dst_rect.x + (req->dst_rect.y * req->dst.width)) *
+                      regs.dst_bpp;
+
+        if (!valid_src_dst(src_start, src_len, dst_start, dst_len, req,
+                           &regs)) {
+                printk(KERN_ERR "mpd_ppp: final src or dst location is "
+                        "invalid, are you trying to make an image too large "
+                        "or to place it outside the screen?\n");
+                return -EINVAL;
+        }
+
+        /* set up operation register */
+        regs.op = 0;
+        blit_rotate(req, &regs);
+        blit_convert(req, &regs);
+        if (req->flags & MDP_DITHER)
+                regs.op |= PPP_OP_DITHER_EN;
+        blit_blend(req, &regs);
+        if (blit_scale(mdp, req, &regs)) {
+                printk(KERN_ERR "mpd_ppp: error computing scale for img.\n");
+                return -EINVAL;
+        }
+        blit_blur(mdp, req, &regs);
+        regs.op |= dst_op_chroma[req->dst.format] |
+                   src_op_chroma[req->src.format];
+
+        /* if the image is YCRYCB, the x and w must be even */
+        if (unlikely(req->src.format == MDP_YCRYCB_H2V1)) {
+                req->src_rect.x = req->src_rect.x & (~0x1);
+                req->src_rect.w = req->src_rect.w & (~0x1);
+                req->dst_rect.x = req->dst_rect.x & (~0x1);
+                req->dst_rect.w = req->dst_rect.w & (~0x1);
+        }
+        if (get_edge_cond(req, &regs))
+                return -EINVAL;
+
+        send_blit(mdp, req, &regs, src_file, dst_file);
+        return 0;
+}
diff --git a/drivers/video/msm/mdp_scale_tables.c b/drivers/video/msm/mdp_scale_tables.c
new file mode 100644
index 000000000000..604783b2e17c
--- /dev/null
+++ b/drivers/video/msm/mdp_scale_tables.c
@@ -0,0 +1,766 @@
+/* drivers/video/msm_fb/mdp_scale_tables.c
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+#include "mdp_scale_tables.h"
+#include "mdp_hw.h"
+
+struct mdp_table_entry mdp_upscale_table[] = {
+        { 0x5fffc, 0x0 },
+        { 0x50200, 0x7fc00000 },
+        { 0x5fffc, 0xff80000d },
+        { 0x50204, 0x7ec003f9 },
+        { 0x5fffc, 0xfec0001c },
+        { 0x50208, 0x7d4003f3 },
+        { 0x5fffc, 0xfe40002b },
+        { 0x5020c, 0x7b8003ed },
+        { 0x5fffc, 0xfd80003c },
+        { 0x50210, 0x794003e8 },
+        { 0x5fffc, 0xfcc0004d },
+        { 0x50214, 0x76c003e4 },
+        { 0x5fffc, 0xfc40005f },
+        { 0x50218, 0x73c003e0 },
+        { 0x5fffc, 0xfb800071 },
+        { 0x5021c, 0x708003de },
+        { 0x5fffc, 0xfac00085 },
+        { 0x50220, 0x6d0003db },
+        { 0x5fffc, 0xfa000098 },
+        { 0x50224, 0x698003d9 },
+        { 0x5fffc, 0xf98000ac },
+        { 0x50228, 0x654003d8 },
+        { 0x5fffc, 0xf8c000c1 },
+        { 0x5022c, 0x610003d7 },
+        { 0x5fffc, 0xf84000d5 },
+        { 0x50230, 0x5c8003d7 },
+        { 0x5fffc, 0xf7c000e9 },
+        { 0x50234, 0x580003d7 },
+        { 0x5fffc, 0xf74000fd },
+        { 0x50238, 0x534003d8 },
+        { 0x5fffc, 0xf6c00112 },
+        { 0x5023c, 0x4e8003d8 },
+        { 0x5fffc, 0xf6800126 },
+        { 0x50240, 0x494003da },
+        { 0x5fffc, 0xf600013a },
+        { 0x50244, 0x448003db },
+        { 0x5fffc, 0xf600014d },
+        { 0x50248, 0x3f4003dd },
+        { 0x5fffc, 0xf5c00160 },
+        { 0x5024c, 0x3a4003df },
+        { 0x5fffc, 0xf5c00172 },
+        { 0x50250, 0x354003e1 },
+        { 0x5fffc, 0xf5c00184 },
+        { 0x50254, 0x304003e3 },
+        { 0x5fffc, 0xf6000195 },
+        { 0x50258, 0x2b0003e6 },
+        { 0x5fffc, 0xf64001a6 },
+        { 0x5025c, 0x260003e8 },
+        { 0x5fffc, 0xf6c001b4 },
+        { 0x50260, 0x214003eb },
+        { 0x5fffc, 0xf78001c2 },
+        { 0x50264, 0x1c4003ee },
+        { 0x5fffc, 0xf80001cf },
+        { 0x50268, 0x17c003f1 },
+        { 0x5fffc, 0xf90001db },
+        { 0x5026c, 0x134003f3 },
+        { 0x5fffc, 0xfa0001e5 },
+        { 0x50270, 0xf0003f6 },
+        { 0x5fffc, 0xfb4001ee },
+        { 0x50274, 0xac003f9 },
+        { 0x5fffc, 0xfcc001f5 },
+        { 0x50278, 0x70003fb },
+        { 0x5fffc, 0xfe4001fb },
+        { 0x5027c, 0x34003fe },
+};
+
+static struct mdp_table_entry mdp_downscale_x_table_PT2TOPT4[] = {
+        { 0x5fffc, 0x740008c },
+        { 0x50280, 0x33800088 },
+        { 0x5fffc, 0x800008e },
+        { 0x50284, 0x33400084 },
+        { 0x5fffc, 0x8400092 },
+        { 0x50288, 0x33000080 },
+        { 0x5fffc, 0x9000094 },
+        { 0x5028c, 0x3300007b },
+        { 0x5fffc, 0x9c00098 },
+        { 0x50290, 0x32400077 },
+        { 0x5fffc, 0xa40009b },
+        { 0x50294, 0x32000073 },
+        { 0x5fffc, 0xb00009d },
+        { 0x50298,  0x31c0006f },
+        { 0x5fffc,  0xbc000a0 },
+        { 0x5029c,  0x3140006b },
+        { 0x5fffc,  0xc8000a2 },
+        { 0x502a0,  0x31000067 },
+        { 0x5fffc,  0xd8000a5 },
+        { 0x502a4,  0x30800062 },
+        { 0x5fffc,  0xe4000a8 },
+        { 0x502a8,  0x2fc0005f },
+        { 0x5fffc,  0xec000aa },
+        { 0x502ac,  0x2fc0005b },
+        { 0x5fffc,  0xf8000ad },
+        { 0x502b0,  0x2f400057 },
+        { 0x5fffc,  0x108000b0 },
+        { 0x502b4,  0x2e400054 },
+        { 0x5fffc,  0x114000b2 },
+        { 0x502b8,  0x2e000050 },
+        { 0x5fffc,  0x124000b4 },
+        { 0x502bc,  0x2d80004c },
+        { 0x5fffc,  0x130000b6 },
+        { 0x502c0,  0x2d000049 },
+        { 0x5fffc,  0x140000b8 },
+        { 0x502c4,  0x2c800045 },
+        { 0x5fffc,  0x150000b9 },
+        { 0x502c8,  0x2c000042 },
+        { 0x5fffc,  0x15c000bd },
+        { 0x502cc,  0x2b40003e },
+        { 0x5fffc,  0x16c000bf },
+        { 0x502d0,  0x2a80003b },
+        { 0x5fffc,  0x17c000bf },
+        { 0x502d4,  0x2a000039 },
+        { 0x5fffc,  0x188000c2 },
+        { 0x502d8,  0x29400036 },
+        { 0x5fffc,  0x19c000c4 },
+        { 0x502dc,  0x28800032 },
+        { 0x5fffc,  0x1ac000c5 },
+        { 0x502e0,  0x2800002f },
+        { 0x5fffc,  0x1bc000c7 },
+        { 0x502e4,  0x2740002c },
+        { 0x5fffc,  0x1cc000c8 },
+        { 0x502e8,  0x26c00029 },
+        { 0x5fffc,  0x1dc000c9 },
+        { 0x502ec,  0x26000027 },
+        { 0x5fffc,  0x1ec000cc },
+        { 0x502f0,  0x25000024 },
+        { 0x5fffc,  0x200000cc },
+        { 0x502f4,  0x24800021 },
+        { 0x5fffc,  0x210000cd },
+        { 0x502f8,  0x23800020 },
+        { 0x5fffc,  0x220000ce },
+        { 0x502fc,  0x2300001d },
+};
+
+static struct mdp_table_entry mdp_downscale_x_table_PT4TOPT6[] = {
+        { 0x5fffc,  0x740008c },
+        { 0x50280,  0x33800088 },
+        { 0x5fffc,  0x800008e },
+        { 0x50284,  0x33400084 },
+        { 0x5fffc,  0x8400092 },
+        { 0x50288,  0x33000080 },
+        { 0x5fffc,  0x9000094 },
+        { 0x5028c,  0x3300007b },
+        { 0x5fffc,  0x9c00098 },
+        { 0x50290,  0x32400077 },
+        { 0x5fffc,  0xa40009b },
+        { 0x50294,  0x32000073 },
+        { 0x5fffc,  0xb00009d },
+        { 0x50298,  0x31c0006f },
+        { 0x5fffc,  0xbc000a0 },
+        { 0x5029c,  0x3140006b },
+        { 0x5fffc,  0xc8000a2 },
+        { 0x502a0,  0x31000067 },
+        { 0x5fffc,  0xd8000a5 },
+        { 0x502a4,  0x30800062 },
+        { 0x5fffc,  0xe4000a8 },
+        { 0x502a8,  0x2fc0005f },
+        { 0x5fffc,  0xec000aa },
+        { 0x502ac,  0x2fc0005b },
+        { 0x5fffc,  0xf8000ad },
+        { 0x502b0,  0x2f400057 },
+        { 0x5fffc,  0x108000b0 },
+        { 0x502b4,  0x2e400054 },
+        { 0x5fffc,  0x114000b2 },
+        { 0x502b8,  0x2e000050 },
+        { 0x5fffc,  0x124000b4 },
+        { 0x502bc,  0x2d80004c },
+        { 0x5fffc,  0x130000b6 },
+        { 0x502c0,  0x2d000049 },
+        { 0x5fffc,  0x140000b8 },
+        { 0x502c4,  0x2c800045 },
+        { 0x5fffc,  0x150000b9 },
+        { 0x502c8,  0x2c000042 },
+        { 0x5fffc,  0x15c000bd },
+        { 0x502cc,  0x2b40003e },
+        { 0x5fffc,  0x16c000bf },
+        { 0x502d0,  0x2a80003b },
+        { 0x5fffc,  0x17c000bf },
+        { 0x502d4,  0x2a000039 },
+        { 0x5fffc,  0x188000c2 },
+        { 0x502d8,  0x29400036 },
+        { 0x5fffc,  0x19c000c4 },
+        { 0x502dc,  0x28800032 },
+        { 0x5fffc,  0x1ac000c5 },
+        { 0x502e0,  0x2800002f },
+        { 0x5fffc,  0x1bc000c7 },
+        { 0x502e4,  0x2740002c },
+        { 0x5fffc,  0x1cc000c8 },
+        { 0x502e8,  0x26c00029 },
+        { 0x5fffc,  0x1dc000c9 },
+        { 0x502ec,  0x26000027 },
+        { 0x5fffc,  0x1ec000cc },
+        { 0x502f0,  0x25000024 },
+        { 0x5fffc,  0x200000cc },
+        { 0x502f4,  0x24800021 },
+        { 0x5fffc,  0x210000cd },
+        { 0x502f8,  0x23800020 },
+        { 0x5fffc,  0x220000ce },
+        { 0x502fc,  0x2300001d },
+};
+
+static struct mdp_table_entry mdp_downscale_x_table_PT6TOPT8[] = {
+        { 0x5fffc,  0xfe000070 },
+        { 0x50280,  0x4bc00068 },
+        { 0x5fffc,  0xfe000078 },
+        { 0x50284,  0x4bc00060 },
+        { 0x5fffc,  0xfe000080 },
+        { 0x50288,  0x4b800059 },
+        { 0x5fffc,  0xfe000089 },
+        { 0x5028c,  0x4b000052 },
+        { 0x5fffc,  0xfe400091 },
+        { 0x50290,  0x4a80004b },
+        { 0x5fffc,  0xfe40009a },
+        { 0x50294,  0x4a000044 },
+        { 0x5fffc,  0xfe8000a3 },
+        { 0x50298,  0x4940003d },
+        { 0x5fffc,  0xfec000ac },
+        { 0x5029c,  0x48400037 },
+        { 0x5fffc,  0xff0000b4 },
+        { 0x502a0,  0x47800031 },
+        { 0x5fffc,  0xff8000bd },
+        { 0x502a4,  0x4640002b },
+        { 0x5fffc,  0xc5 },
+        { 0x502a8,  0x45000026 },
+        { 0x5fffc,  0x8000ce },
+        { 0x502ac,  0x43800021 },
+        { 0x5fffc,  0x10000d6 },
+        { 0x502b0,  0x4240001c },
+        { 0x5fffc,  0x18000df },
+        { 0x502b4,  0x40800018 },
+        { 0x5fffc,  0x24000e6 },
+        { 0x502b8,  0x3f000014 },
+        { 0x5fffc,  0x30000ee },
+        { 0x502bc,  0x3d400010 },
+        { 0x5fffc,  0x40000f5 },
+        { 0x502c0,  0x3b80000c },
+        { 0x5fffc,  0x50000fc },
+        { 0x502c4,  0x39800009 },
+        { 0x5fffc,  0x6000102 },
+        { 0x502c8,  0x37c00006 },
+        { 0x5fffc,  0x7000109 },
+        { 0x502cc,  0x35800004 },
+        { 0x5fffc,  0x840010e },
+        { 0x502d0,  0x33800002 },
+        { 0x5fffc,  0x9800114 },
+        { 0x502d4,  0x31400000 },
+        { 0x5fffc,  0xac00119 },
+        { 0x502d8,  0x2f4003fe },
+        { 0x5fffc,  0xc40011e },
+        { 0x502dc,  0x2d0003fc },
+        { 0x5fffc,  0xdc00121 },
+        { 0x502e0,  0x2b0003fb },
+        { 0x5fffc,  0xf400125 },
+        { 0x502e4,  0x28c003fa },
+        { 0x5fffc,  0x11000128 },
+        { 0x502e8,  0x268003f9 },
+        { 0x5fffc,  0x12c0012a },
+        { 0x502ec,  0x244003f9 },
+        { 0x5fffc,  0x1480012c },
+        { 0x502f0,  0x224003f8 },
+        { 0x5fffc,  0x1640012e },
+        { 0x502f4,  0x200003f8 },
+        { 0x5fffc,  0x1800012f },
+        { 0x502f8,  0x1e0003f8 },
+        { 0x5fffc,  0x1a00012f },
+        { 0x502fc,  0x1c0003f8 },
+};
+
+static struct mdp_table_entry mdp_downscale_x_table_PT8TO1[] = {
+        { 0x5fffc,  0x0 },
+        { 0x50280,  0x7fc00000 },
+        { 0x5fffc,  0xff80000d },
+        { 0x50284,  0x7ec003f9 },
+        { 0x5fffc,  0xfec0001c },
+        { 0x50288,  0x7d4003f3 },
+        { 0x5fffc,  0xfe40002b },
+        { 0x5028c,  0x7b8003ed },
+        { 0x5fffc,  0xfd80003c },
+        { 0x50290,  0x794003e8 },
+        { 0x5fffc,  0xfcc0004d },
+        { 0x50294,  0x76c003e4 },
+        { 0x5fffc,  0xfc40005f },
+        { 0x50298,  0x73c003e0 },
+        { 0x5fffc,  0xfb800071 },
+        { 0x5029c,  0x708003de },
+        { 0x5fffc,  0xfac00085 },
+        { 0x502a0,  0x6d0003db },
+        { 0x5fffc,  0xfa000098 },
+        { 0x502a4,  0x698003d9 },
+        { 0x5fffc,  0xf98000ac },
+        { 0x502a8,  0x654003d8 },
+        { 0x5fffc,  0xf8c000c1 },
+        { 0x502ac,  0x610003d7 },
+        { 0x5fffc,  0xf84000d5 },
+        { 0x502b0,  0x5c8003d7 },
+        { 0x5fffc,  0xf7c000e9 },
+        { 0x502b4,  0x580003d7 },
+        { 0x5fffc,  0xf74000fd },
+        { 0x502b8,  0x534003d8 },
+        { 0x5fffc,  0xf6c00112 },
+        { 0x502bc,  0x4e8003d8 },
+        { 0x5fffc,  0xf6800126 },
+        { 0x502c0,  0x494003da },
+        { 0x5fffc,  0xf600013a },
+        { 0x502c4,  0x448003db },
+        { 0x5fffc,  0xf600014d },
+        { 0x502c8,  0x3f4003dd },
+        { 0x5fffc,  0xf5c00160 },
+        { 0x502cc,  0x3a4003df },
+        { 0x5fffc,  0xf5c00172 },
+        { 0x502d0,  0x354003e1 },
+        { 0x5fffc,  0xf5c00184 },
+        { 0x502d4,  0x304003e3 },
+        { 0x5fffc,  0xf6000195 },
+        { 0x502d8,  0x2b0003e6 },
+        { 0x5fffc,  0xf64001a6 },
+        { 0x502dc,  0x260003e8 },
+        { 0x5fffc,  0xf6c001b4 },
+        { 0x502e0,  0x214003eb },
+        { 0x5fffc,  0xf78001c2 },
+        { 0x502e4,  0x1c4003ee },
+        { 0x5fffc,  0xf80001cf },
+        { 0x502e8,  0x17c003f1 },
+        { 0x5fffc,  0xf90001db },
+        { 0x502ec,  0x134003f3 },
+        { 0x5fffc,  0xfa0001e5 },
+        { 0x502f0,  0xf0003f6 },
+        { 0x5fffc,  0xfb4001ee },
+        { 0x502f4,  0xac003f9 },
+        { 0x5fffc,  0xfcc001f5 },
+        { 0x502f8,  0x70003fb },
+        { 0x5fffc,  0xfe4001fb },
+        { 0x502fc,  0x34003fe },
+};
+
+struct mdp_table_entry *mdp_downscale_x_table[MDP_DOWNSCALE_MAX] = {
+        [MDP_DOWNSCALE_PT2TOPT4] = mdp_downscale_x_table_PT2TOPT4,
+        [MDP_DOWNSCALE_PT4TOPT6] = mdp_downscale_x_table_PT4TOPT6,
+        [MDP_DOWNSCALE_PT6TOPT8] = mdp_downscale_x_table_PT6TOPT8,
+        [MDP_DOWNSCALE_PT8TO1]  = mdp_downscale_x_table_PT8TO1,
+};
+
+static struct mdp_table_entry mdp_downscale_y_table_PT2TOPT4[] = {
+        { 0x5fffc,  0x740008c },
+        { 0x50300,  0x33800088 },
+        { 0x5fffc,  0x800008e },
+        { 0x50304,  0x33400084 },
+        { 0x5fffc,  0x8400092 },
+        { 0x50308,  0x33000080 },
+        { 0x5fffc,  0x9000094 },
+        { 0x5030c,  0x3300007b },
+        { 0x5fffc,  0x9c00098 },
+        { 0x50310,  0x32400077 },
+        { 0x5fffc,  0xa40009b },
+        { 0x50314,  0x32000073 },
+        { 0x5fffc,  0xb00009d },
+        { 0x50318,  0x31c0006f },
+        { 0x5fffc,  0xbc000a0 },
+        { 0x5031c,  0x3140006b },
+        { 0x5fffc,  0xc8000a2 },
+        { 0x50320,  0x31000067 },
+        { 0x5fffc,  0xd8000a5 },
+        { 0x50324,  0x30800062 },
+        { 0x5fffc,  0xe4000a8 },
+        { 0x50328,  0x2fc0005f },
+        { 0x5fffc,  0xec000aa },
+        { 0x5032c,  0x2fc0005b },
+        { 0x5fffc,  0xf8000ad },
+        { 0x50330,  0x2f400057 },
+        { 0x5fffc,  0x108000b0 },
+        { 0x50334,  0x2e400054 },
+        { 0x5fffc,  0x114000b2 },
+        { 0x50338,  0x2e000050 },
+        { 0x5fffc,  0x124000b4 },
+        { 0x5033c,  0x2d80004c },
+        { 0x5fffc,  0x130000b6 },
+        { 0x50340,  0x2d000049 },
+        { 0x5fffc,  0x140000b8 },
+        { 0x50344,  0x2c800045 },
+        { 0x5fffc,  0x150000b9 },
+        { 0x50348,  0x2c000042 },
+        { 0x5fffc,  0x15c000bd },
+        { 0x5034c,  0x2b40003e },
+        { 0x5fffc,  0x16c000bf },
+        { 0x50350,  0x2a80003b },
+        { 0x5fffc,  0x17c000bf },
+        { 0x50354,  0x2a000039 },
+        { 0x5fffc,  0x188000c2 },
+        { 0x50358,  0x29400036 },
+        { 0x5fffc,  0x19c000c4 },
+        { 0x5035c,  0x28800032 },
+        { 0x5fffc,  0x1ac000c5 },
+        { 0x50360,  0x2800002f },
+        { 0x5fffc,  0x1bc000c7 },
+        { 0x50364,  0x2740002c },
+        { 0x5fffc,  0x1cc000c8 },
+        { 0x50368,  0x26c00029 },
+        { 0x5fffc,  0x1dc000c9 },
+        { 0x5036c,  0x26000027 },
+        { 0x5fffc,  0x1ec000cc },
+        { 0x50370,  0x25000024 },
+        { 0x5fffc,  0x200000cc },
+        { 0x50374,  0x24800021 },
+        { 0x5fffc,  0x210000cd },
+        { 0x50378,  0x23800020 },
+        { 0x5fffc,  0x220000ce },
+        { 0x5037c,  0x2300001d },
+};
+
+static struct mdp_table_entry mdp_downscale_y_table_PT4TOPT6[] = {
+        { 0x5fffc,  0x740008c },
+        { 0x50300,  0x33800088 },
+        { 0x5fffc,  0x800008e },
+        { 0x50304,  0x33400084 },
+        { 0x5fffc,  0x8400092 },
+        { 0x50308,  0x33000080 },
+        { 0x5fffc,  0x9000094 },
+        { 0x5030c,  0x3300007b },
+        { 0x5fffc,  0x9c00098 },
+        { 0x50310,  0x32400077 },
+        { 0x5fffc,  0xa40009b },
+        { 0x50314,  0x32000073 },
+        { 0x5fffc,  0xb00009d },
+        { 0x50318,  0x31c0006f },
+        { 0x5fffc,  0xbc000a0 },
+        { 0x5031c,  0x3140006b },
+        { 0x5fffc,  0xc8000a2 },
+        { 0x50320,  0x31000067 },
+        { 0x5fffc,  0xd8000a5 },
+        { 0x50324,  0x30800062 },
+        { 0x5fffc,  0xe4000a8 },
+        { 0x50328,  0x2fc0005f },
+        { 0x5fffc,  0xec000aa },
+        { 0x5032c,  0x2fc0005b },
+        { 0x5fffc,  0xf8000ad },
+        { 0x50330,  0x2f400057 },
+        { 0x5fffc,  0x108000b0 },
+        { 0x50334,  0x2e400054 },
+        { 0x5fffc,  0x114000b2 },
+        { 0x50338,  0x2e000050 },
+        { 0x5fffc,  0x124000b4 },
+        { 0x5033c,  0x2d80004c },
+        { 0x5fffc,  0x130000b6 },
+        { 0x50340,  0x2d000049 },
+        { 0x5fffc,  0x140000b8 },
+        { 0x50344,  0x2c800045 },
+        { 0x5fffc,  0x150000b9 },
+        { 0x50348,  0x2c000042 },
+        { 0x5fffc,  0x15c000bd },
+        { 0x5034c,  0x2b40003e },
+        { 0x5fffc,  0x16c000bf },
+        { 0x50350,  0x2a80003b },
+        { 0x5fffc,  0x17c000bf },
+        { 0x50354,  0x2a000039 },
+        { 0x5fffc,  0x188000c2 },
+        { 0x50358,  0x29400036 },
+        { 0x5fffc,  0x19c000c4 },
+        { 0x5035c,  0x28800032 },
+        { 0x5fffc,  0x1ac000c5 },
+        { 0x50360,  0x2800002f },
+        { 0x5fffc,  0x1bc000c7 },
+        { 0x50364,  0x2740002c },
+        { 0x5fffc,  0x1cc000c8 },
+        { 0x50368,  0x26c00029 },
+        { 0x5fffc,  0x1dc000c9 },
+        { 0x5036c,  0x26000027 },
+        { 0x5fffc,  0x1ec000cc },
+        { 0x50370,  0x25000024 },
+        { 0x5fffc,  0x200000cc },
+        { 0x50374,  0x24800021 },
+        { 0x5fffc,  0x210000cd },
+        { 0x50378,  0x23800020 },
+        { 0x5fffc,  0x220000ce },
+        { 0x5037c,  0x2300001d },
+};
+
+static struct mdp_table_entry mdp_downscale_y_table_PT6TOPT8[] = {
+        { 0x5fffc,  0xfe000070 },
+        { 0x50300,  0x4bc00068 },
+        { 0x5fffc,  0xfe000078 },
+        { 0x50304,  0x4bc00060 },
+        { 0x5fffc,  0xfe000080 },
+        { 0x50308,  0x4b800059 },
+        { 0x5fffc,  0xfe000089 },
+        { 0x5030c,  0x4b000052 },
+        { 0x5fffc,  0xfe400091 },
+        { 0x50310,  0x4a80004b },
+        { 0x5fffc,  0xfe40009a },
+        { 0x50314,  0x4a000044 },
+        { 0x5fffc,  0xfe8000a3 },
+        { 0x50318,  0x4940003d },
+        { 0x5fffc,  0xfec000ac },
+        { 0x5031c,  0x48400037 },
+        { 0x5fffc,  0xff0000b4 },
+        { 0x50320,  0x47800031 },
+        { 0x5fffc,  0xff8000bd },
+        { 0x50324,  0x4640002b },
+        { 0x5fffc,  0xc5 },
+        { 0x50328,  0x45000026 },
+        { 0x5fffc,  0x8000ce },
+        { 0x5032c,  0x43800021 },
+        { 0x5fffc,  0x10000d6 },
+        { 0x50330,  0x4240001c },
+        { 0x5fffc,  0x18000df },
+        { 0x50334,  0x40800018 },
+        { 0x5fffc,  0x24000e6 },
+        { 0x50338,  0x3f000014 },
+        { 0x5fffc,  0x30000ee },
+        { 0x5033c,  0x3d400010 },
+        { 0x5fffc,  0x40000f5 },
+        { 0x50340,  0x3b80000c },
+        { 0x5fffc,  0x50000fc },
+        { 0x50344,  0x39800009 },
+        { 0x5fffc,  0x6000102 },
+        { 0x50348,  0x37c00006 },
+        { 0x5fffc,  0x7000109 },
+        { 0x5034c,  0x35800004 },
+        { 0x5fffc,  0x840010e },
+        { 0x50350,  0x33800002 },
+        { 0x5fffc,  0x9800114 },
+        { 0x50354,  0x31400000 },
+        { 0x5fffc,  0xac00119 },
+        { 0x50358,  0x2f4003fe },
+        { 0x5fffc,  0xc40011e },
+        { 0x5035c,  0x2d0003fc },
+        { 0x5fffc,  0xdc00121 },
+        { 0x50360,  0x2b0003fb },
+        { 0x5fffc,  0xf400125 },
+        { 0x50364,  0x28c003fa },
+        { 0x5fffc,  0x11000128 },
+        { 0x50368,  0x268003f9 },
+        { 0x5fffc,  0x12c0012a },
+        { 0x5036c,  0x244003f9 },
+        { 0x5fffc,  0x1480012c },
+        { 0x50370,  0x224003f8 },
+        { 0x5fffc,  0x1640012e },
+        { 0x50374,  0x200003f8 },
+        { 0x5fffc,  0x1800012f },
+        { 0x50378,  0x1e0003f8 },
+        { 0x5fffc,  0x1a00012f },
+        { 0x5037c,  0x1c0003f8 },
+};
+
+static struct mdp_table_entry mdp_downscale_y_table_PT8TO1[] = {
+        { 0x5fffc,  0x0 },
+        { 0x50300,  0x7fc00000 },
+        { 0x5fffc,  0xff80000d },
+        { 0x50304,  0x7ec003f9 },
+        { 0x5fffc,  0xfec0001c },
+        { 0x50308,  0x7d4003f3 },
+        { 0x5fffc,  0xfe40002b },
+        { 0x5030c,  0x7b8003ed },
+        { 0x5fffc,  0xfd80003c },
+        { 0x50310,  0x794003e8 },
+        { 0x5fffc,  0xfcc0004d },
+        { 0x50314,  0x76c003e4 },
+        { 0x5fffc,  0xfc40005f },
+        { 0x50318,  0x73c003e0 },
+        { 0x5fffc,  0xfb800071 },
+        { 0x5031c,  0x708003de },
+        { 0x5fffc,  0xfac00085 },
+        { 0x50320,  0x6d0003db },
+        { 0x5fffc,  0xfa000098 },
+        { 0x50324,  0x698003d9 },
+        { 0x5fffc,  0xf98000ac },
+        { 0x50328,  0x654003d8 },
+        { 0x5fffc,  0xf8c000c1 },
+        { 0x5032c,  0x610003d7 },
+        { 0x5fffc,  0xf84000d5 },
+        { 0x50330,  0x5c8003d7 },
+        { 0x5fffc,  0xf7c000e9 },
+        { 0x50334,  0x580003d7 },
+        { 0x5fffc,  0xf74000fd },
+        { 0x50338,  0x534003d8 },
+        { 0x5fffc,  0xf6c00112 },
+        { 0x5033c,  0x4e8003d8 },
+        { 0x5fffc,  0xf6800126 },
+        { 0x50340,  0x494003da },
+        { 0x5fffc,  0xf600013a },
+        { 0x50344,  0x448003db },
+        { 0x5fffc,  0xf600014d },
+        { 0x50348,  0x3f4003dd },
+        { 0x5fffc,  0xf5c00160 },
+        { 0x5034c,  0x3a4003df },
+        { 0x5fffc,  0xf5c00172 },
+        { 0x50350,  0x354003e1 },
+        { 0x5fffc,  0xf5c00184 },
+        { 0x50354,  0x304003e3 },
+        { 0x5fffc,  0xf6000195 },
+        { 0x50358,  0x2b0003e6 },
+        { 0x5fffc,  0xf64001a6 },
+        { 0x5035c,  0x260003e8 },
+        { 0x5fffc,  0xf6c001b4 },
+        { 0x50360,  0x214003eb },
+        { 0x5fffc,  0xf78001c2 },
+        { 0x50364,  0x1c4003ee },
+        { 0x5fffc,  0xf80001cf },
+        { 0x50368,  0x17c003f1 },
+        { 0x5fffc,  0xf90001db },
+        { 0x5036c,  0x134003f3 },
+        { 0x5fffc,  0xfa0001e5 },
+        { 0x50370,  0xf0003f6 },
+        { 0x5fffc,  0xfb4001ee },
+        { 0x50374,  0xac003f9 },
+        { 0x5fffc,  0xfcc001f5 },
+        { 0x50378,  0x70003fb },
+        { 0x5fffc,  0xfe4001fb },
+        { 0x5037c,  0x34003fe },
+};
+
+struct mdp_table_entry *mdp_downscale_y_table[MDP_DOWNSCALE_MAX] = {
+        [MDP_DOWNSCALE_PT2TOPT4] = mdp_downscale_y_table_PT2TOPT4,
+        [MDP_DOWNSCALE_PT4TOPT6] = mdp_downscale_y_table_PT4TOPT6,
+        [MDP_DOWNSCALE_PT6TOPT8] = mdp_downscale_y_table_PT6TOPT8,
+        [MDP_DOWNSCALE_PT8TO1]  = mdp_downscale_y_table_PT8TO1,
+};
+
+struct mdp_table_entry mdp_gaussian_blur_table[] = {
+        /* max variance */
+        { 0x5fffc, 0x20000080 },
+        { 0x50280, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50284, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50288, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x5028c, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50290, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50294, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50298, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x5029c, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502a0, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502a4, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502a8, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502ac, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502b0, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502b4, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502b8, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502bc, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502c0, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502c4, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502c8, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502cc, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502d0, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502d4, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502d8, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502dc, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502e0, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502e4, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502e8, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502ec, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502f0, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502f4, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502f8, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x502fc, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50300, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50304, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50308, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x5030c, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50310, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50314, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50318, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x5031c, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50320, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50324, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50328, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x5032c, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50330, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50334, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50338, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x5033c, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50340, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50344, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50348, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x5034c, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50350, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50354, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50358, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x5035c, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50360, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50364, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50368, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x5036c, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50370, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50374, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x50378, 0x20000080 },
+        { 0x5fffc, 0x20000080 },
+        { 0x5037c, 0x20000080 },
+};
diff --git a/drivers/video/msm/mdp_scale_tables.h b/drivers/video/msm/mdp_scale_tables.h
new file mode 100644
index 000000000000..34077b1af603
--- /dev/null
+++ b/drivers/video/msm/mdp_scale_tables.h
@@ -0,0 +1,38 @@
+/* drivers/video/msm_fb/mdp_scale_tables.h
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+#ifndef _MDP_SCALE_TABLES_H_
+#define _MDP_SCALE_TABLES_H_
+
+#include <linux/types.h>
+struct mdp_table_entry {
+        uint32_t reg;
+        uint32_t val;
+};
+
+extern struct mdp_table_entry mdp_upscale_table[64];
+
+enum {
+        MDP_DOWNSCALE_PT2TOPT4,
+        MDP_DOWNSCALE_PT4TOPT6,
+        MDP_DOWNSCALE_PT6TOPT8,
+        MDP_DOWNSCALE_PT8TO1,
+        MDP_DOWNSCALE_MAX,
+};
+
+extern struct mdp_table_entry *mdp_downscale_x_table[MDP_DOWNSCALE_MAX];
+extern struct mdp_table_entry *mdp_downscale_y_table[MDP_DOWNSCALE_MAX];
+extern struct mdp_table_entry mdp_gaussian_blur_table[];
+
+#endif
diff --git a/drivers/video/msm/msm_fb.c b/drivers/video/msm/msm_fb.c
new file mode 100644
index 000000000000..49101dda45ee
--- /dev/null
+++ b/drivers/video/msm/msm_fb.c
@@ -0,0 +1,636 @@
+/* drivers/video/msm/msm_fb.c
+ *
+ * Core MSM framebuffer driver.
+ *
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/platform_device.h>
+#include <linux/module.h>
+#include <linux/fb.h>
+#include <linux/delay.h>
+
+#include <linux/freezer.h>
+#include <linux/wait.h>
+#include <linux/msm_mdp.h>
+#include <linux/io.h>
+#include <linux/uaccess.h>
+#include <mach/msm_fb.h>
+#include <mach/board.h>
+#include <linux/workqueue.h>
+#include <linux/clk.h>
+#include <linux/debugfs.h>
+#include <linux/dma-mapping.h>
+
+#define PRINT_FPS 0
+#define PRINT_BLIT_TIME 0
+
+#define SLEEPING 0x4
+#define UPDATING 0x3
+#define FULL_UPDATE_DONE 0x2
+#define WAKING 0x1
+#define AWAKE 0x0
+
+#define NONE 0
+#define SUSPEND_RESUME 0x1
+#define FPS 0x2
+#define BLIT_TIME 0x4
+#define SHOW_UPDATES 0x8
+
+#define DLOG(mask, fmt, args...) \
+do { \
+        if (msmfb_debug_mask & mask) \
+                printk(KERN_INFO "msmfb: "fmt, ##args); \
+} while (0)
+
+static int msmfb_debug_mask;
+module_param_named(msmfb_debug_mask, msmfb_debug_mask, int,
+                   S_IRUGO | S_IWUSR | S_IWGRP);
+
+struct mdp_device *mdp;
+
+struct msmfb_info {
+        struct fb_info *fb;
+        struct msm_panel_data *panel;
+        int xres;
+        int yres;
+        unsigned output_format;
+        unsigned yoffset;
+        unsigned frame_requested;
+        unsigned frame_done;
+        int sleeping;
+        unsigned update_frame;
+        struct {
+                int left;
+                int top;
+                int eright; /* exclusive */
+                int ebottom; /* exclusive */
+        } update_info;
+        char *black;
+
+        spinlock_t update_lock;
+        struct mutex panel_init_lock;
+        wait_queue_head_t frame_wq;
+        struct workqueue_struct *resume_workqueue;
+        struct work_struct resume_work;
+        struct msmfb_callback dma_callback;
+        struct msmfb_callback vsync_callback;
+        struct hrtimer fake_vsync;
+        ktime_t vsync_request_time;
+};
+
+static int msmfb_open(struct fb_info *info, int user)
+{
+        return 0;
+}
+
+static int msmfb_release(struct fb_info *info, int user)
+{
+        return 0;
+}
+
+/* Called from dma interrupt handler, must not sleep */
+static void msmfb_handle_dma_interrupt(struct msmfb_callback *callback)
+{
+        unsigned long irq_flags;
+        struct msmfb_info *msmfb  = container_of(callback, struct msmfb_info,
+                                               dma_callback);
+
+        spin_lock_irqsave(&msmfb->update_lock, irq_flags);
+        msmfb->frame_done = msmfb->frame_requested;
+        if (msmfb->sleeping == UPDATING &&
+            msmfb->frame_done == msmfb->update_frame) {
+                DLOG(SUSPEND_RESUME, "full update completed\n");
+                queue_work(msmfb->resume_workqueue, &msmfb->resume_work);
+        }
+        spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+        wake_up(&msmfb->frame_wq);
+}
+
+static int msmfb_start_dma(struct msmfb_info *msmfb)
+{
+        uint32_t x, y, w, h;
+        unsigned addr;
+        unsigned long irq_flags;
+        uint32_t yoffset;
+        s64 time_since_request;
+        struct msm_panel_data *panel = msmfb->panel;
+
+        spin_lock_irqsave(&msmfb->update_lock, irq_flags);
+        time_since_request = ktime_to_ns(ktime_sub(ktime_get(),
+                             msmfb->vsync_request_time));
+        if (time_since_request > 20 * NSEC_PER_MSEC) {
+                uint32_t us;
+                us = do_div(time_since_request, NSEC_PER_MSEC) / NSEC_PER_USEC;
+                printk(KERN_WARNING "msmfb_start_dma %lld.%03u ms after vsync "
+                        "request\n", time_since_request, us);
+        }
+        if (msmfb->frame_done == msmfb->frame_requested) {
+                spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+                return -1;
+        }
+        if (msmfb->sleeping == SLEEPING) {
+                DLOG(SUSPEND_RESUME, "tried to start dma while asleep\n");
+                spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+                return -1;
+        }
+        x = msmfb->update_info.left;
+        y = msmfb->update_info.top;
+        w = msmfb->update_info.eright - x;
+        h = msmfb->update_info.ebottom - y;
+        yoffset = msmfb->yoffset;
+        msmfb->update_info.left = msmfb->xres + 1;
+        msmfb->update_info.top = msmfb->yres + 1;
+        msmfb->update_info.eright = 0;
+        msmfb->update_info.ebottom = 0;
+        if (unlikely(w > msmfb->xres || h > msmfb->yres ||
+                     w == 0 || h == 0)) {
+                printk(KERN_INFO "invalid update: %d %d %d "
+                                "%d\n", x, y, w, h);
+                msmfb->frame_done = msmfb->frame_requested;
+                goto error;
+        }
+        spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+
+        addr = ((msmfb->xres * (yoffset + y) + x) * 2);
+        mdp->dma(mdp, addr + msmfb->fb->fix.smem_start,
+                 msmfb->xres * 2, w, h, x, y, &msmfb->dma_callback,
+                 panel->interface_type);
+        return 0;
+error:
+        spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+        /* some clients need to clear their vsync interrupt */
+        if (panel->clear_vsync)
+                panel->clear_vsync(panel);
+        wake_up(&msmfb->frame_wq);
+        return 0;
+}
+
+/* Called from esync interrupt handler, must not sleep */
+static void msmfb_handle_vsync_interrupt(struct msmfb_callback *callback)
+{
+        struct msmfb_info *msmfb = container_of(callback, struct msmfb_info,
+                                               vsync_callback);
+        msmfb_start_dma(msmfb);
+}
+
+static enum hrtimer_restart msmfb_fake_vsync(struct hrtimer *timer)
+{
+        struct msmfb_info *msmfb  = container_of(timer, struct msmfb_info,
+                                               fake_vsync);
+        msmfb_start_dma(msmfb);
+        return HRTIMER_NORESTART;
+}
+
+static void msmfb_pan_update(struct fb_info *info, uint32_t left, uint32_t top,
+                             uint32_t eright, uint32_t ebottom,
+                             uint32_t yoffset, int pan_display)
+{
+        struct msmfb_info *msmfb = info->par;
+        struct msm_panel_data *panel = msmfb->panel;
+        unsigned long irq_flags;
+        int sleeping;
+        int retry = 1;
+
+        DLOG(SHOW_UPDATES, "update %d %d %d %d %d %d\n",
+                left, top, eright, ebottom, yoffset, pan_display);
+restart:
+        spin_lock_irqsave(&msmfb->update_lock, irq_flags);
+
+        /* if we are sleeping, on a pan_display wait 10ms (to throttle back
+         * drawing otherwise return */
+        if (msmfb->sleeping == SLEEPING) {
+                DLOG(SUSPEND_RESUME, "drawing while asleep\n");
+                spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+                if (pan_display)
+                        wait_event_interruptible_timeout(msmfb->frame_wq,
+                                msmfb->sleeping != SLEEPING, HZ/10);
+                return;
+        }
+
+        sleeping = msmfb->sleeping;
+        /* on a full update, if the last frame has not completed, wait for it */
+        if (pan_display && (msmfb->frame_requested != msmfb->frame_done ||
+                            sleeping == UPDATING)) {
+                int ret;
+                spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+                ret = wait_event_interruptible_timeout(msmfb->frame_wq,
+                        msmfb->frame_done == msmfb->frame_requested &&
+                        msmfb->sleeping != UPDATING, 5 * HZ);
+                if (ret <= 0 && (msmfb->frame_requested != msmfb->frame_done ||
+                                 msmfb->sleeping == UPDATING)) {
+                        if (retry && panel->request_vsync &&
+                            (sleeping == AWAKE)) {
+                                panel->request_vsync(panel,
+                                        &msmfb->vsync_callback);
+                                retry = 0;
+                                printk(KERN_WARNING "msmfb_pan_display timeout "
+                                        "rerequest vsync\n");
+                        } else {
+                                printk(KERN_WARNING "msmfb_pan_display timeout "
+                                        "waiting for frame start, %d %d\n",
+                                        msmfb->frame_requested,
+                                        msmfb->frame_done);
+                                return;
+                        }
+                }
+                goto restart;
+        }
+
+
+        msmfb->frame_requested++;
+        /* if necessary, update the y offset, if this is the
+         * first full update on resume, set the sleeping state */
+        if (pan_display) {
+                msmfb->yoffset = yoffset;
+                if (left == 0 && top == 0 && eright == info->var.xres &&
+                    ebottom == info->var.yres) {
+                        if (sleeping == WAKING) {
+                                msmfb->update_frame = msmfb->frame_requested;
+                                DLOG(SUSPEND_RESUME, "full update starting\n");
+                                msmfb->sleeping = UPDATING;
+                        }
+                }
+        }
+
+        /* set the update request */
+        if (left < msmfb->update_info.left)
+                msmfb->update_info.left = left;
+        if (top < msmfb->update_info.top)
+                msmfb->update_info.top = top;
+        if (eright > msmfb->update_info.eright)
+                msmfb->update_info.eright = eright;
+        if (ebottom > msmfb->update_info.ebottom)
+                msmfb->update_info.ebottom = ebottom;
+        DLOG(SHOW_UPDATES, "update queued %d %d %d %d %d\n",
+                msmfb->update_info.left, msmfb->update_info.top,
+                msmfb->update_info.eright, msmfb->update_info.ebottom,
+                msmfb->yoffset);
+        spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+
+        /* if the panel is all the way on wait for vsync, otherwise sleep
+         * for 16 ms (long enough for the dma to panel) and then begin dma */
+        msmfb->vsync_request_time = ktime_get();
+        if (panel->request_vsync && (sleeping == AWAKE)) {
+                panel->request_vsync(panel, &msmfb->vsync_callback);
+        } else {
+                if (!hrtimer_active(&msmfb->fake_vsync)) {
+                        hrtimer_start(&msmfb->fake_vsync,
+                                      ktime_set(0, NSEC_PER_SEC/60),
+                                      HRTIMER_MODE_REL);
+                }
+        }
+}
+
+static void msmfb_update(struct fb_info *info, uint32_t left, uint32_t top,
+                         uint32_t eright, uint32_t ebottom)
+{
+        msmfb_pan_update(info, left, top, eright, ebottom, 0, 0);
+}
+
+static void power_on_panel(struct work_struct *work)
+{
+        struct msmfb_info *msmfb =
+                container_of(work, struct msmfb_info, resume_work);
+        struct msm_panel_data *panel = msmfb->panel;
+        unsigned long irq_flags;
+
+        mutex_lock(&msmfb->panel_init_lock);
+        DLOG(SUSPEND_RESUME, "turning on panel\n");
+        if (msmfb->sleeping == UPDATING) {
+                if (panel->unblank(panel)) {
+                        printk(KERN_INFO "msmfb: panel unblank failed,"
+                               "not starting drawing\n");
+                        goto error;
+                }
+                spin_lock_irqsave(&msmfb->update_lock, irq_flags);
+                msmfb->sleeping = AWAKE;
+                wake_up(&msmfb->frame_wq);
+                spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+        }
+error:
+        mutex_unlock(&msmfb->panel_init_lock);
+}
+
+
+static int msmfb_check_var(struct fb_var_screeninfo *var, struct fb_info *info)
+{
+        if ((var->xres != info->var.xres) ||
+            (var->yres != info->var.yres) ||
+            (var->xres_virtual != info->var.xres_virtual) ||
+            (var->yres_virtual != info->var.yres_virtual) ||
+            (var->xoffset != info->var.xoffset) ||
+            (var->bits_per_pixel != info->var.bits_per_pixel) ||
+            (var->grayscale != info->var.grayscale))
+                 return -EINVAL;
+        return 0;
+}
+
+int msmfb_pan_display(struct fb_var_screeninfo *var, struct fb_info *info)
+{
+        struct msmfb_info *msmfb = info->par;
+        struct msm_panel_data *panel = msmfb->panel;
+
+        /* "UPDT" */
+        if ((panel->caps & MSMFB_CAP_PARTIAL_UPDATES) &&
+            (var->reserved[0] == 0x54445055)) {
+                msmfb_pan_update(info, var->reserved[1] & 0xffff,
+                                 var->reserved[1] >> 16,
+                                 var->reserved[2] & 0xffff,
+                                 var->reserved[2] >> 16, var->yoffset, 1);
+        } else {
+                msmfb_pan_update(info, 0, 0, info->var.xres, info->var.yres,
+                                 var->yoffset, 1);
+        }
+        return 0;
+}
+
+static void msmfb_fillrect(struct fb_info *p, const struct fb_fillrect *rect)
+{
+        cfb_fillrect(p, rect);
+        msmfb_update(p, rect->dx, rect->dy, rect->dx + rect->width,
+                     rect->dy + rect->height);
+}
+
+static void msmfb_copyarea(struct fb_info *p, const struct fb_copyarea *area)
+{
+        cfb_copyarea(p, area);
+        msmfb_update(p, area->dx, area->dy, area->dx + area->width,
+                     area->dy + area->height);
+}
+
+static void msmfb_imageblit(struct fb_info *p, const struct fb_image *image)
+{
+        cfb_imageblit(p, image);
+        msmfb_update(p, image->dx, image->dy, image->dx + image->width,
+                     image->dy + image->height);
+}
+
+
+static int msmfb_blit(struct fb_info *info,
+                      void __user *p)
+{
+        struct mdp_blit_req req;
+        struct mdp_blit_req_list req_list;
+        int i;
+        int ret;
+
+        if (copy_from_user(&req_list, p, sizeof(req_list)))
+                return -EFAULT;
+
+        for (i = 0; i < req_list.count; i++) {
+                struct mdp_blit_req_list *list =
+                        (struct mdp_blit_req_list *)p;
+                if (copy_from_user(&req, &list->req[i], sizeof(req)))
+                        return -EFAULT;
+                ret = mdp->blit(mdp, info, &req);
+                if (ret)
+                        return ret;
+        }
+        return 0;
+}
+
+
+DEFINE_MUTEX(mdp_ppp_lock);
+
+static int msmfb_ioctl(struct fb_info *p, unsigned int cmd, unsigned long arg)
+{
+        void __user *argp = (void __user *)arg;
+        int ret;
+
+        switch (cmd) {
+        case MSMFB_GRP_DISP:
+                mdp->set_grp_disp(mdp, arg);
+                break;
+        case MSMFB_BLIT:
+                ret = msmfb_blit(p, argp);
+                if (ret)
+                        return ret;
+                break;
+        default:
+                        printk(KERN_INFO "msmfb unknown ioctl: %d\n", cmd);
+                        return -EINVAL;
+        }
+        return 0;
+}
+
+static struct fb_ops msmfb_ops = {
+        .owner = THIS_MODULE,
+        .fb_open = msmfb_open,
+        .fb_release = msmfb_release,
+        .fb_check_var = msmfb_check_var,
+        .fb_pan_display = msmfb_pan_display,
+        .fb_fillrect = msmfb_fillrect,
+        .fb_copyarea = msmfb_copyarea,
+        .fb_imageblit = msmfb_imageblit,
+        .fb_ioctl = msmfb_ioctl,
+};
+
+static unsigned PP[16];
+
+
+
+#define BITS_PER_PIXEL 16
+
+static void setup_fb_info(struct msmfb_info *msmfb)
+{
+        struct fb_info *fb_info = msmfb->fb;
+        int r;
+
+        /* finish setting up the fb_info struct */
+        strncpy(fb_info->fix.id, "msmfb", 16);
+        fb_info->fix.ypanstep = 1;
+
+        fb_info->fbops = &msmfb_ops;
+        fb_info->flags = FBINFO_DEFAULT;
+
+        fb_info->fix.type = FB_TYPE_PACKED_PIXELS;
+        fb_info->fix.visual = FB_VISUAL_TRUECOLOR;
+        fb_info->fix.line_length = msmfb->xres * 2;
+
+        fb_info->var.xres = msmfb->xres;
+        fb_info->var.yres = msmfb->yres;
+        fb_info->var.width = msmfb->panel->fb_data->width;
+        fb_info->var.height = msmfb->panel->fb_data->height;
+        fb_info->var.xres_virtual = msmfb->xres;
+        fb_info->var.yres_virtual = msmfb->yres * 2;
+        fb_info->var.bits_per_pixel = BITS_PER_PIXEL;
+        fb_info->var.accel_flags = 0;
+
+        fb_info->var.yoffset = 0;
+
+        if (msmfb->panel->caps & MSMFB_CAP_PARTIAL_UPDATES) {
+                fb_info->var.reserved[0] = 0x54445055;
+                fb_info->var.reserved[1] = 0;
+                fb_info->var.reserved[2] = (uint16_t)msmfb->xres |
+                                           ((uint32_t)msmfb->yres << 16);
+        }
+
+        fb_info->var.red.offset = 11;
+        fb_info->var.red.length = 5;
+        fb_info->var.red.msb_right = 0;
+        fb_info->var.green.offset = 5;
+        fb_info->var.green.length = 6;
+        fb_info->var.green.msb_right = 0;
+        fb_info->var.blue.offset = 0;
+        fb_info->var.blue.length = 5;
+        fb_info->var.blue.msb_right = 0;
+
+        r = fb_alloc_cmap(&fb_info->cmap, 16, 0);
+        fb_info->pseudo_palette = PP;
+
+        PP[0] = 0;
+        for (r = 1; r < 16; r++)
+                PP[r] = 0xffffffff;
+}
+
+static int setup_fbmem(struct msmfb_info *msmfb, struct platform_device *pdev)
+{
+        struct fb_info *fb = msmfb->fb;
+        struct resource *resource;
+        unsigned long size = msmfb->xres * msmfb->yres *
+                             (BITS_PER_PIXEL >> 3) * 2;
+        unsigned char *fbram;
+
+        /* board file might have attached a resource describing an fb */
+        resource = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+        if (!resource)
+                return -EINVAL;
+
+        /* check the resource is large enough to fit the fb */
+        if (resource->end - resource->start < size) {
+                printk(KERN_ERR "allocated resource is too small for "
+                                "fb\n");
+                return -ENOMEM;
+        }
+        fb->fix.smem_start = resource->start;
+        fb->fix.smem_len = resource->end - resource->start;
+        fbram = ioremap(resource->start,
+                        resource->end - resource->start);
+        if (fbram == 0) {
+                printk(KERN_ERR "msmfb: cannot allocate fbram!\n");
+                return -ENOMEM;
+        }
+        fb->screen_base = fbram;
+        return 0;
+}
+
+static int msmfb_probe(struct platform_device *pdev)
+{
+        struct fb_info *fb;
+        struct msmfb_info *msmfb;
+        struct msm_panel_data *panel = pdev->dev.platform_data;
+        int ret;
+
+        if (!panel) {
+                pr_err("msmfb_probe: no platform data\n");
+                return -EINVAL;
+        }
+        if (!panel->fb_data) {
+                pr_err("msmfb_probe: no fb_data\n");
+                return -EINVAL;
+        }
+
+        fb = framebuffer_alloc(sizeof(struct msmfb_info), &pdev->dev);
+        if (!fb)
+                return -ENOMEM;
+        msmfb = fb->par;
+        msmfb->fb = fb;
+        msmfb->panel = panel;
+        msmfb->xres = panel->fb_data->xres;
+        msmfb->yres = panel->fb_data->yres;
+
+        ret = setup_fbmem(msmfb, pdev);
+        if (ret)
+                goto error_setup_fbmem;
+
+        setup_fb_info(msmfb);
+
+        spin_lock_init(&msmfb->update_lock);
+        mutex_init(&msmfb->panel_init_lock);
+        init_waitqueue_head(&msmfb->frame_wq);
+        msmfb->resume_workqueue = create_workqueue("panel_on");
+        if (msmfb->resume_workqueue == NULL) {
+                printk(KERN_ERR "failed to create panel_on workqueue\n");
+                ret = -ENOMEM;
+                goto error_create_workqueue;
+        }
+        INIT_WORK(&msmfb->resume_work, power_on_panel);
+        msmfb->black = kzalloc(msmfb->fb->var.bits_per_pixel*msmfb->xres,
+                               GFP_KERNEL);
+
+        printk(KERN_INFO "msmfb_probe() installing %d x %d panel\n",
+               msmfb->xres, msmfb->yres);
+
+        msmfb->dma_callback.func = msmfb_handle_dma_interrupt;
+        msmfb->vsync_callback.func = msmfb_handle_vsync_interrupt;
+        hrtimer_init(&msmfb->fake_vsync, CLOCK_MONOTONIC,
+                     HRTIMER_MODE_REL);
+
+
+        msmfb->fake_vsync.function = msmfb_fake_vsync;
+
+        ret = register_framebuffer(fb);
+        if (ret)
+                goto error_register_framebuffer;
+
+        msmfb->sleeping = WAKING;
+
+        return 0;
+
+error_register_framebuffer:
+        destroy_workqueue(msmfb->resume_workqueue);
+error_create_workqueue:
+        iounmap(fb->screen_base);
+error_setup_fbmem:
+        framebuffer_release(msmfb->fb);
+        return ret;
+}
+
+static struct platform_driver msm_panel_driver = {
+        /* need to write remove */
+        .probe = msmfb_probe,
+        .driver = {.name = "msm_panel"},
+};
+
+
+static int msmfb_add_mdp_device(struct device *dev,
+                                struct class_interface *class_intf)
+{
+        /* might need locking if mulitple mdp devices */
+        if (mdp)
+                return 0;
+        mdp = container_of(dev, struct mdp_device, dev);
+        return platform_driver_register(&msm_panel_driver);
+}
+
+static void msmfb_remove_mdp_device(struct device *dev,
+                                struct class_interface *class_intf)
+{
+        /* might need locking if mulitple mdp devices */
+        if (dev != &mdp->dev)
+                return;
+        platform_driver_unregister(&msm_panel_driver);
+        mdp = NULL;
+}
+
+static struct class_interface msm_fb_interface = {
+        .add_dev = &msmfb_add_mdp_device,
+        .remove_dev = &msmfb_remove_mdp_device,
+};
+
+static int __init msmfb_init(void)
+{
+        return register_mdp_client(&msm_fb_interface);
+}
+
+module_init(msmfb_init);
diff --git a/drivers/video/omap/Kconfig b/drivers/video/omap/Kconfig
index 44408850e2eb..551e3e9c4cbe 100644
--- a/drivers/video/omap/Kconfig
+++ b/drivers/video/omap/Kconfig
@@ -7,6 +7,69 @@ config FB_OMAP
         help
           Frame buffer driver for OMAP based boards.
 
+config FB_OMAP_LCD_VGA
+        bool "Use LCD in VGA mode"
+                depends on MACH_OMAP_3430SDP || MACH_OMAP_LDP
+
+choice
+        depends on FB_OMAP && MACH_OVERO
+        prompt "Screen resolution"
+        default FB_OMAP_079M3R
+        help
+          Selected desired screen resolution
+
+config FB_OMAP_031M3R
+        boolean "640 x 480 @ 60 Hz Reduced blanking"
+
+config FB_OMAP_048M3R
+        boolean "800 x 600 @ 60 Hz Reduced blanking"
+
+config FB_OMAP_079M3R
+        boolean "1024 x 768 @ 60 Hz Reduced blanking"
+
+config FB_OMAP_092M9R
+        boolean "1280 x 720 @ 60 Hz Reduced blanking"
+
+endchoice
+
+config FB_OMAP_LCDC_EXTERNAL
+        bool "External LCD controller support"
+        depends on FB_OMAP
+        help
+          Say Y here, if you want to have support for boards with an
+          external LCD controller connected to the SoSSI/RFBI interface.
+
+config FB_OMAP_LCDC_HWA742
+        bool "Epson HWA742 LCD controller support"
+        depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
+        help
+          Say Y here if you want to have support for the external
+          Epson HWA742 LCD controller.
+
+config FB_OMAP_LCDC_BLIZZARD
+        bool "Epson Blizzard LCD controller support"
+        depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
+        help
+          Say Y here if you want to have support for the external
+          Epson Blizzard LCD controller.
+
+config FB_OMAP_MANUAL_UPDATE
+        bool "Default to manual update mode"
+        depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
+        help
+          Say Y here, if your user-space applications are capable of
+          notifying the frame buffer driver when a change has occured in
+          the frame buffer content and thus a reload of the image data to
+          the external frame buffer is required. If unsure, say N.
+
+config FB_OMAP_LCD_MIPID
+        bool "MIPI DBI-C/DCS compatible LCD support"
+        depends on FB_OMAP && SPI_MASTER
+        help
+          Say Y here if you want to have support for LCDs compatible with
+          the Mobile Industry Processor Interface DBI-C/DCS
+          specification. (Supported LCDs: Philips LPH8923, Sharp LS041Y3)
+
 config FB_OMAP_BOOTLOADER_INIT
         bool "Check bootloader initialization"
         depends on FB_OMAP
@@ -36,23 +99,4 @@ config FB_OMAP_DMA_TUNE
           answer yes. Answer no if you have a dedicated video
           memory, or don't use any of the accelerated features.
 
-config FB_OMAP_LCDC_EXTERNAL
-        bool "External LCD controller support"
-        depends on FB_OMAP
-        help
-          Say Y here, if you want to have support for boards with an
-          external LCD controller connected to the SoSSI/RFBI interface.
-
-config FB_OMAP_LCDC_HWA742
-        bool "Epson HWA742 LCD controller support"
-        depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
-        help
-          Say Y here if you want to have support for the external
-          Epson HWA742 LCD controller.
 
-config FB_OMAP_LCDC_BLIZZARD
-        bool "Epson Blizzard LCD controller support"
-        depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
-        help
-          Say Y here if you want to have support for the external
-          Epson Blizzard LCD controller.
diff --git a/drivers/video/omap/Makefile b/drivers/video/omap/Makefile
index ed13889c1162..b63b198d1f03 100644
--- a/drivers/video/omap/Makefile
+++ b/drivers/video/omap/Makefile
@@ -8,6 +8,7 @@ objs-yy := omapfb_main.o
 
 objs-y$(CONFIG_ARCH_OMAP1) += lcdc.o
 objs-y$(CONFIG_ARCH_OMAP2) += dispc.o
+objs-y$(CONFIG_ARCH_OMAP3) += dispc.o
 
 objs-$(CONFIG_ARCH_OMAP1)$(CONFIG_FB_OMAP_LCDC_EXTERNAL) += sossi.o
 objs-$(CONFIG_ARCH_OMAP2)$(CONFIG_FB_OMAP_LCDC_EXTERNAL) += rfbi.o
@@ -15,6 +16,7 @@ objs-$(CONFIG_ARCH_OMAP2)$(CONFIG_FB_OMAP_LCDC_EXTERNAL) += rfbi.o
 objs-y$(CONFIG_FB_OMAP_LCDC_HWA742) += hwa742.o
 objs-y$(CONFIG_FB_OMAP_LCDC_BLIZZARD) += blizzard.o
 
+objs-y$(CONFIG_MACH_AMS_DELTA) += lcd_ams_delta.o
 objs-y$(CONFIG_MACH_OMAP_H4) += lcd_h4.o
 objs-y$(CONFIG_MACH_OMAP_H3) += lcd_h3.o
 objs-y$(CONFIG_MACH_OMAP_PALMTE) += lcd_palmte.o
@@ -24,5 +26,15 @@ objs-$(CONFIG_ARCH_OMAP16XX)$(CONFIG_MACH_OMAP_INNOVATOR) += lcd_inn1610.o
 objs-$(CONFIG_ARCH_OMAP15XX)$(CONFIG_MACH_OMAP_INNOVATOR) += lcd_inn1510.o
 objs-y$(CONFIG_MACH_OMAP_OSK) += lcd_osk.o
 
+objs-y$(CONFIG_MACH_OMAP_APOLLON) += lcd_apollon.o
+objs-y$(CONFIG_MACH_OMAP_2430SDP) += lcd_2430sdp.o
+objs-y$(CONFIG_MACH_OMAP_3430SDP) += lcd_2430sdp.o
+objs-y$(CONFIG_MACH_OMAP_LDP) += lcd_ldp.o
+objs-y$(CONFIG_MACH_OMAP2EVM) += lcd_omap2evm.o
+objs-y$(CONFIG_MACH_OMAP3EVM) += lcd_omap3evm.o
+objs-y$(CONFIG_MACH_OMAP3_BEAGLE) += lcd_omap3beagle.o
+objs-y$(CONFIG_FB_OMAP_LCD_MIPID) += lcd_mipid.o
+objs-y$(CONFIG_MACH_OVERO) += lcd_overo.o
+
 omapfb-objs := $(objs-yy)
 
diff --git a/drivers/video/omap/blizzard.c b/drivers/video/omap/blizzard.c
index 9dfcf39d3367..d5e59556f9e2 100644
--- a/drivers/video/omap/blizzard.c
+++ b/drivers/video/omap/blizzard.c
@@ -44,6 +44,7 @@
 #define BLIZZARD_CLK_SRC                        0x0e
 #define BLIZZARD_MEM_BANK0_ACTIVATE             0x10
 #define BLIZZARD_MEM_BANK0_STATUS               0x14
+#define BLIZZARD_PANEL_CONFIGURATION            0x28
 #define BLIZZARD_HDISP                          0x2a
 #define BLIZZARD_HNDP                           0x2c
 #define BLIZZARD_VDISP0                         0x2e
@@ -162,6 +163,10 @@ struct blizzard_struct {
         int                     vid_scaled;
         int                     last_color_mode;
         int                     zoom_on;
+        int                     zoom_area_gx1;
+        int                     zoom_area_gx2;
+        int                     zoom_area_gy1;
+        int                     zoom_area_gy2;
         int                     screen_width;
         int                     screen_height;
         unsigned                te_connected:1;
@@ -513,6 +518,13 @@ static int do_full_screen_update(struct blizzard_request *req)
         return REQ_PENDING;
 }
 
+static int check_1d_intersect(int a1, int a2, int b1, int b2)
+{
+        if (a2 <= b1 || b2 <= a1)
+                return 0;
+        return 1;
+}
+
 /* Setup all planes with an overlapping area with the update window. */
 static int do_partial_update(struct blizzard_request *req, int plane,
                              int x, int y, int w, int h,
@@ -525,6 +537,7 @@ static int do_partial_update(struct blizzard_request *req, int plane,
         int color_mode;
         int flags;
         int zoom_off;
+        int have_zoom_for_this_update = 0;
 
         /* Global coordinates, relative to pixel 0,0 of the LCD */
         gx1 = x + blizzard.plane[plane].pos_x;
@@ -544,10 +557,6 @@ static int do_partial_update(struct blizzard_request *req, int plane,
                 gx2_out = gx1_out + w_out;
                 gy2_out = gy1_out + h_out;
         }
-        zoom_off = blizzard.zoom_on && gx1 == 0 && gy1 == 0 &&
-                w == blizzard.screen_width && h == blizzard.screen_height;
-        blizzard.zoom_on = (!zoom_off && blizzard.zoom_on) ||
-                           (w < w_out || h < h_out);
 
         for (i = 0; i < OMAPFB_PLANE_NUM; i++) {
                 struct plane_info *p = &blizzard.plane[i];
@@ -653,8 +662,49 @@ static int do_partial_update(struct blizzard_request *req, int plane,
         else
                 disable_tearsync();
 
+        if ((gx2_out - gx1_out) != (gx2 - gx1) ||
+            (gy2_out - gy1_out) != (gy2 - gy1))
+                have_zoom_for_this_update = 1;
+
+        /* 'background' type of screen update (as opposed to 'destructive')
+           can be used to disable scaling if scaling is active */
+        zoom_off = blizzard.zoom_on && !have_zoom_for_this_update &&
+            (gx1_out == 0) && (gx2_out == blizzard.screen_width) &&
+            (gy1_out == 0) && (gy2_out == blizzard.screen_height) &&
+            (gx1 == 0) && (gy1 == 0);
+
+        if (blizzard.zoom_on && !have_zoom_for_this_update && !zoom_off &&
+            check_1d_intersect(blizzard.zoom_area_gx1, blizzard.zoom_area_gx2,
+                               gx1_out, gx2_out) &&
+            check_1d_intersect(blizzard.zoom_area_gy1, blizzard.zoom_area_gy2,
+                               gy1_out, gy2_out)) {
+                /* Previous screen update was using scaling, current update
+                 * is not using it. Additionally, current screen update is
+                 * going to overlap with the scaled area. Scaling needs to be
+                 * disabled in order to avoid 'magnifying glass' effect.
+                 * Dummy setup of background window can be used for this.
+                 */
+                set_window_regs(0, 0, blizzard.screen_width,
+                                blizzard.screen_height,
+                                0, 0, blizzard.screen_width,
+                                blizzard.screen_height,
+                                BLIZZARD_COLOR_RGB565, 1, flags);
+                blizzard.zoom_on = 0;
+        }
+
+        /* remember scaling settings if we have scaled update */
+        if (have_zoom_for_this_update) {
+                blizzard.zoom_on = 1;
+                blizzard.zoom_area_gx1 = gx1_out;
+                blizzard.zoom_area_gx2 = gx2_out;
+                blizzard.zoom_area_gy1 = gy1_out;
+                blizzard.zoom_area_gy2 = gy2_out;
+        }
+
         set_window_regs(gx1, gy1, gx2, gy2, gx1_out, gy1_out, gx2_out, gy2_out,
                         color_mode, zoom_off, flags);
+        if (zoom_off)
+                blizzard.zoom_on = 0;
 
         blizzard.extif->set_bits_per_cycle(16);
         /* set_window_regs has left the register index at the right
@@ -908,6 +958,35 @@ static int blizzard_set_scale(int plane, int orig_w, int orig_h,
         return 0;
 }
 
+static int blizzard_set_rotate(int angle)
+{
+        u32 l;
+
+        l = blizzard_read_reg(BLIZZARD_PANEL_CONFIGURATION);
+        l &= ~0x03;
+
+        switch (angle) {
+        case 0:
+                l = l | 0x00;
+                break;
+        case 90:
+                l = l | 0x03;
+                break;
+        case 180:
+                l = l | 0x02;
+                break;
+        case 270:
+                l = l | 0x01;
+                break;
+        default:
+                return -EINVAL;
+        }
+
+        blizzard_write_reg(BLIZZARD_PANEL_CONFIGURATION, l);
+
+        return 0;
+}
+
 static int blizzard_enable_plane(int plane, int enable)
 {
         if (enable)
@@ -1285,7 +1364,8 @@ static void blizzard_get_caps(int plane, struct omapfb_caps *caps)
         caps->ctrl |= OMAPFB_CAPS_MANUAL_UPDATE |
                 OMAPFB_CAPS_WINDOW_PIXEL_DOUBLE |
                 OMAPFB_CAPS_WINDOW_SCALE |
-                OMAPFB_CAPS_WINDOW_OVERLAY;
+                OMAPFB_CAPS_WINDOW_OVERLAY |
+                OMAPFB_CAPS_WINDOW_ROTATE;
         if (blizzard.te_connected)
                 caps->ctrl |= OMAPFB_CAPS_TEARSYNC;
         caps->wnd_color |= (1 << OMAPFB_COLOR_RGB565) |
@@ -1560,6 +1640,7 @@ struct lcd_ctrl blizzard_ctrl = {
         .setup_plane            = blizzard_setup_plane,
         .set_scale              = blizzard_set_scale,
         .enable_plane           = blizzard_enable_plane,
+        .set_rotate             = blizzard_set_rotate,
         .update_window          = blizzard_update_window_async,
         .sync                   = blizzard_sync,
         .suspend                = blizzard_suspend,
diff --git a/drivers/video/omap/dispc.c b/drivers/video/omap/dispc.c
index 148cbcc39602..80a11d078df4 100644
--- a/drivers/video/omap/dispc.c
+++ b/drivers/video/omap/dispc.c
@@ -155,6 +155,8 @@ struct resmap {
         unsigned long   *map;
 };
 
+#define MAX_IRQ_HANDLERS            4
+
 static struct {
         void __iomem    *base;
 
@@ -167,9 +169,11 @@ static struct {
 
         int             ext_mode;
 
-        unsigned long   enabled_irqs;
-        void            (*irq_callback)(void *);
-        void            *irq_callback_data;
+        struct {
+                u32     irq_mask;
+                void    (*callback)(void *);
+                void    *data;
+        } irq_handlers[MAX_IRQ_HANDLERS];
         struct completion       frame_done;
 
         int             fir_hinc[OMAPFB_PLANE_NUM];
@@ -212,9 +216,9 @@ static void enable_rfbi_mode(int enable)
         dispc_write_reg(DISPC_CONTROL, l);
 
         /* Set bypass mode in RFBI module */
-        l = __raw_readl(IO_ADDRESS(RFBI_CONTROL));
+        l = __raw_readl(OMAP2_IO_ADDRESS(RFBI_CONTROL));
         l |= enable ? 0 : (1 << 1);
-        __raw_writel(l, IO_ADDRESS(RFBI_CONTROL));
+        __raw_writel(l, OMAP2_IO_ADDRESS(RFBI_CONTROL));
 }
 
 static void set_lcd_data_lines(int data_lines)
@@ -286,7 +290,7 @@ static void setup_plane_fifo(int plane, int ext_mode)
         BUG_ON(plane > 2);
 
         l = dispc_read_reg(fsz_reg[plane]);
-        l &= FLD_MASK(0, 9);
+        l &= FLD_MASK(0, 11);
         if (ext_mode) {
                 low = l * 3 / 4;
                 high = l;
@@ -294,7 +298,7 @@ static void setup_plane_fifo(int plane, int ext_mode)
                 low = l / 4;
                 high = l * 3 / 4;
         }
-        MOD_REG_FLD(ftrs_reg[plane], FLD_MASK(16, 9) | FLD_MASK(0, 9),
+        MOD_REG_FLD(ftrs_reg[plane], FLD_MASK(16, 12) | FLD_MASK(0, 12),
                         (high << 16) | low);
 }
 
@@ -809,57 +813,74 @@ static void set_lcd_timings(void)
         panel->pixel_clock = fck / lck_div / pck_div / 1000;
 }
 
-int omap_dispc_request_irq(void (*callback)(void *data), void *data)
+static void recalc_irq_mask(void)
 {
-        int r = 0;
+        int i;
+        unsigned long irq_mask = DISPC_IRQ_MASK_ERROR;
 
-        BUG_ON(callback == NULL);
+        for (i = 0; i < MAX_IRQ_HANDLERS; i++) {
+                if (!dispc.irq_handlers[i].callback)
+                        continue;
 
-        if (dispc.irq_callback)
-                r = -EBUSY;
-        else {
-                dispc.irq_callback = callback;
-                dispc.irq_callback_data = data;
+                irq_mask |= dispc.irq_handlers[i].irq_mask;
         }
 
-        return r;
-}
-EXPORT_SYMBOL(omap_dispc_request_irq);
-
-void omap_dispc_enable_irqs(int irq_mask)
-{
         enable_lcd_clocks(1);
-        dispc.enabled_irqs = irq_mask;
-        irq_mask |= DISPC_IRQ_MASK_ERROR;
         MOD_REG_FLD(DISPC_IRQENABLE, 0x7fff, irq_mask);
         enable_lcd_clocks(0);
 }
-EXPORT_SYMBOL(omap_dispc_enable_irqs);
 
-void omap_dispc_disable_irqs(int irq_mask)
+int omap_dispc_request_irq(unsigned long irq_mask, void (*callback)(void *data),
+                           void *data)
 {
-        enable_lcd_clocks(1);
-        dispc.enabled_irqs &= ~irq_mask;
-        irq_mask &= ~DISPC_IRQ_MASK_ERROR;
-        MOD_REG_FLD(DISPC_IRQENABLE, 0x7fff, irq_mask);
-        enable_lcd_clocks(0);
+        int i;
+
+        BUG_ON(callback == NULL);
+
+        for (i = 0; i < MAX_IRQ_HANDLERS; i++) {
+                if (dispc.irq_handlers[i].callback)
+                        continue;
+
+                dispc.irq_handlers[i].irq_mask = irq_mask;
+                dispc.irq_handlers[i].callback = callback;
+                dispc.irq_handlers[i].data = data;
+                recalc_irq_mask();
+
+                return 0;
+        }
+
+        return -EBUSY;
 }
-EXPORT_SYMBOL(omap_dispc_disable_irqs);
+EXPORT_SYMBOL(omap_dispc_request_irq);
 
-void omap_dispc_free_irq(void)
+void omap_dispc_free_irq(unsigned long irq_mask, void (*callback)(void *data),
+                         void *data)
 {
-        enable_lcd_clocks(1);
-        omap_dispc_disable_irqs(DISPC_IRQ_MASK_ALL);
-        dispc.irq_callback = NULL;
-        dispc.irq_callback_data = NULL;
-        enable_lcd_clocks(0);
+        int i;
+
+        for (i = 0; i < MAX_IRQ_HANDLERS; i++) {
+                if (dispc.irq_handlers[i].callback == callback &&
+                    dispc.irq_handlers[i].data == data) {
+                        dispc.irq_handlers[i].irq_mask = 0;
+                        dispc.irq_handlers[i].callback = NULL;
+                        dispc.irq_handlers[i].data = NULL;
+                        recalc_irq_mask();
+                        return;
+                }
+        }
+
+        BUG();
 }
 EXPORT_SYMBOL(omap_dispc_free_irq);
 
 static irqreturn_t omap_dispc_irq_handler(int irq, void *dev)
 {
-        u32 stat = dispc_read_reg(DISPC_IRQSTATUS);
+        u32 stat;
+        int i = 0;
+
+        enable_lcd_clocks(1);
 
+        stat = dispc_read_reg(DISPC_IRQSTATUS);
         if (stat & DISPC_IRQ_FRAMEMASK)
                 complete(&dispc.frame_done);
 
@@ -870,11 +891,17 @@ static irqreturn_t omap_dispc_irq_handler(int irq, void *dev)
                 }
         }
 
-        if ((stat & dispc.enabled_irqs) && dispc.irq_callback)
-                dispc.irq_callback(dispc.irq_callback_data);
+        for (i = 0; i < MAX_IRQ_HANDLERS; i++) {
+                if (unlikely(dispc.irq_handlers[i].callback &&
+                             (stat & dispc.irq_handlers[i].irq_mask)))
+                        dispc.irq_handlers[i].callback(
+                                                dispc.irq_handlers[i].data);
+        }
 
         dispc_write_reg(DISPC_IRQSTATUS, stat);
 
+        enable_lcd_clocks(0);
+
         return IRQ_HANDLED;
 }
 
@@ -913,18 +940,13 @@ static void put_dss_clocks(void)
 
 static void enable_lcd_clocks(int enable)
 {
-        if (enable)
+        if (enable) {
+                clk_enable(dispc.dss_ick);
                 clk_enable(dispc.dss1_fck);
-        else
+        } else {
                 clk_disable(dispc.dss1_fck);
-}
-
-static void enable_interface_clocks(int enable)
-{
-        if (enable)
-                clk_enable(dispc.dss_ick);
-        else
                 clk_disable(dispc.dss_ick);
+        }
 }
 
 static void enable_digit_clocks(int enable)
@@ -1365,7 +1387,6 @@ static int omap_dispc_init(struct omapfb_device *fbdev, int ext_mode,
         if ((r = get_dss_clocks()) < 0)
                 goto fail0;
 
-        enable_interface_clocks(1);
         enable_lcd_clocks(1);
 
 #ifdef CONFIG_FB_OMAP_BOOTLOADER_INIT
@@ -1396,10 +1417,10 @@ static int omap_dispc_init(struct omapfb_device *fbdev, int ext_mode,
                 enable_digit_clocks(0);
         }
 
-        /* Enable smart idle and autoidle */
-        l = dispc_read_reg(DISPC_CONTROL);
+        /* Enable smart standby/idle, autoidle and wakeup */
+        l = dispc_read_reg(DISPC_SYSCONFIG);
         l &= ~((3 << 12) | (3 << 3));
-        l |= (2 << 12) | (2 << 3) | (1 << 0);
+        l |= (2 << 12) | (2 << 3) | (1 << 2) | (1 << 0);
         dispc_write_reg(DISPC_SYSCONFIG, l);
         omap_writel(1 << 0, DSS_BASE + DSS_SYSCONFIG);
 
@@ -1409,10 +1430,9 @@ static int omap_dispc_init(struct omapfb_device *fbdev, int ext_mode,
         dispc_write_reg(DISPC_CONFIG, l);
 
         l = dispc_read_reg(DISPC_IRQSTATUS);
-        dispc_write_reg(l, DISPC_IRQSTATUS);
+        dispc_write_reg(DISPC_IRQSTATUS, l);
 
-        /* Enable those that we handle always */
-        omap_dispc_enable_irqs(DISPC_IRQ_FRAMEMASK);
+        recalc_irq_mask();
 
         if ((r = request_irq(INT_24XX_DSS_IRQ, omap_dispc_irq_handler,
                            0, MODULE_NAME, fbdev)) < 0) {
@@ -1421,7 +1441,7 @@ static int omap_dispc_init(struct omapfb_device *fbdev, int ext_mode,
         }
 
         /* L3 firewall setting: enable access to OCM RAM */
-        __raw_writel(0x402000b0, IO_ADDRESS(0x680050a0));
+        __raw_writel(0x402000b0, OMAP2_IO_ADDRESS(0x680050a0));
 
         if ((r = alloc_palette_ram()) < 0)
                 goto fail2;
@@ -1469,7 +1489,6 @@ fail2:
         free_irq(INT_24XX_DSS_IRQ, fbdev);
 fail1:
         enable_lcd_clocks(0);
-        enable_interface_clocks(0);
         put_dss_clocks();
 fail0:
         iounmap(dispc.base);
@@ -1487,7 +1506,6 @@ static void omap_dispc_cleanup(void)
         cleanup_fbmem();
         free_palette_ram();
         free_irq(INT_24XX_DSS_IRQ, dispc.fbdev);
-        enable_interface_clocks(0);
         put_dss_clocks();
         iounmap(dispc.base);
 }
diff --git a/drivers/video/omap/dispc.h b/drivers/video/omap/dispc.h
index ef720a78f6d5..c15ea77f0604 100644
--- a/drivers/video/omap/dispc.h
+++ b/drivers/video/omap/dispc.h
@@ -37,9 +37,10 @@ extern void omap_dispc_set_lcd_size(int width, int height);
 extern void omap_dispc_enable_lcd_out(int enable);
 extern void omap_dispc_enable_digit_out(int enable);
 
-extern int  omap_dispc_request_irq(void (*callback)(void *data), void *data);
-extern void omap_dispc_free_irq(void);
+extern int omap_dispc_request_irq(unsigned long irq_mask,
+                                   void (*callback)(void *data), void *data);
+extern void omap_dispc_free_irq(unsigned long irq_mask,
+                                 void (*callback)(void *data), void *data);
 
 extern const struct lcd_ctrl omap2_int_ctrl;
-
 #endif
diff --git a/drivers/video/omap/hwa742.c b/drivers/video/omap/hwa742.c
index 5d4f34887a22..ca51583ec98a 100644
--- a/drivers/video/omap/hwa742.c
+++ b/drivers/video/omap/hwa742.c
@@ -131,7 +131,7 @@ struct {
 
         struct omapfb_device    *fbdev;
         struct lcd_ctrl_extif   *extif;
-        struct lcd_ctrl         *int_ctrl;
+        const struct lcd_ctrl   *int_ctrl;
 
         struct clk              *sys_ck;
 } hwa742;
diff --git a/drivers/video/omap/lcd_2430sdp.c b/drivers/video/omap/lcd_2430sdp.c
new file mode 100644
index 000000000000..393712b6f369
--- /dev/null
+++ b/drivers/video/omap/lcd_2430sdp.c
@@ -0,0 +1,202 @@
+/*
+ * LCD panel support for the TI 2430SDP board
+ *
+ * Copyright (C) 2007 MontaVista
+ * Author: Hunyue Yau <hyau@mvista.com>
+ *
+ * Derived from drivers/video/omap/lcd-apollon.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/delay.h>
+#include <linux/gpio.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define SDP2430_LCD_PANEL_BACKLIGHT_GPIO        91
+#define SDP2430_LCD_PANEL_ENABLE_GPIO           154
+#define SDP3430_LCD_PANEL_BACKLIGHT_GPIO        24
+#define SDP3430_LCD_PANEL_ENABLE_GPIO           28
+
+static unsigned backlight_gpio;
+static unsigned enable_gpio;
+
+#define LCD_PIXCLOCK_MAX                5400 /* freq 5.4 MHz */
+#define PM_RECEIVER             TWL4030_MODULE_PM_RECEIVER
+#define ENABLE_VAUX2_DEDICATED  0x09
+#define ENABLE_VAUX2_DEV_GRP    0x20
+#define ENABLE_VAUX3_DEDICATED  0x03
+#define ENABLE_VAUX3_DEV_GRP    0x20
+
+#define ENABLE_VPLL2_DEDICATED          0x05
+#define ENABLE_VPLL2_DEV_GRP            0xE0
+#define TWL4030_VPLL2_DEV_GRP           0x33
+#define TWL4030_VPLL2_DEDICATED         0x36
+
+#define t2_out(c, r, v) twl4030_i2c_write_u8(c, r, v)
+
+
+static int sdp2430_panel_init(struct lcd_panel *panel,
+                                struct omapfb_device *fbdev)
+{
+        if (machine_is_omap_3430sdp()) {
+                enable_gpio    = SDP3430_LCD_PANEL_ENABLE_GPIO;
+                backlight_gpio = SDP3430_LCD_PANEL_BACKLIGHT_GPIO;
+        } else {
+                enable_gpio    = SDP2430_LCD_PANEL_ENABLE_GPIO;
+                backlight_gpio = SDP2430_LCD_PANEL_BACKLIGHT_GPIO;
+        }
+
+        gpio_request(enable_gpio, "LCD enable");        /* LCD panel */
+        gpio_request(backlight_gpio, "LCD bl");         /* LCD backlight */
+        gpio_direction_output(enable_gpio, 0);
+        gpio_direction_output(backlight_gpio, 0);
+
+        return 0;
+}
+
+static void sdp2430_panel_cleanup(struct lcd_panel *panel)
+{
+        gpio_free(backlight_gpio);
+        gpio_free(enable_gpio);
+}
+
+static int sdp2430_panel_enable(struct lcd_panel *panel)
+{
+        u8 ded_val, ded_reg;
+        u8 grp_val, grp_reg;
+
+        if (machine_is_omap_3430sdp()) {
+                ded_reg = TWL4030_VAUX3_DEDICATED;
+                ded_val = ENABLE_VAUX3_DEDICATED;
+                grp_reg = TWL4030_VAUX3_DEV_GRP;
+                grp_val = ENABLE_VAUX3_DEV_GRP;
+
+                if (omap_rev() > OMAP3430_REV_ES1_0) {
+                        t2_out(PM_RECEIVER, ENABLE_VPLL2_DEDICATED,
+                                        TWL4030_VPLL2_DEDICATED);
+                        t2_out(PM_RECEIVER, ENABLE_VPLL2_DEV_GRP,
+                                        TWL4030_VPLL2_DEV_GRP);
+                }
+        } else {
+                ded_reg = TWL4030_VAUX2_DEDICATED;
+                ded_val = ENABLE_VAUX2_DEDICATED;
+                grp_reg = TWL4030_VAUX2_DEV_GRP;
+                grp_val = ENABLE_VAUX2_DEV_GRP;
+        }
+
+        gpio_set_value(enable_gpio, 1);
+        gpio_set_value(backlight_gpio, 1);
+
+        if (0 != t2_out(PM_RECEIVER, ded_val, ded_reg))
+                return -EIO;
+        if (0 != t2_out(PM_RECEIVER, grp_val, grp_reg))
+                return -EIO;
+
+        return 0;
+}
+
+static void sdp2430_panel_disable(struct lcd_panel *panel)
+{
+        gpio_set_value(enable_gpio, 0);
+        gpio_set_value(backlight_gpio, 0);
+        if (omap_rev() > OMAP3430_REV_ES1_0) {
+                t2_out(PM_RECEIVER, 0x0, TWL4030_VPLL2_DEDICATED);
+                t2_out(PM_RECEIVER, 0x0, TWL4030_VPLL2_DEV_GRP);
+                msleep(4);
+        }
+}
+
+static unsigned long sdp2430_panel_get_caps(struct lcd_panel *panel)
+{
+        return 0;
+}
+
+struct lcd_panel sdp2430_panel = {
+        .name           = "sdp2430",
+        .config         = OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+                          OMAP_LCDC_INV_HSYNC,
+
+        .bpp            = 16,
+        .data_lines     = 16,
+        .x_res          = 240,
+        .y_res          = 320,
+        .hsw            = 3,            /* hsync_len (4) - 1 */
+        .hfp            = 3,            /* right_margin (4) - 1 */
+        .hbp            = 39,           /* left_margin (40) - 1 */
+        .vsw            = 1,            /* vsync_len (2) - 1 */
+        .vfp            = 2,            /* lower_margin */
+        .vbp            = 7,            /* upper_margin (8) - 1 */
+
+        .pixel_clock    = LCD_PIXCLOCK_MAX,
+
+        .init           = sdp2430_panel_init,
+        .cleanup        = sdp2430_panel_cleanup,
+        .enable         = sdp2430_panel_enable,
+        .disable        = sdp2430_panel_disable,
+        .get_caps       = sdp2430_panel_get_caps,
+};
+
+static int sdp2430_panel_probe(struct platform_device *pdev)
+{
+        omapfb_register_panel(&sdp2430_panel);
+        return 0;
+}
+
+static int sdp2430_panel_remove(struct platform_device *pdev)
+{
+        return 0;
+}
+
+static int sdp2430_panel_suspend(struct platform_device *pdev,
+                                        pm_message_t mesg)
+{
+        return 0;
+}
+
+static int sdp2430_panel_resume(struct platform_device *pdev)
+{
+        return 0;
+}
+
+struct platform_driver sdp2430_panel_driver = {
+        .probe          = sdp2430_panel_probe,
+        .remove         = sdp2430_panel_remove,
+        .suspend        = sdp2430_panel_suspend,
+        .resume         = sdp2430_panel_resume,
+        .driver         = {
+                .name   = "sdp2430_lcd",
+                .owner  = THIS_MODULE,
+        },
+};
+
+static int __init sdp2430_panel_drv_init(void)
+{
+        return platform_driver_register(&sdp2430_panel_driver);
+}
+
+static void __exit sdp2430_panel_drv_exit(void)
+{
+        platform_driver_unregister(&sdp2430_panel_driver);
+}
+
+module_init(sdp2430_panel_drv_init);
+module_exit(sdp2430_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_ams_delta.c b/drivers/video/omap/lcd_ams_delta.c
new file mode 100644
index 000000000000..1f7439955e02
--- /dev/null
+++ b/drivers/video/omap/lcd_ams_delta.c
@@ -0,0 +1,137 @@
+/*
+ * Based on drivers/video/omap/lcd_inn1510.c
+ *
+ * LCD panel support for the Amstrad E3 (Delta) videophone.
+ *
+ * Copyright (C) 2006 Jonathan McDowell <noodles@earth.li>
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/io.h>
+#include <linux/delay.h>
+
+#include <mach/board-ams-delta.h>
+#include <mach/hardware.h>
+#include <mach/omapfb.h>
+
+#define AMS_DELTA_DEFAULT_CONTRAST      112
+
+static int ams_delta_panel_init(struct lcd_panel *panel,
+                struct omapfb_device *fbdev)
+{
+        return 0;
+}
+
+static void ams_delta_panel_cleanup(struct lcd_panel *panel)
+{
+}
+
+static int ams_delta_panel_enable(struct lcd_panel *panel)
+{
+        ams_delta_latch2_write(AMS_DELTA_LATCH2_LCD_NDISP,
+                        AMS_DELTA_LATCH2_LCD_NDISP);
+        ams_delta_latch2_write(AMS_DELTA_LATCH2_LCD_VBLEN,
+                        AMS_DELTA_LATCH2_LCD_VBLEN);
+
+        omap_writeb(1, OMAP_PWL_CLK_ENABLE);
+        omap_writeb(AMS_DELTA_DEFAULT_CONTRAST, OMAP_PWL_ENABLE);
+
+        return 0;
+}
+
+static void ams_delta_panel_disable(struct lcd_panel *panel)
+{
+        ams_delta_latch2_write(AMS_DELTA_LATCH2_LCD_VBLEN, 0);
+        ams_delta_latch2_write(AMS_DELTA_LATCH2_LCD_NDISP, 0);
+}
+
+static unsigned long ams_delta_panel_get_caps(struct lcd_panel *panel)
+{
+        return 0;
+}
+
+static struct lcd_panel ams_delta_panel = {
+        .name           = "ams-delta",
+        .config         = 0,
+
+        .bpp            = 12,
+        .data_lines     = 16,
+        .x_res          = 480,
+        .y_res          = 320,
+        .pixel_clock    = 4687,
+        .hsw            = 3,
+        .hfp            = 1,
+        .hbp            = 1,
+        .vsw            = 1,
+        .vfp            = 0,
+        .vbp            = 0,
+        .pcd            = 0,
+        .acb            = 37,
+
+        .init           = ams_delta_panel_init,
+        .cleanup        = ams_delta_panel_cleanup,
+        .enable         = ams_delta_panel_enable,
+        .disable        = ams_delta_panel_disable,
+        .get_caps       = ams_delta_panel_get_caps,
+};
+
+static int ams_delta_panel_probe(struct platform_device *pdev)
+{
+        omapfb_register_panel(&ams_delta_panel);
+        return 0;
+}
+
+static int ams_delta_panel_remove(struct platform_device *pdev)
+{
+        return 0;
+}
+
+static int ams_delta_panel_suspend(struct platform_device *pdev,
+                pm_message_t mesg)
+{
+        return 0;
+}
+
+static int ams_delta_panel_resume(struct platform_device *pdev)
+{
+        return 0;
+}
+
+struct platform_driver ams_delta_panel_driver = {
+        .probe          = ams_delta_panel_probe,
+        .remove         = ams_delta_panel_remove,
+        .suspend        = ams_delta_panel_suspend,
+        .resume         = ams_delta_panel_resume,
+        .driver         = {
+                .name   = "lcd_ams_delta",
+                .owner  = THIS_MODULE,
+        },
+};
+
+static int ams_delta_panel_drv_init(void)
+{
+        return platform_driver_register(&ams_delta_panel_driver);
+}
+
+static void ams_delta_panel_drv_cleanup(void)
+{
+        platform_driver_unregister(&ams_delta_panel_driver);
+}
+
+module_init(ams_delta_panel_drv_init);
+module_exit(ams_delta_panel_drv_cleanup);
diff --git a/drivers/video/omap/lcd_apollon.c b/drivers/video/omap/lcd_apollon.c
new file mode 100644
index 000000000000..626ae3a532ff
--- /dev/null
+++ b/drivers/video/omap/lcd_apollon.c
@@ -0,0 +1,138 @@
+/*
+ * LCD panel support for the Samsung OMAP2 Apollon board
+ *
+ * Copyright (C) 2005,2006 Samsung Electronics
+ * Author: Kyungmin Park <kyungmin.park@samsung.com>
+ *
+ * Derived from drivers/video/omap/lcd-h4.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+
+#include <mach/gpio.h>
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+
+/* #define USE_35INCH_LCD 1 */
+
+static int apollon_panel_init(struct lcd_panel *panel,
+                                struct omapfb_device *fbdev)
+{
+        /* configure LCD PWR_EN */
+        omap_cfg_reg(M21_242X_GPIO11);
+        return 0;
+}
+
+static void apollon_panel_cleanup(struct lcd_panel *panel)
+{
+}
+
+static int apollon_panel_enable(struct lcd_panel *panel)
+{
+        return 0;
+}
+
+static void apollon_panel_disable(struct lcd_panel *panel)
+{
+}
+
+static unsigned long apollon_panel_get_caps(struct lcd_panel *panel)
+{
+        return 0;
+}
+
+struct lcd_panel apollon_panel = {
+        .name           = "apollon",
+        .config         = OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+                          OMAP_LCDC_INV_HSYNC,
+
+        .bpp            = 16,
+        .data_lines     = 18,
+#ifdef USE_35INCH_LCD
+        .x_res          = 240,
+        .y_res          = 320,
+        .hsw            = 2,
+        .hfp            = 3,
+        .hbp            = 9,
+        .vsw            = 4,
+        .vfp            = 3,
+        .vbp            = 5,
+#else
+        .x_res          = 480,
+        .y_res          = 272,
+        .hsw            = 41,
+        .hfp            = 2,
+        .hbp            = 2,
+        .vsw            = 10,
+        .vfp            = 2,
+        .vbp            = 2,
+#endif
+        .pixel_clock    = 6250,
+
+        .init           = apollon_panel_init,
+        .cleanup        = apollon_panel_cleanup,
+        .enable         = apollon_panel_enable,
+        .disable        = apollon_panel_disable,
+        .get_caps       = apollon_panel_get_caps,
+};
+
+static int apollon_panel_probe(struct platform_device *pdev)
+{
+        omapfb_register_panel(&apollon_panel);
+        return 0;
+}
+
+static int apollon_panel_remove(struct platform_device *pdev)
+{
+        return 0;
+}
+
+static int apollon_panel_suspend(struct platform_device *pdev,
+                                  pm_message_t mesg)
+{
+        return 0;
+}
+
+static int apollon_panel_resume(struct platform_device *pdev)
+{
+        return 0;
+}
+
+struct platform_driver apollon_panel_driver = {
+        .probe          = apollon_panel_probe,
+        .remove         = apollon_panel_remove,
+        .suspend        = apollon_panel_suspend,
+        .resume         = apollon_panel_resume,
+        .driver         = {
+                .name   = "apollon_lcd",
+                .owner  = THIS_MODULE,
+        },
+};
+
+static int __init apollon_panel_drv_init(void)
+{
+        return platform_driver_register(&apollon_panel_driver);
+}
+
+static void __exit apollon_panel_drv_exit(void)
+{
+        platform_driver_unregister(&apollon_panel_driver);
+}
+
+module_init(apollon_panel_drv_init);
+module_exit(apollon_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_h3.c b/drivers/video/omap/lcd_h3.c
index 2486237ebba5..417ae5efa8bb 100644
--- a/drivers/video/omap/lcd_h3.c
+++ b/drivers/video/omap/lcd_h3.c
@@ -124,12 +124,12 @@ struct platform_driver h3_panel_driver = {
         },
 };
 
-static int h3_panel_drv_init(void)
+static int __init h3_panel_drv_init(void)
 {
         return platform_driver_register(&h3_panel_driver);
 }
 
-static void h3_panel_drv_cleanup(void)
+static void __exit h3_panel_drv_cleanup(void)
 {
         platform_driver_unregister(&h3_panel_driver);
 }
diff --git a/drivers/video/omap/lcd_h4.c b/drivers/video/omap/lcd_h4.c
index 6ff56430341b..0c398bda7601 100644
--- a/drivers/video/omap/lcd_h4.c
+++ b/drivers/video/omap/lcd_h4.c
@@ -102,12 +102,12 @@ static struct platform_driver h4_panel_driver = {
         },
 };
 
-static int h4_panel_drv_init(void)
+static int __init h4_panel_drv_init(void)
 {
         return platform_driver_register(&h4_panel_driver);
 }
 
-static void h4_panel_drv_cleanup(void)
+static void __exit h4_panel_drv_cleanup(void)
 {
         platform_driver_unregister(&h4_panel_driver);
 }
diff --git a/drivers/video/omap/lcd_inn1510.c b/drivers/video/omap/lcd_inn1510.c
index 6953ed4b5820..cdbd8bb607be 100644
--- a/drivers/video/omap/lcd_inn1510.c
+++ b/drivers/video/omap/lcd_inn1510.c
@@ -109,12 +109,12 @@ struct platform_driver innovator1510_panel_driver = {
         },
 };
 
-static int innovator1510_panel_drv_init(void)
+static int __init innovator1510_panel_drv_init(void)
 {
         return platform_driver_register(&innovator1510_panel_driver);
 }
 
-static void innovator1510_panel_drv_cleanup(void)
+static void __exit innovator1510_panel_drv_cleanup(void)
 {
         platform_driver_unregister(&innovator1510_panel_driver);
 }
diff --git a/drivers/video/omap/lcd_inn1610.c b/drivers/video/omap/lcd_inn1610.c
index 4c4f7ee6d733..268f7f808a4e 100644
--- a/drivers/video/omap/lcd_inn1610.c
+++ b/drivers/video/omap/lcd_inn1610.c
@@ -133,12 +133,12 @@ struct platform_driver innovator1610_panel_driver = {
         },
 };
 
-static int innovator1610_panel_drv_init(void)
+static int __init innovator1610_panel_drv_init(void)
 {
         return platform_driver_register(&innovator1610_panel_driver);
 }
 
-static void innovator1610_panel_drv_cleanup(void)
+static void __exit innovator1610_panel_drv_cleanup(void)
 {
         platform_driver_unregister(&innovator1610_panel_driver);
 }
diff --git a/drivers/video/omap/lcd_ldp.c b/drivers/video/omap/lcd_ldp.c
new file mode 100644
index 000000000000..dbfe8974fb94
--- /dev/null
+++ b/drivers/video/omap/lcd_ldp.c
@@ -0,0 +1,200 @@
+/*
+ * LCD panel support for the TI LDP board
+ *
+ * Copyright (C) 2007 WindRiver
+ * Author: Stanley Miao <stanley.miao@windriver.com>
+ *
+ * Derived from drivers/video/omap/lcd-2430sdp.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/delay.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/gpio.h>
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_PANEL_BACKLIGHT_GPIO        (15 + OMAP_MAX_GPIO_LINES)
+#define LCD_PANEL_ENABLE_GPIO           (7 + OMAP_MAX_GPIO_LINES)
+
+#define LCD_PANEL_RESET_GPIO            55
+#define LCD_PANEL_QVGA_GPIO             56
+
+#ifdef CONFIG_FB_OMAP_LCD_VGA
+#define LCD_XRES                480
+#define LCD_YRES                640
+#define LCD_PIXCLOCK_MAX        41700
+#else
+#define LCD_XRES                240
+#define LCD_YRES                320
+#define LCD_PIXCLOCK_MAX        185186
+#endif
+
+#define PM_RECEIVER             TWL4030_MODULE_PM_RECEIVER
+#define ENABLE_VAUX2_DEDICATED  0x09
+#define ENABLE_VAUX2_DEV_GRP    0x20
+#define ENABLE_VAUX3_DEDICATED  0x03
+#define ENABLE_VAUX3_DEV_GRP    0x20
+
+#define ENABLE_VPLL2_DEDICATED          0x05
+#define ENABLE_VPLL2_DEV_GRP            0xE0
+#define TWL4030_VPLL2_DEV_GRP           0x33
+#define TWL4030_VPLL2_DEDICATED         0x36
+
+#define t2_out(c, r, v) twl4030_i2c_write_u8(c, r, v)
+
+
+static int ldp_panel_init(struct lcd_panel *panel,
+                                struct omapfb_device *fbdev)
+{
+        gpio_request(LCD_PANEL_RESET_GPIO, "lcd reset");
+        gpio_request(LCD_PANEL_QVGA_GPIO, "lcd qvga");
+        gpio_request(LCD_PANEL_ENABLE_GPIO, "lcd panel");
+        gpio_request(LCD_PANEL_BACKLIGHT_GPIO, "lcd backlight");
+
+        gpio_direction_output(LCD_PANEL_QVGA_GPIO, 0);
+        gpio_direction_output(LCD_PANEL_RESET_GPIO, 0);
+        gpio_direction_output(LCD_PANEL_ENABLE_GPIO, 0);
+        gpio_direction_output(LCD_PANEL_BACKLIGHT_GPIO, 0);
+
+#ifdef CONFIG_FB_OMAP_LCD_VGA
+        gpio_set_value(LCD_PANEL_QVGA_GPIO, 0);
+#else
+        gpio_set_value(LCD_PANEL_QVGA_GPIO, 1);
+#endif
+        gpio_set_value(LCD_PANEL_RESET_GPIO, 1);
+
+        return 0;
+}
+
+static void ldp_panel_cleanup(struct lcd_panel *panel)
+{
+        gpio_free(LCD_PANEL_BACKLIGHT_GPIO);
+        gpio_free(LCD_PANEL_ENABLE_GPIO);
+        gpio_free(LCD_PANEL_QVGA_GPIO);
+        gpio_free(LCD_PANEL_RESET_GPIO);
+}
+
+static int ldp_panel_enable(struct lcd_panel *panel)
+{
+        if (0 != t2_out(PM_RECEIVER, ENABLE_VPLL2_DEDICATED,
+                        TWL4030_VPLL2_DEDICATED))
+                return -EIO;
+        if (0 != t2_out(PM_RECEIVER, ENABLE_VPLL2_DEV_GRP,
+                        TWL4030_VPLL2_DEV_GRP))
+                return -EIO;
+
+        gpio_direction_output(LCD_PANEL_ENABLE_GPIO, 1);
+        gpio_direction_output(LCD_PANEL_BACKLIGHT_GPIO, 1);
+
+        if (0 != t2_out(PM_RECEIVER, ENABLE_VAUX3_DEDICATED,
+                                TWL4030_VAUX3_DEDICATED))
+                return -EIO;
+        if (0 != t2_out(PM_RECEIVER, ENABLE_VAUX3_DEV_GRP,
+                                TWL4030_VAUX3_DEV_GRP))
+                return -EIO;
+
+        return 0;
+}
+
+static void ldp_panel_disable(struct lcd_panel *panel)
+{
+        gpio_direction_output(LCD_PANEL_ENABLE_GPIO, 0);
+        gpio_direction_output(LCD_PANEL_BACKLIGHT_GPIO, 0);
+
+        t2_out(PM_RECEIVER, 0x0, TWL4030_VPLL2_DEDICATED);
+        t2_out(PM_RECEIVER, 0x0, TWL4030_VPLL2_DEV_GRP);
+        msleep(4);
+}
+
+static unsigned long ldp_panel_get_caps(struct lcd_panel *panel)
+{
+        return 0;
+}
+
+struct lcd_panel ldp_panel = {
+        .name           = "ldp",
+        .config         = OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+                          OMAP_LCDC_INV_HSYNC,
+
+        .bpp            = 16,
+        .data_lines     = 18,
+        .x_res          = LCD_XRES,
+        .y_res          = LCD_YRES,
+        .hsw            = 3,            /* hsync_len (4) - 1 */
+        .hfp            = 3,            /* right_margin (4) - 1 */
+        .hbp            = 39,           /* left_margin (40) - 1 */
+        .vsw            = 1,            /* vsync_len (2) - 1 */
+        .vfp            = 2,            /* lower_margin */
+        .vbp            = 7,            /* upper_margin (8) - 1 */
+
+        .pixel_clock    = LCD_PIXCLOCK_MAX,
+
+        .init           = ldp_panel_init,
+        .cleanup        = ldp_panel_cleanup,
+        .enable         = ldp_panel_enable,
+        .disable        = ldp_panel_disable,
+        .get_caps       = ldp_panel_get_caps,
+};
+
+static int ldp_panel_probe(struct platform_device *pdev)
+{
+        omapfb_register_panel(&ldp_panel);
+        return 0;
+}
+
+static int ldp_panel_remove(struct platform_device *pdev)
+{
+        return 0;
+}
+
+static int ldp_panel_suspend(struct platform_device *pdev, pm_message_t mesg)
+{
+        return 0;
+}
+
+static int ldp_panel_resume(struct platform_device *pdev)
+{
+        return 0;
+}
+
+struct platform_driver ldp_panel_driver = {
+        .probe          = ldp_panel_probe,
+        .remove         = ldp_panel_remove,
+        .suspend        = ldp_panel_suspend,
+        .resume         = ldp_panel_resume,
+        .driver         = {
+                .name   = "ldp_lcd",
+                .owner  = THIS_MODULE,
+        },
+};
+
+static int __init ldp_panel_drv_init(void)
+{
+        return platform_driver_register(&ldp_panel_driver);
+}
+
+static void __exit ldp_panel_drv_exit(void)
+{
+        platform_driver_unregister(&ldp_panel_driver);
+}
+
+module_init(ldp_panel_drv_init);
+module_exit(ldp_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_mipid.c b/drivers/video/omap/lcd_mipid.c
new file mode 100644
index 000000000000..918ee8934196
--- /dev/null
+++ b/drivers/video/omap/lcd_mipid.c
@@ -0,0 +1,625 @@
+/*
+ * LCD driver for MIPI DBI-C / DCS compatible LCDs
+ *
+ * Copyright (C) 2006 Nokia Corporation
+ * Author: Imre Deak <imre.deak@nokia.com>
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+#include <linux/device.h>
+#include <linux/delay.h>
+#include <linux/workqueue.h>
+#include <linux/spi/spi.h>
+
+#include <mach/omapfb.h>
+#include <mach/lcd_mipid.h>
+
+#define MIPID_MODULE_NAME               "lcd_mipid"
+
+#define MIPID_CMD_READ_DISP_ID          0x04
+#define MIPID_CMD_READ_RED              0x06
+#define MIPID_CMD_READ_GREEN            0x07
+#define MIPID_CMD_READ_BLUE             0x08
+#define MIPID_CMD_READ_DISP_STATUS      0x09
+#define MIPID_CMD_RDDSDR                0x0F
+#define MIPID_CMD_SLEEP_IN              0x10
+#define MIPID_CMD_SLEEP_OUT             0x11
+#define MIPID_CMD_DISP_OFF              0x28
+#define MIPID_CMD_DISP_ON               0x29
+
+#define MIPID_ESD_CHECK_PERIOD          msecs_to_jiffies(5000)
+
+#define to_mipid_device(p)              container_of(p, struct mipid_device, \
+                                                panel)
+struct mipid_device {
+        int             enabled;
+        int             revision;
+        unsigned int    saved_bklight_level;
+        unsigned long   hw_guard_end;           /* next value of jiffies
+                                                   when we can issue the
+                                                   next sleep in/out command */
+        unsigned long   hw_guard_wait;          /* max guard time in jiffies */
+
+        struct omapfb_device    *fbdev;
+        struct spi_device       *spi;
+        struct mutex            mutex;
+        struct lcd_panel        panel;
+
+        struct workqueue_struct *esd_wq;
+        struct delayed_work     esd_work;
+        void                    (*esd_check)(struct mipid_device *m);
+};
+
+static void mipid_transfer(struct mipid_device *md, int cmd, const u8 *wbuf,
+                           int wlen, u8 *rbuf, int rlen)
+{
+        struct spi_message      m;
+        struct spi_transfer     *x, xfer[4];
+        u16                     w;
+        int                     r;
+
+        BUG_ON(md->spi == NULL);
+
+        spi_message_init(&m);
+
+        memset(xfer, 0, sizeof(xfer));
+        x = &xfer[0];
+
+        cmd &=  0xff;
+        x->tx_buf               = &cmd;
+        x->bits_per_word        = 9;
+        x->len                  = 2;
+        spi_message_add_tail(x, &m);
+
+        if (wlen) {
+                x++;
+                x->tx_buf               = wbuf;
+                x->len                  = wlen;
+                x->bits_per_word        = 9;
+                spi_message_add_tail(x, &m);
+        }
+
+        if (rlen) {
+                x++;
+                x->rx_buf       = &w;
+                x->len          = 1;
+                spi_message_add_tail(x, &m);
+
+                if (rlen > 1) {
+                        /* Arrange for the extra clock before the first
+                         * data bit.
+                         */
+                        x->bits_per_word = 9;
+                        x->len           = 2;
+
+                        x++;
+                        x->rx_buf        = &rbuf[1];
+                        x->len           = rlen - 1;
+                        spi_message_add_tail(x, &m);
+                }
+        }
+
+        r = spi_sync(md->spi, &m);
+        if (r < 0)
+                dev_dbg(&md->spi->dev, "spi_sync %d\n", r);
+
+        if (rlen)
+                rbuf[0] = w & 0xff;
+}
+
+static inline void mipid_cmd(struct mipid_device *md, int cmd)
+{
+        mipid_transfer(md, cmd, NULL, 0, NULL, 0);
+}
+
+static inline void mipid_write(struct mipid_device *md,
+                               int reg, const u8 *buf, int len)
+{
+        mipid_transfer(md, reg, buf, len, NULL, 0);
+}
+
+static inline void mipid_read(struct mipid_device *md,
+                              int reg, u8 *buf, int len)
+{
+        mipid_transfer(md, reg, NULL, 0, buf, len);
+}
+
+static void set_data_lines(struct mipid_device *md, int data_lines)
+{
+        u16 par;
+
+        switch (data_lines) {
+        case 16:
+                par = 0x150;
+                break;
+        case 18:
+                par = 0x160;
+                break;
+        case 24:
+                par = 0x170;
+                break;
+        }
+        mipid_write(md, 0x3a, (u8 *)&par, 2);
+}
+
+static void send_init_string(struct mipid_device *md)
+{
+        u16 initpar[] = { 0x0102, 0x0100, 0x0100 };
+
+        mipid_write(md, 0xc2, (u8 *)initpar, sizeof(initpar));
+        set_data_lines(md, md->panel.data_lines);
+}
+
+static void hw_guard_start(struct mipid_device *md, int guard_msec)
+{
+        md->hw_guard_wait = msecs_to_jiffies(guard_msec);
+        md->hw_guard_end = jiffies + md->hw_guard_wait;
+}
+
+static void hw_guard_wait(struct mipid_device *md)
+{
+        unsigned long wait = md->hw_guard_end - jiffies;
+
+        if ((long)wait > 0 && wait <= md->hw_guard_wait) {
+                set_current_state(TASK_UNINTERRUPTIBLE);
+                schedule_timeout(wait);
+        }
+}
+
+static void set_sleep_mode(struct mipid_device *md, int on)
+{
+        int cmd, sleep_time = 50;
+
+        if (on)
+                cmd = MIPID_CMD_SLEEP_IN;
+        else
+                cmd = MIPID_CMD_SLEEP_OUT;
+        hw_guard_wait(md);
+        mipid_cmd(md, cmd);
+        hw_guard_start(md, 120);
+        /*
+         * When we enable the panel, it seems we _have_ to sleep
+         * 120 ms before sending the init string. When disabling the
+         * panel we'll sleep for the duration of 2 frames, so that the
+         * controller can still provide the PCLK,HS,VS signals.
+         */
+        if (!on)
+                sleep_time = 120;
+        msleep(sleep_time);
+}
+
+static void set_display_state(struct mipid_device *md, int enabled)
+{
+        int cmd = enabled ? MIPID_CMD_DISP_ON : MIPID_CMD_DISP_OFF;
+
+        mipid_cmd(md, cmd);
+}
+
+static int mipid_set_bklight_level(struct lcd_panel *panel, unsigned int level)
+{
+        struct mipid_device *md = to_mipid_device(panel);
+        struct mipid_platform_data *pd = md->spi->dev.platform_data;
+
+        if (pd->get_bklight_max == NULL || pd->set_bklight_level == NULL)
+                return -ENODEV;
+        if (level > pd->get_bklight_max(pd))
+                return -EINVAL;
+        if (!md->enabled) {
+                md->saved_bklight_level = level;
+                return 0;
+        }
+        pd->set_bklight_level(pd, level);
+
+        return 0;
+}
+
+static unsigned int mipid_get_bklight_level(struct lcd_panel *panel)
+{
+        struct mipid_device *md = to_mipid_device(panel);
+        struct mipid_platform_data *pd = md->spi->dev.platform_data;
+
+        if (pd->get_bklight_level == NULL)
+                return -ENODEV;
+        return pd->get_bklight_level(pd);
+}
+
+static unsigned int mipid_get_bklight_max(struct lcd_panel *panel)
+{
+        struct mipid_device *md = to_mipid_device(panel);
+        struct mipid_platform_data *pd = md->spi->dev.platform_data;
+
+        if (pd->get_bklight_max == NULL)
+                return -ENODEV;
+
+        return pd->get_bklight_max(pd);
+}
+
+static unsigned long mipid_get_caps(struct lcd_panel *panel)
+{
+        return OMAPFB_CAPS_SET_BACKLIGHT;
+}
+
+static u16 read_first_pixel(struct mipid_device *md)
+{
+        u16 pixel;
+        u8 red, green, blue;
+
+        mutex_lock(&md->mutex);
+        mipid_read(md, MIPID_CMD_READ_RED, &red, 1);
+        mipid_read(md, MIPID_CMD_READ_GREEN, &green, 1);
+        mipid_read(md, MIPID_CMD_READ_BLUE, &blue, 1);
+        mutex_unlock(&md->mutex);
+
+        switch (md->panel.data_lines) {
+        case 16:
+                pixel = ((red >> 1) << 11) | (green << 5) | (blue >> 1);
+                break;
+        case 24:
+                /* 24 bit -> 16 bit */
+                pixel = ((red >> 3) << 11) | ((green >> 2) << 5) |
+                        (blue >> 3);
+                break;
+        default:
+                pixel = 0;
+                BUG();
+        }
+
+        return pixel;
+}
+
+static int mipid_run_test(struct lcd_panel *panel, int test_num)
+{
+        struct mipid_device *md = to_mipid_device(panel);
+        static const u16 test_values[4] = {
+                0x0000, 0xffff, 0xaaaa, 0x5555,
+        };
+        int i;
+
+        if (test_num != MIPID_TEST_RGB_LINES)
+                return MIPID_TEST_INVALID;
+
+        for (i = 0; i < ARRAY_SIZE(test_values); i++) {
+                int delay;
+                unsigned long tmo;
+
+                omapfb_write_first_pixel(md->fbdev, test_values[i]);
+                tmo = jiffies + msecs_to_jiffies(100);
+                delay = 25;
+                while (1) {
+                        u16 pixel;
+
+                        msleep(delay);
+                        pixel = read_first_pixel(md);
+                        if (pixel == test_values[i])
+                                break;
+                        if (time_after(jiffies, tmo)) {
+                                dev_err(&md->spi->dev,
+                                        "MIPI LCD RGB I/F test failed: "
+                                        "expecting %04x, got %04x\n",
+                                        test_values[i], pixel);
+                                return MIPID_TEST_FAILED;
+                        }
+                        delay = 10;
+                }
+        }
+
+        return 0;
+}
+
+static void ls041y3_esd_recover(struct mipid_device *md)
+{
+        dev_err(&md->spi->dev, "performing LCD ESD recovery\n");
+        set_sleep_mode(md, 1);
+        set_sleep_mode(md, 0);
+}
+
+static void ls041y3_esd_check_mode1(struct mipid_device *md)
+{
+        u8 state1, state2;
+
+        mipid_read(md, MIPID_CMD_RDDSDR, &state1, 1);
+        set_sleep_mode(md, 0);
+        mipid_read(md, MIPID_CMD_RDDSDR, &state2, 1);
+        dev_dbg(&md->spi->dev, "ESD mode 1 state1 %02x state2 %02x\n",
+                state1, state2);
+        /* Each sleep out command will trigger a self diagnostic and flip
+        * Bit6 if the test passes.
+        */
+        if (!((state1 ^ state2) & (1 << 6)))
+                ls041y3_esd_recover(md);
+}
+
+static void ls041y3_esd_check_mode2(struct mipid_device *md)
+{
+        int i;
+        u8 rbuf[2];
+        static const struct {
+                int     cmd;
+                int     wlen;
+                u16     wbuf[3];
+        } *rd, rd_ctrl[7] = {
+                { 0xb0, 4, { 0x0101, 0x01fe, } },
+                { 0xb1, 4, { 0x01de, 0x0121, } },
+                { 0xc2, 4, { 0x0100, 0x0100, } },
+                { 0xbd, 2, { 0x0100, } },
+                { 0xc2, 4, { 0x01fc, 0x0103, } },
+                { 0xb4, 0, },
+                { 0x00, 0, },
+        };
+
+        rd = rd_ctrl;
+        for (i = 0; i < 3; i++, rd++)
+                mipid_write(md, rd->cmd, (u8 *)rd->wbuf, rd->wlen);
+
+        udelay(10);
+        mipid_read(md, rd->cmd, rbuf, 2);
+        rd++;
+
+        for (i = 0; i < 3; i++, rd++) {
+                udelay(10);
+                mipid_write(md, rd->cmd, (u8 *)rd->wbuf, rd->wlen);
+        }
+
+        dev_dbg(&md->spi->dev, "ESD mode 2 state %02x\n", rbuf[1]);
+        if (rbuf[1] == 0x00)
+                ls041y3_esd_recover(md);
+}
+
+static void ls041y3_esd_check(struct mipid_device *md)
+{
+        ls041y3_esd_check_mode1(md);
+        if (md->revision >= 0x88)
+                ls041y3_esd_check_mode2(md);
+}
+
+static void mipid_esd_start_check(struct mipid_device *md)
+{
+        if (md->esd_check != NULL)
+                queue_delayed_work(md->esd_wq, &md->esd_work,
+                                   MIPID_ESD_CHECK_PERIOD);
+}
+
+static void mipid_esd_stop_check(struct mipid_device *md)
+{
+        if (md->esd_check != NULL)
+                cancel_rearming_delayed_workqueue(md->esd_wq, &md->esd_work);
+}
+
+static void mipid_esd_work(struct work_struct *work)
+{
+        struct mipid_device *md = container_of(work, struct mipid_device,
+                                               esd_work.work);
+
+        mutex_lock(&md->mutex);
+        md->esd_check(md);
+        mutex_unlock(&md->mutex);
+        mipid_esd_start_check(md);
+}
+
+static int mipid_enable(struct lcd_panel *panel)
+{
+        struct mipid_device *md = to_mipid_device(panel);
+
+        mutex_lock(&md->mutex);
+
+        if (md->enabled) {
+                mutex_unlock(&md->mutex);
+                return 0;
+        }
+        set_sleep_mode(md, 0);
+        md->enabled = 1;
+        send_init_string(md);
+        set_display_state(md, 1);
+        mipid_set_bklight_level(panel, md->saved_bklight_level);
+        mipid_esd_start_check(md);
+
+        mutex_unlock(&md->mutex);
+        return 0;
+}
+
+static void mipid_disable(struct lcd_panel *panel)
+{
+        struct mipid_device *md = to_mipid_device(panel);
+
+        /*
+         * A final ESD work might be called before returning,
+         * so do this without holding the lock.
+         */
+        mipid_esd_stop_check(md);
+        mutex_lock(&md->mutex);
+
+        if (!md->enabled) {
+                mutex_unlock(&md->mutex);
+                return;
+        }
+        md->saved_bklight_level = mipid_get_bklight_level(panel);
+        mipid_set_bklight_level(panel, 0);
+        set_display_state(md, 0);
+        set_sleep_mode(md, 1);
+        md->enabled = 0;
+
+        mutex_unlock(&md->mutex);
+}
+
+static int panel_enabled(struct mipid_device *md)
+{
+        u32 disp_status;
+        int enabled;
+
+        mipid_read(md, MIPID_CMD_READ_DISP_STATUS, (u8 *)&disp_status, 4);
+        disp_status = __be32_to_cpu(disp_status);
+        enabled = (disp_status & (1 << 17)) && (disp_status & (1 << 10));
+        dev_dbg(&md->spi->dev,
+                "LCD panel %senabled by bootloader (status 0x%04x)\n",
+                enabled ? "" : "not ", disp_status);
+        return enabled;
+}
+
+static int mipid_init(struct lcd_panel *panel,
+                            struct omapfb_device *fbdev)
+{
+        struct mipid_device *md = to_mipid_device(panel);
+
+        md->fbdev = fbdev;
+        md->esd_wq = create_singlethread_workqueue("mipid_esd");
+        if (md->esd_wq == NULL) {
+                dev_err(&md->spi->dev, "can't create ESD workqueue\n");
+                return -ENOMEM;
+        }
+        INIT_DELAYED_WORK(&md->esd_work, mipid_esd_work);
+        mutex_init(&md->mutex);
+
+        md->enabled = panel_enabled(md);
+
+        if (md->enabled)
+                mipid_esd_start_check(md);
+        else
+                md->saved_bklight_level = mipid_get_bklight_level(panel);
+
+        return 0;
+}
+
+static void mipid_cleanup(struct lcd_panel *panel)
+{
+        struct mipid_device *md = to_mipid_device(panel);
+
+        if (md->enabled)
+                mipid_esd_stop_check(md);
+        destroy_workqueue(md->esd_wq);
+}
+
+static struct lcd_panel mipid_panel = {
+        .config         = OMAP_LCDC_PANEL_TFT,
+
+        .bpp            = 16,
+        .x_res          = 800,
+        .y_res          = 480,
+        .pixel_clock    = 21940,
+        .hsw            = 50,
+        .hfp            = 20,
+        .hbp            = 15,
+        .vsw            = 2,
+        .vfp            = 1,
+        .vbp            = 3,
+
+        .init                   = mipid_init,
+        .cleanup                = mipid_cleanup,
+        .enable                 = mipid_enable,
+        .disable                = mipid_disable,
+        .get_caps               = mipid_get_caps,
+        .set_bklight_level      = mipid_set_bklight_level,
+        .get_bklight_level      = mipid_get_bklight_level,
+        .get_bklight_max        = mipid_get_bklight_max,
+        .run_test               = mipid_run_test,
+};
+
+static int mipid_detect(struct mipid_device *md)
+{
+        struct mipid_platform_data *pdata;
+        u8 display_id[3];
+
+        pdata = md->spi->dev.platform_data;
+        if (pdata == NULL) {
+                dev_err(&md->spi->dev, "missing platform data\n");
+                return -ENOENT;
+        }
+
+        mipid_read(md, MIPID_CMD_READ_DISP_ID, display_id, 3);
+        dev_dbg(&md->spi->dev, "MIPI display ID: %02x%02x%02x\n",
+                display_id[0], display_id[1], display_id[2]);
+
+        switch (display_id[0]) {
+        case 0x45:
+                md->panel.name = "lph8923";
+                break;
+        case 0x83:
+                md->panel.name = "ls041y3";
+                md->esd_check = ls041y3_esd_check;
+                break;
+        default:
+                md->panel.name = "unknown";
+                dev_err(&md->spi->dev, "invalid display ID\n");
+                return -ENODEV;
+        }
+
+        md->revision = display_id[1];
+        md->panel.data_lines = pdata->data_lines;
+        pr_info("omapfb: %s rev %02x LCD detected, %d data lines\n",
+                        md->panel.name, md->revision, md->panel.data_lines);
+
+        return 0;
+}
+
+static int mipid_spi_probe(struct spi_device *spi)
+{
+        struct mipid_device *md;
+        int r;
+
+        md = kzalloc(sizeof(*md), GFP_KERNEL);
+        if (md == NULL) {
+                dev_err(&spi->dev, "out of memory\n");
+                return -ENOMEM;
+        }
+
+        spi->mode = SPI_MODE_0;
+        md->spi = spi;
+        dev_set_drvdata(&spi->dev, md);
+        md->panel = mipid_panel;
+
+        r = mipid_detect(md);
+        if (r < 0)
+                return r;
+
+        omapfb_register_panel(&md->panel);
+
+        return 0;
+}
+
+static int mipid_spi_remove(struct spi_device *spi)
+{
+        struct mipid_device *md = dev_get_drvdata(&spi->dev);
+
+        mipid_disable(&md->panel);
+        kfree(md);
+
+        return 0;
+}
+
+static struct spi_driver mipid_spi_driver = {
+        .driver = {
+                .name   = MIPID_MODULE_NAME,
+                .bus    = &spi_bus_type,
+                .owner  = THIS_MODULE,
+        },
+        .probe  = mipid_spi_probe,
+        .remove = __devexit_p(mipid_spi_remove),
+};
+
+static int mipid_drv_init(void)
+{
+        spi_register_driver(&mipid_spi_driver);
+
+        return 0;
+}
+module_init(mipid_drv_init);
+
+static void mipid_drv_cleanup(void)
+{
+        spi_unregister_driver(&mipid_spi_driver);
+}
+module_exit(mipid_drv_cleanup);
+
+MODULE_DESCRIPTION("MIPI display driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/omap/lcd_omap2evm.c b/drivers/video/omap/lcd_omap2evm.c
new file mode 100644
index 000000000000..7a2bbe2ecec3
--- /dev/null
+++ b/drivers/video/omap/lcd_omap2evm.c
@@ -0,0 +1,191 @@
+/*
+ * LCD panel support for the MISTRAL OMAP2EVM board
+ *
+ * Author: Arun C <arunedarath@mistralsolutions.com>
+ *
+ * Derived from drivers/video/omap/lcd_omap3evm.c
+ * Derived from drivers/video/omap/lcd-apollon.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/gpio.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_PANEL_ENABLE_GPIO   154
+#define LCD_PANEL_LR            128
+#define LCD_PANEL_UD            129
+#define LCD_PANEL_INI           152
+#define LCD_PANEL_QVGA          148
+#define LCD_PANEL_RESB          153
+
+#define TWL_LED_LEDEN           0x00
+#define TWL_PWMA_PWMAON         0x00
+#define TWL_PWMA_PWMAOFF        0x01
+
+static unsigned int bklight_level;
+
+static int omap2evm_panel_init(struct lcd_panel *panel,
+                                struct omapfb_device *fbdev)
+{
+        gpio_request(LCD_PANEL_ENABLE_GPIO, "LCD enable");
+        gpio_request(LCD_PANEL_LR, "LCD lr");
+        gpio_request(LCD_PANEL_UD, "LCD ud");
+        gpio_request(LCD_PANEL_INI, "LCD ini");
+        gpio_request(LCD_PANEL_QVGA, "LCD qvga");
+        gpio_request(LCD_PANEL_RESB, "LCD resb");
+
+        gpio_direction_output(LCD_PANEL_ENABLE_GPIO, 1);
+        gpio_direction_output(LCD_PANEL_RESB, 1);
+        gpio_direction_output(LCD_PANEL_INI, 1);
+        gpio_direction_output(LCD_PANEL_QVGA, 0);
+        gpio_direction_output(LCD_PANEL_LR, 1);
+        gpio_direction_output(LCD_PANEL_UD, 1);
+
+        twl4030_i2c_write_u8(TWL4030_MODULE_LED, 0x11, TWL_LED_LEDEN);
+        twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, 0x01, TWL_PWMA_PWMAON);
+        twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, 0x02, TWL_PWMA_PWMAOFF);
+        bklight_level = 100;
+
+        return 0;
+}
+
+static void omap2evm_panel_cleanup(struct lcd_panel *panel)
+{
+        gpio_free(LCD_PANEL_RESB);
+        gpio_free(LCD_PANEL_QVGA);
+        gpio_free(LCD_PANEL_INI);
+        gpio_free(LCD_PANEL_UD);
+        gpio_free(LCD_PANEL_LR);
+        gpio_free(LCD_PANEL_ENABLE_GPIO);
+}
+
+static int omap2evm_panel_enable(struct lcd_panel *panel)
+{
+        gpio_set_value(LCD_PANEL_ENABLE_GPIO, 0);
+        return 0;
+}
+
+static void omap2evm_panel_disable(struct lcd_panel *panel)
+{
+        gpio_set_value(LCD_PANEL_ENABLE_GPIO, 1);
+}
+
+static unsigned long omap2evm_panel_get_caps(struct lcd_panel *panel)
+{
+        return 0;
+}
+
+static int omap2evm_bklight_setlevel(struct lcd_panel *panel,
+                                                unsigned int level)
+{
+        u8 c;
+        if ((level >= 0) && (level <= 100)) {
+                c = (125 * (100 - level)) / 100 + 2;
+                twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, c, TWL_PWMA_PWMAOFF);
+                bklight_level = level;
+        }
+        return 0;
+}
+
+static unsigned int omap2evm_bklight_getlevel(struct lcd_panel *panel)
+{
+        return bklight_level;
+}
+
+static unsigned int omap2evm_bklight_getmaxlevel(struct lcd_panel *panel)
+{
+        return 100;
+}
+
+struct lcd_panel omap2evm_panel = {
+        .name           = "omap2evm",
+        .config         = OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+                          OMAP_LCDC_INV_HSYNC,
+
+        .bpp            = 16,
+        .data_lines     = 18,
+        .x_res          = 480,
+        .y_res          = 640,
+        .hsw            = 3,
+        .hfp            = 0,
+        .hbp            = 28,
+        .vsw            = 2,
+        .vfp            = 1,
+        .vbp            = 0,
+
+        .pixel_clock    = 20000,
+
+        .init           = omap2evm_panel_init,
+        .cleanup        = omap2evm_panel_cleanup,
+        .enable         = omap2evm_panel_enable,
+        .disable        = omap2evm_panel_disable,
+        .get_caps       = omap2evm_panel_get_caps,
+        .set_bklight_level      = omap2evm_bklight_setlevel,
+        .get_bklight_level      = omap2evm_bklight_getlevel,
+        .get_bklight_max        = omap2evm_bklight_getmaxlevel,
+};
+
+static int omap2evm_panel_probe(struct platform_device *pdev)
+{
+        omapfb_register_panel(&omap2evm_panel);
+        return 0;
+}
+
+static int omap2evm_panel_remove(struct platform_device *pdev)
+{
+        return 0;
+}
+
+static int omap2evm_panel_suspend(struct platform_device *pdev,
+                                   pm_message_t mesg)
+{
+        return 0;
+}
+
+static int omap2evm_panel_resume(struct platform_device *pdev)
+{
+        return 0;
+}
+
+struct platform_driver omap2evm_panel_driver = {
+        .probe          = omap2evm_panel_probe,
+        .remove         = omap2evm_panel_remove,
+        .suspend        = omap2evm_panel_suspend,
+        .resume         = omap2evm_panel_resume,
+        .driver         = {
+                .name   = "omap2evm_lcd",
+                .owner  = THIS_MODULE,
+        },
+};
+
+static int __init omap2evm_panel_drv_init(void)
+{
+        return platform_driver_register(&omap2evm_panel_driver);
+}
+
+static void __exit omap2evm_panel_drv_exit(void)
+{
+        platform_driver_unregister(&omap2evm_panel_driver);
+}
+
+module_init(omap2evm_panel_drv_init);
+module_exit(omap2evm_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_omap3beagle.c b/drivers/video/omap/lcd_omap3beagle.c
new file mode 100644
index 000000000000..4011910123bf
--- /dev/null
+++ b/drivers/video/omap/lcd_omap3beagle.c
@@ -0,0 +1,130 @@
+/*
+ * LCD panel support for the TI OMAP3 Beagle board
+ *
+ * Author: Koen Kooi <koen@openembedded.org>
+ *
+ * Derived from drivers/video/omap/lcd-omap3evm.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/gpio.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_PANEL_ENABLE_GPIO       170
+
+static int omap3beagle_panel_init(struct lcd_panel *panel,
+                                struct omapfb_device *fbdev)
+{
+        gpio_request(LCD_PANEL_ENABLE_GPIO, "LCD enable");
+        return 0;
+}
+
+static void omap3beagle_panel_cleanup(struct lcd_panel *panel)
+{
+        gpio_free(LCD_PANEL_ENABLE_GPIO);
+}
+
+static int omap3beagle_panel_enable(struct lcd_panel *panel)
+{
+        gpio_set_value(LCD_PANEL_ENABLE_GPIO, 1);
+        return 0;
+}
+
+static void omap3beagle_panel_disable(struct lcd_panel *panel)
+{
+        gpio_set_value(LCD_PANEL_ENABLE_GPIO, 0);
+}
+
+static unsigned long omap3beagle_panel_get_caps(struct lcd_panel *panel)
+{
+        return 0;
+}
+
+struct lcd_panel omap3beagle_panel = {
+        .name           = "omap3beagle",
+        .config         = OMAP_LCDC_PANEL_TFT,
+
+        .bpp            = 16,
+        .data_lines     = 24,
+        .x_res          = 1024,
+        .y_res          = 768,
+        .hsw            = 3,            /* hsync_len (4) - 1 */
+        .hfp            = 3,            /* right_margin (4) - 1 */
+        .hbp            = 39,           /* left_margin (40) - 1 */
+        .vsw            = 1,            /* vsync_len (2) - 1 */
+        .vfp            = 2,            /* lower_margin */
+        .vbp            = 7,            /* upper_margin (8) - 1 */
+
+        .pixel_clock    = 64000,
+
+        .init           = omap3beagle_panel_init,
+        .cleanup        = omap3beagle_panel_cleanup,
+        .enable         = omap3beagle_panel_enable,
+        .disable        = omap3beagle_panel_disable,
+        .get_caps       = omap3beagle_panel_get_caps,
+};
+
+static int omap3beagle_panel_probe(struct platform_device *pdev)
+{
+        omapfb_register_panel(&omap3beagle_panel);
+        return 0;
+}
+
+static int omap3beagle_panel_remove(struct platform_device *pdev)
+{
+        return 0;
+}
+
+static int omap3beagle_panel_suspend(struct platform_device *pdev,
+                                   pm_message_t mesg)
+{
+        return 0;
+}
+
+static int omap3beagle_panel_resume(struct platform_device *pdev)
+{
+        return 0;
+}
+
+struct platform_driver omap3beagle_panel_driver = {
+        .probe          = omap3beagle_panel_probe,
+        .remove         = omap3beagle_panel_remove,
+        .suspend        = omap3beagle_panel_suspend,
+        .resume         = omap3beagle_panel_resume,
+        .driver         = {
+                .name   = "omap3beagle_lcd",
+                .owner  = THIS_MODULE,
+        },
+};
+
+static int __init omap3beagle_panel_drv_init(void)
+{
+        return platform_driver_register(&omap3beagle_panel_driver);
+}
+
+static void __exit omap3beagle_panel_drv_exit(void)
+{
+        platform_driver_unregister(&omap3beagle_panel_driver);
+}
+
+module_init(omap3beagle_panel_drv_init);
+module_exit(omap3beagle_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_omap3evm.c b/drivers/video/omap/lcd_omap3evm.c
new file mode 100644
index 000000000000..b6a4c2c57a2f
--- /dev/null
+++ b/drivers/video/omap/lcd_omap3evm.c
@@ -0,0 +1,192 @@
+/*
+ * LCD panel support for the TI OMAP3 EVM board
+ *
+ * Author: Steve Sakoman <steve@sakoman.com>
+ *
+ * Derived from drivers/video/omap/lcd-apollon.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/gpio.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_PANEL_ENABLE_GPIO       153
+#define LCD_PANEL_LR                2
+#define LCD_PANEL_UD                3
+#define LCD_PANEL_INI               152
+#define LCD_PANEL_QVGA              154
+#define LCD_PANEL_RESB              155
+
+#define ENABLE_VDAC_DEDICATED   0x03
+#define ENABLE_VDAC_DEV_GRP     0x20
+#define ENABLE_VPLL2_DEDICATED  0x05
+#define ENABLE_VPLL2_DEV_GRP    0xE0
+
+#define TWL_LED_LEDEN           0x00
+#define TWL_PWMA_PWMAON         0x00
+#define TWL_PWMA_PWMAOFF        0x01
+
+static unsigned int bklight_level;
+
+static int omap3evm_panel_init(struct lcd_panel *panel,
+                                struct omapfb_device *fbdev)
+{
+        gpio_request(LCD_PANEL_LR, "LCD lr");
+        gpio_request(LCD_PANEL_UD, "LCD ud");
+        gpio_request(LCD_PANEL_INI, "LCD ini");
+        gpio_request(LCD_PANEL_RESB, "LCD resb");
+        gpio_request(LCD_PANEL_QVGA, "LCD qvga");
+
+        gpio_direction_output(LCD_PANEL_RESB, 1);
+        gpio_direction_output(LCD_PANEL_INI, 1);
+        gpio_direction_output(LCD_PANEL_QVGA, 0);
+        gpio_direction_output(LCD_PANEL_LR, 1);
+        gpio_direction_output(LCD_PANEL_UD, 1);
+
+        twl4030_i2c_write_u8(TWL4030_MODULE_LED, 0x11, TWL_LED_LEDEN);
+        twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, 0x01, TWL_PWMA_PWMAON);
+        twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, 0x02, TWL_PWMA_PWMAOFF);
+        bklight_level = 100;
+
+        return 0;
+}
+
+static void omap3evm_panel_cleanup(struct lcd_panel *panel)
+{
+        gpio_free(LCD_PANEL_QVGA);
+        gpio_free(LCD_PANEL_RESB);
+        gpio_free(LCD_PANEL_INI);
+        gpio_free(LCD_PANEL_UD);
+        gpio_free(LCD_PANEL_LR);
+}
+
+static int omap3evm_panel_enable(struct lcd_panel *panel)
+{
+        gpio_set_value(LCD_PANEL_ENABLE_GPIO, 0);
+        return 0;
+}
+
+static void omap3evm_panel_disable(struct lcd_panel *panel)
+{
+        gpio_set_value(LCD_PANEL_ENABLE_GPIO, 1);
+}
+
+static unsigned long omap3evm_panel_get_caps(struct lcd_panel *panel)
+{
+        return 0;
+}
+
+static int omap3evm_bklight_setlevel(struct lcd_panel *panel,
+                                                unsigned int level)
+{
+        u8 c;
+        if ((level >= 0) && (level <= 100)) {
+                c = (125 * (100 - level)) / 100 + 2;
+                twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, c, TWL_PWMA_PWMAOFF);
+                bklight_level = level;
+        }
+        return 0;
+}
+
+static unsigned int omap3evm_bklight_getlevel(struct lcd_panel *panel)
+{
+        return bklight_level;
+}
+
+static unsigned int omap3evm_bklight_getmaxlevel(struct lcd_panel *panel)
+{
+        return 100;
+}
+
+struct lcd_panel omap3evm_panel = {
+        .name           = "omap3evm",
+        .config         = OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+                          OMAP_LCDC_INV_HSYNC,
+
+        .bpp            = 16,
+        .data_lines     = 18,
+        .x_res          = 480,
+        .y_res          = 640,
+        .hsw            = 3,            /* hsync_len (4) - 1 */
+        .hfp            = 3,            /* right_margin (4) - 1 */
+        .hbp            = 39,           /* left_margin (40) - 1 */
+        .vsw            = 1,            /* vsync_len (2) - 1 */
+        .vfp            = 2,            /* lower_margin */
+        .vbp            = 7,            /* upper_margin (8) - 1 */
+
+        .pixel_clock    = 26000,
+
+        .init           = omap3evm_panel_init,
+        .cleanup        = omap3evm_panel_cleanup,
+        .enable         = omap3evm_panel_enable,
+        .disable        = omap3evm_panel_disable,
+        .get_caps       = omap3evm_panel_get_caps,
+        .set_bklight_level      = omap3evm_bklight_setlevel,
+        .get_bklight_level      = omap3evm_bklight_getlevel,
+        .get_bklight_max        = omap3evm_bklight_getmaxlevel,
+};
+
+static int omap3evm_panel_probe(struct platform_device *pdev)
+{
+        omapfb_register_panel(&omap3evm_panel);
+        return 0;
+}
+
+static int omap3evm_panel_remove(struct platform_device *pdev)
+{
+        return 0;
+}
+
+static int omap3evm_panel_suspend(struct platform_device *pdev,
+                                   pm_message_t mesg)
+{
+        return 0;
+}
+
+static int omap3evm_panel_resume(struct platform_device *pdev)
+{
+        return 0;
+}
+
+struct platform_driver omap3evm_panel_driver = {
+        .probe          = omap3evm_panel_probe,
+        .remove         = omap3evm_panel_remove,
+        .suspend        = omap3evm_panel_suspend,
+        .resume         = omap3evm_panel_resume,
+        .driver         = {
+                .name   = "omap3evm_lcd",
+                .owner  = THIS_MODULE,
+        },
+};
+
+static int __init omap3evm_panel_drv_init(void)
+{
+        return platform_driver_register(&omap3evm_panel_driver);
+}
+
+static void __exit omap3evm_panel_drv_exit(void)
+{
+        platform_driver_unregister(&omap3evm_panel_driver);
+}
+
+module_init(omap3evm_panel_drv_init);
+module_exit(omap3evm_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_osk.c b/drivers/video/omap/lcd_osk.c
index 379c96d36da5..b3fa88bc6269 100644
--- a/drivers/video/omap/lcd_osk.c
+++ b/drivers/video/omap/lcd_osk.c
@@ -127,12 +127,12 @@ struct platform_driver osk_panel_driver = {
         },
 };
 
-static int osk_panel_drv_init(void)
+static int __init osk_panel_drv_init(void)
 {
         return platform_driver_register(&osk_panel_driver);
 }
 
-static void osk_panel_drv_cleanup(void)
+static void __exit osk_panel_drv_cleanup(void)
 {
         platform_driver_unregister(&osk_panel_driver);
 }
diff --git a/drivers/video/omap/lcd_overo.c b/drivers/video/omap/lcd_overo.c
new file mode 100644
index 000000000000..2bc5c9268e5e
--- /dev/null
+++ b/drivers/video/omap/lcd_overo.c
@@ -0,0 +1,179 @@
+/*
+ * LCD panel support for the Gumstix Overo
+ *
+ * Author: Steve Sakoman <steve@sakoman.com>
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ *
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/gpio.h>
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_ENABLE       144
+
+static int overo_panel_init(struct lcd_panel *panel,
+                                struct omapfb_device *fbdev)
+{
+        if ((gpio_request(LCD_ENABLE, "LCD_ENABLE") == 0) &&
+            (gpio_direction_output(LCD_ENABLE, 1) == 0))
+                gpio_export(LCD_ENABLE, 0);
+        else
+                printk(KERN_ERR "could not obtain gpio for LCD_ENABLE\n");
+
+        return 0;
+}
+
+static void overo_panel_cleanup(struct lcd_panel *panel)
+{
+        gpio_free(LCD_ENABLE);
+}
+
+static int overo_panel_enable(struct lcd_panel *panel)
+{
+        gpio_set_value(LCD_ENABLE, 1);
+        return 0;
+}
+
+static void overo_panel_disable(struct lcd_panel *panel)
+{
+        gpio_set_value(LCD_ENABLE, 0);
+}
+
+static unsigned long overo_panel_get_caps(struct lcd_panel *panel)
+{
+        return 0;
+}
+
+struct lcd_panel overo_panel = {
+        .name           = "overo",
+        .config         = OMAP_LCDC_PANEL_TFT,
+        .bpp            = 16,
+        .data_lines     = 24,
+
+#if defined CONFIG_FB_OMAP_031M3R
+
+        /* 640 x 480 @ 60 Hz  Reduced blanking VESA CVT 0.31M3-R */
+        .x_res          = 640,
+        .y_res          = 480,
+        .hfp            = 48,
+        .hsw            = 32,
+        .hbp            = 80,
+        .vfp            = 3,
+        .vsw            = 4,
+        .vbp            = 7,
+        .pixel_clock    = 23500,
+
+#elif defined CONFIG_FB_OMAP_048M3R
+
+        /* 800 x 600 @ 60 Hz  Reduced blanking VESA CVT 0.48M3-R */
+        .x_res          = 800,
+        .y_res          = 600,
+        .hfp            = 48,
+        .hsw            = 32,
+        .hbp            = 80,
+        .vfp            = 3,
+        .vsw            = 4,
+        .vbp            = 11,
+        .pixel_clock    = 35500,
+
+#elif defined CONFIG_FB_OMAP_079M3R
+
+        /* 1024 x 768 @ 60 Hz  Reduced blanking VESA CVT 0.79M3-R */
+        .x_res          = 1024,
+        .y_res          = 768,
+        .hfp            = 48,
+        .hsw            = 32,
+        .hbp            = 80,
+        .vfp            = 3,
+        .vsw            = 4,
+        .vbp            = 15,
+        .pixel_clock    = 56000,
+
+#elif defined CONFIG_FB_OMAP_092M9R
+
+        /* 1280 x 720 @ 60 Hz  Reduced blanking VESA CVT 0.92M9-R */
+        .x_res          = 1280,
+        .y_res          = 720,
+        .hfp            = 48,
+        .hsw            = 32,
+        .hbp            = 80,
+        .vfp            = 3,
+        .vsw            = 5,
+        .vbp            = 13,
+        .pixel_clock    = 64000,
+
+#else
+
+        /* use 640 x 480 if no config option */
+        /* 640 x 480 @ 60 Hz  Reduced blanking VESA CVT 0.31M3-R */
+        .x_res          = 640,
+        .y_res          = 480,
+        .hfp            = 48,
+        .hsw            = 32,
+        .hbp            = 80,
+        .vfp            = 3,
+        .vsw            = 4,
+        .vbp            = 7,
+        .pixel_clock    = 23500,
+
+#endif
+
+        .init           = overo_panel_init,
+        .cleanup        = overo_panel_cleanup,
+        .enable         = overo_panel_enable,
+        .disable        = overo_panel_disable,
+        .get_caps       = overo_panel_get_caps,
+};
+
+static int overo_panel_probe(struct platform_device *pdev)
+{
+        omapfb_register_panel(&overo_panel);
+        return 0;
+}
+
+static int overo_panel_remove(struct platform_device *pdev)
+{
+        /* omapfb does not have unregister_panel */
+        return 0;
+}
+
+static struct platform_driver overo_panel_driver = {
+        .probe          = overo_panel_probe,
+        .remove         = overo_panel_remove,
+        .driver         = {
+                .name   = "overo_lcd",
+                .owner  = THIS_MODULE,
+        },
+};
+
+static int __init overo_panel_drv_init(void)
+{
+        return platform_driver_register(&overo_panel_driver);
+}
+
+static void __exit overo_panel_drv_exit(void)
+{
+        platform_driver_unregister(&overo_panel_driver);
+}
+
+module_init(overo_panel_drv_init);
+module_exit(overo_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_palmte.c b/drivers/video/omap/lcd_palmte.c
index 218317366e6e..4bf3c79f3cc7 100644
--- a/drivers/video/omap/lcd_palmte.c
+++ b/drivers/video/omap/lcd_palmte.c
@@ -108,12 +108,12 @@ struct platform_driver palmte_panel_driver = {
         },
 };
 
-static int palmte_panel_drv_init(void)
+static int __init palmte_panel_drv_init(void)
 {
         return platform_driver_register(&palmte_panel_driver);
 }
 
-static void palmte_panel_drv_cleanup(void)
+static void __exit palmte_panel_drv_cleanup(void)
 {
         platform_driver_unregister(&palmte_panel_driver);
 }
diff --git a/drivers/video/omap/lcd_palmtt.c b/drivers/video/omap/lcd_palmtt.c
index 57b0f6cf6a5a..48ea1f9f2cbf 100644
--- a/drivers/video/omap/lcd_palmtt.c
+++ b/drivers/video/omap/lcd_palmtt.c
@@ -113,12 +113,12 @@ struct platform_driver palmtt_panel_driver = {
         },
 };
 
-static int palmtt_panel_drv_init(void)
+static int __init palmtt_panel_drv_init(void)
 {
         return platform_driver_register(&palmtt_panel_driver);
 }
 
-static void palmtt_panel_drv_cleanup(void)
+static void __exit palmtt_panel_drv_cleanup(void)
 {
         platform_driver_unregister(&palmtt_panel_driver);
 }
diff --git a/drivers/video/omap/lcd_palmz71.c b/drivers/video/omap/lcd_palmz71.c
index d33d78b11723..0697d29b4d3b 100644
--- a/drivers/video/omap/lcd_palmz71.c
+++ b/drivers/video/omap/lcd_palmz71.c
@@ -109,12 +109,12 @@ struct platform_driver palmz71_panel_driver = {
         },
 };
 
-static int palmz71_panel_drv_init(void)
+static int __init palmz71_panel_drv_init(void)
 {
         return platform_driver_register(&palmz71_panel_driver);
 }
 
-static void palmz71_panel_drv_cleanup(void)
+static void __exit palmz71_panel_drv_cleanup(void)
 {
         platform_driver_unregister(&palmz71_panel_driver);
 }
diff --git a/drivers/video/omap/omapfb_main.c b/drivers/video/omap/omapfb_main.c
index 8862233d57b6..125e605b8c68 100644
--- a/drivers/video/omap/omapfb_main.c
+++ b/drivers/video/omap/omapfb_main.c
@@ -67,6 +67,7 @@ static struct caps_table_struct ctrl_caps[] = {
         { OMAPFB_CAPS_WINDOW_PIXEL_DOUBLE, "pixel double window" },
         { OMAPFB_CAPS_WINDOW_SCALE,   "scale window" },
         { OMAPFB_CAPS_WINDOW_OVERLAY, "overlay window" },
+        { OMAPFB_CAPS_WINDOW_ROTATE,  "rotate window" },
         { OMAPFB_CAPS_SET_BACKLIGHT,  "backlight setting" },
 };
 
@@ -215,6 +216,15 @@ static int ctrl_change_mode(struct fb_info *fbi)
                                  offset, var->xres_virtual,
                                  plane->info.pos_x, plane->info.pos_y,
                                  var->xres, var->yres, plane->color_mode);
+        if (r < 0)
+                return r;
+
+        if (fbdev->ctrl->set_rotate != NULL) {
+                r = fbdev->ctrl->set_rotate(var->rotate);
+                if (r < 0)
+                        return r;
+        }
+
         if (fbdev->ctrl->set_scale != NULL)
                 r = fbdev->ctrl->set_scale(plane->idx,
                                    var->xres, var->yres,
@@ -554,7 +564,6 @@ static int set_fb_var(struct fb_info *fbi,
                 var->xoffset = var->xres_virtual - var->xres;
         if (var->yres + var->yoffset > var->yres_virtual)
                 var->yoffset = var->yres_virtual - var->yres;
-        line_size = var->xres * bpp / 8;
 
         if (plane->color_mode == OMAPFB_COLOR_RGB444) {
                 var->red.offset   = 8; var->red.length   = 4;
@@ -600,7 +609,7 @@ static void omapfb_rotate(struct fb_info *fbi, int rotate)
         struct omapfb_device *fbdev = plane->fbdev;
 
         omapfb_rqueue_lock(fbdev);
-        if (cpu_is_omap15xx() && rotate != fbi->var.rotate) {
+        if (rotate != fbi->var.rotate) {
                 struct fb_var_screeninfo *new_var = &fbdev->new_var;
 
                 memcpy(new_var, &fbi->var, sizeof(*new_var));
@@ -707,28 +716,42 @@ int omapfb_update_window_async(struct fb_info *fbi,
                                 void (*callback)(void *),
                                 void *callback_data)
 {
+        int xres, yres;
         struct omapfb_plane_struct *plane = fbi->par;
         struct omapfb_device *fbdev = plane->fbdev;
-        struct fb_var_screeninfo *var;
+        struct fb_var_screeninfo *var = &fbi->var;
+
+        switch (var->rotate) {
+        case 0:
+        case 180:
+                xres = fbdev->panel->x_res;
+                yres = fbdev->panel->y_res;
+                break;
+        case 90:
+        case 270:
+                xres = fbdev->panel->y_res;
+                yres = fbdev->panel->x_res;
+                break;
+        default:
+                return -EINVAL;
+        }
 
-        var = &fbi->var;
-        if (win->x >= var->xres || win->y >= var->yres ||
-            win->out_x > var->xres || win->out_y >= var->yres)
+        if (win->x >= xres || win->y >= yres ||
+            win->out_x > xres || win->out_y > yres)
                 return -EINVAL;
 
         if (!fbdev->ctrl->update_window ||
             fbdev->ctrl->get_update_mode() != OMAPFB_MANUAL_UPDATE)
                 return -ENODEV;
 
-        if (win->x + win->width >= var->xres)
-                win->width = var->xres - win->x;
-        if (win->y + win->height >= var->yres)
-                win->height = var->yres - win->y;
-        /* The out sizes should be cropped to the LCD size */
-        if (win->out_x + win->out_width > fbdev->panel->x_res)
-                win->out_width = fbdev->panel->x_res - win->out_x;
-        if (win->out_y + win->out_height > fbdev->panel->y_res)
-                win->out_height = fbdev->panel->y_res - win->out_y;
+        if (win->x + win->width > xres)
+                win->width = xres - win->x;
+        if (win->y + win->height > yres)
+                win->height = yres - win->y;
+        if (win->out_x + win->out_width > xres)
+                win->out_width = xres - win->out_x;
+        if (win->out_y + win->out_height > yres)
+                win->out_height = yres - win->out_y;
         if (!win->width || !win->height || !win->out_width || !win->out_height)
                 return 0;
 
@@ -1699,8 +1722,8 @@ static int omapfb_do_probe(struct platform_device *pdev,
 
         pr_info("omapfb: configured for panel %s\n", fbdev->panel->name);
 
-        def_vxres = def_vxres ? : fbdev->panel->x_res;
-        def_vyres = def_vyres ? : fbdev->panel->y_res;
+        def_vxres = def_vxres ? def_vxres : fbdev->panel->x_res;
+        def_vyres = def_vyres ? def_vyres : fbdev->panel->y_res;
 
         init_state++;
 
@@ -1822,8 +1845,8 @@ static int omapfb_suspend(struct platform_device *pdev, pm_message_t mesg)
 {
         struct omapfb_device *fbdev = platform_get_drvdata(pdev);
 
-        omapfb_blank(FB_BLANK_POWERDOWN, fbdev->fb_info[0]);
-
+        if (fbdev != NULL)
+                omapfb_blank(FB_BLANK_POWERDOWN, fbdev->fb_info[0]);
         return 0;
 }
 
@@ -1832,7 +1855,8 @@ static int omapfb_resume(struct platform_device *pdev)
 {
         struct omapfb_device *fbdev = platform_get_drvdata(pdev);
 
-        omapfb_blank(FB_BLANK_UNBLANK, fbdev->fb_info[0]);
+        if (fbdev != NULL)
+                omapfb_blank(FB_BLANK_UNBLANK, fbdev->fb_info[0]);
         return 0;
 }
 
diff --git a/drivers/video/omap/rfbi.c b/drivers/video/omap/rfbi.c
index 9332d6ca6456..ee01e84e19c1 100644
--- a/drivers/video/omap/rfbi.c
+++ b/drivers/video/omap/rfbi.c
@@ -57,6 +57,7 @@
 
 #define DISPC_BASE              0x48050400
 #define DISPC_CONTROL           0x0040
+#define DISPC_IRQ_FRAMEMASK     0x0001
 
 static struct {
         void __iomem    *base;
@@ -553,7 +554,9 @@ static int rfbi_init(struct omapfb_device *fbdev)
         l = (0x01 << 2);
         rfbi_write_reg(RFBI_CONTROL, l);
 
-        if ((r = omap_dispc_request_irq(rfbi_dma_callback, NULL)) < 0) {
+        r = omap_dispc_request_irq(DISPC_IRQ_FRAMEMASK, rfbi_dma_callback,
+                                   NULL);
+        if (r < 0) {
                 dev_err(fbdev->dev, "can't get DISPC irq\n");
                 rfbi_enable_clocks(0);
                 return r;
@@ -570,7 +573,7 @@ static int rfbi_init(struct omapfb_device *fbdev)
 
 static void rfbi_cleanup(void)
 {
-        omap_dispc_free_irq();
+        omap_dispc_free_irq(DISPC_IRQ_FRAMEMASK, rfbi_dma_callback, NULL);
         rfbi_put_clocks();
         iounmap(rfbi.base);
 }
diff --git a/drivers/video/platinumfb.c b/drivers/video/platinumfb.c
index bacfabd9ce16..0a366d86f08e 100644
--- a/drivers/video/platinumfb.c
+++ b/drivers/video/platinumfb.c
@@ -223,10 +223,14 @@ static int platinumfb_setcolreg(u_int regno, u_int red, u_int green, u_int blue,
 
 static inline int platinum_vram_reqd(int video_mode, int color_mode)
 {
-        return vmode_attrs[video_mode-1].vres *
-               (vmode_attrs[video_mode-1].hres * (1<<color_mode) +
-                ((video_mode == VMODE_832_624_75) &&
-                 (color_mode > CMODE_8)) ? 0x10 : 0x20) + 0x1000;
+        int baseval = vmode_attrs[video_mode-1].hres * (1<<color_mode);
+
+        if ((video_mode == VMODE_832_624_75) && (color_mode > CMODE_8))
+                baseval += 0x10;
+        else
+                baseval += 0x20;
+
+        return vmode_attrs[video_mode-1].vres * baseval + 0x1000;
 }
 
 #define STORE_D2(a, d) { \
diff --git a/drivers/video/s3c-fb.c b/drivers/video/s3c-fb.c
index 5a72083dc67c..adf9632c6b1f 100644
--- a/drivers/video/s3c-fb.c
+++ b/drivers/video/s3c-fb.c
@@ -1036,7 +1036,7 @@ static int s3c_fb_resume(struct platform_device *pdev)
 
 static struct platform_driver s3c_fb_driver = {
         .probe          = s3c_fb_probe,
-        .remove         = s3c_fb_remove,
+        .remove         = __devexit_p(s3c_fb_remove),
         .suspend        = s3c_fb_suspend,
         .resume         = s3c_fb_resume,
         .driver         = {
diff --git a/drivers/video/s3c2410fb.c b/drivers/video/s3c2410fb.c
index 7da0027e2409..aac661225c78 100644
--- a/drivers/video/s3c2410fb.c
+++ b/drivers/video/s3c2410fb.c
@@ -369,7 +369,9 @@ static void s3c2410fb_activate_var(struct fb_info *info)
         void __iomem *regs = fbi->io;
         int type = fbi->regs.lcdcon1 & S3C2410_LCDCON1_TFT;
         struct fb_var_screeninfo *var = &info->var;
-        int clkdiv = s3c2410fb_calc_pixclk(fbi, var->pixclock) / 2;
+        int clkdiv;
+
+        clkdiv = DIV_ROUND_UP(s3c2410fb_calc_pixclk(fbi, var->pixclock), 2);
 
         dprintk("%s: var->xres  = %d\n", __func__, var->xres);
         dprintk("%s: var->yres  = %d\n", __func__, var->yres);
@@ -1119,7 +1121,7 @@ int __init s3c2410fb_init(void)
         int ret = platform_driver_register(&s3c2410fb_driver);
 
         if (ret == 0)
-                ret = platform_driver_register(&s3c2412fb_driver);;
+                ret = platform_driver_register(&s3c2412fb_driver);
 
         return ret;
 }
diff --git a/drivers/video/sh_mobile_lcdcfb.c b/drivers/video/sh_mobile_lcdcfb.c
index 07f22b625632..3ad5157f9899 100644
--- a/drivers/video/sh_mobile_lcdcfb.c
+++ b/drivers/video/sh_mobile_lcdcfb.c
@@ -14,6 +14,7 @@
 #include <linux/mm.h>
 #include <linux/fb.h>
 #include <linux/clk.h>
+#include <linux/pm_runtime.h>
 #include <linux/platform_device.h>
 #include <linux/dma-mapping.h>
 #include <linux/interrupt.h>
@@ -22,35 +23,8 @@
 #include <asm/atomic.h>
 
 #define PALETTE_NR 16
-
-struct sh_mobile_lcdc_priv;
-struct sh_mobile_lcdc_chan {
-        struct sh_mobile_lcdc_priv *lcdc;
-        unsigned long *reg_offs;
-        unsigned long ldmt1r_value;
-        unsigned long enabled; /* ME and SE in LDCNT2R */
-        struct sh_mobile_lcdc_chan_cfg cfg;
-        u32 pseudo_palette[PALETTE_NR];
-        struct fb_info *info;
-        dma_addr_t dma_handle;
-        struct fb_deferred_io defio;
-        struct scatterlist *sglist;
-        unsigned long frame_end;
-        wait_queue_head_t frame_end_wait;
-};
-
-struct sh_mobile_lcdc_priv {
-        void __iomem *base;
-        int irq;
-#ifdef CONFIG_HAVE_CLK
-        atomic_t clk_usecnt;
-        struct clk *dot_clk;
-        struct clk *clk;
-#endif
-        unsigned long lddckr;
-        struct sh_mobile_lcdc_chan ch[2];
-        int started;
-};
+#define SIDE_B_OFFSET 0x1000
+#define MIRROR_OFFSET 0x2000
 
 /* shared registers */
 #define _LDDCKR 0x410
@@ -59,17 +33,30 @@ struct sh_mobile_lcdc_priv {
 #define _LDSR 0x46c
 #define _LDCNT1R 0x470
 #define _LDCNT2R 0x474
+#define _LDRCNTR 0x478
 #define _LDDDSR 0x47c
 #define _LDDWD0R 0x800
 #define _LDDRDR 0x840
 #define _LDDWAR 0x900
 #define _LDDRAR 0x904
 
+/* shared registers and their order for context save/restore */
+static int lcdc_shared_regs[] = {
+        _LDDCKR,
+        _LDDCKSTPR,
+        _LDINTR,
+        _LDDDSR,
+        _LDCNT1R,
+        _LDCNT2R,
+};
+#define NR_SHARED_REGS ARRAY_SIZE(lcdc_shared_regs)
+
 /* per-channel registers */
 enum { LDDCKPAT1R, LDDCKPAT2R, LDMT1R, LDMT2R, LDMT3R, LDDFR, LDSM1R,
-       LDSM2R, LDSA1R, LDMLSR, LDHCNR, LDHSYNR, LDVLNR, LDVSYNR, LDPMR };
+       LDSM2R, LDSA1R, LDMLSR, LDHCNR, LDHSYNR, LDVLNR, LDVSYNR, LDPMR,
+       NR_CH_REGS };
 
-static unsigned long lcdc_offs_mainlcd[] = {
+static unsigned long lcdc_offs_mainlcd[NR_CH_REGS] = {
         [LDDCKPAT1R] = 0x400,
         [LDDCKPAT2R] = 0x404,
         [LDMT1R] = 0x418,
@@ -87,7 +74,7 @@ static unsigned long lcdc_offs_mainlcd[] = {
         [LDPMR] = 0x460,
 };
 
-static unsigned long lcdc_offs_sublcd[] = {
+static unsigned long lcdc_offs_sublcd[NR_CH_REGS] = {
         [LDDCKPAT1R] = 0x408,
         [LDDCKPAT2R] = 0x40c,
         [LDMT1R] = 0x600,
@@ -110,12 +97,80 @@ static unsigned long lcdc_offs_sublcd[] = {
 #define DISPLAY_BEU     0x00000008
 #define LCDC_ENABLE     0x00000001
 #define LDINTR_FE       0x00000400
+#define LDINTR_VSE      0x00000200
+#define LDINTR_VEE      0x00000100
 #define LDINTR_FS       0x00000004
+#define LDINTR_VSS      0x00000002
+#define LDINTR_VES      0x00000001
+#define LDRCNTR_SRS     0x00020000
+#define LDRCNTR_SRC     0x00010000
+#define LDRCNTR_MRS     0x00000002
+#define LDRCNTR_MRC     0x00000001
+
+struct sh_mobile_lcdc_priv;
+struct sh_mobile_lcdc_chan {
+        struct sh_mobile_lcdc_priv *lcdc;
+        unsigned long *reg_offs;
+        unsigned long ldmt1r_value;
+        unsigned long enabled; /* ME and SE in LDCNT2R */
+        struct sh_mobile_lcdc_chan_cfg cfg;
+        u32 pseudo_palette[PALETTE_NR];
+        unsigned long saved_ch_regs[NR_CH_REGS];
+        struct fb_info *info;
+        dma_addr_t dma_handle;
+        struct fb_deferred_io defio;
+        struct scatterlist *sglist;
+        unsigned long frame_end;
+        unsigned long pan_offset;
+        unsigned long new_pan_offset;
+        wait_queue_head_t frame_end_wait;
+};
+
+struct sh_mobile_lcdc_priv {
+        void __iomem *base;
+        int irq;
+        atomic_t hw_usecnt;
+        struct device *dev;
+        struct clk *dot_clk;
+        unsigned long lddckr;
+        struct sh_mobile_lcdc_chan ch[2];
+        unsigned long saved_shared_regs[NR_SHARED_REGS];
+        int started;
+};
+
+static bool banked(int reg_nr)
+{
+        switch (reg_nr) {
+        case LDMT1R:
+        case LDMT2R:
+        case LDMT3R:
+        case LDDFR:
+        case LDSM1R:
+        case LDSA1R:
+        case LDMLSR:
+        case LDHCNR:
+        case LDHSYNR:
+        case LDVLNR:
+        case LDVSYNR:
+                return true;
+        }
+        return false;
+}
 
 static void lcdc_write_chan(struct sh_mobile_lcdc_chan *chan,
                             int reg_nr, unsigned long data)
 {
         iowrite32(data, chan->lcdc->base + chan->reg_offs[reg_nr]);
+        if (banked(reg_nr))
+                iowrite32(data, chan->lcdc->base + chan->reg_offs[reg_nr] +
+                          SIDE_B_OFFSET);
+}
+
+static void lcdc_write_chan_mirror(struct sh_mobile_lcdc_chan *chan,
+                            int reg_nr, unsigned long data)
+{
+        iowrite32(data, chan->lcdc->base + chan->reg_offs[reg_nr] +
+                  MIRROR_OFFSET);
 }
 
 static unsigned long lcdc_read_chan(struct sh_mobile_lcdc_chan *chan,
@@ -156,6 +211,7 @@ static void lcdc_sys_write_index(void *handle, unsigned long data)
         lcdc_write(ch->lcdc, _LDDWD0R, data | 0x10000000);
         lcdc_wait_bit(ch->lcdc, _LDSR, 2, 0);
         lcdc_write(ch->lcdc, _LDDWAR, 1 | (lcdc_chan_is_sublcd(ch) ? 2 : 0));
+        lcdc_wait_bit(ch->lcdc, _LDSR, 2, 0);
 }
 
 static void lcdc_sys_write_data(void *handle, unsigned long data)
@@ -165,6 +221,7 @@ static void lcdc_sys_write_data(void *handle, unsigned long data)
         lcdc_write(ch->lcdc, _LDDWD0R, data | 0x11000000);
         lcdc_wait_bit(ch->lcdc, _LDSR, 2, 0);
         lcdc_write(ch->lcdc, _LDDWAR, 1 | (lcdc_chan_is_sublcd(ch) ? 2 : 0));
+        lcdc_wait_bit(ch->lcdc, _LDSR, 2, 0);
 }
 
 static unsigned long lcdc_sys_read_data(void *handle)
@@ -175,8 +232,9 @@ static unsigned long lcdc_sys_read_data(void *handle)
         lcdc_wait_bit(ch->lcdc, _LDSR, 2, 0);
         lcdc_write(ch->lcdc, _LDDRAR, 1 | (lcdc_chan_is_sublcd(ch) ? 2 : 0));
         udelay(1);
+        lcdc_wait_bit(ch->lcdc, _LDSR, 2, 0);
 
-        return lcdc_read(ch->lcdc, _LDDRDR) & 0xffff;
+        return lcdc_read(ch->lcdc, _LDDRDR) & 0x3ffff;
 }
 
 struct sh_mobile_lcdc_sys_bus_ops sh_mobile_lcdc_sys_bus_ops = {
@@ -185,11 +243,10 @@ struct sh_mobile_lcdc_sys_bus_ops sh_mobile_lcdc_sys_bus_ops = {
         lcdc_sys_read_data,
 };
 
-#ifdef CONFIG_HAVE_CLK
 static void sh_mobile_lcdc_clk_on(struct sh_mobile_lcdc_priv *priv)
 {
-        if (atomic_inc_and_test(&priv->clk_usecnt)) {
-                clk_enable(priv->clk);
+        if (atomic_inc_and_test(&priv->hw_usecnt)) {
+                pm_runtime_get_sync(priv->dev);
                 if (priv->dot_clk)
                         clk_enable(priv->dot_clk);
         }
@@ -197,16 +254,12 @@ static void sh_mobile_lcdc_clk_on(struct sh_mobile_lcdc_priv *priv)
 
 static void sh_mobile_lcdc_clk_off(struct sh_mobile_lcdc_priv *priv)
 {
-        if (atomic_sub_return(1, &priv->clk_usecnt) == -1) {
+        if (atomic_sub_return(1, &priv->hw_usecnt) == -1) {
                 if (priv->dot_clk)
                         clk_disable(priv->dot_clk);
-                clk_disable(priv->clk);
+                pm_runtime_put(priv->dev);
         }
 }
-#else
-static void sh_mobile_lcdc_clk_on(struct sh_mobile_lcdc_priv *priv) {}
-static void sh_mobile_lcdc_clk_off(struct sh_mobile_lcdc_priv *priv) {}
-#endif
 
 static int sh_mobile_lcdc_sginit(struct fb_info *info,
                                   struct list_head *pagelist)
@@ -255,30 +308,52 @@ static irqreturn_t sh_mobile_lcdc_irq(int irq, void *data)
         struct sh_mobile_lcdc_priv *priv = data;
         struct sh_mobile_lcdc_chan *ch;
         unsigned long tmp;
+        unsigned long ldintr;
         int is_sub;
         int k;
 
         /* acknowledge interrupt */
-        tmp = lcdc_read(priv, _LDINTR);
-        tmp &= 0xffffff00; /* mask in high 24 bits */
-        tmp |= 0x000000ff ^ LDINTR_FS; /* status in low 8 */
+        ldintr = tmp = lcdc_read(priv, _LDINTR);
+        /*
+         * disable further VSYNC End IRQs, preserve all other enabled IRQs,
+         * write 0 to bits 0-6 to ack all triggered IRQs.
+         */
+        tmp &= 0xffffff00 & ~LDINTR_VEE;
         lcdc_write(priv, _LDINTR, tmp);
 
         /* figure out if this interrupt is for main or sub lcd */
         is_sub = (lcdc_read(priv, _LDSR) & (1 << 10)) ? 1 : 0;
 
-        /* wake up channel and disable clocks*/
+        /* wake up channel and disable clocks */
         for (k = 0; k < ARRAY_SIZE(priv->ch); k++) {
                 ch = &priv->ch[k];
 
                 if (!ch->enabled)
                         continue;
 
-                if (is_sub == lcdc_chan_is_sublcd(ch)) {
-                        ch->frame_end = 1;
-                        wake_up(&ch->frame_end_wait);
+                /* Frame Start */
+                if (ldintr & LDINTR_FS) {
+                        if (is_sub == lcdc_chan_is_sublcd(ch)) {
+                                ch->frame_end = 1;
+                                wake_up(&ch->frame_end_wait);
 
-                        sh_mobile_lcdc_clk_off(priv);
+                                sh_mobile_lcdc_clk_off(priv);
+                        }
+                }
+
+                /* VSYNC End */
+                if (ldintr & LDINTR_VES) {
+                        unsigned long ldrcntr = lcdc_read(priv, _LDRCNTR);
+                        /* Set the source address for the next refresh */
+                        lcdc_write_chan_mirror(ch, LDSA1R, ch->dma_handle +
+                                               ch->new_pan_offset);
+                        if (lcdc_chan_is_sublcd(ch))
+                                lcdc_write(ch->lcdc, _LDRCNTR,
+                                           ldrcntr ^ LDRCNTR_SRS);
+                        else
+                                lcdc_write(ch->lcdc, _LDRCNTR,
+                                           ldrcntr ^ LDRCNTR_MRS);
+                        ch->pan_offset = ch->new_pan_offset;
                 }
         }
 
@@ -520,7 +595,6 @@ static void sh_mobile_lcdc_stop(struct sh_mobile_lcdc_priv *priv)
                 board_cfg = &ch->cfg.board_cfg;
                 if (board_cfg->display_off)
                         board_cfg->display_off(board_cfg->board_data);
-
         }
 
         /* stop the lcdc */
@@ -579,9 +653,6 @@ static int sh_mobile_lcdc_setup_clocks(struct platform_device *pdev,
                                        int clock_source,
                                        struct sh_mobile_lcdc_priv *priv)
 {
-#ifdef CONFIG_HAVE_CLK
-        char clk_name[8];
-#endif
         char *str;
         int icksel;
 
@@ -595,25 +666,21 @@ static int sh_mobile_lcdc_setup_clocks(struct platform_device *pdev,
 
         priv->lddckr = icksel << 16;
 
-#ifdef CONFIG_HAVE_CLK
-        atomic_set(&priv->clk_usecnt, -1);
-        snprintf(clk_name, sizeof(clk_name), "lcdc%d", pdev->id);
-        priv->clk = clk_get(&pdev->dev, clk_name);
-        if (IS_ERR(priv->clk)) {
-                dev_err(&pdev->dev, "cannot get clock \"%s\"\n", clk_name);
-                return PTR_ERR(priv->clk);
-        }
-        
         if (str) {
                 priv->dot_clk = clk_get(&pdev->dev, str);
                 if (IS_ERR(priv->dot_clk)) {
                         dev_err(&pdev->dev, "cannot get dot clock %s\n", str);
-                        clk_put(priv->clk);
                         return PTR_ERR(priv->dot_clk);
                 }
         }
-#endif
-
+        atomic_set(&priv->hw_usecnt, -1);
+
+        /* Runtime PM support involves two step for this driver:
+         * 1) Enable Runtime PM
+         * 2) Force Runtime PM Resume since hardware is accessed from probe()
+         */
+        pm_runtime_enable(priv->dev);
+        pm_runtime_resume(priv->dev);
         return 0;
 }
 
@@ -646,6 +713,9 @@ static struct fb_fix_screeninfo sh_mobile_lcdc_fix  = {
         .type =         FB_TYPE_PACKED_PIXELS,
         .visual =       FB_VISUAL_TRUECOLOR,
         .accel =        FB_ACCEL_NONE,
+        .xpanstep =     0,
+        .ypanstep =     1,
+        .ywrapstep =    0,
 };
 
 static void sh_mobile_lcdc_fillrect(struct fb_info *info,
@@ -669,13 +739,38 @@ static void sh_mobile_lcdc_imageblit(struct fb_info *info,
         sh_mobile_lcdc_deferred_io_touch(info);
 }
 
+static int sh_mobile_fb_pan_display(struct fb_var_screeninfo *var,
+                                     struct fb_info *info)
+{
+        struct sh_mobile_lcdc_chan *ch = info->par;
+
+        if (info->var.xoffset == var->xoffset &&
+            info->var.yoffset == var->yoffset)
+                return 0;       /* No change, do nothing */
+
+        ch->new_pan_offset = (var->yoffset * info->fix.line_length) +
+                (var->xoffset * (info->var.bits_per_pixel / 8));
+
+        if (ch->new_pan_offset != ch->pan_offset) {
+                unsigned long ldintr;
+                ldintr = lcdc_read(ch->lcdc, _LDINTR);
+                ldintr |= LDINTR_VEE;
+                lcdc_write(ch->lcdc, _LDINTR, ldintr);
+                sh_mobile_lcdc_deferred_io_touch(info);
+        }
+
+        return 0;
+}
+
 static struct fb_ops sh_mobile_lcdc_ops = {
+        .owner          = THIS_MODULE,
         .fb_setcolreg   = sh_mobile_lcdc_setcolreg,
         .fb_read        = fb_sys_read,
         .fb_write       = fb_sys_write,
         .fb_fillrect    = sh_mobile_lcdc_fillrect,
         .fb_copyarea    = sh_mobile_lcdc_copyarea,
         .fb_imageblit   = sh_mobile_lcdc_imageblit,
+        .fb_pan_display = sh_mobile_fb_pan_display,
 };
 
 static int sh_mobile_lcdc_set_bpp(struct fb_var_screeninfo *var, int bpp)
@@ -731,9 +826,59 @@ static int sh_mobile_lcdc_resume(struct device *dev)
         return sh_mobile_lcdc_start(platform_get_drvdata(pdev));
 }
 
+static int sh_mobile_lcdc_runtime_suspend(struct device *dev)
+{
+        struct platform_device *pdev = to_platform_device(dev);
+        struct sh_mobile_lcdc_priv *p = platform_get_drvdata(pdev);
+        struct sh_mobile_lcdc_chan *ch;
+        int k, n;
+
+        /* save per-channel registers */
+        for (k = 0; k < ARRAY_SIZE(p->ch); k++) {
+                ch = &p->ch[k];
+                if (!ch->enabled)
+                        continue;
+                for (n = 0; n < NR_CH_REGS; n++)
+                        ch->saved_ch_regs[n] = lcdc_read_chan(ch, n);
+        }
+
+        /* save shared registers */
+        for (n = 0; n < NR_SHARED_REGS; n++)
+                p->saved_shared_regs[n] = lcdc_read(p, lcdc_shared_regs[n]);
+
+        /* turn off LCDC hardware */
+        lcdc_write(p, _LDCNT1R, 0);
+        return 0;
+}
+
+static int sh_mobile_lcdc_runtime_resume(struct device *dev)
+{
+        struct platform_device *pdev = to_platform_device(dev);
+        struct sh_mobile_lcdc_priv *p = platform_get_drvdata(pdev);
+        struct sh_mobile_lcdc_chan *ch;
+        int k, n;
+
+        /* restore per-channel registers */
+        for (k = 0; k < ARRAY_SIZE(p->ch); k++) {
+                ch = &p->ch[k];
+                if (!ch->enabled)
+                        continue;
+                for (n = 0; n < NR_CH_REGS; n++)
+                        lcdc_write_chan(ch, n, ch->saved_ch_regs[n]);
+        }
+
+        /* restore shared registers */
+        for (n = 0; n < NR_SHARED_REGS; n++)
+                lcdc_write(p, lcdc_shared_regs[n], p->saved_shared_regs[n]);
+
+        return 0;
+}
+
 static struct dev_pm_ops sh_mobile_lcdc_dev_pm_ops = {
         .suspend = sh_mobile_lcdc_suspend,
         .resume = sh_mobile_lcdc_resume,
+        .runtime_suspend = sh_mobile_lcdc_runtime_suspend,
+        .runtime_resume = sh_mobile_lcdc_runtime_resume,
 };
 
 static int sh_mobile_lcdc_remove(struct platform_device *pdev);
@@ -778,6 +923,7 @@ static int __init sh_mobile_lcdc_probe(struct platform_device *pdev)
         }
 
         priv->irq = i;
+        priv->dev = &pdev->dev;
         platform_set_drvdata(pdev, priv);
         pdata = pdev->dev.platform_data;
 
@@ -792,6 +938,8 @@ static int __init sh_mobile_lcdc_probe(struct platform_device *pdev)
                         goto err1;
                 }
                 init_waitqueue_head(&priv->ch[i].frame_end_wait);
+                priv->ch[j].pan_offset = 0;
+                priv->ch[j].new_pan_offset = 0;
 
                 switch (pdata->ch[i].chan) {
                 case LCDC_CHAN_MAINLCD:
@@ -834,7 +982,9 @@ static int __init sh_mobile_lcdc_probe(struct platform_device *pdev)
                 info = priv->ch[i].info;
                 info->fbops = &sh_mobile_lcdc_ops;
                 info->var.xres = info->var.xres_virtual = cfg->lcd_cfg.xres;
-                info->var.yres = info->var.yres_virtual = cfg->lcd_cfg.yres;
+                info->var.yres = cfg->lcd_cfg.yres;
+                /* Default Y virtual resolution is 2x panel size */
+                info->var.yres_virtual = info->var.yres * 2;
                 info->var.width = cfg->lcd_size_cfg.width;
                 info->var.height = cfg->lcd_size_cfg.height;
                 info->var.activate = FB_ACTIVATE_NOW;
@@ -844,7 +994,8 @@ static int __init sh_mobile_lcdc_probe(struct platform_device *pdev)
 
                 info->fix = sh_mobile_lcdc_fix;
                 info->fix.line_length = cfg->lcd_cfg.xres * (cfg->bpp / 8);
-                info->fix.smem_len = info->fix.line_length * cfg->lcd_cfg.yres;
+                info->fix.smem_len = info->fix.line_length *
+                        info->var.yres_virtual;
 
                 buf = dma_alloc_coherent(&pdev->dev, info->fix.smem_len,
                                          &priv->ch[i].dma_handle, GFP_KERNEL);
@@ -947,11 +1098,10 @@ static int sh_mobile_lcdc_remove(struct platform_device *pdev)
                 framebuffer_release(info);
         }
 
-#ifdef CONFIG_HAVE_CLK
         if (priv->dot_clk)
                 clk_put(priv->dot_clk);
-        clk_put(priv->clk);
-#endif
+
+        pm_runtime_disable(priv->dev);
 
         if (priv->base)
                 iounmap(priv->base);
diff --git a/drivers/video/sis/sis_main.c b/drivers/video/sis/sis_main.c
index 4a067f0d0ceb..a4e05e4d7501 100644
--- a/drivers/video/sis/sis_main.c
+++ b/drivers/video/sis/sis_main.c
@@ -698,8 +698,8 @@ sisfb_search_refresh_rate(struct sis_video_info *ivideo, unsigned int rate, int
                                                 rate, sisfb_vrate[i].refresh);
                                         ivideo->rate_idx = sisfb_vrate[i].idx;
                                         ivideo->refresh_rate = sisfb_vrate[i].refresh;
-                                } else if(((rate - sisfb_vrate[i-1].refresh) <= 2)
-                                                && (sisfb_vrate[i].idx != 1)) {
+                                } else if((sisfb_vrate[i].idx != 1) &&
+                                                ((rate - sisfb_vrate[i-1].refresh) <= 2)) {
                                         DPRINTK("sisfb: Adjusting rate from %d down to %d\n",
                                                 rate, sisfb_vrate[i-1].refresh);
                                         ivideo->rate_idx = sisfb_vrate[i-1].idx;
diff --git a/drivers/video/sis/vstruct.h b/drivers/video/sis/vstruct.h
index 705c85360526..bef4aae388d0 100644
--- a/drivers/video/sis/vstruct.h
+++ b/drivers/video/sis/vstruct.h
@@ -342,7 +342,7 @@ struct SiS_Private
         unsigned short                  SiS_RY4COE;
         unsigned short                  SiS_LCDHDES;
         unsigned short                  SiS_LCDVDES;
-        unsigned short                  SiS_DDC_Port;
+        SISIOADDRESS                    SiS_DDC_Port;
         unsigned short                  SiS_DDC_Index;
         unsigned short                  SiS_DDC_Data;
         unsigned short                  SiS_DDC_NData;
diff --git a/drivers/video/tmiofb.c b/drivers/video/tmiofb.c
index a1eb0862255b..6913fe168c25 100644
--- a/drivers/video/tmiofb.c
+++ b/drivers/video/tmiofb.c
@@ -974,7 +974,7 @@ static int tmiofb_resume(struct platform_device *dev)
 {
         struct fb_info *info = platform_get_drvdata(dev);
         struct mfd_cell *cell = dev->dev.platform_data;
-        int retval;
+        int retval = 0;
 
         acquire_console_sem();
 
diff --git a/drivers/video/via/accel.c b/drivers/video/via/accel.c
index 45c54bfe99bb..9d4f3a49ba4a 100644
--- a/drivers/video/via/accel.c
+++ b/drivers/video/via/accel.c
@@ -20,229 +20,430 @@
  */
 #include "global.h"
 
-void viafb_init_accel(void)
+static int hw_bitblt_1(void __iomem *engine, u8 op, u32 width, u32 height,
+        u8 dst_bpp, u32 dst_addr, u32 dst_pitch, u32 dst_x, u32 dst_y,
+        u32 *src_mem, u32 src_addr, u32 src_pitch, u32 src_x, u32 src_y,
+        u32 fg_color, u32 bg_color, u8 fill_rop)
 {
-        viaparinfo->fbmem_free -= CURSOR_SIZE;
-        viaparinfo->cursor_start = viaparinfo->fbmem_free;
-        viaparinfo->fbmem_used += CURSOR_SIZE;
+        u32 ge_cmd = 0, tmp, i;
 
-        /* Reverse 8*1024 memory space for cursor image */
-        viaparinfo->fbmem_free -= (CURSOR_SIZE + VQ_SIZE);
-        viaparinfo->VQ_start = viaparinfo->fbmem_free;
-        viaparinfo->VQ_end = viaparinfo->VQ_start + VQ_SIZE - 1;
-        viaparinfo->fbmem_used += (CURSOR_SIZE + VQ_SIZE); }
-
-void viafb_init_2d_engine(void)
-{
-        u32 dwVQStartAddr, dwVQEndAddr;
-        u32 dwVQLen, dwVQStartL, dwVQEndL, dwVQStartEndH;
-
-        /* init 2D engine regs to reset 2D engine */
-        writel(0x0, viaparinfo->io_virt + VIA_REG_GEMODE);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_SRCPOS);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_DSTPOS);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_DIMENSION);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_PATADDR);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_FGCOLOR);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_BGCOLOR);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_CLIPTL);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_CLIPBR);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_OFFSET);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_KEYCONTROL);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_SRCBASE);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_DSTBASE);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_PITCH);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_MONOPAT1);
-
-        /* Init AGP and VQ regs */
-        switch (viaparinfo->chip_info->gfx_chip_name) {
-        case UNICHROME_K8M890:
-        case UNICHROME_P4M900:
-                writel(0x00100000, viaparinfo->io_virt + VIA_REG_CR_TRANSET);
-                writel(0x680A0000, viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-                writel(0x02000000, viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-                break;
+        if (!op || op > 3) {
+                printk(KERN_WARNING "hw_bitblt_1: Invalid operation: %d\n", op);
+                return -EINVAL;
+        }
 
-        default:
-                writel(0x00100000, viaparinfo->io_virt + VIA_REG_TRANSET);
-                writel(0x00000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                writel(0x00333004, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                writel(0x60000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                writel(0x61000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                writel(0x62000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                writel(0x63000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                writel(0x64000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                writel(0x7D000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-
-                writel(0xFE020000, viaparinfo->io_virt + VIA_REG_TRANSET);
-                writel(0x00000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                break;
+        if (op != VIA_BITBLT_FILL && !src_mem && src_addr == dst_addr) {
+                if (src_x < dst_x) {
+                        ge_cmd |= 0x00008000;
+                        src_x += width - 1;
+                        dst_x += width - 1;
+                }
+                if (src_y < dst_y) {
+                        ge_cmd |= 0x00004000;
+                        src_y += height - 1;
+                        dst_y += height - 1;
+                }
         }
-        if (viaparinfo->VQ_start != 0) {
-                /* Enable VQ */
-                dwVQStartAddr = viaparinfo->VQ_start;
-                dwVQEndAddr = viaparinfo->VQ_end;
-
-                dwVQStartL = 0x50000000 | (dwVQStartAddr & 0xFFFFFF);
-                dwVQEndL = 0x51000000 | (dwVQEndAddr & 0xFFFFFF);
-                dwVQStartEndH = 0x52000000 |
-                        ((dwVQStartAddr & 0xFF000000) >> 24) |
-                        ((dwVQEndAddr & 0xFF000000) >> 16);
-                dwVQLen = 0x53000000 | (VQ_SIZE >> 3);
-                switch (viaparinfo->chip_info->gfx_chip_name) {
-                case UNICHROME_K8M890:
-                case UNICHROME_P4M900:
-                        dwVQStartL |= 0x20000000;
-                        dwVQEndL |= 0x20000000;
-                        dwVQStartEndH |= 0x20000000;
-                        dwVQLen |= 0x20000000;
+
+        if (op == VIA_BITBLT_FILL) {
+                switch (fill_rop) {
+                case 0x00: /* blackness */
+                case 0x5A: /* pattern inversion */
+                case 0xF0: /* pattern copy */
+                case 0xFF: /* whiteness */
                         break;
                 default:
-                        break;
+                        printk(KERN_WARNING "hw_bitblt_1: Invalid fill rop: "
+                                "%u\n", fill_rop);
+                        return -EINVAL;
                 }
+        }
 
-                switch (viaparinfo->chip_info->gfx_chip_name) {
-                case UNICHROME_K8M890:
-                case UNICHROME_P4M900:
-                        writel(0x00100000,
-                                viaparinfo->io_virt + VIA_REG_CR_TRANSET);
-                        writel(dwVQStartEndH,
-                                viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-                        writel(dwVQStartL,
-                                viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-                        writel(dwVQEndL,
-                                viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-                        writel(dwVQLen,
-                                viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-                        writel(0x74301001,
-                                viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-                        writel(0x00000000,
-                                viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-                        break;
-                default:
-                        writel(0x00FE0000,
-                                viaparinfo->io_virt + VIA_REG_TRANSET);
-                        writel(0x080003FE,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x0A00027C,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x0B000260,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x0C000274,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x0D000264,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x0E000000,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x0F000020,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x1000027E,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x110002FE,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x200F0060,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-
-                        writel(0x00000006,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x40008C0F,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x44000000,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x45080C04,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x46800408,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-
-                        writel(dwVQStartEndH,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(dwVQStartL,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(dwVQEndL,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(dwVQLen,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        break;
+        switch (dst_bpp) {
+        case 8:
+                tmp = 0x00000000;
+                break;
+        case 16:
+                tmp = 0x00000100;
+                break;
+        case 32:
+                tmp = 0x00000300;
+                break;
+        default:
+                printk(KERN_WARNING "hw_bitblt_1: Unsupported bpp %d\n",
+                        dst_bpp);
+                return -EINVAL;
+        }
+        writel(tmp, engine + 0x04);
+
+        if (op != VIA_BITBLT_FILL) {
+                if (src_x & (op == VIA_BITBLT_MONO ? 0xFFFF8000 : 0xFFFFF000)
+                        || src_y & 0xFFFFF000) {
+                        printk(KERN_WARNING "hw_bitblt_1: Unsupported source "
+                                "x/y %d %d\n", src_x, src_y);
+                        return -EINVAL;
                 }
-        } else {
-                /* Disable VQ */
-                switch (viaparinfo->chip_info->gfx_chip_name) {
-                case UNICHROME_K8M890:
-                case UNICHROME_P4M900:
-                        writel(0x00100000,
-                                viaparinfo->io_virt + VIA_REG_CR_TRANSET);
-                        writel(0x74301000,
-                                viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-                        break;
-                default:
-                        writel(0x00FE0000,
-                                viaparinfo->io_virt + VIA_REG_TRANSET);
-                        writel(0x00000004,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x40008C0F,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x44000000,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x45080C04,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        writel(0x46800408,
-                                viaparinfo->io_virt + VIA_REG_TRANSPACE);
-                        break;
+                tmp = src_x | (src_y << 16);
+                writel(tmp, engine + 0x08);
+        }
+
+        if (dst_x & 0xFFFFF000 || dst_y & 0xFFFFF000) {
+                printk(KERN_WARNING "hw_bitblt_1: Unsupported destination x/y "
+                        "%d %d\n", dst_x, dst_y);
+                return -EINVAL;
+        }
+        tmp = dst_x | (dst_y << 16);
+        writel(tmp, engine + 0x0C);
+
+        if ((width - 1) & 0xFFFFF000 || (height - 1) & 0xFFFFF000) {
+                printk(KERN_WARNING "hw_bitblt_1: Unsupported width/height "
+                        "%d %d\n", width, height);
+                return -EINVAL;
+        }
+        tmp = (width - 1) | ((height - 1) << 16);
+        writel(tmp, engine + 0x10);
+
+        if (op != VIA_BITBLT_COLOR)
+                writel(fg_color, engine + 0x18);
+
+        if (op == VIA_BITBLT_MONO)
+                writel(bg_color, engine + 0x1C);
+
+        if (op != VIA_BITBLT_FILL) {
+                tmp = src_mem ? 0 : src_addr;
+                if (dst_addr & 0xE0000007) {
+                        printk(KERN_WARNING "hw_bitblt_1: Unsupported source "
+                                "address %X\n", tmp);
+                        return -EINVAL;
                 }
+                tmp >>= 3;
+                writel(tmp, engine + 0x30);
+        }
+
+        if (dst_addr & 0xE0000007) {
+                printk(KERN_WARNING "hw_bitblt_1: Unsupported destination "
+                        "address %X\n", dst_addr);
+                return -EINVAL;
         }
+        tmp = dst_addr >> 3;
+        writel(tmp, engine + 0x34);
 
-        viafb_set_2d_color_depth(viaparinfo->bpp);
+        if (op == VIA_BITBLT_FILL)
+                tmp = 0;
+        else
+                tmp = src_pitch;
+        if (tmp & 0xFFFFC007 || dst_pitch & 0xFFFFC007) {
+                printk(KERN_WARNING "hw_bitblt_1: Unsupported pitch %X %X\n",
+                        tmp, dst_pitch);
+                return -EINVAL;
+        }
+        tmp = (tmp >> 3) | (dst_pitch << (16 - 3));
+        writel(tmp, engine + 0x38);
+
+        if (op == VIA_BITBLT_FILL)
+                ge_cmd |= fill_rop << 24 | 0x00002000 | 0x00000001;
+        else {
+                ge_cmd |= 0xCC000000; /* ROP=SRCCOPY */
+                if (src_mem)
+                        ge_cmd |= 0x00000040;
+                if (op == VIA_BITBLT_MONO)
+                        ge_cmd |= 0x00000002 | 0x00000100 | 0x00020000;
+                else
+                        ge_cmd |= 0x00000001;
+        }
+        writel(ge_cmd, engine);
 
-        writel(0x0, viaparinfo->io_virt + VIA_REG_SRCBASE);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_DSTBASE);
+        if (op == VIA_BITBLT_FILL || !src_mem)
+                return 0;
 
-        writel(VIA_PITCH_ENABLE |
-                   (((viaparinfo->hres *
-                      viaparinfo->bpp >> 3) >> 3) | (((viaparinfo->hres *
-                                                   viaparinfo->
-                                                   bpp >> 3) >> 3) << 16)),
-                                        viaparinfo->io_virt + VIA_REG_PITCH);
+        tmp = (width * height * (op == VIA_BITBLT_MONO ? 1 : (dst_bpp >> 3)) +
+                3) >> 2;
+
+        for (i = 0; i < tmp; i++)
+                writel(src_mem[i], engine + VIA_MMIO_BLTBASE);
+
+        return 0;
 }
 
-void viafb_set_2d_color_depth(int bpp)
+static int hw_bitblt_2(void __iomem *engine, u8 op, u32 width, u32 height,
+        u8 dst_bpp, u32 dst_addr, u32 dst_pitch, u32 dst_x, u32 dst_y,
+        u32 *src_mem, u32 src_addr, u32 src_pitch, u32 src_x, u32 src_y,
+        u32 fg_color, u32 bg_color, u8 fill_rop)
 {
-        u32 dwGEMode;
+        u32 ge_cmd = 0, tmp, i;
+
+        if (!op || op > 3) {
+                printk(KERN_WARNING "hw_bitblt_2: Invalid operation: %d\n", op);
+                return -EINVAL;
+        }
 
-        dwGEMode = readl(viaparinfo->io_virt + 0x04) & 0xFFFFFCFF;
+        if (op != VIA_BITBLT_FILL && !src_mem && src_addr == dst_addr) {
+                if (src_x < dst_x) {
+                        ge_cmd |= 0x00008000;
+                        src_x += width - 1;
+                        dst_x += width - 1;
+                }
+                if (src_y < dst_y) {
+                        ge_cmd |= 0x00004000;
+                        src_y += height - 1;
+                        dst_y += height - 1;
+                }
+        }
 
-        switch (bpp) {
+        if (op == VIA_BITBLT_FILL) {
+                switch (fill_rop) {
+                case 0x00: /* blackness */
+                case 0x5A: /* pattern inversion */
+                case 0xF0: /* pattern copy */
+                case 0xFF: /* whiteness */
+                        break;
+                default:
+                        printk(KERN_WARNING "hw_bitblt_2: Invalid fill rop: "
+                                "%u\n", fill_rop);
+                        return -EINVAL;
+                }
+        }
+
+        switch (dst_bpp) {
+        case 8:
+                tmp = 0x00000000;
+                break;
         case 16:
-                dwGEMode |= VIA_GEM_16bpp;
+                tmp = 0x00000100;
                 break;
         case 32:
-                dwGEMode |= VIA_GEM_32bpp;
+                tmp = 0x00000300;
                 break;
         default:
-                dwGEMode |= VIA_GEM_8bpp;
-                break;
+                printk(KERN_WARNING "hw_bitblt_2: Unsupported bpp %d\n",
+                        dst_bpp);
+                return -EINVAL;
+        }
+        writel(tmp, engine + 0x04);
+
+        if (op == VIA_BITBLT_FILL)
+                tmp = 0;
+        else
+                tmp = src_pitch;
+        if (tmp & 0xFFFFC007 || dst_pitch & 0xFFFFC007) {
+                printk(KERN_WARNING "hw_bitblt_2: Unsupported pitch %X %X\n",
+                        tmp, dst_pitch);
+                return -EINVAL;
+        }
+        tmp = (tmp >> 3) | (dst_pitch << (16 - 3));
+        writel(tmp, engine + 0x08);
+
+        if ((width - 1) & 0xFFFFF000 || (height - 1) & 0xFFFFF000) {
+                printk(KERN_WARNING "hw_bitblt_2: Unsupported width/height "
+                        "%d %d\n", width, height);
+                return -EINVAL;
+        }
+        tmp = (width - 1) | ((height - 1) << 16);
+        writel(tmp, engine + 0x0C);
+
+        if (dst_x & 0xFFFFF000 || dst_y & 0xFFFFF000) {
+                printk(KERN_WARNING "hw_bitblt_2: Unsupported destination x/y "
+                        "%d %d\n", dst_x, dst_y);
+                return -EINVAL;
+        }
+        tmp = dst_x | (dst_y << 16);
+        writel(tmp, engine + 0x10);
+
+        if (dst_addr & 0xE0000007) {
+                printk(KERN_WARNING "hw_bitblt_2: Unsupported destination "
+                        "address %X\n", dst_addr);
+                return -EINVAL;
+        }
+        tmp = dst_addr >> 3;
+        writel(tmp, engine + 0x14);
+
+        if (op != VIA_BITBLT_FILL) {
+                if (src_x & (op == VIA_BITBLT_MONO ? 0xFFFF8000 : 0xFFFFF000)
+                        || src_y & 0xFFFFF000) {
+                        printk(KERN_WARNING "hw_bitblt_2: Unsupported source "
+                                "x/y %d %d\n", src_x, src_y);
+                        return -EINVAL;
+                }
+                tmp = src_x | (src_y << 16);
+                writel(tmp, engine + 0x18);
+
+                tmp = src_mem ? 0 : src_addr;
+                if (dst_addr & 0xE0000007) {
+                        printk(KERN_WARNING "hw_bitblt_2: Unsupported source "
+                                "address %X\n", tmp);
+                        return -EINVAL;
+                }
+                tmp >>= 3;
+                writel(tmp, engine + 0x1C);
         }
 
-        /* Set BPP and Pitch */
-        writel(dwGEMode, viaparinfo->io_virt + VIA_REG_GEMODE);
+        if (op != VIA_BITBLT_COLOR)
+                writel(fg_color, engine + 0x4C);
+
+        if (op == VIA_BITBLT_MONO)
+                writel(bg_color, engine + 0x50);
+
+        if (op == VIA_BITBLT_FILL)
+                ge_cmd |= fill_rop << 24 | 0x00002000 | 0x00000001;
+        else {
+                ge_cmd |= 0xCC000000; /* ROP=SRCCOPY */
+                if (src_mem)
+                        ge_cmd |= 0x00000040;
+                if (op == VIA_BITBLT_MONO)
+                        ge_cmd |= 0x00000002 | 0x00000100 | 0x00020000;
+                else
+                        ge_cmd |= 0x00000001;
+        }
+        writel(ge_cmd, engine);
+
+        if (op == VIA_BITBLT_FILL || !src_mem)
+                return 0;
+
+        tmp = (width * height * (op == VIA_BITBLT_MONO ? 1 : (dst_bpp >> 3)) +
+                3) >> 2;
+
+        for (i = 0; i < tmp; i++)
+                writel(src_mem[i], engine + VIA_MMIO_BLTBASE);
+
+        return 0;
 }
 
-void viafb_hw_cursor_init(void)
+int viafb_init_engine(struct fb_info *info)
 {
+        struct viafb_par *viapar = info->par;
+        void __iomem *engine;
+        u32 vq_start_addr, vq_end_addr, vq_start_low, vq_end_low, vq_high,
+                vq_len, chip_name = viapar->shared->chip_info.gfx_chip_name;
+
+        engine = ioremap_nocache(info->fix.mmio_start, info->fix.mmio_len);
+        viapar->shared->engine_mmio = engine;
+        if (!engine) {
+                printk(KERN_WARNING "viafb_init_accel: ioremap failed, "
+                        "hardware acceleration disabled\n");
+                return -ENOMEM;
+        }
+
+        switch (chip_name) {
+        case UNICHROME_CLE266:
+        case UNICHROME_K400:
+        case UNICHROME_K800:
+        case UNICHROME_PM800:
+        case UNICHROME_CN700:
+        case UNICHROME_CX700:
+        case UNICHROME_CN750:
+        case UNICHROME_K8M890:
+        case UNICHROME_P4M890:
+        case UNICHROME_P4M900:
+                viapar->shared->hw_bitblt = hw_bitblt_1;
+                break;
+        case UNICHROME_VX800:
+        case UNICHROME_VX855:
+                viapar->shared->hw_bitblt = hw_bitblt_2;
+                break;
+        default:
+                viapar->shared->hw_bitblt = NULL;
+        }
+
+        viapar->fbmem_free -= CURSOR_SIZE;
+        viapar->shared->cursor_vram_addr = viapar->fbmem_free;
+        viapar->fbmem_used += CURSOR_SIZE;
+
+        viapar->fbmem_free -= VQ_SIZE;
+        viapar->shared->vq_vram_addr = viapar->fbmem_free;
+        viapar->fbmem_used += VQ_SIZE;
+
+        /* Init AGP and VQ regs */
+        switch (chip_name) {
+        case UNICHROME_K8M890:
+        case UNICHROME_P4M900:
+                writel(0x00100000, engine + VIA_REG_CR_TRANSET);
+                writel(0x680A0000, engine + VIA_REG_CR_TRANSPACE);
+                writel(0x02000000, engine + VIA_REG_CR_TRANSPACE);
+                break;
+
+        default:
+                writel(0x00100000, engine + VIA_REG_TRANSET);
+                writel(0x00000000, engine + VIA_REG_TRANSPACE);
+                writel(0x00333004, engine + VIA_REG_TRANSPACE);
+                writel(0x60000000, engine + VIA_REG_TRANSPACE);
+                writel(0x61000000, engine + VIA_REG_TRANSPACE);
+                writel(0x62000000, engine + VIA_REG_TRANSPACE);
+                writel(0x63000000, engine + VIA_REG_TRANSPACE);
+                writel(0x64000000, engine + VIA_REG_TRANSPACE);
+                writel(0x7D000000, engine + VIA_REG_TRANSPACE);
+
+                writel(0xFE020000, engine + VIA_REG_TRANSET);
+                writel(0x00000000, engine + VIA_REG_TRANSPACE);
+                break;
+        }
+
+        /* Enable VQ */
+        vq_start_addr = viapar->shared->vq_vram_addr;
+        vq_end_addr = viapar->shared->vq_vram_addr + VQ_SIZE - 1;
+
+        vq_start_low = 0x50000000 | (vq_start_addr & 0xFFFFFF);
+        vq_end_low = 0x51000000 | (vq_end_addr & 0xFFFFFF);
+        vq_high = 0x52000000 | ((vq_start_addr & 0xFF000000) >> 24) |
+                ((vq_end_addr & 0xFF000000) >> 16);
+        vq_len = 0x53000000 | (VQ_SIZE >> 3);
+
+        switch (chip_name) {
+        case UNICHROME_K8M890:
+        case UNICHROME_P4M900:
+                vq_start_low |= 0x20000000;
+                vq_end_low |= 0x20000000;
+                vq_high |= 0x20000000;
+                vq_len |= 0x20000000;
+
+                writel(0x00100000, engine + VIA_REG_CR_TRANSET);
+                writel(vq_high, engine + VIA_REG_CR_TRANSPACE);
+                writel(vq_start_low, engine + VIA_REG_CR_TRANSPACE);
+                writel(vq_end_low, engine + VIA_REG_CR_TRANSPACE);
+                writel(vq_len, engine + VIA_REG_CR_TRANSPACE);
+                writel(0x74301001, engine + VIA_REG_CR_TRANSPACE);
+                writel(0x00000000, engine + VIA_REG_CR_TRANSPACE);
+                break;
+        default:
+                writel(0x00FE0000, engine + VIA_REG_TRANSET);
+                writel(0x080003FE, engine + VIA_REG_TRANSPACE);
+                writel(0x0A00027C, engine + VIA_REG_TRANSPACE);
+                writel(0x0B000260, engine + VIA_REG_TRANSPACE);
+                writel(0x0C000274, engine + VIA_REG_TRANSPACE);
+                writel(0x0D000264, engine + VIA_REG_TRANSPACE);
+                writel(0x0E000000, engine + VIA_REG_TRANSPACE);
+                writel(0x0F000020, engine + VIA_REG_TRANSPACE);
+                writel(0x1000027E, engine + VIA_REG_TRANSPACE);
+                writel(0x110002FE, engine + VIA_REG_TRANSPACE);
+                writel(0x200F0060, engine + VIA_REG_TRANSPACE);
+
+                writel(0x00000006, engine + VIA_REG_TRANSPACE);
+                writel(0x40008C0F, engine + VIA_REG_TRANSPACE);
+                writel(0x44000000, engine + VIA_REG_TRANSPACE);
+                writel(0x45080C04, engine + VIA_REG_TRANSPACE);
+                writel(0x46800408, engine + VIA_REG_TRANSPACE);
+
+                writel(vq_high, engine + VIA_REG_TRANSPACE);
+                writel(vq_start_low, engine + VIA_REG_TRANSPACE);
+                writel(vq_end_low, engine + VIA_REG_TRANSPACE);
+                writel(vq_len, engine + VIA_REG_TRANSPACE);
+                break;
+        }
+
         /* Set Cursor Image Base Address */
-        writel(viaparinfo->cursor_start,
-                viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_CURSOR_POS);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_CURSOR_ORG);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_CURSOR_BG);
-        writel(0x0, viaparinfo->io_virt + VIA_REG_CURSOR_FG);
+        writel(viapar->shared->cursor_vram_addr, engine + VIA_REG_CURSOR_MODE);
+        writel(0x0, engine + VIA_REG_CURSOR_POS);
+        writel(0x0, engine + VIA_REG_CURSOR_ORG);
+        writel(0x0, engine + VIA_REG_CURSOR_BG);
+        writel(0x0, engine + VIA_REG_CURSOR_FG);
+        return 0;
 }
 
 void viafb_show_hw_cursor(struct fb_info *info, int Status)
 {
-        u32 temp;
-        u32 iga_path = ((struct viafb_par *)(info->par))->iga_path;
+        struct viafb_par *viapar = info->par;
+        u32 temp, iga_path = viapar->iga_path;
 
-        temp = readl(viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
+        temp = readl(viapar->shared->engine_mmio + VIA_REG_CURSOR_MODE);
         switch (Status) {
         case HW_Cursor_ON:
                 temp |= 0x1;
@@ -259,25 +460,27 @@ void viafb_show_hw_cursor(struct fb_info *info, int Status)
         default:
                 temp &= 0x7FFFFFFF;
         }
-        writel(temp, viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
+        writel(temp, viapar->shared->engine_mmio + VIA_REG_CURSOR_MODE);
 }
 
-int viafb_wait_engine_idle(void)
+void viafb_wait_engine_idle(struct fb_info *info)
 {
+        struct viafb_par *viapar = info->par;
         int loop = 0;
 
-        while (!(readl(viaparinfo->io_virt + VIA_REG_STATUS) &
+        while (!(readl(viapar->shared->engine_mmio + VIA_REG_STATUS) &
                         VIA_VR_QUEUE_BUSY) && (loop < MAXLOOP)) {
                 loop++;
                 cpu_relax();
         }
 
-        while ((readl(viaparinfo->io_virt + VIA_REG_STATUS) &
+        while ((readl(viapar->shared->engine_mmio + VIA_REG_STATUS) &
                     (VIA_CMD_RGTR_BUSY | VIA_2D_ENG_BUSY | VIA_3D_ENG_BUSY)) &&
                     (loop < MAXLOOP)) {
                 loop++;
                 cpu_relax();
         }
 
-        return loop >= MAXLOOP;
+        if (loop >= MAXLOOP)
+                printk(KERN_ERR "viafb_wait_engine_idle: not syncing\n");
 }
diff --git a/drivers/video/via/accel.h b/drivers/video/via/accel.h
index 29bf854e8ccf..615c84ad0f01 100644
--- a/drivers/video/via/accel.h
+++ b/drivers/video/via/accel.h
@@ -159,11 +159,12 @@
 
 #define MAXLOOP                 0xFFFFFF
 
-void viafb_init_accel(void);
-void viafb_init_2d_engine(void);
-void set_2d_color_depth(int);
-void viafb_hw_cursor_init(void);
-void viafb_show_hw_cursor(struct fb_info *info, int Status); int
-viafb_wait_engine_idle(void); void viafb_set_2d_color_depth(int bpp);
+#define VIA_BITBLT_COLOR        1
+#define VIA_BITBLT_MONO         2
+#define VIA_BITBLT_FILL         3
+
+int viafb_init_engine(struct fb_info *info);
+void viafb_show_hw_cursor(struct fb_info *info, int Status);
+void viafb_wait_engine_idle(struct fb_info *info);
 
 #endif /* __ACCEL_H__ */
diff --git a/drivers/video/via/chip.h b/drivers/video/via/chip.h
index dde95edc387a..474f428aea92 100644
--- a/drivers/video/via/chip.h
+++ b/drivers/video/via/chip.h
@@ -68,6 +68,9 @@
 #define     UNICHROME_VX800         11
 #define     UNICHROME_VX800_DID     0x1122
 
+#define     UNICHROME_VX855         12
+#define     UNICHROME_VX855_DID     0x5122
+
 /**************************************************/
 /* Definition TMDS Trasmitter Information         */
 /**************************************************/
@@ -122,7 +125,6 @@ struct lvds_chip_information {
 struct chip_information {
         int gfx_chip_name;
         int gfx_chip_revision;
-        int chip_on_slot;
         struct tmds_chip_information tmds_chip_info;
         struct lvds_chip_information lvds_chip_info;
         struct lvds_chip_information lvds_chip_info2;
diff --git a/drivers/video/via/dvi.c b/drivers/video/via/dvi.c
index d6965447ca69..c5c32b6b6e6c 100644
--- a/drivers/video/via/dvi.c
+++ b/drivers/video/via/dvi.c
@@ -160,7 +160,7 @@ int viafb_tmds_trasmitter_identify(void)
 
 static void tmds_register_write(int index, u8 data)
 {
-        viaparinfo->i2c_stuff.i2c_port =
+        viaparinfo->shared->i2c_stuff.i2c_port =
                 viaparinfo->chip_info->tmds_chip_info.i2c_port;
 
         viafb_i2c_writebyte(viaparinfo->chip_info->tmds_chip_info.
@@ -172,7 +172,7 @@ static int tmds_register_read(int index)
 {
         u8 data;
 
-        viaparinfo->i2c_stuff.i2c_port =
+        viaparinfo->shared->i2c_stuff.i2c_port =
                 viaparinfo->chip_info->tmds_chip_info.i2c_port;
         viafb_i2c_readbyte((u8) viaparinfo->chip_info->
             tmds_chip_info.tmds_chip_slave_addr,
@@ -182,7 +182,7 @@ static int tmds_register_read(int index)
 
 static int tmds_register_read_bytes(int index, u8 *buff, int buff_len)
 {
-        viaparinfo->i2c_stuff.i2c_port =
+        viaparinfo->shared->i2c_stuff.i2c_port =
                 viaparinfo->chip_info->tmds_chip_info.i2c_port;
         viafb_i2c_readbytes((u8) viaparinfo->chip_info->tmds_chip_info.
                          tmds_chip_slave_addr, (u8) index, buff, buff_len);
diff --git a/drivers/video/via/global.c b/drivers/video/via/global.c
index 468be2425af3..b675cdbb03ad 100644
--- a/drivers/video/via/global.c
+++ b/drivers/video/via/global.c
@@ -32,7 +32,6 @@ int viafb_lcd_dsp_method = LCD_EXPANDSION;
 int viafb_lcd_mode = LCD_OPENLDI;
 int viafb_bpp = 32;
 int viafb_bpp1 = 32;
-int viafb_accel = 1;
 int viafb_CRT_ON = 1;
 int viafb_DVI_ON;
 int viafb_LCD_ON ;
@@ -46,13 +45,11 @@ int viafb_hotplug_refresh = 60;
 unsigned int viafb_second_offset;
 int viafb_second_size;
 int viafb_primary_dev = None_Device;
-void __iomem *viafb_FB_MM;
 unsigned int viafb_second_xres = 640;
 unsigned int viafb_second_yres = 480;
 unsigned int viafb_second_virtual_xres;
 unsigned int viafb_second_virtual_yres;
 int viafb_lcd_panel_id = LCD_PANEL_ID_MAXIMUM + 1;
-struct fb_cursor viacursor;
 struct fb_info *viafbinfo;
 struct fb_info *viafbinfo1;
 struct viafb_par *viaparinfo;
diff --git a/drivers/video/via/global.h b/drivers/video/via/global.h
index 7543d5f7e309..d69d0ca99c2f 100644
--- a/drivers/video/via/global.h
+++ b/drivers/video/via/global.h
@@ -77,8 +77,6 @@ extern int viafb_hotplug_Yres;
 extern int viafb_hotplug_bpp;
 extern int viafb_hotplug_refresh;
 extern int viafb_primary_dev;
-extern void __iomem *viafb_FB_MM;
-extern struct fb_cursor viacursor;
 
 extern unsigned int viafb_second_xres;
 extern unsigned int viafb_second_yres;
diff --git a/drivers/video/via/hw.c b/drivers/video/via/hw.c
index c8960003f47d..3e083ff67ae2 100644
--- a/drivers/video/via/hw.c
+++ b/drivers/video/via/hw.c
@@ -21,125 +21,143 @@
 
 #include "global.h"
 
-static const struct pci_device_id_info pciidlist[] = {
-        {PCI_VIA_VENDOR_ID, UNICHROME_CLE266_DID, UNICHROME_CLE266},
-        {PCI_VIA_VENDOR_ID, UNICHROME_PM800_DID, UNICHROME_PM800},
-        {PCI_VIA_VENDOR_ID, UNICHROME_K400_DID, UNICHROME_K400},
-        {PCI_VIA_VENDOR_ID, UNICHROME_K800_DID, UNICHROME_K800},
-        {PCI_VIA_VENDOR_ID, UNICHROME_CN700_DID, UNICHROME_CN700},
-        {PCI_VIA_VENDOR_ID, UNICHROME_P4M890_DID, UNICHROME_P4M890},
-        {PCI_VIA_VENDOR_ID, UNICHROME_K8M890_DID, UNICHROME_K8M890},
-        {PCI_VIA_VENDOR_ID, UNICHROME_CX700_DID, UNICHROME_CX700},
-        {PCI_VIA_VENDOR_ID, UNICHROME_P4M900_DID, UNICHROME_P4M900},
-        {PCI_VIA_VENDOR_ID, UNICHROME_CN750_DID, UNICHROME_CN750},
-        {PCI_VIA_VENDOR_ID, UNICHROME_VX800_DID, UNICHROME_VX800},
-        {0, 0, 0}
-};
-
-struct offset offset_reg = {
-        /* IGA1 Offset Register */
-        {IGA1_OFFSET_REG_NUM, {{CR13, 0, 7}, {CR35, 5, 7} } },
-        /* IGA2 Offset Register */
-        {IGA2_OFFSET_REG_NUM, {{CR66, 0, 7}, {CR67, 0, 1} } }
-};
-
 static struct pll_map pll_value[] = {
-        {CLK_25_175M, CLE266_PLL_25_175M, K800_PLL_25_175M, CX700_25_175M},
-        {CLK_29_581M, CLE266_PLL_29_581M, K800_PLL_29_581M, CX700_29_581M},
-        {CLK_26_880M, CLE266_PLL_26_880M, K800_PLL_26_880M, CX700_26_880M},
-        {CLK_31_490M, CLE266_PLL_31_490M, K800_PLL_31_490M, CX700_31_490M},
-        {CLK_31_500M, CLE266_PLL_31_500M, K800_PLL_31_500M, CX700_31_500M},
-        {CLK_31_728M, CLE266_PLL_31_728M, K800_PLL_31_728M, CX700_31_728M},
-        {CLK_32_668M, CLE266_PLL_32_668M, K800_PLL_32_668M, CX700_32_668M},
-        {CLK_36_000M, CLE266_PLL_36_000M, K800_PLL_36_000M, CX700_36_000M},
-        {CLK_40_000M, CLE266_PLL_40_000M, K800_PLL_40_000M, CX700_40_000M},
-        {CLK_41_291M, CLE266_PLL_41_291M, K800_PLL_41_291M, CX700_41_291M},
-        {CLK_43_163M, CLE266_PLL_43_163M, K800_PLL_43_163M, CX700_43_163M},
-        {CLK_45_250M, CLE266_PLL_45_250M, K800_PLL_45_250M, CX700_45_250M},
-        {CLK_46_000M, CLE266_PLL_46_000M, K800_PLL_46_000M, CX700_46_000M},
-        {CLK_46_996M, CLE266_PLL_46_996M, K800_PLL_46_996M, CX700_46_996M},
-        {CLK_48_000M, CLE266_PLL_48_000M, K800_PLL_48_000M, CX700_48_000M},
-        {CLK_48_875M, CLE266_PLL_48_875M, K800_PLL_48_875M, CX700_48_875M},
-        {CLK_49_500M, CLE266_PLL_49_500M, K800_PLL_49_500M, CX700_49_500M},
-        {CLK_52_406M, CLE266_PLL_52_406M, K800_PLL_52_406M, CX700_52_406M},
-        {CLK_52_977M, CLE266_PLL_52_977M, K800_PLL_52_977M, CX700_52_977M},
-        {CLK_56_250M, CLE266_PLL_56_250M, K800_PLL_56_250M, CX700_56_250M},
-        {CLK_60_466M, CLE266_PLL_60_466M, K800_PLL_60_466M, CX700_60_466M},
-        {CLK_61_500M, CLE266_PLL_61_500M, K800_PLL_61_500M, CX700_61_500M},
-        {CLK_65_000M, CLE266_PLL_65_000M, K800_PLL_65_000M, CX700_65_000M},
-        {CLK_65_178M, CLE266_PLL_65_178M, K800_PLL_65_178M, CX700_65_178M},
-        {CLK_66_750M, CLE266_PLL_66_750M, K800_PLL_66_750M, CX700_66_750M},
-        {CLK_68_179M, CLE266_PLL_68_179M, K800_PLL_68_179M, CX700_68_179M},
-        {CLK_69_924M, CLE266_PLL_69_924M, K800_PLL_69_924M, CX700_69_924M},
-        {CLK_70_159M, CLE266_PLL_70_159M, K800_PLL_70_159M, CX700_70_159M},
-        {CLK_72_000M, CLE266_PLL_72_000M, K800_PLL_72_000M, CX700_72_000M},
-        {CLK_78_750M, CLE266_PLL_78_750M, K800_PLL_78_750M, CX700_78_750M},
-        {CLK_80_136M, CLE266_PLL_80_136M, K800_PLL_80_136M, CX700_80_136M},
-        {CLK_83_375M, CLE266_PLL_83_375M, K800_PLL_83_375M, CX700_83_375M},
-        {CLK_83_950M, CLE266_PLL_83_950M, K800_PLL_83_950M, CX700_83_950M},
-        {CLK_84_750M, CLE266_PLL_84_750M, K800_PLL_84_750M, CX700_84_750M},
-        {CLK_85_860M, CLE266_PLL_85_860M, K800_PLL_85_860M, CX700_85_860M},
-        {CLK_88_750M, CLE266_PLL_88_750M, K800_PLL_88_750M, CX700_88_750M},
-        {CLK_94_500M, CLE266_PLL_94_500M, K800_PLL_94_500M, CX700_94_500M},
-        {CLK_97_750M, CLE266_PLL_97_750M, K800_PLL_97_750M, CX700_97_750M},
+        {CLK_25_175M, CLE266_PLL_25_175M, K800_PLL_25_175M,
+         CX700_25_175M, VX855_25_175M},
+        {CLK_29_581M, CLE266_PLL_29_581M, K800_PLL_29_581M,
+         CX700_29_581M, VX855_29_581M},
+        {CLK_26_880M, CLE266_PLL_26_880M, K800_PLL_26_880M,
+         CX700_26_880M, VX855_26_880M},
+        {CLK_31_490M, CLE266_PLL_31_490M, K800_PLL_31_490M,
+         CX700_31_490M, VX855_31_490M},
+        {CLK_31_500M, CLE266_PLL_31_500M, K800_PLL_31_500M,
+         CX700_31_500M, VX855_31_500M},
+        {CLK_31_728M, CLE266_PLL_31_728M, K800_PLL_31_728M,
+         CX700_31_728M, VX855_31_728M},
+        {CLK_32_668M, CLE266_PLL_32_668M, K800_PLL_32_668M,
+         CX700_32_668M, VX855_32_668M},
+        {CLK_36_000M, CLE266_PLL_36_000M, K800_PLL_36_000M,
+         CX700_36_000M, VX855_36_000M},
+        {CLK_40_000M, CLE266_PLL_40_000M, K800_PLL_40_000M,
+         CX700_40_000M, VX855_40_000M},
+        {CLK_41_291M, CLE266_PLL_41_291M, K800_PLL_41_291M,
+         CX700_41_291M, VX855_41_291M},
+        {CLK_43_163M, CLE266_PLL_43_163M, K800_PLL_43_163M,
+         CX700_43_163M, VX855_43_163M},
+        {CLK_45_250M, CLE266_PLL_45_250M, K800_PLL_45_250M,
+         CX700_45_250M, VX855_45_250M},
+        {CLK_46_000M, CLE266_PLL_46_000M, K800_PLL_46_000M,
+         CX700_46_000M, VX855_46_000M},
+        {CLK_46_996M, CLE266_PLL_46_996M, K800_PLL_46_996M,
+         CX700_46_996M, VX855_46_996M},
+        {CLK_48_000M, CLE266_PLL_48_000M, K800_PLL_48_000M,
+         CX700_48_000M, VX855_48_000M},
+        {CLK_48_875M, CLE266_PLL_48_875M, K800_PLL_48_875M,
+         CX700_48_875M, VX855_48_875M},
+        {CLK_49_500M, CLE266_PLL_49_500M, K800_PLL_49_500M,
+         CX700_49_500M, VX855_49_500M},
+        {CLK_52_406M, CLE266_PLL_52_406M, K800_PLL_52_406M,
+         CX700_52_406M, VX855_52_406M},
+        {CLK_52_977M, CLE266_PLL_52_977M, K800_PLL_52_977M,
+         CX700_52_977M, VX855_52_977M},
+        {CLK_56_250M, CLE266_PLL_56_250M, K800_PLL_56_250M,
+         CX700_56_250M, VX855_56_250M},
+        {CLK_60_466M, CLE266_PLL_60_466M, K800_PLL_60_466M,
+         CX700_60_466M, VX855_60_466M},
+        {CLK_61_500M, CLE266_PLL_61_500M, K800_PLL_61_500M,
+         CX700_61_500M, VX855_61_500M},
+        {CLK_65_000M, CLE266_PLL_65_000M, K800_PLL_65_000M,
+         CX700_65_000M, VX855_65_000M},
+        {CLK_65_178M, CLE266_PLL_65_178M, K800_PLL_65_178M,
+         CX700_65_178M, VX855_65_178M},
+        {CLK_66_750M, CLE266_PLL_66_750M, K800_PLL_66_750M,
+         CX700_66_750M, VX855_66_750M},
+        {CLK_68_179M, CLE266_PLL_68_179M, K800_PLL_68_179M,
+         CX700_68_179M, VX855_68_179M},
+        {CLK_69_924M, CLE266_PLL_69_924M, K800_PLL_69_924M,
+         CX700_69_924M, VX855_69_924M},
+        {CLK_70_159M, CLE266_PLL_70_159M, K800_PLL_70_159M,
+         CX700_70_159M, VX855_70_159M},
+        {CLK_72_000M, CLE266_PLL_72_000M, K800_PLL_72_000M,
+         CX700_72_000M, VX855_72_000M},
+        {CLK_78_750M, CLE266_PLL_78_750M, K800_PLL_78_750M,
+         CX700_78_750M, VX855_78_750M},
+        {CLK_80_136M, CLE266_PLL_80_136M, K800_PLL_80_136M,
+         CX700_80_136M, VX855_80_136M},
+        {CLK_83_375M, CLE266_PLL_83_375M, K800_PLL_83_375M,
+         CX700_83_375M, VX855_83_375M},
+        {CLK_83_950M, CLE266_PLL_83_950M, K800_PLL_83_950M,
+         CX700_83_950M, VX855_83_950M},
+        {CLK_84_750M, CLE266_PLL_84_750M, K800_PLL_84_750M,
+         CX700_84_750M, VX855_84_750M},
+        {CLK_85_860M, CLE266_PLL_85_860M, K800_PLL_85_860M,
+         CX700_85_860M, VX855_85_860M},
+        {CLK_88_750M, CLE266_PLL_88_750M, K800_PLL_88_750M,
+         CX700_88_750M, VX855_88_750M},
+        {CLK_94_500M, CLE266_PLL_94_500M, K800_PLL_94_500M,
+         CX700_94_500M, VX855_94_500M},
+        {CLK_97_750M, CLE266_PLL_97_750M, K800_PLL_97_750M,
+         CX700_97_750M, VX855_97_750M},
         {CLK_101_000M, CLE266_PLL_101_000M, K800_PLL_101_000M,
-         CX700_101_000M},
+         CX700_101_000M, VX855_101_000M},
         {CLK_106_500M, CLE266_PLL_106_500M, K800_PLL_106_500M,
-         CX700_106_500M},
+         CX700_106_500M, VX855_106_500M},
         {CLK_108_000M, CLE266_PLL_108_000M, K800_PLL_108_000M,
-         CX700_108_000M},
+         CX700_108_000M, VX855_108_000M},
         {CLK_113_309M, CLE266_PLL_113_309M, K800_PLL_113_309M,
-         CX700_113_309M},
+         CX700_113_309M, VX855_113_309M},
         {CLK_118_840M, CLE266_PLL_118_840M, K800_PLL_118_840M,
-         CX700_118_840M},
+         CX700_118_840M, VX855_118_840M},
         {CLK_119_000M, CLE266_PLL_119_000M, K800_PLL_119_000M,
-         CX700_119_000M},
+         CX700_119_000M, VX855_119_000M},
         {CLK_121_750M, CLE266_PLL_121_750M, K800_PLL_121_750M,
-         CX700_121_750M},
+         CX700_121_750M, 0},
         {CLK_125_104M, CLE266_PLL_125_104M, K800_PLL_125_104M,
-         CX700_125_104M},
+         CX700_125_104M, 0},
         {CLK_133_308M, CLE266_PLL_133_308M, K800_PLL_133_308M,
-         CX700_133_308M},
+         CX700_133_308M, 0},
         {CLK_135_000M, CLE266_PLL_135_000M, K800_PLL_135_000M,
-         CX700_135_000M},
+         CX700_135_000M, VX855_135_000M},
         {CLK_136_700M, CLE266_PLL_136_700M, K800_PLL_136_700M,
-         CX700_136_700M},
+         CX700_136_700M, VX855_136_700M},
         {CLK_138_400M, CLE266_PLL_138_400M, K800_PLL_138_400M,
-         CX700_138_400M},
+         CX700_138_400M, VX855_138_400M},
         {CLK_146_760M, CLE266_PLL_146_760M, K800_PLL_146_760M,
-         CX700_146_760M},
+         CX700_146_760M, VX855_146_760M},
         {CLK_153_920M, CLE266_PLL_153_920M, K800_PLL_153_920M,
-         CX700_153_920M},
+         CX700_153_920M, VX855_153_920M},
         {CLK_156_000M, CLE266_PLL_156_000M, K800_PLL_156_000M,
-         CX700_156_000M},
+         CX700_156_000M, VX855_156_000M},
         {CLK_157_500M, CLE266_PLL_157_500M, K800_PLL_157_500M,
-         CX700_157_500M},
+         CX700_157_500M, VX855_157_500M},
         {CLK_162_000M, CLE266_PLL_162_000M, K800_PLL_162_000M,
-         CX700_162_000M},
+         CX700_162_000M, VX855_162_000M},
         {CLK_187_000M, CLE266_PLL_187_000M, K800_PLL_187_000M,
-         CX700_187_000M},
+         CX700_187_000M, VX855_187_000M},
         {CLK_193_295M, CLE266_PLL_193_295M, K800_PLL_193_295M,
-         CX700_193_295M},
+         CX700_193_295M, VX855_193_295M},
         {CLK_202_500M, CLE266_PLL_202_500M, K800_PLL_202_500M,
-         CX700_202_500M},
+         CX700_202_500M, VX855_202_500M},
         {CLK_204_000M, CLE266_PLL_204_000M, K800_PLL_204_000M,
-         CX700_204_000M},
+         CX700_204_000M, VX855_204_000M},
         {CLK_218_500M, CLE266_PLL_218_500M, K800_PLL_218_500M,
-         CX700_218_500M},
+         CX700_218_500M, VX855_218_500M},
         {CLK_234_000M, CLE266_PLL_234_000M, K800_PLL_234_000M,
-         CX700_234_000M},
+         CX700_234_000M, VX855_234_000M},
         {CLK_267_250M, CLE266_PLL_267_250M, K800_PLL_267_250M,
-         CX700_267_250M},
+         CX700_267_250M, VX855_267_250M},
         {CLK_297_500M, CLE266_PLL_297_500M, K800_PLL_297_500M,
-         CX700_297_500M},
-        {CLK_74_481M, CLE266_PLL_74_481M, K800_PLL_74_481M, CX700_74_481M},
+         CX700_297_500M, VX855_297_500M},
+        {CLK_74_481M, CLE266_PLL_74_481M, K800_PLL_74_481M,
+         CX700_74_481M, VX855_74_481M},
         {CLK_172_798M, CLE266_PLL_172_798M, K800_PLL_172_798M,
-         CX700_172_798M},
+         CX700_172_798M, VX855_172_798M},
         {CLK_122_614M, CLE266_PLL_122_614M, K800_PLL_122_614M,
-         CX700_122_614M},
-        {CLK_74_270M, CLE266_PLL_74_270M, K800_PLL_74_270M, CX700_74_270M},
+         CX700_122_614M, VX855_122_614M},
+        {CLK_74_270M, CLE266_PLL_74_270M, K800_PLL_74_270M,
+         CX700_74_270M, 0},
         {CLK_148_500M, CLE266_PLL_148_500M, K800_PLL_148_500M,
-         CX700_148_500M}
+         CX700_148_500M, VX855_148_500M}
 };
 
 static struct fifo_depth_select display_fifo_depth_reg = {
@@ -508,7 +526,8 @@ static void set_dvi_output_path(int set_iga, int output_interface);
 static void set_lcd_output_path(int set_iga, int output_interface);
 static int search_mode_setting(int ModeInfoIndex);
 static void load_fix_bit_crtc_reg(void);
-static void init_gfx_chip_info(void);
+static void init_gfx_chip_info(struct pci_dev *pdev,
+                                const struct pci_device_id *pdi);
 static void init_tmds_chip_info(void);
 static void init_lvds_chip_info(void);
 static void device_screen_off(void);
@@ -518,7 +537,6 @@ static void device_off(void);
 static void device_on(void);
 static void enable_second_display_channel(void);
 static void disable_second_display_channel(void);
-static int get_fb_size_from_pci(void);
 
 void viafb_write_reg(u8 index, u16 io_port, u8 data)
 {
@@ -629,70 +647,43 @@ void viafb_set_iga_path(void)
         }
 }
 
-void viafb_set_start_addr(void)
+void viafb_set_primary_address(u32 addr)
 {
-        unsigned long offset = 0, tmp = 0, size = 0;
-        unsigned long length;
-
-        DEBUG_MSG(KERN_INFO "viafb_set_start_addr!\n");
-        viafb_unlock_crt();
-        /* update starting address of IGA1 */
-        viafb_write_reg(CR0C, VIACR, 0x00);     /*initial starting address */
-        viafb_write_reg(CR0D, VIACR, 0x00);
-        viafb_write_reg(CR34, VIACR, 0x00);
-        viafb_write_reg_mask(CR48, VIACR, 0x00, 0x1F);
-
-        if (viafb_dual_fb) {
-                viaparinfo->iga_path = IGA1;
-                viaparinfo1->iga_path = IGA2;
-        }
-
-        if (viafb_SAMM_ON == 1) {
-                if (!viafb_dual_fb) {
-                        if (viafb_second_size)
-                                size = viafb_second_size * 1024 * 1024;
-                        else
-                                size = 8 * 1024 * 1024;
-                } else {
+        DEBUG_MSG(KERN_DEBUG "viafb_set_primary_address(0x%08X)\n", addr);
+        viafb_write_reg(CR0D, VIACR, addr & 0xFF);
+        viafb_write_reg(CR0C, VIACR, (addr >> 8) & 0xFF);
+        viafb_write_reg(CR34, VIACR, (addr >> 16) & 0xFF);
+        viafb_write_reg_mask(CR48, VIACR, (addr >> 24) & 0x1F, 0x1F);
+}
 
-                        size = viaparinfo1->memsize;
-                }
-                offset = viafb_second_offset;
-                DEBUG_MSG(KERN_INFO
-                          "viafb_second_size=%lx, second start_adddress=%lx\n",
-                          size, offset);
-        }
-        if (viafb_SAMM_ON == 1) {
-                offset = offset >> 3;
-
-                tmp = viafb_read_reg(VIACR, 0x62) & 0x01;
-                tmp |= (offset & 0x7F) << 1;
-                viafb_write_reg(CR62, VIACR, tmp);
-                viafb_write_reg(CR63, VIACR, ((offset & 0x7F80) >> 7));
-                viafb_write_reg(CR64, VIACR, ((offset & 0x7F8000) >> 15));
-                viafb_write_reg(CRA3, VIACR, ((offset & 0x3800000) >> 23));
-        } else {
-                /* update starting address */
-                viafb_write_reg(CR62, VIACR, 0x00);
-                viafb_write_reg(CR63, VIACR, 0x00);
-                viafb_write_reg(CR64, VIACR, 0x00);
-                viafb_write_reg(CRA3, VIACR, 0x00);
-        }
+void viafb_set_secondary_address(u32 addr)
+{
+        DEBUG_MSG(KERN_DEBUG "viafb_set_secondary_address(0x%08X)\n", addr);
+        /* secondary display supports only quadword aligned memory */
+        viafb_write_reg_mask(CR62, VIACR, (addr >> 2) & 0xFE, 0xFE);
+        viafb_write_reg(CR63, VIACR, (addr >> 10) & 0xFF);
+        viafb_write_reg(CR64, VIACR, (addr >> 18) & 0xFF);
+        viafb_write_reg_mask(CRA3, VIACR, (addr >> 26) & 0x07, 0x07);
+}
 
-        if (viafb_SAMM_ON == 1) {
-                if (viafb_accel) {
-                        if (!viafb_dual_fb)
-                                length = size - viaparinfo->fbmem_used;
-                        else
-                                length = size - viaparinfo1->fbmem_used;
-                } else
-                        length = size;
-                offset = (unsigned long)(void *)viafb_FB_MM +
-                        viafb_second_offset;
-                memset((void *)offset, 0, length);
-        }
+void viafb_set_primary_pitch(u32 pitch)
+{
+        DEBUG_MSG(KERN_DEBUG "viafb_set_primary_pitch(0x%08X)\n", pitch);
+        /* spec does not say that first adapter skips 3 bits but old
+         * code did it and seems to be reasonable in analogy to 2nd adapter
+         */
+        pitch = pitch >> 3;
+        viafb_write_reg(0x13, VIACR, pitch & 0xFF);
+        viafb_write_reg_mask(0x35, VIACR, (pitch >> (8 - 5)) & 0xE0, 0xE0);
+}
 
-        viafb_lock_crt();
+void viafb_set_secondary_pitch(u32 pitch)
+{
+        DEBUG_MSG(KERN_DEBUG "viafb_set_secondary_pitch(0x%08X)\n", pitch);
+        pitch = pitch >> 3;
+        viafb_write_reg(0x66, VIACR, pitch & 0xFF);
+        viafb_write_reg_mask(0x67, VIACR, (pitch >> 8) & 0x03, 0x03);
+        viafb_write_reg_mask(0x71, VIACR, (pitch >> (10 - 7)) & 0x80, 0x80);
 }
 
 void viafb_set_output_path(int device, int set_iga, int output_interface)
@@ -1123,30 +1114,6 @@ void viafb_write_regx(struct io_reg RegTable[], int ItemNum)
         }
 }
 
-void viafb_load_offset_reg(int h_addr, int bpp_byte, int set_iga)
-{
-        int reg_value;
-        int viafb_load_reg_num;
-        struct io_register *reg;
-
-        switch (set_iga) {
-        case IGA1_IGA2:
-        case IGA1:
-                reg_value = IGA1_OFFSET_FORMULA(h_addr, bpp_byte);
-                viafb_load_reg_num = offset_reg.iga1_offset_reg.reg_num;
-                reg = offset_reg.iga1_offset_reg.reg;
-                viafb_load_reg(reg_value, viafb_load_reg_num, reg, VIACR);
-                if (set_iga == IGA1)
-                        break;
-        case IGA2:
-                reg_value = IGA2_OFFSET_FORMULA(h_addr, bpp_byte);
-                viafb_load_reg_num = offset_reg.iga2_offset_reg.reg_num;
-                reg = offset_reg.iga2_offset_reg.reg;
-                viafb_load_reg(reg_value, viafb_load_reg_num, reg, VIACR);
-                break;
-        }
-}
-
 void viafb_load_fetch_count_reg(int h_addr, int bpp_byte, int set_iga)
 {
         int reg_value;
@@ -1277,6 +1244,15 @@ void viafb_load_FIFO_reg(int set_iga, int hor_active, int ver_active)
                             VX800_IGA1_DISPLAY_QUEUE_EXPIRE_NUM;
                 }
 
+                if (viaparinfo->chip_info->gfx_chip_name == UNICHROME_VX855) {
+                        iga1_fifo_max_depth = VX855_IGA1_FIFO_MAX_DEPTH;
+                        iga1_fifo_threshold = VX855_IGA1_FIFO_THRESHOLD;
+                        iga1_fifo_high_threshold =
+                            VX855_IGA1_FIFO_HIGH_THRESHOLD;
+                        iga1_display_queue_expire_num =
+                            VX855_IGA1_DISPLAY_QUEUE_EXPIRE_NUM;
+                }
+
                 /* Set Display FIFO Depath Select */
                 reg_value = IGA1_FIFO_DEPTH_SELECT_FORMULA(iga1_fifo_max_depth);
                 viafb_load_reg_num =
@@ -1408,6 +1384,15 @@ void viafb_load_FIFO_reg(int set_iga, int hor_active, int ver_active)
                             VX800_IGA2_DISPLAY_QUEUE_EXPIRE_NUM;
                 }
 
+                if (viaparinfo->chip_info->gfx_chip_name == UNICHROME_VX855) {
+                        iga2_fifo_max_depth = VX855_IGA2_FIFO_MAX_DEPTH;
+                        iga2_fifo_threshold = VX855_IGA2_FIFO_THRESHOLD;
+                        iga2_fifo_high_threshold =
+                            VX855_IGA2_FIFO_HIGH_THRESHOLD;
+                        iga2_display_queue_expire_num =
+                            VX855_IGA2_DISPLAY_QUEUE_EXPIRE_NUM;
+                }
+
                 if (viaparinfo->chip_info->gfx_chip_name == UNICHROME_K800) {
                         /* Set Display FIFO Depath Select */
                         reg_value =
@@ -1496,6 +1481,8 @@ u32 viafb_get_clk_value(int clk)
                         case UNICHROME_P4M900:
                         case UNICHROME_VX800:
                                 return pll_value[i].cx700_pll;
+                        case UNICHROME_VX855:
+                                return pll_value[i].vx855_pll;
                         }
                 }
         }
@@ -1529,6 +1516,7 @@ void viafb_set_vclock(u32 CLK, int set_iga)
                 case UNICHROME_P4M890:
                 case UNICHROME_P4M900:
                 case UNICHROME_VX800:
+                case UNICHROME_VX855:
                         viafb_write_reg(SR44, VIASR, CLK / 0x10000);
                         DEBUG_MSG(KERN_INFO "\nSR44=%x", CLK / 0x10000);
                         viafb_write_reg(SR45, VIASR, (CLK & 0xFFFF) / 0x100);
@@ -1557,6 +1545,7 @@ void viafb_set_vclock(u32 CLK, int set_iga)
                 case UNICHROME_P4M890:
                 case UNICHROME_P4M900:
                 case UNICHROME_VX800:
+                case UNICHROME_VX855:
                         viafb_write_reg(SR4A, VIASR, CLK / 0x10000);
                         viafb_write_reg(SR4B, VIASR, (CLK & 0xFFFF) / 0x100);
                         viafb_write_reg(SR4C, VIASR, CLK % 0x100);
@@ -1916,7 +1905,6 @@ void viafb_fill_crtc_timing(struct crt_mode_table *crt_table,
         load_fix_bit_crtc_reg();
         viafb_lock_crt();
         viafb_write_reg_mask(CR17, VIACR, 0x80, BIT7);
-        viafb_load_offset_reg(h_addr, bpp_byte, set_iga);
         viafb_load_fetch_count_reg(h_addr, bpp_byte, set_iga);
 
         /* load FIFO */
@@ -1933,9 +1921,10 @@ void viafb_fill_crtc_timing(struct crt_mode_table *crt_table,
 
 }
 
-void viafb_init_chip_info(void)
+void viafb_init_chip_info(struct pci_dev *pdev,
+                          const struct pci_device_id *pdi)
 {
-        init_gfx_chip_info();
+        init_gfx_chip_info(pdev, pdi);
         init_tmds_chip_info();
         init_lvds_chip_info();
 
@@ -2008,24 +1997,12 @@ void viafb_update_device_setting(int hres, int vres,
         }
 }
 
-static void init_gfx_chip_info(void)
+static void init_gfx_chip_info(struct pci_dev *pdev,
+                               const struct pci_device_id *pdi)
 {
-        struct pci_dev *pdev = NULL;
-        u32 i;
         u8 tmp;
 
-        /* Indentify GFX Chip Name */
-        for (i = 0; pciidlist[i].vendor != 0; i++) {
-                pdev = pci_get_device(pciidlist[i].vendor,
-                        pciidlist[i].device, 0);
-                if (pdev)
-                        break;
-        }
-
-        if (!pciidlist[i].vendor)
-                return ;
-
-        viaparinfo->chip_info->gfx_chip_name = pciidlist[i].chip_index;
+        viaparinfo->chip_info->gfx_chip_name = pdi->driver_data;
 
         /* Check revision of CLE266 Chip */
         if (viaparinfo->chip_info->gfx_chip_name == UNICHROME_CLE266) {
@@ -2056,8 +2033,6 @@ static void init_gfx_chip_info(void)
                                 CX700_REVISION_700;
                 }
         }
-
-        pci_dev_put(pdev);
 }
 
 static void init_tmds_chip_info(void)
@@ -2271,11 +2246,12 @@ int viafb_setmode(int vmode_index, int hor_res, int ver_res, int video_bpp,
                 break;
 
         case UNICHROME_CX700:
-                viafb_write_regx(CX700_ModeXregs, NUM_TOTAL_CX700_ModeXregs);
-
         case UNICHROME_VX800:
-                viafb_write_regx(VX800_ModeXregs, NUM_TOTAL_VX800_ModeXregs);
+                viafb_write_regx(CX700_ModeXregs, NUM_TOTAL_CX700_ModeXregs);
+                break;
 
+        case UNICHROME_VX855:
+                viafb_write_regx(VX855_ModeXregs, NUM_TOTAL_VX855_ModeXregs);
                 break;
         }
 
@@ -2291,7 +2267,8 @@ int viafb_setmode(int vmode_index, int hor_res, int ver_res, int video_bpp,
                 outb(VPIT.SR[i - 1], VIASR + 1);
         }
 
-        viafb_set_start_addr();
+        viafb_set_primary_address(0);
+        viafb_set_secondary_address(viafb_SAMM_ON ? viafb_second_offset : 0);
         viafb_set_iga_path();
 
         /* Write CRTC */
@@ -2371,6 +2348,9 @@ int viafb_setmode(int vmode_index, int hor_res, int ver_res, int video_bpp,
                 }
         }
 
+        viafb_set_primary_pitch(viafbinfo->fix.line_length);
+        viafb_set_secondary_pitch(viafb_dual_fb ? viafbinfo1->fix.line_length
+                : viafbinfo->fix.line_length);
         /* Update Refresh Rate Setting */
 
         /* Clear On Screen */
@@ -2545,38 +2525,6 @@ void viafb_crt_enable(void)
         viafb_write_reg_mask(CR36, VIACR, 0x0, BIT5 + BIT4);
 }
 
-void viafb_get_mmio_info(unsigned long *mmio_base,
-        unsigned long *mmio_len)
-{
-        struct pci_dev *pdev = NULL;
-        u32 vendor, device;
-        u32 i;
-
-        for (i = 0; pciidlist[i].vendor != 0; i++)
-                if (viaparinfo->chip_info->gfx_chip_name ==
-                        pciidlist[i].chip_index)
-                        break;
-
-        if (!pciidlist[i].vendor)
-                return ;
-
-        vendor = pciidlist[i].vendor;
-        device = pciidlist[i].device;
-
-        pdev = pci_get_device(vendor, device, NULL);
-
-        if (!pdev) {
-                *mmio_base = 0;
-                *mmio_len = 0;
-                return ;
-        }
-
-        *mmio_base = pci_resource_start(pdev, 1);
-        *mmio_len = pci_resource_len(pdev, 1);
-
-        pci_dev_put(pdev);
-}
-
 static void enable_second_display_channel(void)
 {
         /* to enable second display channel. */
@@ -2593,44 +2541,7 @@ static void disable_second_display_channel(void)
         viafb_write_reg_mask(CR6A, VIACR, BIT6, BIT6);
 }
 
-void viafb_get_fb_info(unsigned int *fb_base, unsigned int *fb_len)
-{
-        struct pci_dev *pdev = NULL;
-        u32 vendor, device;
-        u32 i;
-
-        for (i = 0; pciidlist[i].vendor != 0; i++)
-                if (viaparinfo->chip_info->gfx_chip_name ==
-                        pciidlist[i].chip_index)
-                        break;
-
-        if (!pciidlist[i].vendor)
-                return ;
-
-        vendor = pciidlist[i].vendor;
-        device = pciidlist[i].device;
-
-        pdev = pci_get_device(vendor, device, NULL);
-
-        if (!pdev) {
-                *fb_base = viafb_read_reg(VIASR, SR30) << 24;
-                *fb_len = viafb_get_memsize();
-                DEBUG_MSG(KERN_INFO "Get FB info from SR30!\n");
-                DEBUG_MSG(KERN_INFO "fb_base = %08x\n", *fb_base);
-                DEBUG_MSG(KERN_INFO "fb_len = %08x\n", *fb_len);
-                return ;
-        }
-
-        *fb_base = (unsigned int)pci_resource_start(pdev, 0);
-        *fb_len = get_fb_size_from_pci();
-        DEBUG_MSG(KERN_INFO "Get FB info from PCI system!\n");
-        DEBUG_MSG(KERN_INFO "fb_base = %08x\n", *fb_base);
-        DEBUG_MSG(KERN_INFO "fb_len = %08x\n", *fb_len);
-
-        pci_dev_put(pdev);
-}
-
-static int get_fb_size_from_pci(void)
+int viafb_get_fb_size_from_pci(void)
 {
         unsigned long configid, deviceid, FBSize = 0;
         int VideoMemSize;
@@ -2656,6 +2567,7 @@ static int get_fb_size_from_pci(void)
                 case P4M890_FUNCTION3:
                 case P4M900_FUNCTION3:
                 case VX800_FUNCTION3:
+                case VX855_FUNCTION3:
                         /*case CN750_FUNCTION3: */
                         outl(configid + 0xA0, (unsigned long)0xCF8);
                         FBSize = inl((unsigned long)0xCFC);
@@ -2719,6 +2631,10 @@ static int get_fb_size_from_pci(void)
                         VideoMemSize = (256 << 20);     /*256M */
                         break;
 
+                case 0x00007000:        /* Only on VX855/875 */
+                        VideoMemSize = (512 << 20);     /*512M */
+                        break;
+
                 default:
                         VideoMemSize = (32 << 20);      /*32M */
                         break;
@@ -2788,24 +2704,6 @@ void viafb_set_dpa_gfx(int output_interface, struct GFX_DPA_SETTING\
         }
 }
 
-void viafb_memory_pitch_patch(struct fb_info *info)
-{
-        if (info->var.xres != info->var.xres_virtual) {
-                viafb_load_offset_reg(info->var.xres_virtual,
-                                info->var.bits_per_pixel >> 3, IGA1);
-
-                if (viafb_SAMM_ON) {
-                        viafb_load_offset_reg(viafb_second_virtual_xres,
-                                viafb_bpp1 >> 3,
-                                        IGA2);
-                } else {
-                        viafb_load_offset_reg(info->var.xres_virtual,
-                                        info->var.bits_per_pixel >> 3, IGA2);
-                }
-
-        }
-}
-
 /*According var's xres, yres fill var's other timing information*/
 void viafb_fill_var_timing_info(struct fb_var_screeninfo *var, int refresh,
                           int mode_index)
diff --git a/drivers/video/via/hw.h b/drivers/video/via/hw.h
index 6ff38fa8569a..b874d952b446 100644
--- a/drivers/video/via/hw.h
+++ b/drivers/video/via/hw.h
@@ -147,14 +147,8 @@ is reserved, so it may have problem to set 1600x1200 on IGA2. */
 /* location: {CR5F,0,4} */
 #define IGA2_VER_SYNC_END_REG_NUM       1
 
-/* Define Offset and Fetch Count Register*/
+/* Define Fetch Count Register*/
 
-/* location: {CR13,0,7},{CR35,5,7} */
-#define IGA1_OFFSET_REG_NUM             2
-/* 8 bytes alignment. */
-#define IGA1_OFFSER_ALIGN_BYTE          8
-/* x: H resolution, y: color depth */
-#define IGA1_OFFSET_FORMULA(x, y)        ((x*y)/IGA1_OFFSER_ALIGN_BYTE)
 /* location: {SR1C,0,7},{SR1D,0,1} */
 #define IGA1_FETCH_COUNT_REG_NUM        2
 /* 16 bytes alignment. */
@@ -164,11 +158,6 @@ is reserved, so it may have problem to set 1600x1200 on IGA2. */
 #define IGA1_FETCH_COUNT_FORMULA(x, y)   \
         (((x*y)/IGA1_FETCH_COUNT_ALIGN_BYTE) + IGA1_FETCH_COUNT_PATCH_VALUE)
 
-/* location: {CR66,0,7},{CR67,0,1} */
-#define IGA2_OFFSET_REG_NUM             2
-#define IGA2_OFFSET_ALIGN_BYTE          8
-/* x: H resolution, y: color depth */
-#define IGA2_OFFSET_FORMULA(x, y)        ((x*y)/IGA2_OFFSET_ALIGN_BYTE)
 /* location: {CR65,0,7},{CR67,2,3} */
 #define IGA2_FETCH_COUNT_REG_NUM        2
 #define IGA2_FETCH_COUNT_ALIGN_BYTE     16
@@ -335,6 +324,17 @@ is reserved, so it may have problem to set 1600x1200 on IGA2. */
 /* location: {CR94,0,6} */
 #define VX800_IGA2_DISPLAY_QUEUE_EXPIRE_NUM     128
 
+/* For VT3409 */
+#define VX855_IGA1_FIFO_MAX_DEPTH               400
+#define VX855_IGA1_FIFO_THRESHOLD               320
+#define VX855_IGA1_FIFO_HIGH_THRESHOLD          320
+#define VX855_IGA1_DISPLAY_QUEUE_EXPIRE_NUM     160
+
+#define VX855_IGA2_FIFO_MAX_DEPTH               200
+#define VX855_IGA2_FIFO_THRESHOLD               160
+#define VX855_IGA2_FIFO_HIGH_THRESHOLD          160
+#define VX855_IGA2_DISPLAY_QUEUE_EXPIRE_NUM     320
+
 #define IGA1_FIFO_DEPTH_SELECT_REG_NUM          1
 #define IGA1_FIFO_THRESHOLD_REG_NUM             2
 #define IGA1_FIFO_HIGH_THRESHOLD_REG_NUM        2
@@ -617,23 +617,6 @@ struct iga2_ver_sync_end {
         struct io_register reg[IGA2_VER_SYNC_END_REG_NUM];
 };
 
-/* IGA1 Offset Register */
-struct iga1_offset {
-        int reg_num;
-        struct io_register reg[IGA1_OFFSET_REG_NUM];
-};
-
-/* IGA2 Offset Register */
-struct iga2_offset {
-        int reg_num;
-        struct io_register reg[IGA2_OFFSET_REG_NUM];
-};
-
-struct offset {
-        struct iga1_offset iga1_offset_reg;
-        struct iga2_offset iga2_offset_reg;
-};
-
 /* IGA1 Fetch Count Register */
 struct iga1_fetch_count {
         int reg_num;
@@ -716,6 +699,7 @@ struct pll_map {
         u32 cle266_pll;
         u32 k800_pll;
         u32 cx700_pll;
+        u32 vx855_pll;
 };
 
 struct rgbLUT {
@@ -860,6 +844,8 @@ struct iga2_crtc_timing {
 #define P4M900_FUNCTION3    0x3364
 /* VT3353 chipset*/
 #define VX800_FUNCTION3     0x3353
+/* VT3409 chipset*/
+#define VX855_FUNCTION3     0x3409
 
 #define NUM_TOTAL_PLL_TABLE ARRAY_SIZE(pll_value)
 
@@ -883,7 +869,6 @@ extern int viafb_dual_fb;
 extern int viafb_LCD2_ON;
 extern int viafb_LCD_ON;
 extern int viafb_DVI_ON;
-extern int viafb_accel;
 extern int viafb_hotplug;
 
 void viafb_write_reg_mask(u8 index, int io_port, u8 data, u8 mask);
@@ -904,7 +889,6 @@ void viafb_write_reg(u8 index, u16 io_port, u8 data);
 u8 viafb_read_reg(int io_port, u8 index);
 void viafb_lock_crt(void);
 void viafb_unlock_crt(void);
-void viafb_load_offset_reg(int h_addr, int bpp_byte, int set_iga);
 void viafb_load_fetch_count_reg(int h_addr, int bpp_byte, int set_iga);
 void viafb_write_regx(struct io_reg RegTable[], int ItemNum);
 struct VideoModeTable *viafb_get_modetbl_pointer(int Index);
@@ -917,17 +901,20 @@ void viafb_set_dpa_gfx(int output_interface, struct GFX_DPA_SETTING\
 int viafb_setmode(int vmode_index, int hor_res, int ver_res,
             int video_bpp, int vmode_index1, int hor_res1,
             int ver_res1, int video_bpp1);
-void viafb_init_chip_info(void);
+void viafb_init_chip_info(struct pci_dev *pdev,
+                          const struct pci_device_id *pdi);
 void viafb_init_dac(int set_iga);
 int viafb_get_pixclock(int hres, int vres, int vmode_refresh);
 int viafb_get_refresh(int hres, int vres, u32 float_refresh);
 void viafb_update_device_setting(int hres, int vres, int bpp,
                            int vmode_refresh, int flag);
-void viafb_get_mmio_info(unsigned long *mmio_base,
-        unsigned long *mmio_len);
 
+int viafb_get_fb_size_from_pci(void);
 void viafb_set_iga_path(void);
-void viafb_set_start_addr(void);
+void viafb_set_primary_address(u32 addr);
+void viafb_set_secondary_address(u32 addr);
+void viafb_set_primary_pitch(u32 pitch);
+void viafb_set_secondary_pitch(u32 pitch);
 void viafb_get_fb_info(unsigned int *fb_base, unsigned int *fb_len);
 
 #endif /* __HW_H__ */
diff --git a/drivers/video/via/ioctl.h b/drivers/video/via/ioctl.h
index 842fe30b9868..de899807eade 100644
--- a/drivers/video/via/ioctl.h
+++ b/drivers/video/via/ioctl.h
@@ -50,8 +50,6 @@
 #define VIAFB_GET_GAMMA_LUT             0x56494124
 #define VIAFB_SET_GAMMA_LUT             0x56494125
 #define VIAFB_GET_GAMMA_SUPPORT_STATE   0x56494126
-#define VIAFB_SET_VIDEO_DEVICE          0x56494127
-#define VIAFB_GET_VIDEO_DEVICE          0x56494128
 #define VIAFB_SET_SECOND_MODE           0x56494129
 #define VIAFB_SYNC_SURFACE              0x56494130
 #define VIAFB_GET_DRIVER_CAPS           0x56494131
@@ -179,9 +177,7 @@ struct viafb_ioctl_setting {
         unsigned short second_dev_bpp;
         /* Indicate which device are primary display device. */
         unsigned int primary_device;
-        /* Indicate which device will show video. only valid in duoview mode */
-        unsigned int video_device_status;
-        unsigned int struct_reserved[34];
+        unsigned int struct_reserved[35];
         struct viafb_ioctl_lcd_attribute lcd_attributes;
 };
 
diff --git a/drivers/video/via/lcd.c b/drivers/video/via/lcd.c
index 78c6b3387947..e3e597f937a5 100644
--- a/drivers/video/via/lcd.c
+++ b/drivers/video/via/lcd.c
@@ -207,13 +207,13 @@ static bool lvds_identify_integratedlvds(void)
 
 int viafb_lvds_trasmitter_identify(void)
 {
-        viaparinfo->i2c_stuff.i2c_port = I2CPORTINDEX;
+        viaparinfo->shared->i2c_stuff.i2c_port = I2CPORTINDEX;
         if (viafb_lvds_identify_vt1636()) {
                 viaparinfo->chip_info->lvds_chip_info.i2c_port = I2CPORTINDEX;
                 DEBUG_MSG(KERN_INFO
                           "Found VIA VT1636 LVDS on port i2c 0x31 \n");
         } else {
-                viaparinfo->i2c_stuff.i2c_port = GPIOPORTINDEX;
+                viaparinfo->shared->i2c_stuff.i2c_port = GPIOPORTINDEX;
                 if (viafb_lvds_identify_vt1636()) {
                         viaparinfo->chip_info->lvds_chip_info.i2c_port =
                                 GPIOPORTINDEX;
@@ -470,7 +470,7 @@ static int lvds_register_read(int index)
 {
         u8 data;
 
-        viaparinfo->i2c_stuff.i2c_port = GPIOPORTINDEX;
+        viaparinfo->shared->i2c_stuff.i2c_port = GPIOPORTINDEX;
         viafb_i2c_readbyte((u8) viaparinfo->chip_info->
             lvds_chip_info.lvds_chip_slave_addr,
                         (u8) index, &data);
@@ -952,13 +952,10 @@ void viafb_lcd_set_mode(struct crt_mode_table *mode_crt_table,
         int video_index = plvds_setting_info->lcd_panel_size;
         int set_iga = plvds_setting_info->iga_path;
         int mode_bpp = plvds_setting_info->bpp;
-        int viafb_load_reg_num = 0;
-        int reg_value = 0;
         int set_hres, set_vres;
         int panel_hres, panel_vres;
         u32 pll_D_N;
         int offset;
-        struct io_register *reg = NULL;
         struct display_timing mode_crt_reg, panel_crt_reg;
         struct crt_mode_table *panel_crt_table = NULL;
         struct VideoModeTable *vmode_tbl = NULL;
@@ -1038,16 +1035,11 @@ void viafb_lcd_set_mode(struct crt_mode_table *mode_crt_table,
                 }
 
                 /* Offset for simultaneous */
-                reg_value = offset;
-                viafb_load_reg_num = offset_reg.iga2_offset_reg.reg_num;
-                reg = offset_reg.iga2_offset_reg.reg;
-                viafb_load_reg(reg_value, viafb_load_reg_num, reg, VIACR);
+                viafb_set_secondary_pitch(offset << 3);
                 DEBUG_MSG(KERN_INFO "viafb_load_reg!!\n");
                 viafb_load_fetch_count_reg(set_hres, 4, IGA2);
                 /* Fetch count for simultaneous */
         } else {                /* SAMM */
-                /* Offset for IGA2 only */
-                viafb_load_offset_reg(set_hres, mode_bpp / 8, set_iga);
                 /* Fetch count for IGA2 only */
                 viafb_load_fetch_count_reg(set_hres, mode_bpp / 8, set_iga);
 
diff --git a/drivers/video/via/share.h b/drivers/video/via/share.h
index 2e1254da9c8c..7cd03e2a1275 100644
--- a/drivers/video/via/share.h
+++ b/drivers/video/via/share.h
@@ -167,6 +167,10 @@
 #define SR4B    0x4B
 #define SR4C    0x4C
 #define SR52    0x52
+#define SR57    0x57
+#define SR58    0x58
+#define SR59    0x59
+#define SR5D    0x5D
 #define SR5E    0x5E
 #define SR65    0x65
 
@@ -966,6 +970,100 @@
 #define CX700_297_500M    0x00CE0403
 #define CX700_122_614M    0x00870802
 
+/* PLL for VX855 */
+#define VX855_22_000M     0x007B1005
+#define VX855_25_175M     0x008D1005
+#define VX855_26_719M     0x00961005
+#define VX855_26_880M     0x00961005
+#define VX855_27_000M     0x00971005
+#define VX855_29_581M     0x00A51005
+#define VX855_29_829M     0x00641003
+#define VX855_31_490M     0x00B01005
+#define VX855_31_500M     0x00B01005
+#define VX855_31_728M     0x008E1004
+#define VX855_32_668M     0x00921004
+#define VX855_36_000M     0x00A11004
+#define VX855_40_000M     0x00700C05
+#define VX855_41_291M     0x00730C05
+#define VX855_43_163M     0x00790C05
+#define VX855_45_250M     0x007F0C05      /* 45.46MHz */
+#define VX855_46_000M     0x00670C04
+#define VX855_46_996M     0x00690C04
+#define VX855_48_000M     0x00860C05
+#define VX855_48_875M     0x00890C05
+#define VX855_49_500M     0x00530C03
+#define VX855_52_406M     0x00580C03
+#define VX855_52_977M     0x00940C05
+#define VX855_56_250M     0x009D0C05
+#define VX855_60_466M     0x00A90C05
+#define VX855_61_500M     0x00AC0C05
+#define VX855_65_000M     0x006D0C03
+#define VX855_65_178M     0x00B60C05
+#define VX855_66_750M     0x00700C03    /*67.116MHz */
+#define VX855_67_295M     0x00BC0C05
+#define VX855_68_179M     0x00BF0C05
+#define VX855_68_369M     0x00BF0C05
+#define VX855_69_924M     0x00C30C05
+#define VX855_70_159M     0x00C30C05
+#define VX855_72_000M     0x00A10C04
+#define VX855_73_023M     0x00CC0C05
+#define VX855_74_481M     0x00D10C05
+#define VX855_78_750M     0x006E0805
+#define VX855_79_466M     0x006F0805
+#define VX855_80_136M     0x00700805
+#define VX855_81_627M     0x00720805
+#define VX855_83_375M     0x00750805
+#define VX855_83_527M     0x00750805
+#define VX855_83_950M     0x00750805
+#define VX855_84_537M     0x00760805
+#define VX855_84_750M     0x00760805     /* 84.537Mhz */
+#define VX855_85_500M     0x00760805        /* 85.909080 MHz*/
+#define VX855_85_860M     0x00760805
+#define VX855_85_909M     0x00760805
+#define VX855_88_750M     0x007C0805
+#define VX855_89_489M     0x007D0805
+#define VX855_94_500M     0x00840805
+#define VX855_96_648M     0x00870805
+#define VX855_97_750M     0x00890805
+#define VX855_101_000M    0x008D0805
+#define VX855_106_500M    0x00950805
+#define VX855_108_000M    0x00970805
+#define VX855_110_125M    0x00990805
+#define VX855_112_000M    0x009D0805
+#define VX855_113_309M    0x009F0805
+#define VX855_115_000M    0x00A10805
+#define VX855_118_840M    0x00A60805
+#define VX855_119_000M    0x00A70805
+#define VX855_121_750M    0x00AA0805       /* 121.704MHz */
+#define VX855_122_614M    0x00AC0805
+#define VX855_126_266M    0x00B10805
+#define VX855_130_250M    0x00B60805      /* 130.250 */
+#define VX855_135_000M    0x00BD0805
+#define VX855_136_700M    0x00BF0805
+#define VX855_137_750M    0x00C10805
+#define VX855_138_400M    0x00C20805
+#define VX855_144_300M    0x00CA0805
+#define VX855_146_760M    0x00CE0805
+#define VX855_148_500M    0x00D00805
+#define VX855_153_920M    0x00540402
+#define VX855_156_000M    0x006C0405
+#define VX855_156_867M    0x006E0405
+#define VX855_157_500M    0x006E0405
+#define VX855_162_000M    0x00710405
+#define VX855_172_798M    0x00790405
+#define VX855_187_000M    0x00830405
+#define VX855_193_295M    0x00870405
+#define VX855_202_500M    0x008E0405
+#define VX855_204_000M    0x008F0405
+#define VX855_218_500M    0x00990405
+#define VX855_229_500M    0x00A10405
+#define VX855_234_000M    0x00A40405
+#define VX855_267_250M    0x00BB0405
+#define VX855_297_500M    0x00D00405
+#define VX855_339_500M    0x00770005
+#define VX855_340_772M    0x00770005
+
+
 /* Definition CRTC Timing Index */
 #define H_TOTAL_INDEX               0
 #define H_ADDR_INDEX                1
diff --git a/drivers/video/via/via_i2c.c b/drivers/video/via/via_i2c.c
index 0f3ed4eb236d..15543e968248 100644
--- a/drivers/video/via/via_i2c.c
+++ b/drivers/video/via/via_i2c.c
@@ -97,7 +97,7 @@ int viafb_i2c_readbyte(u8 slave_addr, u8 index, u8 *pdata)
         mm1[0] = index;
         msgs[0].len = 1; msgs[1].len = 1;
         msgs[0].buf = mm1; msgs[1].buf = pdata;
-        i2c_transfer(&viaparinfo->i2c_stuff.adapter, msgs, 2);
+        i2c_transfer(&viaparinfo->shared->i2c_stuff.adapter, msgs, 2);
 
         return 0;
 }
@@ -111,7 +111,7 @@ int viafb_i2c_writebyte(u8 slave_addr, u8 index, u8 data)
         msgs.addr = slave_addr / 2;
         msgs.len = 2;
         msgs.buf = msg;
-        return i2c_transfer(&viaparinfo->i2c_stuff.adapter, &msgs, 1);
+        return i2c_transfer(&viaparinfo->shared->i2c_stuff.adapter, &msgs, 1);
 }
 
 int viafb_i2c_readbytes(u8 slave_addr, u8 index, u8 *buff, int buff_len)
@@ -125,53 +125,53 @@ int viafb_i2c_readbytes(u8 slave_addr, u8 index, u8 *buff, int buff_len)
         mm1[0] = index;
         msgs[0].len = 1; msgs[1].len = buff_len;
         msgs[0].buf = mm1; msgs[1].buf = buff;
-        i2c_transfer(&viaparinfo->i2c_stuff.adapter, msgs, 2);
+        i2c_transfer(&viaparinfo->shared->i2c_stuff.adapter, msgs, 2);
         return 0;
 }
 
 int viafb_create_i2c_bus(void *viapar)
 {
         int ret;
-        struct viafb_par *par = (struct viafb_par *)viapar;
-
-        strcpy(par->i2c_stuff.adapter.name, "via_i2c");
-        par->i2c_stuff.i2c_port = 0x0;
-        par->i2c_stuff.adapter.owner = THIS_MODULE;
-        par->i2c_stuff.adapter.id = 0x01FFFF;
-        par->i2c_stuff.adapter.class = 0;
-        par->i2c_stuff.adapter.algo_data = &par->i2c_stuff.algo;
-        par->i2c_stuff.adapter.dev.parent = NULL;
-        par->i2c_stuff.algo.setsda = via_i2c_setsda;
-        par->i2c_stuff.algo.setscl = via_i2c_setscl;
-        par->i2c_stuff.algo.getsda = via_i2c_getsda;
-        par->i2c_stuff.algo.getscl = via_i2c_getscl;
-        par->i2c_stuff.algo.udelay = 40;
-        par->i2c_stuff.algo.timeout = 20;
-        par->i2c_stuff.algo.data = &par->i2c_stuff;
-
-        i2c_set_adapdata(&par->i2c_stuff.adapter, &par->i2c_stuff);
+        struct via_i2c_stuff *i2c_stuff =
+                &((struct viafb_par *)viapar)->shared->i2c_stuff;
+
+        strcpy(i2c_stuff->adapter.name, "via_i2c");
+        i2c_stuff->i2c_port = 0x0;
+        i2c_stuff->adapter.owner = THIS_MODULE;
+        i2c_stuff->adapter.id = 0x01FFFF;
+        i2c_stuff->adapter.class = 0;
+        i2c_stuff->adapter.algo_data = &i2c_stuff->algo;
+        i2c_stuff->adapter.dev.parent = NULL;
+        i2c_stuff->algo.setsda = via_i2c_setsda;
+        i2c_stuff->algo.setscl = via_i2c_setscl;
+        i2c_stuff->algo.getsda = via_i2c_getsda;
+        i2c_stuff->algo.getscl = via_i2c_getscl;
+        i2c_stuff->algo.udelay = 40;
+        i2c_stuff->algo.timeout = 20;
+        i2c_stuff->algo.data = i2c_stuff;
+
+        i2c_set_adapdata(&i2c_stuff->adapter, i2c_stuff);
 
         /* Raise SCL and SDA */
-        par->i2c_stuff.i2c_port = I2CPORTINDEX;
-        via_i2c_setsda(&par->i2c_stuff, 1);
-        via_i2c_setscl(&par->i2c_stuff, 1);
+        i2c_stuff->i2c_port = I2CPORTINDEX;
+        via_i2c_setsda(i2c_stuff, 1);
+        via_i2c_setscl(i2c_stuff, 1);
 
-        par->i2c_stuff.i2c_port = GPIOPORTINDEX;
-        via_i2c_setsda(&par->i2c_stuff, 1);
-        via_i2c_setscl(&par->i2c_stuff, 1);
+        i2c_stuff->i2c_port = GPIOPORTINDEX;
+        via_i2c_setsda(i2c_stuff, 1);
+        via_i2c_setscl(i2c_stuff, 1);
         udelay(20);
 
-        ret = i2c_bit_add_bus(&par->i2c_stuff.adapter);
+        ret = i2c_bit_add_bus(&i2c_stuff->adapter);
         if (ret == 0)
-                DEBUG_MSG("I2C bus %s registered.\n",
-                par->i2c_stuff.adapter.name);
+                DEBUG_MSG("I2C bus %s registered.\n", i2c_stuff->adapter.name);
         else
                 DEBUG_MSG("Failed to register I2C bus %s.\n",
-                        par->i2c_stuff.adapter.name);
+                        i2c_stuff->adapter.name);
         return ret;
 }
 
 void viafb_delete_i2c_buss(void *par)
 {
-        i2c_del_adapter(&((struct viafb_par *)par)->i2c_stuff.adapter);
+        i2c_del_adapter(&((struct viafb_par *)par)->shared->i2c_stuff.adapter);
 }
diff --git a/drivers/video/via/viafbdev.c b/drivers/video/via/viafbdev.c
index 72833f3334b5..56ec696e8afa 100644
--- a/drivers/video/via/viafbdev.c
+++ b/drivers/video/via/viafbdev.c
@@ -20,11 +20,12 @@
  */
 
 #include <linux/module.h>
+#include <linux/seq_file.h>
+#include <linux/stat.h>
 #define _MASTER_FILE
 
 #include "global.h"
 
-static int MAX_CURS = 32;
 static struct fb_var_screeninfo default_var;
 static char *viafb_name = "Via";
 static u32 pseudo_pal[17];
@@ -33,12 +34,11 @@ static u32 pseudo_pal[17];
 static char *viafb_mode = "640x480";
 static char *viafb_mode1 = "640x480";
 
+static int viafb_accel = 1;
+
 /* Added for specifying active devices.*/
 char *viafb_active_dev = "";
 
-/* Added for specifying video on devices.*/
-char *viafb_video_dev = "";
-
 /*Added for specify lcd output port*/
 char *viafb_lcd_port = "";
 char *viafb_dvi_port = "";
@@ -50,71 +50,20 @@ static void apply_second_mode_setting(struct fb_var_screeninfo
         *sec_var);
 static void retrieve_device_setting(struct viafb_ioctl_setting
         *setting_info);
-static void viafb_set_video_device(u32 video_dev_info);
-static void viafb_get_video_device(u32 *video_dev_info);
-
-/* Mode information */
-static const struct viafb_modeinfo viafb_modentry[] = {
-        {480, 640, VIA_RES_480X640},
-        {640, 480, VIA_RES_640X480},
-        {800, 480, VIA_RES_800X480},
-        {800, 600, VIA_RES_800X600},
-        {1024, 768, VIA_RES_1024X768},
-        {1152, 864, VIA_RES_1152X864},
-        {1280, 1024, VIA_RES_1280X1024},
-        {1600, 1200, VIA_RES_1600X1200},
-        {1440, 1050, VIA_RES_1440X1050},
-        {1280, 768, VIA_RES_1280X768,},
-        {1280, 800, VIA_RES_1280X800},
-        {1280, 960, VIA_RES_1280X960},
-        {1920, 1440, VIA_RES_1920X1440},
-        {848, 480, VIA_RES_848X480},
-        {1400, 1050, VIA_RES_1400X1050},
-        {720, 480, VIA_RES_720X480},
-        {720, 576, VIA_RES_720X576},
-        {1024, 512, VIA_RES_1024X512},
-        {1024, 576, VIA_RES_1024X576},
-        {1024, 600, VIA_RES_1024X600},
-        {1280, 720, VIA_RES_1280X720},
-        {1920, 1080, VIA_RES_1920X1080},
-        {1366, 768, VIA_RES_1368X768},
-        {1680, 1050, VIA_RES_1680X1050},
-        {960, 600, VIA_RES_960X600},
-        {1000, 600, VIA_RES_1000X600},
-        {1024, 576, VIA_RES_1024X576},
-        {1024, 600, VIA_RES_1024X600},
-        {1088, 612, VIA_RES_1088X612},
-        {1152, 720, VIA_RES_1152X720},
-        {1200, 720, VIA_RES_1200X720},
-        {1280, 600, VIA_RES_1280X600},
-        {1360, 768, VIA_RES_1360X768},
-        {1440, 900, VIA_RES_1440X900},
-        {1600, 900, VIA_RES_1600X900},
-        {1600, 1024, VIA_RES_1600X1024},
-        {1792, 1344, VIA_RES_1792X1344},
-        {1856, 1392, VIA_RES_1856X1392},
-        {1920, 1200, VIA_RES_1920X1200},
-        {2048, 1536, VIA_RES_2048X1536},
-        {0, 0, VIA_RES_INVALID}
-};
 
 static struct fb_ops viafb_ops;
 
-static int viafb_update_fix(struct fb_fix_screeninfo *fix, struct fb_info *info)
-{
-        struct viafb_par *ppar;
-        ppar = info->par;
-
-        DEBUG_MSG(KERN_INFO "viafb_update_fix!\n");
 
-        fix->visual =
-            ppar->bpp == 8 ? FB_VISUAL_PSEUDOCOLOR : FB_VISUAL_TRUECOLOR;
-        fix->line_length = ppar->linelength;
+static void viafb_update_fix(struct fb_info *info)
+{
+        u32 bpp = info->var.bits_per_pixel;
 
-        return 0;
+        info->fix.visual =
+                bpp == 8 ? FB_VISUAL_PSEUDOCOLOR : FB_VISUAL_TRUECOLOR;
+        info->fix.line_length =
+                ((info->var.xres_virtual + 7) & ~7) * bpp / 8;
 }
 
-
 static void viafb_setup_fixinfo(struct fb_fix_screeninfo *fix,
         struct viafb_par *viaparinfo)
 {
@@ -123,8 +72,6 @@ static void viafb_setup_fixinfo(struct fb_fix_screeninfo *fix,
 
         fix->smem_start = viaparinfo->fbmem;
         fix->smem_len = viaparinfo->fbmem_free;
-        fix->mmio_start = viaparinfo->mmio_base;
-        fix->mmio_len = viaparinfo->mmio_len;
 
         fix->type = FB_TYPE_PACKED_PIXELS;
         fix->type_aux = 0;
@@ -147,28 +94,12 @@ static int viafb_release(struct fb_info *info, int user)
         return 0;
 }
 
-static void viafb_update_viafb_par(struct fb_info *info)
-{
-        struct viafb_par *ppar;
-
-        ppar = info->par;
-        ppar->bpp = info->var.bits_per_pixel;
-        ppar->linelength = ((info->var.xres_virtual + 7) & ~7) * ppar->bpp / 8;
-        ppar->hres = info->var.xres;
-        ppar->vres = info->var.yres;
-        ppar->xoffset = info->var.xoffset;
-        ppar->yoffset = info->var.yoffset;
-}
-
 static int viafb_check_var(struct fb_var_screeninfo *var,
         struct fb_info *info)
 {
         int vmode_index, htotal, vtotal;
-        struct viafb_par *ppar;
+        struct viafb_par *ppar = info->par;
         u32 long_refresh;
-        struct viafb_par *p_viafb_par;
-        ppar = info->par;
-
 
         DEBUG_MSG(KERN_INFO "viafb_check_var!\n");
         /* Sanity check */
@@ -212,23 +143,21 @@ static int viafb_check_var(struct fb_var_screeninfo *var,
 
         /* Adjust var according to our driver's own table */
         viafb_fill_var_timing_info(var, viafb_refresh, vmode_index);
-
-        /* This is indeed a patch for VT3353 */
-        if (!info->par)
-                return -1;
-        p_viafb_par = (struct viafb_par *)info->par;
-        if (p_viafb_par->chip_info->gfx_chip_name == UNICHROME_VX800)
-                var->accel_flags = 0;
+        if (info->var.accel_flags & FB_ACCELF_TEXT &&
+                !ppar->shared->engine_mmio)
+                info->var.accel_flags = 0;
 
         return 0;
 }
 
 static int viafb_set_par(struct fb_info *info)
 {
+        struct viafb_par *viapar = info->par;
         int vmode_index;
         int vmode_index1 = 0;
         DEBUG_MSG(KERN_INFO "viafb_set_par!\n");
 
+        viapar->depth = fb_get_color_depth(&info->var, &info->fix);
         viafb_update_device_setting(info->var.xres, info->var.yres,
                               info->var.bits_per_pixel, viafb_refresh, 0);
 
@@ -252,21 +181,12 @@ static int viafb_set_par(struct fb_info *info)
                         info->var.bits_per_pixel, vmode_index1,
                         viafb_second_xres, viafb_second_yres, viafb_bpp1);
 
-                /*We should set memory offset according virtual_x */
-                /*Fix me:put this function into viafb_setmode */
-                viafb_memory_pitch_patch(info);
-
-                /* Update ***fb_par information */
-                viafb_update_viafb_par(info);
-
-                /* Update other fixed information */
-                viafb_update_fix(&info->fix, info);
+                viafb_update_fix(info);
                 viafb_bpp = info->var.bits_per_pixel;
-                /* Update viafb_accel, it is necessary to our 2D accelerate */
-                viafb_accel = info->var.accel_flags;
-
-                if (viafb_accel)
-                        viafb_set_2d_color_depth(info->var.bits_per_pixel);
+                if (info->var.accel_flags & FB_ACCELF_TEXT)
+                        info->flags &= ~FBINFO_HWACCEL_DISABLED;
+                else
+                        info->flags |= FBINFO_HWACCEL_DISABLED;
         }
 
         return 0;
@@ -503,12 +423,7 @@ static int viafb_pan_display(struct fb_var_screeninfo *var,
             var->bits_per_pixel / 16;
 
         DEBUG_MSG(KERN_INFO "\nviafb_pan_display,offset =%d ", offset);
-
-        viafb_write_reg_mask(0x48, 0x3d4, ((offset >> 24) & 0x3), 0x3);
-        viafb_write_reg_mask(0x34, 0x3d4, ((offset >> 16) & 0xff), 0xff);
-        viafb_write_reg_mask(0x0c, 0x3d4, ((offset >> 8) & 0xff), 0xff);
-        viafb_write_reg_mask(0x0d, 0x3d4, (offset & 0xff), 0xff);
-
+        viafb_set_primary_address(offset);
         return 0;
 }
 
@@ -560,7 +475,6 @@ static int viafb_ioctl(struct fb_info *info, u_int cmd, u_long arg)
 
         u32 __user *argp = (u32 __user *) arg;
         u32 gpu32;
-        u32 video_dev_info = 0;
 
         DEBUG_MSG(KERN_INFO "viafb_ioctl: 0x%X !!\n", cmd);
         memset(&u, 0, sizeof(u));
@@ -792,15 +706,6 @@ static int viafb_ioctl(struct fb_info *info, u_int cmd, u_long arg)
                 if (put_user(state_info, argp))
                         return -EFAULT;
                 break;
-        case VIAFB_SET_VIDEO_DEVICE:
-                get_user(video_dev_info, argp);
-                viafb_set_video_device(video_dev_info);
-                break;
-        case VIAFB_GET_VIDEO_DEVICE:
-                viafb_get_video_device(&video_dev_info);
-                if (put_user(video_dev_info, argp))
-                        return -EFAULT;
-                break;
         case VIAFB_SYNC_SURFACE:
                 DEBUG_MSG(KERN_INFO "lobo VIAFB_SYNC_SURFACE\n");
                 break;
@@ -866,10 +771,12 @@ static int viafb_ioctl(struct fb_info *info, u_int cmd, u_long arg)
 static void viafb_fillrect(struct fb_info *info,
         const struct fb_fillrect *rect)
 {
-        u32 col = 0, rop = 0;
-        int pitch;
+        struct viafb_par *viapar = info->par;
+        struct viafb_shared *shared = viapar->shared;
+        u32 fg_color;
+        u8 rop;
 
-        if (!viafb_accel) {
+        if (info->flags & FBINFO_HWACCEL_DISABLED || !shared->hw_bitblt) {
                 cfb_fillrect(info, rect);
                 return;
         }
@@ -877,68 +784,31 @@ static void viafb_fillrect(struct fb_info *info,
         if (!rect->width || !rect->height)
                 return;
 
-        switch (rect->rop) {
-        case ROP_XOR:
+        if (info->fix.visual == FB_VISUAL_TRUECOLOR)
+                fg_color = ((u32 *)info->pseudo_palette)[rect->color];
+        else
+                fg_color = rect->color;
+
+        if (rect->rop == ROP_XOR)
                 rop = 0x5A;
-                break;
-        case ROP_COPY:
-        default:
+        else
                 rop = 0xF0;
-                break;
-        }
-
-        switch (info->var.bits_per_pixel) {
-        case 8:
-                col = rect->color;
-                break;
-        case 16:
-                col = ((u32 *) (info->pseudo_palette))[rect->color];
-                break;
-        case 32:
-                col = ((u32 *) (info->pseudo_palette))[rect->color];
-                break;
-        }
-
-        /* BitBlt Source Address */
-        writel(0x0, viaparinfo->io_virt + VIA_REG_SRCPOS);
-        /* Source Base Address */
-        writel(0x0, viaparinfo->io_virt + VIA_REG_SRCBASE);
-        /* Destination Base Address */
-        writel(((unsigned long) (info->screen_base) -
-                   (unsigned long) viafb_FB_MM) >> 3,
-                   viaparinfo->io_virt + VIA_REG_DSTBASE);
-        /* Pitch */
-        pitch = (info->var.xres_virtual + 7) & ~7;
-        writel(VIA_PITCH_ENABLE |
-                   (((pitch *
-                      info->var.bits_per_pixel >> 3) >> 3) |
-                      (((pitch * info->
-                      var.bits_per_pixel >> 3) >> 3) << 16)),
-                      viaparinfo->io_virt + VIA_REG_PITCH);
-        /* BitBlt Destination Address */
-        writel(((rect->dy << 16) | rect->dx),
-                viaparinfo->io_virt + VIA_REG_DSTPOS);
-        /* Dimension: width & height */
-        writel((((rect->height - 1) << 16) | (rect->width - 1)),
-                viaparinfo->io_virt + VIA_REG_DIMENSION);
-        /* Forground color or Destination color */
-        writel(col, viaparinfo->io_virt + VIA_REG_FGCOLOR);
-        /* GE Command */
-        writel((0x01 | 0x2000 | (rop << 24)),
-                viaparinfo->io_virt + VIA_REG_GECMD);
 
+        DEBUG_MSG(KERN_DEBUG "viafb 2D engine: fillrect\n");
+        if (shared->hw_bitblt(shared->engine_mmio, VIA_BITBLT_FILL,
+                rect->width, rect->height, info->var.bits_per_pixel,
+                viapar->vram_addr, info->fix.line_length, rect->dx, rect->dy,
+                NULL, 0, 0, 0, 0, fg_color, 0, rop))
+                cfb_fillrect(info, rect);
 }
 
 static void viafb_copyarea(struct fb_info *info,
         const struct fb_copyarea *area)
 {
-        u32 dy = area->dy, sy = area->sy, direction = 0x0;
-        u32 sx = area->sx, dx = area->dx, width = area->width;
-        int pitch;
-
-        DEBUG_MSG(KERN_INFO "viafb_copyarea!!\n");
+        struct viafb_par *viapar = info->par;
+        struct viafb_shared *shared = viapar->shared;
 
-        if (!viafb_accel) {
+        if (info->flags & FBINFO_HWACCEL_DISABLED || !shared->hw_bitblt) {
                 cfb_copyarea(info, area);
                 return;
         }
@@ -946,263 +816,148 @@ static void viafb_copyarea(struct fb_info *info,
         if (!area->width || !area->height)
                 return;
 
-        if (sy < dy) {
-                dy += area->height - 1;
-                sy += area->height - 1;
-                direction |= 0x4000;
-        }
-
-        if (sx < dx) {
-                dx += width - 1;
-                sx += width - 1;
-                direction |= 0x8000;
-        }
-
-        /* Source Base Address */
-        writel(((unsigned long) (info->screen_base) -
-                   (unsigned long) viafb_FB_MM) >> 3,
-                   viaparinfo->io_virt + VIA_REG_SRCBASE);
-        /* Destination Base Address */
-        writel(((unsigned long) (info->screen_base) -
-                   (unsigned long) viafb_FB_MM) >> 3,
-                   viaparinfo->io_virt + VIA_REG_DSTBASE);
-        /* Pitch */
-        pitch = (info->var.xres_virtual + 7) & ~7;
-        /* VIA_PITCH_ENABLE can be omitted now. */
-        writel(VIA_PITCH_ENABLE |
-                   (((pitch *
-                      info->var.bits_per_pixel >> 3) >> 3) | (((pitch *
-                                                                info->var.
-                                                                bits_per_pixel
-                                                                >> 3) >> 3)
-                                                              << 16)),
-                                viaparinfo->io_virt + VIA_REG_PITCH);
-        /* BitBlt Source Address */
-        writel(((sy << 16) | sx), viaparinfo->io_virt + VIA_REG_SRCPOS);
-        /* BitBlt Destination Address */
-        writel(((dy << 16) | dx), viaparinfo->io_virt + VIA_REG_DSTPOS);
-        /* Dimension: width & height */
-        writel((((area->height - 1) << 16) | (area->width - 1)),
-                   viaparinfo->io_virt + VIA_REG_DIMENSION);
-        /* GE Command */
-        writel((0x01 | direction | (0xCC << 24)),
-                viaparinfo->io_virt + VIA_REG_GECMD);
-
+        DEBUG_MSG(KERN_DEBUG "viafb 2D engine: copyarea\n");
+        if (shared->hw_bitblt(shared->engine_mmio, VIA_BITBLT_COLOR,
+                area->width, area->height, info->var.bits_per_pixel,
+                viapar->vram_addr, info->fix.line_length, area->dx, area->dy,
+                NULL, viapar->vram_addr, info->fix.line_length,
+                area->sx, area->sy, 0, 0, 0))
+                cfb_copyarea(info, area);
 }
 
 static void viafb_imageblit(struct fb_info *info,
         const struct fb_image *image)
 {
-        u32 size, bg_col = 0, fg_col = 0, *udata;
-        int i;
-        int pitch;
+        struct viafb_par *viapar = info->par;
+        struct viafb_shared *shared = viapar->shared;
+        u32 fg_color = 0, bg_color = 0;
+        u8 op;
 
-        if (!viafb_accel) {
+        if (info->flags & FBINFO_HWACCEL_DISABLED || !shared->hw_bitblt ||
+                (image->depth != 1 && image->depth != viapar->depth)) {
                 cfb_imageblit(info, image);
                 return;
         }
 
-        udata = (u32 *) image->data;
-
-        switch (info->var.bits_per_pixel) {
-        case 8:
-                bg_col = image->bg_color;
-                fg_col = image->fg_color;
-                break;
-        case 16:
-                bg_col = ((u32 *) (info->pseudo_palette))[image->bg_color];
-                fg_col = ((u32 *) (info->pseudo_palette))[image->fg_color];
-                break;
-        case 32:
-                bg_col = ((u32 *) (info->pseudo_palette))[image->bg_color];
-                fg_col = ((u32 *) (info->pseudo_palette))[image->fg_color];
-                break;
-        }
-        size = image->width * image->height;
-
-        /* Source Base Address */
-        writel(0x0, viaparinfo->io_virt + VIA_REG_SRCBASE);
-        /* Destination Base Address */
-        writel(((unsigned long) (info->screen_base) -
-                   (unsigned long) viafb_FB_MM) >> 3,
-                   viaparinfo->io_virt + VIA_REG_DSTBASE);
-        /* Pitch */
-        pitch = (info->var.xres_virtual + 7) & ~7;
-        writel(VIA_PITCH_ENABLE |
-                   (((pitch *
-                      info->var.bits_per_pixel >> 3) >> 3) | (((pitch *
-                                                                info->var.
-                                                                bits_per_pixel
-                                                                >> 3) >> 3)
-                                                              << 16)),
-                                viaparinfo->io_virt + VIA_REG_PITCH);
-        /* BitBlt Source Address */
-        writel(0x0, viaparinfo->io_virt + VIA_REG_SRCPOS);
-        /* BitBlt Destination Address */
-        writel(((image->dy << 16) | image->dx),
-                viaparinfo->io_virt + VIA_REG_DSTPOS);
-        /* Dimension: width & height */
-        writel((((image->height - 1) << 16) | (image->width - 1)),
-                   viaparinfo->io_virt + VIA_REG_DIMENSION);
-        /* fb color */
-        writel(fg_col, viaparinfo->io_virt + VIA_REG_FGCOLOR);
-        /* bg color */
-        writel(bg_col, viaparinfo->io_virt + VIA_REG_BGCOLOR);
-        /* GE Command */
-        writel(0xCC020142, viaparinfo->io_virt + VIA_REG_GECMD);
-
-        for (i = 0; i < size / 4; i++) {
-                writel(*udata, viaparinfo->io_virt + VIA_MMIO_BLTBASE);
-                udata++;
-        }
+        if (image->depth == 1) {
+                op = VIA_BITBLT_MONO;
+                if (info->fix.visual == FB_VISUAL_TRUECOLOR) {
+                        fg_color =
+                                ((u32 *)info->pseudo_palette)[image->fg_color];
+                        bg_color =
+                                ((u32 *)info->pseudo_palette)[image->bg_color];
+                } else {
+                        fg_color = image->fg_color;
+                        bg_color = image->bg_color;
+                }
+        } else
+                op = VIA_BITBLT_COLOR;
 
+        DEBUG_MSG(KERN_DEBUG "viafb 2D engine: imageblit\n");
+        if (shared->hw_bitblt(shared->engine_mmio, op,
+                image->width, image->height, info->var.bits_per_pixel,
+                viapar->vram_addr, info->fix.line_length, image->dx, image->dy,
+                (u32 *)image->data, 0, 0, 0, 0, fg_color, bg_color, 0))
+                cfb_imageblit(info, image);
 }
 
 static int viafb_cursor(struct fb_info *info, struct fb_cursor *cursor)
 {
-        u32 temp, xx, yy, bg_col = 0, fg_col = 0;
-        int i, j = 0;
-        static int hw_cursor;
-        struct viafb_par *p_viafb_par;
-
-        if (viafb_accel)
-                hw_cursor = 1;
-
-        if (!viafb_accel) {
-                if (hw_cursor) {
-                        viafb_show_hw_cursor(info, HW_Cursor_OFF);
-                        hw_cursor = 0;
-                }
-                return -ENODEV;
-        }
+        struct viafb_par *viapar = info->par;
+        void __iomem *engine = viapar->shared->engine_mmio;
+        u32 temp, xx, yy, bg_color = 0, fg_color = 0,
+                chip_name = viapar->shared->chip_info.gfx_chip_name;
+        int i, j = 0, cur_size = 64;
 
-        if ((((struct viafb_par *)(info->par))->iga_path == IGA2)
-            && (viaparinfo->chip_info->gfx_chip_name == UNICHROME_CLE266))
+        if (info->flags & FBINFO_HWACCEL_DISABLED || info != viafbinfo)
                 return -ENODEV;
 
-        /* When duoview and using lcd , use soft cursor */
-        if (viafb_LCD_ON || ((struct viafb_par *)(info->par))->duoview)
+        if (chip_name == UNICHROME_CLE266 && viapar->iga_path == IGA2)
                 return -ENODEV;
 
         viafb_show_hw_cursor(info, HW_Cursor_OFF);
-        viacursor = *cursor;
 
         if (cursor->set & FB_CUR_SETHOT) {
-                viacursor.hot = cursor->hot;
-                temp = ((viacursor.hot.x) << 16) + viacursor.hot.y;
-                writel(temp, viaparinfo->io_virt + VIA_REG_CURSOR_ORG);
+                temp = (cursor->hot.x << 16) + cursor->hot.y;
+                writel(temp, engine + VIA_REG_CURSOR_ORG);
         }
 
         if (cursor->set & FB_CUR_SETPOS) {
-                viacursor.image.dx = cursor->image.dx;
-                viacursor.image.dy = cursor->image.dy;
                 yy = cursor->image.dy - info->var.yoffset;
                 xx = cursor->image.dx - info->var.xoffset;
                 temp = yy & 0xFFFF;
                 temp |= (xx << 16);
-                writel(temp, viaparinfo->io_virt + VIA_REG_CURSOR_POS);
+                writel(temp, engine + VIA_REG_CURSOR_POS);
         }
 
-        if (cursor->set & FB_CUR_SETSIZE) {
-                temp = readl(viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
+        if (cursor->image.width <= 32 && cursor->image.height <= 32)
+                cur_size = 32;
+        else if (cursor->image.width <= 64 && cursor->image.height <= 64)
+                cur_size = 64;
+        else {
+                printk(KERN_WARNING "viafb_cursor: The cursor is too large "
+                        "%dx%d", cursor->image.width, cursor->image.height);
+                return -ENXIO;
+        }
 
-                if ((cursor->image.width <= 32)
-                    && (cursor->image.height <= 32)) {
-                        MAX_CURS = 32;
+        if (cursor->set & FB_CUR_SETSIZE) {
+                temp = readl(engine + VIA_REG_CURSOR_MODE);
+                if (cur_size == 32)
                         temp |= 0x2;
-                } else if ((cursor->image.width <= 64)
-                           && (cursor->image.height <= 64)) {
-                        MAX_CURS = 64;
-                        temp &= 0xFFFFFFFD;
-                } else {
-                        DEBUG_MSG(KERN_INFO
-                        "The cursor image is biger than 64x64 bits...\n");
-                        return -ENXIO;
-                }
-                writel(temp, viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
+                else
+                        temp &= ~0x2;
 
-                viacursor.image.height = cursor->image.height;
-                viacursor.image.width = cursor->image.width;
+                writel(temp, engine + VIA_REG_CURSOR_MODE);
         }
 
         if (cursor->set & FB_CUR_SETCMAP) {
-                viacursor.image.fg_color = cursor->image.fg_color;
-                viacursor.image.bg_color = cursor->image.bg_color;
-
-                switch (info->var.bits_per_pixel) {
-                case 8:
-                case 16:
-                case 32:
-                        bg_col =
-                            (0xFF << 24) |
-                            (((info->cmap.red)[viacursor.image.bg_color] &
-                            0xFF00) << 8) |
-                            ((info->cmap.green)[viacursor.image.bg_color] &
-                            0xFF00) |
-                            (((info->cmap.blue)[viacursor.image.bg_color] &
-                            0xFF00) >> 8);
-                        fg_col =
-                            (0xFF << 24) |
-                            (((info->cmap.red)[viacursor.image.fg_color] &
-                            0xFF00) << 8) |
-                            ((info->cmap.green)[viacursor.image.fg_color] &
-                            0xFF00) |
-                            (((info->cmap.blue)[viacursor.image.fg_color] &
-                            0xFF00) >> 8);
-                        break;
-                default:
-                        return 0;
-                }
-
-                /* This is indeed a patch for VT3324/VT3353 */
-                if (!info->par)
-                        return 0;
-                p_viafb_par = (struct viafb_par *)info->par;
-
-                if ((p_viafb_par->chip_info->gfx_chip_name ==
-                        UNICHROME_CX700) ||
-                        ((p_viafb_par->chip_info->gfx_chip_name ==
-                        UNICHROME_VX800))) {
-                        bg_col =
-                            (((info->cmap.red)[viacursor.image.bg_color] &
-                            0xFFC0) << 14) |
-                            (((info->cmap.green)[viacursor.image.bg_color] &
-                            0xFFC0) << 4) |
-                            (((info->cmap.blue)[viacursor.image.bg_color] &
-                            0xFFC0) >> 6);
-                        fg_col =
-                            (((info->cmap.red)[viacursor.image.fg_color] &
-                            0xFFC0) << 14) |
-                            (((info->cmap.green)[viacursor.image.fg_color] &
-                            0xFFC0) << 4) |
-                            (((info->cmap.blue)[viacursor.image.fg_color] &
-                            0xFFC0) >> 6);
+                fg_color = cursor->image.fg_color;
+                bg_color = cursor->image.bg_color;
+                if (chip_name == UNICHROME_CX700 ||
+                        chip_name == UNICHROME_VX800 ||
+                        chip_name == UNICHROME_VX855) {
+                        fg_color =
+                                ((info->cmap.red[fg_color] & 0xFFC0) << 14) |
+                                ((info->cmap.green[fg_color] & 0xFFC0) << 4) |
+                                ((info->cmap.blue[fg_color] & 0xFFC0) >> 6);
+                        bg_color =
+                                ((info->cmap.red[bg_color] & 0xFFC0) << 14) |
+                                ((info->cmap.green[bg_color] & 0xFFC0) << 4) |
+                                ((info->cmap.blue[bg_color] & 0xFFC0) >> 6);
+                } else {
+                        fg_color =
+                                ((info->cmap.red[fg_color] & 0xFF00) << 8) |
+                                (info->cmap.green[fg_color] & 0xFF00) |
+                                ((info->cmap.blue[fg_color] & 0xFF00) >> 8);
+                        bg_color =
+                                ((info->cmap.red[bg_color] & 0xFF00) << 8) |
+                                (info->cmap.green[bg_color] & 0xFF00) |
+                                ((info->cmap.blue[bg_color] & 0xFF00) >> 8);
                 }
 
-                writel(bg_col, viaparinfo->io_virt + VIA_REG_CURSOR_BG);
-                writel(fg_col, viaparinfo->io_virt + VIA_REG_CURSOR_FG);
+                writel(bg_color, engine + VIA_REG_CURSOR_BG);
+                writel(fg_color, engine + VIA_REG_CURSOR_FG);
         }
 
         if (cursor->set & FB_CUR_SETSHAPE) {
                 struct {
-                        u8 data[CURSOR_SIZE / 8];
-                        u32 bak[CURSOR_SIZE / 32];
+                        u8 data[CURSOR_SIZE];
+                        u32 bak[CURSOR_SIZE / 4];
                 } *cr_data = kzalloc(sizeof(*cr_data), GFP_ATOMIC);
-                int size =
-                    ((viacursor.image.width + 7) >> 3) *
-                    viacursor.image.height;
+                int size = ((cursor->image.width + 7) >> 3) *
+                        cursor->image.height;
 
-                if (cr_data == NULL)
-                        goto out;
+                if (!cr_data)
+                        return -ENOMEM;
 
-                if (MAX_CURS == 32) {
-                        for (i = 0; i < (CURSOR_SIZE / 32); i++) {
+                if (cur_size == 32) {
+                        for (i = 0; i < (CURSOR_SIZE / 4); i++) {
                                 cr_data->bak[i] = 0x0;
                                 cr_data->bak[i + 1] = 0xFFFFFFFF;
                                 i += 1;
                         }
-                } else if (MAX_CURS == 64) {
-                        for (i = 0; i < (CURSOR_SIZE / 32); i++) {
+                } else {
+                        for (i = 0; i < (CURSOR_SIZE / 4); i++) {
                                 cr_data->bak[i] = 0x0;
                                 cr_data->bak[i + 1] = 0x0;
                                 cr_data->bak[i + 2] = 0xFFFFFFFF;
@@ -1211,27 +966,27 @@ static int viafb_cursor(struct fb_info *info, struct fb_cursor *cursor)
                         }
                 }
 
-                switch (viacursor.rop) {
+                switch (cursor->rop) {
                 case ROP_XOR:
                         for (i = 0; i < size; i++)
-                                cr_data->data[i] = viacursor.mask[i];
+                                cr_data->data[i] = cursor->mask[i];
                         break;
                 case ROP_COPY:
 
                         for (i = 0; i < size; i++)
-                                cr_data->data[i] = viacursor.mask[i];
+                                cr_data->data[i] = cursor->mask[i];
                         break;
                 default:
                         break;
                 }
 
-                if (MAX_CURS == 32) {
+                if (cur_size == 32) {
                         for (i = 0; i < size; i++) {
                                 cr_data->bak[j] = (u32) cr_data->data[i];
                                 cr_data->bak[j + 1] = ~cr_data->bak[j];
                                 j += 2;
                         }
-                } else if (MAX_CURS == 64) {
+                } else {
                         for (i = 0; i < size; i++) {
                                 cr_data->bak[j] = (u32) cr_data->data[i];
                                 cr_data->bak[j + 1] = 0x0;
@@ -1241,14 +996,12 @@ static int viafb_cursor(struct fb_info *info, struct fb_cursor *cursor)
                         }
                 }
 
-                memcpy(((struct viafb_par *)(info->par))->fbmem_virt +
-                       ((struct viafb_par *)(info->par))->cursor_start,
-                       cr_data->bak, CURSOR_SIZE);
-out:
+                memcpy_toio(viafbinfo->screen_base + viapar->shared->
+                        cursor_vram_addr, cr_data->bak, CURSOR_SIZE);
                 kfree(cr_data);
         }
 
-        if (viacursor.enable)
+        if (cursor->enable)
                 viafb_show_hw_cursor(info, HW_Cursor_ON);
 
         return 0;
@@ -1256,8 +1009,8 @@ out:
 
 static int viafb_sync(struct fb_info *info)
 {
-        if (viafb_accel)
-                viafb_wait_engine_idle();
+        if (!(info->flags & FBINFO_HWACCEL_DISABLED))
+                viafb_wait_engine_idle(info);
         return 0;
 }
 
@@ -1266,12 +1019,16 @@ int viafb_get_mode_index(int hres, int vres)
         u32 i;
         DEBUG_MSG(KERN_INFO "viafb_get_mode_index!\n");
 
-        for (i = 0; viafb_modentry[i].mode_index != VIA_RES_INVALID; i++)
-                if (viafb_modentry[i].xres == hres &&
-                        viafb_modentry[i].yres == vres)
+        for (i = 0; i < NUM_TOTAL_MODETABLE; i++)
+                if (CLE266Modes[i].mode_array &&
+                        CLE266Modes[i].crtc[0].crtc.hor_addr == hres &&
+                        CLE266Modes[i].crtc[0].crtc.ver_addr == vres)
                         break;
 
-        return viafb_modentry[i].mode_index;
+        if (i == NUM_TOTAL_MODETABLE)
+                return VIA_RES_INVALID;
+
+        return CLE266Modes[i].ModeIndex;
 }
 
 static void check_available_device_to_enable(int device_id)
@@ -1375,36 +1132,11 @@ static void viafb_set_device(struct device_t active_dev)
                 viafb_SAMM_ON = active_dev.samm;
         viafb_primary_dev = active_dev.primary_dev;
 
-        viafb_set_start_addr();
+        viafb_set_primary_address(0);
+        viafb_set_secondary_address(viafb_SAMM_ON ? viafb_second_offset : 0);
         viafb_set_iga_path();
 }
 
-static void viafb_set_video_device(u32 video_dev_info)
-{
-        viaparinfo->video_on_crt = STATE_OFF;
-        viaparinfo->video_on_dvi = STATE_OFF;
-        viaparinfo->video_on_lcd = STATE_OFF;
-
-        /* Check available device to enable: */
-        if ((video_dev_info & CRT_Device) == CRT_Device)
-                viaparinfo->video_on_crt = STATE_ON;
-        else if ((video_dev_info & DVI_Device) == DVI_Device)
-                viaparinfo->video_on_dvi = STATE_ON;
-        else if ((video_dev_info & LCD_Device) == LCD_Device)
-                viaparinfo->video_on_lcd = STATE_ON;
-}
-
-static void viafb_get_video_device(u32 *video_dev_info)
-{
-        *video_dev_info = None_Device;
-        if (viaparinfo->video_on_crt == STATE_ON)
-                *video_dev_info |= CRT_Device;
-        else if (viaparinfo->video_on_dvi == STATE_ON)
-                *video_dev_info |= DVI_Device;
-        else if (viaparinfo->video_on_lcd == STATE_ON)
-                *video_dev_info |= LCD_Device;
-}
-
 static int get_primary_device(void)
 {
         int primary_device = 0;
@@ -1446,18 +1178,6 @@ static int get_primary_device(void)
         return primary_device;
 }
 
-static u8 is_duoview(void)
-{
-        if (0 == viafb_SAMM_ON) {
-                if (viafb_LCD_ON + viafb_LCD2_ON +
-                        viafb_DVI_ON + viafb_CRT_ON == 2)
-                        return true;
-                return false;
-        } else {
-                return false;
-        }
-}
-
 static void apply_second_mode_setting(struct fb_var_screeninfo
         *sec_var)
 {
@@ -1559,14 +1279,13 @@ static int apply_device_setting(struct viafb_ioctl_setting setting_info,
                         if (viafb_SAMM_ON)
                                 viafb_primary_dev = setting_info.primary_device;
 
-                        viafb_set_start_addr();
+                        viafb_set_primary_address(0);
+                        viafb_set_secondary_address(viafb_SAMM_ON ? viafb_second_offset : 0);
                         viafb_set_iga_path();
                 }
                 need_set_mode = 1;
         }
 
-        viaparinfo->duoview = is_duoview();
-
         if (!need_set_mode) {
                 ;
         } else {
@@ -1589,18 +1308,6 @@ static void retrieve_device_setting(struct viafb_ioctl_setting
                 setting_info->device_status |= LCD_Device;
         if (viafb_LCD2_ON == 1)
                 setting_info->device_status |= LCD2_Device;
-        if ((viaparinfo->video_on_crt == 1) && (viafb_CRT_ON == 1)) {
-                setting_info->video_device_status =
-                        viaparinfo->crt_setting_info->iga_path;
-        } else if ((viaparinfo->video_on_dvi == 1) && (viafb_DVI_ON == 1)) {
-                setting_info->video_device_status =
-                        viaparinfo->tmds_setting_info->iga_path;
-        } else if ((viaparinfo->video_on_lcd == 1) && (viafb_LCD_ON == 1)) {
-                setting_info->video_device_status =
-                        viaparinfo->lvds_setting_info->iga_path;
-        } else {
-                setting_info->video_device_status = 0;
-        }
 
         setting_info->samm_status = viafb_SAMM_ON;
         setting_info->primary_device = get_primary_device();
@@ -1687,25 +1394,6 @@ static void parse_active_dev(void)
                 viafb_CRT_ON = STATE_ON;
                 viafb_SAMM_ON = STATE_OFF;
         }
-        viaparinfo->duoview = is_duoview();
-}
-
-static void parse_video_dev(void)
-{
-        viaparinfo->video_on_crt = STATE_OFF;
-        viaparinfo->video_on_dvi = STATE_OFF;
-        viaparinfo->video_on_lcd = STATE_OFF;
-
-        if (!strncmp(viafb_video_dev, "CRT", 3)) {
-                /* Video on CRT */
-                viaparinfo->video_on_crt = STATE_ON;
-        } else if (!strncmp(viafb_video_dev, "DVI", 3)) {
-                /* Video on DVI */
-                viaparinfo->video_on_dvi = STATE_ON;
-        } else if (!strncmp(viafb_video_dev, "LCD", 3)) {
-                /* Video on LCD */
-                viaparinfo->video_on_lcd = STATE_ON;
-        }
 }
 
 static int parse_port(char *opt_str, int *output_interface)
@@ -1754,10 +1442,8 @@ static void parse_dvi_port(void)
  * DVP1Driving, DFPHigh, DFPLow CR96,   SR2A[5], SR1B[1], SR2A[4], SR1E[2],
  * CR9B,    SR65,    CR97,    CR99
  */
-static int viafb_dvp0_proc_read(char *buf, char **start, off_t offset,
-int count, int *eof, void *data)
+static int viafb_dvp0_proc_show(struct seq_file *m, void *v)
 {
-        int len = 0;
         u8 dvp0_data_dri = 0, dvp0_clk_dri = 0, dvp0 = 0;
         dvp0_data_dri =
             (viafb_read_reg(VIASR, SR2A) & BIT5) >> 4 |
@@ -1766,13 +1452,17 @@ int count, int *eof, void *data)
             (viafb_read_reg(VIASR, SR2A) & BIT4) >> 3 |
             (viafb_read_reg(VIASR, SR1E) & BIT2) >> 2;
         dvp0 = viafb_read_reg(VIACR, CR96) & 0x0f;
-        len +=
-            sprintf(buf + len, "%x %x %x\n", dvp0, dvp0_data_dri, dvp0_clk_dri);
-        *eof = 1;               /*Inform kernel end of data */
-        return len;
+        seq_printf(m, "%x %x %x\n", dvp0, dvp0_data_dri, dvp0_clk_dri);
+        return 0;
 }
-static int viafb_dvp0_proc_write(struct file *file,
-        const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_dvp0_proc_open(struct inode *inode, struct file *file)
+{
+        return single_open(file, viafb_dvp0_proc_show, NULL);
+}
+
+static ssize_t viafb_dvp0_proc_write(struct file *file,
+        const char __user *buffer, size_t count, loff_t *pos)
 {
         char buf[20], *value, *pbuf;
         u8 reg_val = 0;
@@ -1816,21 +1506,33 @@ static int viafb_dvp0_proc_write(struct file *file,
         }
         return count;
 }
-static int viafb_dvp1_proc_read(char *buf, char **start, off_t offset,
-        int count, int *eof, void *data)
+
+static const struct file_operations viafb_dvp0_proc_fops = {
+        .owner          = THIS_MODULE,
+        .open           = viafb_dvp0_proc_open,
+        .read           = seq_read,
+        .llseek         = seq_lseek,
+        .release        = single_release,
+        .write          = viafb_dvp0_proc_write,
+};
+
+static int viafb_dvp1_proc_show(struct seq_file *m, void *v)
 {
-        int len = 0;
         u8 dvp1 = 0, dvp1_data_dri = 0, dvp1_clk_dri = 0;
         dvp1 = viafb_read_reg(VIACR, CR9B) & 0x0f;
         dvp1_data_dri = (viafb_read_reg(VIASR, SR65) & 0x0c) >> 2;
         dvp1_clk_dri = viafb_read_reg(VIASR, SR65) & 0x03;
-        len +=
-            sprintf(buf + len, "%x %x %x\n", dvp1, dvp1_data_dri, dvp1_clk_dri);
-        *eof = 1;               /*Inform kernel end of data */
-        return len;
+        seq_printf(m, "%x %x %x\n", dvp1, dvp1_data_dri, dvp1_clk_dri);
+        return 0;
 }
-static int viafb_dvp1_proc_write(struct file *file,
-        const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_dvp1_proc_open(struct inode *inode, struct file *file)
+{
+        return single_open(file, viafb_dvp1_proc_show, NULL);
+}
+
+static ssize_t viafb_dvp1_proc_write(struct file *file,
+        const char __user *buffer, size_t count, loff_t *pos)
 {
         char buf[20], *value, *pbuf;
         u8 reg_val = 0;
@@ -1869,18 +1571,30 @@ static int viafb_dvp1_proc_write(struct file *file,
         return count;
 }
 
-static int viafb_dfph_proc_read(char *buf, char **start, off_t offset,
-        int count, int *eof, void *data)
+static const struct file_operations viafb_dvp1_proc_fops = {
+        .owner          = THIS_MODULE,
+        .open           = viafb_dvp1_proc_open,
+        .read           = seq_read,
+        .llseek         = seq_lseek,
+        .release        = single_release,
+        .write          = viafb_dvp1_proc_write,
+};
+
+static int viafb_dfph_proc_show(struct seq_file *m, void *v)
 {
-        int len = 0;
         u8 dfp_high = 0;
         dfp_high = viafb_read_reg(VIACR, CR97) & 0x0f;
-        len += sprintf(buf + len, "%x\n", dfp_high);
-        *eof = 1;               /*Inform kernel end of data */
-        return len;
+        seq_printf(m, "%x\n", dfp_high);
+        return 0;
 }
-static int viafb_dfph_proc_write(struct file *file,
-        const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_dfph_proc_open(struct inode *inode, struct file *file)
+{
+        return single_open(file, viafb_dfph_proc_show, NULL);
+}
+
+static ssize_t viafb_dfph_proc_write(struct file *file,
+        const char __user *buffer, size_t count, loff_t *pos)
 {
         char buf[20];
         u8 reg_val = 0;
@@ -1895,18 +1609,31 @@ static int viafb_dfph_proc_write(struct file *file,
         viafb_write_reg_mask(CR97, VIACR, reg_val, 0x0f);
         return count;
 }
-static int viafb_dfpl_proc_read(char *buf, char **start, off_t offset,
-        int count, int *eof, void *data)
+
+static const struct file_operations viafb_dfph_proc_fops = {
+        .owner          = THIS_MODULE,
+        .open           = viafb_dfph_proc_open,
+        .read           = seq_read,
+        .llseek         = seq_lseek,
+        .release        = single_release,
+        .write          = viafb_dfph_proc_write,
+};
+
+static int viafb_dfpl_proc_show(struct seq_file *m, void *v)
 {
-        int len = 0;
         u8 dfp_low = 0;
         dfp_low = viafb_read_reg(VIACR, CR99) & 0x0f;
-        len += sprintf(buf + len, "%x\n", dfp_low);
-        *eof = 1;               /*Inform kernel end of data */
-        return len;
+        seq_printf(m, "%x\n", dfp_low);
+        return 0;
 }
-static int viafb_dfpl_proc_write(struct file *file,
-        const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_dfpl_proc_open(struct inode *inode, struct file *file)
+{
+        return single_open(file, viafb_dfpl_proc_show, NULL);
+}
+
+static ssize_t viafb_dfpl_proc_write(struct file *file,
+        const char __user *buffer, size_t count, loff_t *pos)
 {
         char buf[20];
         u8 reg_val = 0;
@@ -1921,10 +1648,18 @@ static int viafb_dfpl_proc_write(struct file *file,
         viafb_write_reg_mask(CR99, VIACR, reg_val, 0x0f);
         return count;
 }
-static int viafb_vt1636_proc_read(char *buf, char **start,
-        off_t offset, int count, int *eof, void *data)
+
+static const struct file_operations viafb_dfpl_proc_fops = {
+        .owner          = THIS_MODULE,
+        .open           = viafb_dfpl_proc_open,
+        .read           = seq_read,
+        .llseek         = seq_lseek,
+        .release        = single_release,
+        .write          = viafb_dfpl_proc_write,
+};
+
+static int viafb_vt1636_proc_show(struct seq_file *m, void *v)
 {
-        int len = 0;
         u8 vt1636_08 = 0, vt1636_09 = 0;
         switch (viaparinfo->chip_info->lvds_chip_info.lvds_chip_name) {
         case VT1636_LVDS:
@@ -1934,7 +1669,7 @@ static int viafb_vt1636_proc_read(char *buf, char **start,
                 vt1636_09 =
                     viafb_gpio_i2c_read_lvds(viaparinfo->lvds_setting_info,
                     &viaparinfo->chip_info->lvds_chip_info, 0x09) & 0x1f;
-                len += sprintf(buf + len, "%x %x\n", vt1636_08, vt1636_09);
+                seq_printf(m, "%x %x\n", vt1636_08, vt1636_09);
                 break;
         default:
                 break;
@@ -1947,16 +1682,21 @@ static int viafb_vt1636_proc_read(char *buf, char **start,
                 vt1636_09 =
                     viafb_gpio_i2c_read_lvds(viaparinfo->lvds_setting_info2,
                         &viaparinfo->chip_info->lvds_chip_info2, 0x09) & 0x1f;
-                len += sprintf(buf + len, " %x %x\n", vt1636_08, vt1636_09);
+                seq_printf(m, " %x %x\n", vt1636_08, vt1636_09);
                 break;
         default:
                 break;
         }
-        *eof = 1;               /*Inform kernel end of data */
-        return len;
+        return 0;
 }
-static int viafb_vt1636_proc_write(struct file *file,
-        const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_vt1636_proc_open(struct inode *inode, struct file *file)
+{
+        return single_open(file, viafb_vt1636_proc_show, NULL);
+}
+
+static ssize_t viafb_vt1636_proc_write(struct file *file,
+        const char __user *buffer, size_t count, loff_t *pos)
 {
         char buf[30], *value, *pbuf;
         struct IODATA reg_val;
@@ -2045,39 +1785,27 @@ static int viafb_vt1636_proc_write(struct file *file,
         return count;
 }
 
+static const struct file_operations viafb_vt1636_proc_fops = {
+        .owner          = THIS_MODULE,
+        .open           = viafb_vt1636_proc_open,
+        .read           = seq_read,
+        .llseek         = seq_lseek,
+        .release        = single_release,
+        .write          = viafb_vt1636_proc_write,
+};
+
 static void viafb_init_proc(struct proc_dir_entry **viafb_entry)
 {
-        struct proc_dir_entry *entry;
         *viafb_entry = proc_mkdir("viafb", NULL);
         if (viafb_entry) {
-                entry = create_proc_entry("dvp0", 0, *viafb_entry);
-                if (entry) {
-                        entry->read_proc = viafb_dvp0_proc_read;
-                        entry->write_proc = viafb_dvp0_proc_write;
-                }
-                entry = create_proc_entry("dvp1", 0, *viafb_entry);
-                if (entry) {
-                        entry->read_proc = viafb_dvp1_proc_read;
-                        entry->write_proc = viafb_dvp1_proc_write;
-                }
-                entry = create_proc_entry("dfph", 0, *viafb_entry);
-                if (entry) {
-                        entry->read_proc = viafb_dfph_proc_read;
-                        entry->write_proc = viafb_dfph_proc_write;
-                }
-                entry = create_proc_entry("dfpl", 0, *viafb_entry);
-                if (entry) {
-                        entry->read_proc = viafb_dfpl_proc_read;
-                        entry->write_proc = viafb_dfpl_proc_write;
-                }
+                proc_create("dvp0", 0, *viafb_entry, &viafb_dvp0_proc_fops);
+                proc_create("dvp1", 0, *viafb_entry, &viafb_dvp1_proc_fops);
+                proc_create("dfph", 0, *viafb_entry, &viafb_dfph_proc_fops);
+                proc_create("dfpl", 0, *viafb_entry, &viafb_dfpl_proc_fops);
                 if (VT1636_LVDS == viaparinfo->chip_info->lvds_chip_info.
                         lvds_chip_name || VT1636_LVDS ==
                     viaparinfo->chip_info->lvds_chip_info2.lvds_chip_name) {
-                        entry = create_proc_entry("vt1636", 0, *viafb_entry);
-                        if (entry) {
-                                entry->read_proc = viafb_vt1636_proc_read;
-                                entry->write_proc = viafb_vt1636_proc_write;
-                        }
+                        proc_create("vt1636", 0, *viafb_entry, &viafb_vt1636_proc_fops);
                 }
 
         }
@@ -2094,51 +1822,61 @@ static void viafb_remove_proc(struct proc_dir_entry *viafb_entry)
         remove_proc_entry("viafb", NULL);
 }
 
-static int __devinit via_pci_probe(void)
+static void parse_mode(const char *str, u32 *xres, u32 *yres)
 {
-        unsigned long default_xres, default_yres;
-        char *tmpc, *tmpm;
-        char *tmpc_sec, *tmpm_sec;
+        char *ptr;
+
+        *xres = simple_strtoul(str, &ptr, 10);
+        if (ptr[0] != 'x')
+                goto out_default;
+
+        *yres = simple_strtoul(&ptr[1], &ptr, 10);
+        if (ptr[0])
+                goto out_default;
+
+        return;
+
+out_default:
+        printk(KERN_WARNING "viafb received invalid mode string: %s\n", str);
+        *xres = 640;
+        *yres = 480;
+}
+
+static int __devinit via_pci_probe(struct pci_dev *pdev,
+                                   const struct pci_device_id *ent)
+{
+        u32 default_xres, default_yres;
         int vmode_index;
-        u32 tmds_length, lvds_length, crt_length, chip_length, viafb_par_length;
+        u32 viafb_par_length;
 
         DEBUG_MSG(KERN_INFO "VIAFB PCI Probe!!\n");
 
         viafb_par_length = ALIGN(sizeof(struct viafb_par), BITS_PER_LONG/8);
-        tmds_length = ALIGN(sizeof(struct tmds_setting_information),
-                BITS_PER_LONG/8);
-        lvds_length = ALIGN(sizeof(struct lvds_setting_information),
-                BITS_PER_LONG/8);
-        crt_length = ALIGN(sizeof(struct lvds_setting_information),
-                BITS_PER_LONG/8);
-        chip_length = ALIGN(sizeof(struct chip_information), BITS_PER_LONG/8);
 
         /* Allocate fb_info and ***_par here, also including some other needed
          * variables
         */
-        viafbinfo = framebuffer_alloc(viafb_par_length + 2 * lvds_length +
-        tmds_length + crt_length + chip_length, NULL);
+        viafbinfo = framebuffer_alloc(viafb_par_length +
+                ALIGN(sizeof(struct viafb_shared), BITS_PER_LONG/8),
+                &pdev->dev);
         if (!viafbinfo) {
                 printk(KERN_ERR"Could not allocate memory for viafb_info.\n");
                 return -ENODEV;
         }
 
         viaparinfo = (struct viafb_par *)viafbinfo->par;
-        viaparinfo->tmds_setting_info = (struct tmds_setting_information *)
-                ((unsigned long)viaparinfo + viafb_par_length);
-        viaparinfo->lvds_setting_info = (struct lvds_setting_information *)
-                ((unsigned long)viaparinfo->tmds_setting_info + tmds_length);
-        viaparinfo->lvds_setting_info2 = (struct lvds_setting_information *)
-                ((unsigned long)viaparinfo->lvds_setting_info + lvds_length);
-        viaparinfo->crt_setting_info = (struct crt_setting_information *)
-                ((unsigned long)viaparinfo->lvds_setting_info2 + lvds_length);
-        viaparinfo->chip_info = (struct chip_information *)
-                ((unsigned long)viaparinfo->crt_setting_info + crt_length);
+        viaparinfo->shared = viafbinfo->par + viafb_par_length;
+        viaparinfo->vram_addr = 0;
+        viaparinfo->tmds_setting_info = &viaparinfo->shared->tmds_setting_info;
+        viaparinfo->lvds_setting_info = &viaparinfo->shared->lvds_setting_info;
+        viaparinfo->lvds_setting_info2 =
+                &viaparinfo->shared->lvds_setting_info2;
+        viaparinfo->crt_setting_info = &viaparinfo->shared->crt_setting_info;
+        viaparinfo->chip_info = &viaparinfo->shared->chip_info;
 
         if (viafb_dual_fb)
                 viafb_SAMM_ON = 1;
         parse_active_dev();
-        parse_video_dev();
         parse_lcd_port();
         parse_dvi_port();
 
@@ -2149,32 +1887,32 @@ static int __devinit via_pci_probe(void)
         /* Set up I2C bus stuff */
         viafb_create_i2c_bus(viaparinfo);
 
-        viafb_init_chip_info();
-        viafb_get_fb_info(&viaparinfo->fbmem, &viaparinfo->memsize);
+        viafb_init_chip_info(pdev, ent);
+        viaparinfo->fbmem = pci_resource_start(pdev, 0);
+        viaparinfo->memsize = viafb_get_fb_size_from_pci();
         viaparinfo->fbmem_free = viaparinfo->memsize;
         viaparinfo->fbmem_used = 0;
-        viaparinfo->fbmem_virt = ioremap_nocache(viaparinfo->fbmem,
+        viafbinfo->screen_base = ioremap_nocache(viaparinfo->fbmem,
                 viaparinfo->memsize);
-        viafbinfo->screen_base = (char *)viaparinfo->fbmem_virt;
-
-        if (!viaparinfo->fbmem_virt) {
+        if (!viafbinfo->screen_base) {
                 printk(KERN_INFO "ioremap failed\n");
-                return -1;
+                return -ENOMEM;
         }
 
-        viafb_get_mmio_info(&viaparinfo->mmio_base, &viaparinfo->mmio_len);
-        viaparinfo->io_virt = ioremap_nocache(viaparinfo->mmio_base,
-                viaparinfo->mmio_len);
-
+        viafbinfo->fix.mmio_start = pci_resource_start(pdev, 1);
+        viafbinfo->fix.mmio_len = pci_resource_len(pdev, 1);
         viafbinfo->node = 0;
         viafbinfo->fbops = &viafb_ops;
         viafbinfo->flags = FBINFO_DEFAULT | FBINFO_HWACCEL_YPAN;
 
         viafbinfo->pseudo_palette = pseudo_pal;
-        if (viafb_accel) {
-                viafb_init_accel();
-                viafb_init_2d_engine();
-                viafb_hw_cursor_init();
+        if (viafb_accel && !viafb_init_engine(viafbinfo)) {
+                viafbinfo->flags |= FBINFO_HWACCEL_COPYAREA |
+                        FBINFO_HWACCEL_FILLRECT |  FBINFO_HWACCEL_IMAGEBLIT;
+                default_var.accel_flags = FB_ACCELF_TEXT;
+        } else {
+                viafbinfo->flags |= FBINFO_HWACCEL_DISABLED;
+                default_var.accel_flags = 0;
         }
 
         if (viafb_second_size && (viafb_second_size < 8)) {
@@ -2186,27 +1924,14 @@ static int __devinit via_pci_probe(void)
                         viafb_second_size * 1024 * 1024;
         }
 
-        viafb_FB_MM = viaparinfo->fbmem_virt;
-        tmpm = viafb_mode;
-        tmpc = strsep(&tmpm, "x");
-        strict_strtoul(tmpc, 0, &default_xres);
-        strict_strtoul(tmpm, 0, &default_yres);
-
+        parse_mode(viafb_mode, &default_xres, &default_yres);
         vmode_index = viafb_get_mode_index(default_xres, default_yres);
         DEBUG_MSG(KERN_INFO "0->index=%d\n", vmode_index);
 
         if (viafb_SAMM_ON == 1) {
-                if (strcmp(viafb_mode, viafb_mode1)) {
-                        tmpm_sec = viafb_mode1;
-                        tmpc_sec = strsep(&tmpm_sec, "x");
-                        strict_strtoul(tmpc_sec, 0,
-                                (unsigned long *)&viafb_second_xres);
-                        strict_strtoul(tmpm_sec, 0,
-                                (unsigned long *)&viafb_second_yres);
-                } else {
-                        viafb_second_xres = default_xres;
-                        viafb_second_yres = default_yres;
-                }
+                parse_mode(viafb_mode1, &viafb_second_xres,
+                        &viafb_second_yres);
+
                 if (0 == viafb_second_virtual_xres) {
                         switch (viafb_second_xres) {
                         case 1400:
@@ -2256,18 +1981,9 @@ static int __devinit via_pci_probe(void)
         default_var.lower_margin = 4;
         default_var.hsync_len = default_var.left_margin;
         default_var.vsync_len = 4;
-        default_var.accel_flags = 0;
-
-        if (viafb_accel) {
-                viafbinfo->flags |=
-                    (FBINFO_HWACCEL_COPYAREA | FBINFO_HWACCEL_FILLRECT |
-                     FBINFO_HWACCEL_IMAGEBLIT);
-                default_var.accel_flags |= FB_ACCELF_TEXT;
-        } else
-                viafbinfo->flags |= FBINFO_HWACCEL_DISABLED;
 
         if (viafb_dual_fb) {
-                viafbinfo1 = framebuffer_alloc(viafb_par_length, NULL);
+                viafbinfo1 = framebuffer_alloc(viafb_par_length, &pdev->dev);
                 if (!viafbinfo1) {
                         printk(KERN_ERR
                         "allocate the second framebuffer struct error\n");
@@ -2276,11 +1992,10 @@ static int __devinit via_pci_probe(void)
                 }
                 viaparinfo1 = viafbinfo1->par;
                 memcpy(viaparinfo1, viaparinfo, viafb_par_length);
+                viaparinfo1->vram_addr = viafb_second_offset;
                 viaparinfo1->memsize = viaparinfo->memsize -
                         viafb_second_offset;
                 viaparinfo->memsize = viafb_second_offset;
-                viaparinfo1->fbmem_virt = viaparinfo->fbmem_virt +
-                        viafb_second_offset;
                 viaparinfo1->fbmem = viaparinfo->fbmem + viafb_second_offset;
 
                 viaparinfo1->fbmem_used = viaparinfo->fbmem_used;
@@ -2288,20 +2003,13 @@ static int __devinit via_pci_probe(void)
                         viaparinfo1->fbmem_used;
                 viaparinfo->fbmem_free = viaparinfo->memsize;
                 viaparinfo->fbmem_used = 0;
-                if (viafb_accel) {
-                        viaparinfo1->cursor_start =
-                            viaparinfo->cursor_start - viafb_second_offset;
-                        viaparinfo1->VQ_start = viaparinfo->VQ_start -
-                                viafb_second_offset;
-                        viaparinfo1->VQ_end = viaparinfo->VQ_end -
-                                viafb_second_offset;
-                }
 
+                viaparinfo->iga_path = IGA1;
+                viaparinfo1->iga_path = IGA2;
                 memcpy(viafbinfo1, viafbinfo, sizeof(struct fb_info));
+                viafbinfo1->par = viaparinfo1;
                 viafbinfo1->screen_base = viafbinfo->screen_base +
                         viafb_second_offset;
-                viafbinfo1->fix.smem_start = viaparinfo1->fbmem;
-                viafbinfo1->fix.smem_len = viaparinfo1->fbmem_free;
 
                 default_var.xres = viafb_second_xres;
                 default_var.yres = viafb_second_yres;
@@ -2323,15 +2031,17 @@ static int __devinit via_pci_probe(void)
                 viafb_setup_fixinfo(&viafbinfo1->fix, viaparinfo1);
                 viafb_check_var(&default_var, viafbinfo1);
                 viafbinfo1->var = default_var;
-                viafb_update_viafb_par(viafbinfo);
-                viafb_update_fix(&viafbinfo1->fix, viafbinfo1);
+                viafb_update_fix(viafbinfo1);
+                viaparinfo1->depth = fb_get_color_depth(&viafbinfo1->var,
+                        &viafbinfo1->fix);
         }
 
         viafb_setup_fixinfo(&viafbinfo->fix, viaparinfo);
         viafb_check_var(&default_var, viafbinfo);
         viafbinfo->var = default_var;
-        viafb_update_viafb_par(viafbinfo);
-        viafb_update_fix(&viafbinfo->fix, viafbinfo);
+        viafb_update_fix(viafbinfo);
+        viaparinfo->depth = fb_get_color_depth(&viafbinfo->var,
+                &viafbinfo->fix);
         default_var.activate = FB_ACTIVATE_NOW;
         fb_alloc_cmap(&viafbinfo->cmap, 256, 0);
 
@@ -2353,20 +2063,20 @@ static int __devinit via_pci_probe(void)
                   viafbinfo->node, viafbinfo->fix.id, default_var.xres,
                   default_var.yres, default_var.bits_per_pixel);
 
-        viafb_init_proc(&viaparinfo->proc_entry);
+        viafb_init_proc(&viaparinfo->shared->proc_entry);
         viafb_init_dac(IGA2);
         return 0;
 }
 
-static void __devexit via_pci_remove(void)
+static void __devexit via_pci_remove(struct pci_dev *pdev)
 {
         DEBUG_MSG(KERN_INFO "via_pci_remove!\n");
         fb_dealloc_cmap(&viafbinfo->cmap);
         unregister_framebuffer(viafbinfo);
         if (viafb_dual_fb)
                 unregister_framebuffer(viafbinfo1);
-        iounmap((void *)viaparinfo->fbmem_virt);
-        iounmap(viaparinfo->io_virt);
+        iounmap((void *)viafbinfo->screen_base);
+        iounmap(viaparinfo->shared->engine_mmio);
 
         viafb_delete_i2c_buss(viaparinfo);
 
@@ -2374,7 +2084,7 @@ static void __devexit via_pci_remove(void)
         if (viafb_dual_fb)
                 framebuffer_release(viafbinfo1);
 
-        viafb_remove_proc(viaparinfo->proc_entry);
+        viafb_remove_proc(viaparinfo->shared->proc_entry);
 }
 
 #ifndef MODULE
@@ -2441,8 +2151,6 @@ static int __init viafb_setup(char *options)
                 else if (!strncmp(this_opt, "viafb_lcd_mode=", 15))
                         strict_strtoul(this_opt + 15, 0,
                                 (unsigned long *)&viafb_lcd_mode);
-                else if (!strncmp(this_opt, "viafb_video_dev=", 16))
-                        viafb_video_dev = kstrdup(this_opt + 16, GFP_KERNEL);
                 else if (!strncmp(this_opt, "viafb_lcd_port=", 15))
                         viafb_lcd_port = kstrdup(this_opt + 15, GFP_KERNEL);
                 else if (!strncmp(this_opt, "viafb_dvi_port=", 15))
@@ -2452,6 +2160,40 @@ static int __init viafb_setup(char *options)
 }
 #endif
 
+static struct pci_device_id viafb_pci_table[] __devinitdata = {
+        { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_CLE266_DID),
+          .driver_data = UNICHROME_CLE266 },
+        { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_PM800_DID),
+          .driver_data = UNICHROME_PM800 },
+        { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_K400_DID),
+          .driver_data = UNICHROME_K400 },
+        { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_K800_DID),
+          .driver_data = UNICHROME_K800 },
+        { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_P4M890_DID),
+          .driver_data = UNICHROME_CN700 },
+        { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_K8M890_DID),
+          .driver_data = UNICHROME_K8M890 },
+        { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_CX700_DID),
+          .driver_data = UNICHROME_CX700 },
+        { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_P4M900_DID),
+          .driver_data = UNICHROME_P4M900 },
+        { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_CN750_DID),
+          .driver_data = UNICHROME_CN750 },
+        { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_VX800_DID),
+          .driver_data = UNICHROME_VX800 },
+        { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_VX855_DID),
+          .driver_data = UNICHROME_VX855 },
+        { }
+};
+MODULE_DEVICE_TABLE(pci, viafb_pci_table);
+
+static struct pci_driver viafb_driver = {
+        .name           = "viafb",
+        .id_table       = viafb_pci_table,
+        .probe          = via_pci_probe,
+        .remove         = __devexit_p(via_pci_remove),
+};
+
 static int __init viafb_init(void)
 {
 #ifndef MODULE
@@ -2463,13 +2205,13 @@ static int __init viafb_init(void)
         printk(KERN_INFO
        "VIA Graphics Intergration Chipset framebuffer %d.%d initializing\n",
                VERSION_MAJOR, VERSION_MINOR);
-        return via_pci_probe();
+        return pci_register_driver(&viafb_driver);
 }
 
 static void __exit viafb_exit(void)
 {
         DEBUG_MSG(KERN_INFO "viafb_exit!\n");
-        via_pci_remove();
+        pci_unregister_driver(&viafb_driver);
 }
 
 static struct fb_ops viafb_ops = {
@@ -2494,82 +2236,79 @@ module_init(viafb_init);
 module_exit(viafb_exit);
 
 #ifdef MODULE
-module_param(viafb_memsize, int, 0);
+module_param(viafb_memsize, int, S_IRUSR);
 
-module_param(viafb_mode, charp, 0);
+module_param(viafb_mode, charp, S_IRUSR);
 MODULE_PARM_DESC(viafb_mode, "Set resolution (default=640x480)");
 
-module_param(viafb_mode1, charp, 0);
+module_param(viafb_mode1, charp, S_IRUSR);
 MODULE_PARM_DESC(viafb_mode1, "Set resolution (default=640x480)");
 
-module_param(viafb_bpp, int, 0);
+module_param(viafb_bpp, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_bpp, "Set color depth (default=32bpp)");
 
-module_param(viafb_bpp1, int, 0);
+module_param(viafb_bpp1, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_bpp1, "Set color depth (default=32bpp)");
 
-module_param(viafb_refresh, int, 0);
+module_param(viafb_refresh, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_refresh,
         "Set CRT viafb_refresh rate (default = 60)");
 
-module_param(viafb_refresh1, int, 0);
+module_param(viafb_refresh1, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_refresh1,
         "Set CRT refresh rate (default = 60)");
 
-module_param(viafb_lcd_panel_id, int, 0);
+module_param(viafb_lcd_panel_id, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_lcd_panel_id,
         "Set Flat Panel type(Default=1024x768)");
 
-module_param(viafb_lcd_dsp_method, int, 0);
+module_param(viafb_lcd_dsp_method, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_lcd_dsp_method,
         "Set Flat Panel display scaling method.(Default=Expandsion)");
 
-module_param(viafb_SAMM_ON, int, 0);
+module_param(viafb_SAMM_ON, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_SAMM_ON,
         "Turn on/off flag of SAMM(Default=OFF)");
 
-module_param(viafb_accel, int, 0);
+module_param(viafb_accel, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_accel,
-        "Set 2D Hardware Acceleration.(Default = OFF)");
+        "Set 2D Hardware Acceleration: 0 = OFF, 1 = ON (default)");
 
-module_param(viafb_active_dev, charp, 0);
+module_param(viafb_active_dev, charp, S_IRUSR);
 MODULE_PARM_DESC(viafb_active_dev, "Specify active devices.");
 
-module_param(viafb_display_hardware_layout, int, 0);
+module_param(viafb_display_hardware_layout, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_display_hardware_layout,
         "Display Hardware Layout (LCD Only, DVI Only...,etc)");
 
-module_param(viafb_second_size, int, 0);
+module_param(viafb_second_size, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_second_size,
         "Set secondary device memory size");
 
-module_param(viafb_dual_fb, int, 0);
+module_param(viafb_dual_fb, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_dual_fb,
         "Turn on/off flag of dual framebuffer devices.(Default = OFF)");
 
-module_param(viafb_platform_epia_dvi, int, 0);
+module_param(viafb_platform_epia_dvi, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_platform_epia_dvi,
         "Turn on/off flag of DVI devices on EPIA board.(Default = OFF)");
 
-module_param(viafb_device_lcd_dualedge, int, 0);
+module_param(viafb_device_lcd_dualedge, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_device_lcd_dualedge,
         "Turn on/off flag of dual edge panel.(Default = OFF)");
 
-module_param(viafb_bus_width, int, 0);
+module_param(viafb_bus_width, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_bus_width,
         "Set bus width of panel.(Default = 12)");
 
-module_param(viafb_lcd_mode, int, 0);
+module_param(viafb_lcd_mode, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_lcd_mode,
         "Set Flat Panel mode(Default=OPENLDI)");
 
-module_param(viafb_video_dev, charp, 0);
-MODULE_PARM_DESC(viafb_video_dev, "Specify video devices.");
-
-module_param(viafb_lcd_port, charp, 0);
+module_param(viafb_lcd_port, charp, S_IRUSR);
 MODULE_PARM_DESC(viafb_lcd_port, "Specify LCD output port.");
 
-module_param(viafb_dvi_port, charp, 0);
+module_param(viafb_dvi_port, charp, S_IRUSR);
 MODULE_PARM_DESC(viafb_dvi_port, "Specify DVI output port.");
 
 MODULE_LICENSE("GPL");
diff --git a/drivers/video/via/viafbdev.h b/drivers/video/via/viafbdev.h
index 227b000feb38..0c94d2441922 100644
--- a/drivers/video/via/viafbdev.h
+++ b/drivers/video/via/viafbdev.h
@@ -37,51 +37,50 @@
 #define VERSION_OS          0   /* 0: for 32 bits OS, 1: for 64 bits OS */
 #define VERSION_MINOR       4
 
+struct viafb_shared {
+        struct proc_dir_entry *proc_entry;      /*viafb proc entry */
+
+        /* I2C stuff */
+        struct via_i2c_stuff i2c_stuff;
+
+        /* All the information will be needed to set engine */
+        struct tmds_setting_information tmds_setting_info;
+        struct crt_setting_information crt_setting_info;
+        struct lvds_setting_information lvds_setting_info;
+        struct lvds_setting_information lvds_setting_info2;
+        struct chip_information chip_info;
+
+        /* hardware acceleration stuff */
+        void __iomem *engine_mmio;
+        u32 cursor_vram_addr;
+        u32 vq_vram_addr;       /* virtual queue address in video ram */
+        int (*hw_bitblt)(void __iomem *engine, u8 op, u32 width, u32 height,
+                u8 dst_bpp, u32 dst_addr, u32 dst_pitch, u32 dst_x, u32 dst_y,
+                u32 *src_mem, u32 src_addr, u32 src_pitch, u32 src_x, u32 src_y,
+                u32 fg_color, u32 bg_color, u8 fill_rop);
+};
+
 struct viafb_par {
-        int bpp;
-        int hres;
-        int vres;
-        int linelength;
-        u32 xoffset;
-        u32 yoffset;
-
-        void __iomem *fbmem_virt;       /*framebuffer virtual memory address */
-        void __iomem *io_virt;  /*iospace virtual memory address */
+        u8 depth;
+        u32 vram_addr;
+
         unsigned int fbmem;     /*framebuffer physical memory address */
         unsigned int memsize;   /*size of fbmem */
-        unsigned int io;        /*io space address */
-        unsigned long mmio_base;        /*mmio base address */
-        unsigned long mmio_len; /*mmio base length */
         u32 fbmem_free;         /* Free FB memory */
         u32 fbmem_used;         /* Use FB memory size */
-        u32 cursor_start;       /* Cursor Start Address */
-        u32 VQ_start;           /* Virtual Queue Start Address */
-        u32 VQ_end;             /* Virtual Queue End Address */
         u32 iga_path;
-        struct proc_dir_entry *proc_entry;      /*viafb proc entry */
-        u8 duoview;             /*Is working in duoview mode? */
 
-        /* I2C stuff */
-        struct via_i2c_stuff i2c_stuff;
+        struct viafb_shared *shared;
 
         /* All the information will be needed to set engine */
+        /* depreciated, use the ones in shared directly */
         struct tmds_setting_information *tmds_setting_info;
         struct crt_setting_information *crt_setting_info;
         struct lvds_setting_information *lvds_setting_info;
         struct lvds_setting_information *lvds_setting_info2;
         struct chip_information *chip_info;
-
-        /* some information related to video playing */
-        int video_on_crt;
-        int video_on_dvi;
-        int video_on_lcd;
-
-};
-struct viafb_modeinfo {
-        u32 xres;
-        u32 yres;
-        int mode_index;
 };
+
 extern unsigned int viafb_second_virtual_yres;
 extern unsigned int viafb_second_virtual_xres;
 extern unsigned int viafb_second_offset;
@@ -91,14 +90,12 @@ extern int viafb_dual_fb;
 extern int viafb_LCD2_ON;
 extern int viafb_LCD_ON;
 extern int viafb_DVI_ON;
-extern int viafb_accel;
 extern int viafb_hotplug;
 extern int viafb_memsize;
 
 extern int strict_strtoul(const char *cp, unsigned int base,
         unsigned long *res);
 
-void viafb_memory_pitch_patch(struct fb_info *info);
 void viafb_fill_var_timing_info(struct fb_var_screeninfo *var, int refresh,
                           int mode_index);
 int viafb_get_mode_index(int hres, int vres);
diff --git a/drivers/video/via/viamode.c b/drivers/video/via/viamode.c
index 6dcf583a837d..b74f8a67923c 100644
--- a/drivers/video/via/viamode.c
+++ b/drivers/video/via/viamode.c
@@ -100,12 +100,8 @@ struct io_reg CN400_ModeXregs[] = { {VIASR, SR10, 0xFF, 0x01},
 {VIACR, CR0F, 0xFF, 0x00},      /* Cursor Localtion Low                */
 {VIACR, CR32, 0xFF, 0x00},
 {VIACR, CR33, 0xFF, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
 {VIACR, CR35, 0xFF, 0x00},
 {VIACR, CR36, 0x08, 0x00},
-{VIACR, CR62, 0xFF, 0x00},      /* Secondary Display Starting Address  */
-{VIACR, CR63, 0xFF, 0x00},      /* Secondary Display Starting Address  */
-{VIACR, CR64, 0xFF, 0x00},      /* Secondary Display Starting Address  */
 {VIACR, CR69, 0xFF, 0x00},
 {VIACR, CR6A, 0xFF, 0x40},
 {VIACR, CR6B, 0xFF, 0x00},
@@ -159,16 +155,12 @@ struct io_reg CN700_ModeXregs[] = { {VIASR, SR10, 0xFF, 0x01},
 {VIASR, CR30, 0xFF, 0x04},
 {VIACR, CR32, 0xFF, 0x00},
 {VIACR, CR33, 0x7F, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
 {VIACR, CR35, 0xFF, 0x00},
 {VIACR, CR36, 0xFF, 0x31},
 {VIACR, CR41, 0xFF, 0x80},
 {VIACR, CR42, 0xFF, 0x00},
 {VIACR, CR55, 0x80, 0x00},
 {VIACR, CR5D, 0x80, 0x00},      /*Horizontal Retrace Start bit[11] should be 0*/
-{VIACR, CR62, 0xFF, 0x00},      /* Secondary Display Starting Address */
-{VIACR, CR63, 0xFF, 0x00},      /* Secondary Display Starting Address */
-{VIACR, CR64, 0xFF, 0x00},      /* Secondary Display Starting Address */
 {VIACR, CR68, 0xFF, 0x67},      /* Default FIFO For IGA2 */
 {VIACR, CR69, 0xFF, 0x00},
 {VIACR, CR6A, 0xFD, 0x40},
@@ -233,9 +225,6 @@ struct io_reg KM400_ModeXregs[] = {
         {VIACR, CR55, 0x80, 0x00},
         {VIACR, CR5D, 0x80, 0x00},
         {VIACR, CR36, 0xFF, 0x01},      /* Power Mangement 3                  */
-        {VIACR, CR62, 0xFF, 0x00},      /* Secondary Display Starting Address */
-        {VIACR, CR63, 0xFF, 0x00},      /* Secondary Display Starting Address */
-        {VIACR, CR64, 0xFF, 0x00},      /* Secondary Display Starting Address */
         {VIACR, CR68, 0xFF, 0x67},      /* Default FIFO For IGA2              */
         {VIACR, CR6A, 0x20, 0x20},      /* Extended FIFO On                   */
         {VIACR, CR7A, 0xFF, 0x01},      /* LCD Scaling Parameter 1            */
@@ -285,14 +274,9 @@ struct io_reg CX700_ModeXregs[] = { {VIASR, SR10, 0xFF, 0x01},
 {VIACR, CR0F, 0xFF, 0x00},      /* Cursor Localtion Low                */
 {VIACR, CR32, 0xFF, 0x00},
 {VIACR, CR33, 0xFF, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
 {VIACR, CR35, 0xFF, 0x00},
 {VIACR, CR36, 0x08, 0x00},
 {VIACR, CR47, 0xC8, 0x00},      /* Clear VCK Plus. */
-{VIACR, CR62, 0xFF, 0x00},      /* Secondary Display Starting Address  */
-{VIACR, CR63, 0xFF, 0x00},      /* Secondary Display Starting Address  */
-{VIACR, CR64, 0xFF, 0x00},      /* Secondary Display Starting Address  */
-{VIACR, CRA3, 0xFF, 0x00},      /* Secondary Display Starting Address  */
 {VIACR, CR69, 0xFF, 0x00},
 {VIACR, CR6A, 0xFF, 0x40},
 {VIACR, CR6B, 0xFF, 0x00},
@@ -325,69 +309,61 @@ struct io_reg CX700_ModeXregs[] = { {VIASR, SR10, 0xFF, 0x01},
 {VIACR, CR96, 0xFF, 0x00},
 {VIACR, CR97, 0xFF, 0x00},
 {VIACR, CR99, 0xFF, 0x00},
-{VIACR, CR9B, 0xFF, 0x00},
-{VIACR, CRD2, 0xFF, 0xFF}       /* TMDS/LVDS control register.         */
+{VIACR, CR9B, 0xFF, 0x00}
 };
 
-/* For VT3353: Common Setting for Video Mode */
-struct io_reg VX800_ModeXregs[] = { {VIASR, SR10, 0xFF, 0x01},
+struct io_reg VX855_ModeXregs[] = {
+{VIASR, SR10, 0xFF, 0x01},
 {VIASR, SR15, 0x02, 0x02},
 {VIASR, SR16, 0xBF, 0x08},
 {VIASR, SR17, 0xFF, 0x1F},
 {VIASR, SR18, 0xFF, 0x4E},
 {VIASR, SR1A, 0xFB, 0x08},
 {VIASR, SR1B, 0xFF, 0xF0},
-{VIASR, SR1E, 0xFF, 0x01},
-{VIASR, SR2A, 0xFF, 0x00},
+{VIASR, SR1E, 0x07, 0x01},
+{VIASR, SR2A, 0xF0, 0x00},
+{VIASR, SR58, 0xFF, 0x00},
+{VIASR, SR59, 0xFF, 0x00},
 {VIASR, SR2D, 0xFF, 0xFF},      /* VCK and LCK PLL power on.           */
+{VIACR, CR09, 0xFF, 0x00},      /* Initial CR09=0*/
+{VIACR, CR11, 0x8F, 0x00},      /* IGA1 initial  Vertical end       */
+{VIACR, CR17, 0x7F, 0x00},      /* IGA1 CRT Mode control init   */
 {VIACR, CR0A, 0xFF, 0x1E},      /* Cursor Start                        */
 {VIACR, CR0B, 0xFF, 0x00},      /* Cursor End                          */
 {VIACR, CR0E, 0xFF, 0x00},      /* Cursor Location High                */
 {VIACR, CR0F, 0xFF, 0x00},      /* Cursor Localtion Low                */
 {VIACR, CR32, 0xFF, 0x00},
-{VIACR, CR33, 0xFF, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
+{VIACR, CR33, 0x7F, 0x00},
 {VIACR, CR35, 0xFF, 0x00},
 {VIACR, CR36, 0x08, 0x00},
-{VIACR, CR47, 0xC8, 0x00},      /* Clear VCK Plus. */
-{VIACR, CR62, 0xFF, 0x00},      /* Secondary Display Starting Address  */
-{VIACR, CR63, 0xFF, 0x00},      /* Secondary Display Starting Address  */
-{VIACR, CR64, 0xFF, 0x00},      /* Secondary Display Starting Address  */
-{VIACR, CRA3, 0xFF, 0x00},      /* Secondary Display Starting Address  */
 {VIACR, CR69, 0xFF, 0x00},
-{VIACR, CR6A, 0xFF, 0x40},
+{VIACR, CR6A, 0xFD, 0x60},
 {VIACR, CR6B, 0xFF, 0x00},
 {VIACR, CR6C, 0xFF, 0x00},
-{VIACR, CR7A, 0xFF, 0x01},      /* LCD Scaling Parameter 1             */
-{VIACR, CR7B, 0xFF, 0x02},      /* LCD Scaling Parameter 2             */
-{VIACR, CR7C, 0xFF, 0x03},      /* LCD Scaling Parameter 3             */
-{VIACR, CR7D, 0xFF, 0x04},      /* LCD Scaling Parameter 4             */
-{VIACR, CR7E, 0xFF, 0x07},      /* LCD Scaling Parameter 5             */
-{VIACR, CR7F, 0xFF, 0x0A},      /* LCD Scaling Parameter 6             */
-{VIACR, CR80, 0xFF, 0x0D},      /* LCD Scaling Parameter 7             */
-{VIACR, CR81, 0xFF, 0x13},      /* LCD Scaling Parameter 8             */
-{VIACR, CR82, 0xFF, 0x16},      /* LCD Scaling Parameter 9             */
-{VIACR, CR83, 0xFF, 0x19},      /* LCD Scaling Parameter 10            */
-{VIACR, CR84, 0xFF, 0x1C},      /* LCD Scaling Parameter 11            */
-{VIACR, CR85, 0xFF, 0x1D},      /* LCD Scaling Parameter 12            */
-{VIACR, CR86, 0xFF, 0x1E},      /* LCD Scaling Parameter 13            */
-{VIACR, CR87, 0xFF, 0x1F},      /* LCD Scaling Parameter 14            */
-{VIACR, CR88, 0xFF, 0x40},      /* LCD Panel Type                      */
-{VIACR, CR89, 0xFF, 0x00},      /* LCD Timing Control 0                */
-{VIACR, CR8A, 0xFF, 0x88},      /* LCD Timing Control 1                */
-{VIACR, CRD4, 0xFF, 0x81},      /* Second power sequence control       */
-{VIACR, CR8B, 0xFF, 0x5D},      /* LCD Power Sequence Control 0        */
-{VIACR, CR8C, 0xFF, 0x2B},      /* LCD Power Sequence Control 1        */
-{VIACR, CR8D, 0xFF, 0x6F},      /* LCD Power Sequence Control 2        */
-{VIACR, CR8E, 0xFF, 0x2B},      /* LCD Power Sequence Control 3        */
-{VIACR, CR8F, 0xFF, 0x01},      /* LCD Power Sequence Control 4        */
-{VIACR, CR90, 0xFF, 0x01},      /* LCD Power Sequence Control 5        */
-{VIACR, CR91, 0xFF, 0x80},      /* 24/12 bit LVDS Data off             */
+{VIACR, CR7A, 0xFF, 0x01},          /* LCD Scaling Parameter 1             */
+{VIACR, CR7B, 0xFF, 0x02},          /* LCD Scaling Parameter 2             */
+{VIACR, CR7C, 0xFF, 0x03},          /* LCD Scaling Parameter 3             */
+{VIACR, CR7D, 0xFF, 0x04},          /* LCD Scaling Parameter 4             */
+{VIACR, CR7E, 0xFF, 0x07},          /* LCD Scaling Parameter 5             */
+{VIACR, CR7F, 0xFF, 0x0A},          /* LCD Scaling Parameter 6             */
+{VIACR, CR80, 0xFF, 0x0D},          /* LCD Scaling Parameter 7             */
+{VIACR, CR81, 0xFF, 0x13},          /* LCD Scaling Parameter 8             */
+{VIACR, CR82, 0xFF, 0x16},          /* LCD Scaling Parameter 9             */
+{VIACR, CR83, 0xFF, 0x19},          /* LCD Scaling Parameter 10            */
+{VIACR, CR84, 0xFF, 0x1C},          /* LCD Scaling Parameter 11            */
+{VIACR, CR85, 0xFF, 0x1D},          /* LCD Scaling Parameter 12            */
+{VIACR, CR86, 0xFF, 0x1E},          /* LCD Scaling Parameter 13            */
+{VIACR, CR87, 0xFF, 0x1F},          /* LCD Scaling Parameter 14            */
+{VIACR, CR88, 0xFF, 0x40},          /* LCD Panel Type                      */
+{VIACR, CR89, 0xFF, 0x00},          /* LCD Timing Control 0                */
+{VIACR, CR8A, 0xFF, 0x88},          /* LCD Timing Control 1                */
+{VIACR, CRD4, 0xFF, 0x81},          /* Second power sequence control       */
+{VIACR, CR91, 0xFF, 0x80},          /* 24/12 bit LVDS Data off             */
 {VIACR, CR96, 0xFF, 0x00},
 {VIACR, CR97, 0xFF, 0x00},
 {VIACR, CR99, 0xFF, 0x00},
 {VIACR, CR9B, 0xFF, 0x00},
-{VIACR, CRD2, 0xFF, 0xFF}       /* TMDS/LVDS control register.         */
+{VIACR, CRD2, 0xFF, 0xFF}           /* TMDS/LVDS control register.         */
 };
 
 /* Video Mode Table */
@@ -401,7 +377,6 @@ struct io_reg CLE266_ModeXregs[] = { {VIASR, SR1E, 0xF0, 0x00},
 {VIASR, SR1A, 0xFB, 0x08},
 
 {VIACR, CR32, 0xFF, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
 {VIACR, CR35, 0xFF, 0x00},
 {VIACR, CR36, 0x08, 0x00},
 {VIACR, CR6A, 0xFF, 0x80},
@@ -1084,3 +1059,14 @@ struct VideoModeTable CEA_HDMI_Modes[] = {
         {VIA_RES_1280X720, CEAM1280x720, ARRAY_SIZE(CEAM1280x720)},
         {VIA_RES_1920X1080, CEAM1920x1080, ARRAY_SIZE(CEAM1920x1080)}
 };
+
+int NUM_TOTAL_RES_MAP_REFRESH = ARRAY_SIZE(res_map_refresh_tbl);
+int NUM_TOTAL_CEA_MODES = ARRAY_SIZE(CEA_HDMI_Modes);
+int NUM_TOTAL_CN400_ModeXregs = ARRAY_SIZE(CN400_ModeXregs);
+int NUM_TOTAL_CN700_ModeXregs = ARRAY_SIZE(CN700_ModeXregs);
+int NUM_TOTAL_KM400_ModeXregs = ARRAY_SIZE(KM400_ModeXregs);
+int NUM_TOTAL_CX700_ModeXregs = ARRAY_SIZE(CX700_ModeXregs);
+int NUM_TOTAL_VX855_ModeXregs = ARRAY_SIZE(VX855_ModeXregs);
+int NUM_TOTAL_CLE266_ModeXregs = ARRAY_SIZE(CLE266_ModeXregs);
+int NUM_TOTAL_PATCH_MODE = ARRAY_SIZE(res_patch_table);
+int NUM_TOTAL_MODETABLE = ARRAY_SIZE(CLE266Modes);
diff --git a/drivers/video/via/viamode.h b/drivers/video/via/viamode.h
index 1a5de50a23a2..a9d6554fabdf 100644
--- a/drivers/video/via/viamode.h
+++ b/drivers/video/via/viamode.h
@@ -50,128 +50,35 @@ struct res_map_refresh {
         int vmode_refresh;
 };
 
-#define NUM_TOTAL_RES_MAP_REFRESH ARRAY_SIZE(res_map_refresh_tbl)
-#define NUM_TOTAL_CEA_MODES  ARRAY_SIZE(CEA_HDMI_Modes)
-#define NUM_TOTAL_CN400_ModeXregs ARRAY_SIZE(CN400_ModeXregs)
-#define NUM_TOTAL_CN700_ModeXregs ARRAY_SIZE(CN700_ModeXregs)
-#define NUM_TOTAL_KM400_ModeXregs ARRAY_SIZE(KM400_ModeXregs)
-#define NUM_TOTAL_CX700_ModeXregs ARRAY_SIZE(CX700_ModeXregs)
-#define NUM_TOTAL_VX800_ModeXregs ARRAY_SIZE(VX800_ModeXregs)
-#define NUM_TOTAL_CLE266_ModeXregs ARRAY_SIZE(CLE266_ModeXregs)
-#define NUM_TOTAL_PATCH_MODE ARRAY_SIZE(res_patch_table)
-#define NUM_TOTAL_MODETABLE ARRAY_SIZE(CLE266Modes)
+extern int NUM_TOTAL_RES_MAP_REFRESH;
+extern int NUM_TOTAL_CEA_MODES;
+extern int NUM_TOTAL_CN400_ModeXregs;
+extern int NUM_TOTAL_CN700_ModeXregs;
+extern int NUM_TOTAL_KM400_ModeXregs;
+extern int NUM_TOTAL_CX700_ModeXregs;
+extern int NUM_TOTAL_VX855_ModeXregs;
+extern int NUM_TOTAL_CLE266_ModeXregs;
+extern int NUM_TOTAL_PATCH_MODE;
+extern int NUM_TOTAL_MODETABLE;
 
 /********************/
 /* Mode Table       */
 /********************/
 
-/* 480x640 */
-extern struct crt_mode_table CRTM480x640[1];
-/* 640x480*/
-extern struct crt_mode_table CRTM640x480[5];
-/*720x480 (GTF)*/
-extern struct crt_mode_table CRTM720x480[1];
-/*720x576 (GTF)*/
-extern struct crt_mode_table CRTM720x576[1];
-/* 800x480 (CVT) */
-extern struct crt_mode_table CRTM800x480[1];
-/* 800x600*/
-extern struct crt_mode_table CRTM800x600[5];
-/* 848x480 (CVT) */
-extern struct crt_mode_table CRTM848x480[1];
-/*856x480 (GTF) convert to 852x480*/
-extern struct crt_mode_table CRTM852x480[1];
-/*1024x512 (GTF)*/
-extern struct crt_mode_table CRTM1024x512[1];
-/* 1024x600*/
-extern struct crt_mode_table CRTM1024x600[1];
-/* 1024x768*/
-extern struct crt_mode_table CRTM1024x768[4];
-/* 1152x864*/
-extern struct crt_mode_table CRTM1152x864[1];
-/* 1280x720 (HDMI 720P)*/
-extern struct crt_mode_table CRTM1280x720[2];
-/*1280x768 (GTF)*/
-extern struct crt_mode_table CRTM1280x768[2];
-/* 1280x800 (CVT) */
-extern struct crt_mode_table CRTM1280x800[1];
-/*1280x960*/
-extern struct crt_mode_table CRTM1280x960[1];
-/* 1280x1024*/
-extern struct crt_mode_table CRTM1280x1024[3];
-/* 1368x768 (GTF) */
-extern struct crt_mode_table CRTM1368x768[1];
-/*1440x1050 (GTF)*/
-extern struct crt_mode_table CRTM1440x1050[1];
-/* 1600x1200*/
-extern struct crt_mode_table CRTM1600x1200[2];
-/* 1680x1050 (CVT) */
-extern struct crt_mode_table CRTM1680x1050[2];
-/* 1680x1050 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1680x1050_RB[1];
-/* 1920x1080 (CVT)*/
-extern struct crt_mode_table CRTM1920x1080[1];
-/* 1920x1080 (CVT with Reduce Blanking) */
-extern struct crt_mode_table CRTM1920x1080_RB[1];
-/* 1920x1440*/
-extern struct crt_mode_table CRTM1920x1440[2];
-/* 1400x1050 (CVT) */
-extern struct crt_mode_table CRTM1400x1050[2];
-/* 1400x1050 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1400x1050_RB[1];
-/* 960x600 (CVT) */
-extern struct crt_mode_table CRTM960x600[1];
-/* 1000x600 (GTF) */
-extern struct crt_mode_table CRTM1000x600[1];
-/* 1024x576 (GTF) */
-extern struct crt_mode_table CRTM1024x576[1];
-/* 1088x612 (CVT) */
-extern struct crt_mode_table CRTM1088x612[1];
-/* 1152x720 (CVT) */
-extern struct crt_mode_table CRTM1152x720[1];
-/* 1200x720 (GTF) */
-extern struct crt_mode_table CRTM1200x720[1];
-/* 1280x600 (GTF) */
-extern struct crt_mode_table CRTM1280x600[1];
-/* 1360x768 (CVT) */
-extern struct crt_mode_table CRTM1360x768[1];
-/* 1360x768 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1360x768_RB[1];
-/* 1366x768 (GTF) */
-extern struct crt_mode_table CRTM1366x768[2];
-/* 1440x900 (CVT) */
-extern struct crt_mode_table CRTM1440x900[2];
-/* 1440x900 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1440x900_RB[1];
-/* 1600x900 (CVT) */
-extern struct crt_mode_table CRTM1600x900[1];
-/* 1600x900 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1600x900_RB[1];
-/* 1600x1024 (GTF) */
-extern struct crt_mode_table CRTM1600x1024[1];
-/* 1792x1344 (DMT) */
-extern struct crt_mode_table CRTM1792x1344[1];
-/* 1856x1392 (DMT) */
-extern struct crt_mode_table CRTM1856x1392[1];
-/* 1920x1200 (CVT) */
-extern struct crt_mode_table CRTM1920x1200[1];
-/* 1920x1200 (CVT with Reduce Blanking) */
-extern struct crt_mode_table CRTM1920x1200_RB[1];
-/* 2048x1536 (CVT) */
-extern struct crt_mode_table CRTM2048x1536[1];
-extern struct VideoModeTable CLE266Modes[47];
-extern struct crt_mode_table CEAM1280x720[1];
-extern struct crt_mode_table CEAM1920x1080[1];
-extern struct VideoModeTable CEA_HDMI_Modes[2];
+extern struct VideoModeTable CLE266Modes[];
+extern struct crt_mode_table CEAM1280x720[];
+extern struct crt_mode_table CEAM1920x1080[];
+extern struct VideoModeTable CEA_HDMI_Modes[];
 
-extern struct res_map_refresh res_map_refresh_tbl[61];
-extern struct io_reg CN400_ModeXregs[52];
-extern struct io_reg CN700_ModeXregs[66];
-extern struct io_reg KM400_ModeXregs[55];
-extern struct io_reg CX700_ModeXregs[58];
-extern struct io_reg VX800_ModeXregs[58];
-extern struct io_reg CLE266_ModeXregs[32];
-extern struct io_reg PM1024x768[2];
-extern struct patch_table res_patch_table[1];
+extern struct res_map_refresh res_map_refresh_tbl[];
+extern struct io_reg CN400_ModeXregs[];
+extern struct io_reg CN700_ModeXregs[];
+extern struct io_reg KM400_ModeXregs[];
+extern struct io_reg CX700_ModeXregs[];
+extern struct io_reg VX800_ModeXregs[];
+extern struct io_reg VX855_ModeXregs[];
+extern struct io_reg CLE266_ModeXregs[];
+extern struct io_reg PM1024x768[];
+extern struct patch_table res_patch_table[];
 extern struct VPITTable VPIT;
 #endif /* __VIAMODE_H__ */
diff --git a/drivers/video/via/vt1636.c b/drivers/video/via/vt1636.c
index 322a9f993550..a6b37494e79a 100644
--- a/drivers/video/via/vt1636.c
+++ b/drivers/video/via/vt1636.c
@@ -27,7 +27,7 @@ u8 viafb_gpio_i2c_read_lvds(struct lvds_setting_information
 {
         u8 data;
 
-        viaparinfo->i2c_stuff.i2c_port = plvds_chip_info->i2c_port;
+        viaparinfo->shared->i2c_stuff.i2c_port = plvds_chip_info->i2c_port;
         viafb_i2c_readbyte(plvds_chip_info->lvds_chip_slave_addr, index, &data);
 
         return data;
@@ -39,7 +39,7 @@ void viafb_gpio_i2c_write_mask_lvds(struct lvds_setting_information
 {
         int index, data;
 
-        viaparinfo->i2c_stuff.i2c_port = plvds_chip_info->i2c_port;
+        viaparinfo->shared->i2c_stuff.i2c_port = plvds_chip_info->i2c_port;
 
         index = io_data.Index;
         data = viafb_gpio_i2c_read_lvds(plvds_setting_info, plvds_chip_info,