aboutsummaryrefslogtreecommitdiffstats
path: root/tools/perf/util
Commit message (Collapse)AuthorAge
...
| * | | | perf stat: Support JSON metrics in perf statAndi Kleen2017-09-13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Add generic support for standalone metrics specified in JSON files to perf stat. A metric is a formula that uses multiple events to compute a higher level result (e.g. IPC). Previously metrics were always tied to an event and automatically enabled with that event. But now change it that we can have standalone metrics. They are in the same JSON data structure as events, but don't have an event name. We also allow to organize the metrics in metric groups, which allows a short cut to select several related metrics at once. Add a new -M / --metrics option to perf stat that adds the metrics or metric groups specified. Add the core code to manage and parse the metric groups. They are collected from the JSON data structures into a separate rblist. When computing shadow values look for metrics in that list. Then they are computed using the existing saved values infrastructure in stat-shadow.c The actual JSON metrics are in a separate pull request. % perf stat -M Summary --metric-only -a sleep 1 Performance counter stats for 'system wide': Instructions CLKS CPU_Utilization GFLOPs SMT_2T_Utilization Kernel_Utilization 317614222.0 1392930775.0 0.0 0.0 0.2 0.1 1.001497549 seconds time elapsed % perf stat -M GFLOPs flops Performance counter stats for 'flops': 3,999,541,471 fp_comp_ops_exe.sse_scalar_single # 1.2 GFLOPs (66.65%) 14 fp_comp_ops_exe.sse_scalar_double (66.65%) 0 fp_comp_ops_exe.sse_packed_double (66.67%) 0 fp_comp_ops_exe.sse_packed_single (66.70%) 0 simd_fp_256.packed_double (66.70%) 0 simd_fp_256.packed_single (66.67%) 0 duration_time 3.238372845 seconds time elapsed v2: Add missing header file v3: Move find_map to pmu.c Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Link: http://lkml.kernel.org/r/20170831194036.30146-7-andi@firstfloor.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
| * | | | perf pmu: Extract function to get JSON alias mapAndi Kleen2017-09-13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Extract the code to get the per cpu JSON alias into a separate function for reuse. No behavior changes. Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Link: http://lkml.kernel.org/r/20170831194036.30146-6-andi@firstfloor.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
| * | | | perf stat: Print generic metric header even for failed expressionsAndi Kleen2017-09-13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Print the generic metric header even when the expression evaluation failed. Otherwise an expression that fails on the first collections due to division by zero may suddenly reappear later without an header. Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Link: http://lkml.kernel.org/r/20170831194036.30146-5-andi@firstfloor.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
| * | | | perf stat: Factor out generic metric printingAndi Kleen2017-09-13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The 'perf stat' shadow metric printing already supports generic metrics. Factor out the code doing that into a separate function that can be re-used in a later patch. No behavior changes. v2: Fix indentation Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Link: http://lkml.kernel.org/r/20170831194036.30146-4-andi@firstfloor.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
| * | | | perf tools: Support weak groups in 'perf stat'Andi Kleen2017-09-13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Setting up groups can be complicated due to the complicated scheduling restrictions of different PMUs. User tools usually don't understand all these restrictions. Still in many cases it is useful to set up groups and they work most of the time. However if the group is set up wrong some members will not report any value because they never get scheduled. Add a concept of a 'weak group': try to set up a group, but if it's not schedulable fallback to not using a group. That gives us the best of both worlds: groups if they work, but still a usable fallback if they don't. In theory it would be possible to have more complex fallback strategies (e.g. try to split the group in half), but the simple fallback of not using a group seems to work for now. So far the weak group is only implemented for perf stat, not for record. Here's an unschedulable group (on IvyBridge with SMT on) % perf stat -e '{branches,branch-misses,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}' -a sleep 1 73,806,067 branches 4,848,144 branch-misses # 6.57% of all branches 14,754,458 l1d.replacement 24,905,558 l2_lines_in.all <not supported> l2_rqsts.all_code_rd <------- will never report anything With the weak group: % perf stat -e '{branches,branch-misses,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}:W' -a sleep 1 125,366,055 branches (80.02%) 9,208,402 branch-misses # 7.35% of all branches (80.01%) 24,560,249 l1d.replacement (80.00%) 43,174,971 l2_lines_in.all (80.05%) 31,891,457 l2_rqsts.all_code_rd (79.92%) The extra event scheduled with some extra multiplexing v2: Move fallback code to separate function. Add comment on for_each_group_member Adjust to new perf_evsel__close interface v3: Fix debug print out. Committer testing: Before: # perf stat -e '{branches,branch-misses,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}' -a sleep 1 Performance counter stats for 'system wide': <not counted> branches <not counted> branch-misses <not counted> l1d.replacement <not counted> l2_lines_in.all <not supported> l2_rqsts.all_code_rd 1.002147212 seconds time elapsed # perf stat -e '{branches,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}' -a sleep 1 Performance counter stats for 'system wide': 83,207,892 branches 11,065,444 l1d.replacement 28,484,024 l2_lines_in.all 12,186,179 l2_rqsts.all_code_rd 1.001739493 seconds time elapsed After: # perf stat -e '{branches,branch-misses,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}':W -a sleep 1 Performance counter stats for 'system wide': 543,323,909 branches (80.01%) 27,100,512 branch-misses # 4.99% of all branches (80.02%) 50,402,905 l1d.replacement (80.03%) 67,385,892 l2_lines_in.all (80.01%) 21,352,885 l2_rqsts.all_code_rd (79.94%) 1.001086658 seconds time elapsed # Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Link: http://lkml.kernel.org/r/20170831194036.30146-2-andi@firstfloor.org [ Add a "'perf stat' only, for now" comment in the man page, suggested by Jiri ] Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | | | | Merge branch 'locking-core-for-linus' of ↵Linus Torvalds2017-11-13
|\ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip Pull core locking updates from Ingo Molnar: "The main changes in this cycle are: - Another attempt at enabling cross-release lockdep dependency tracking (automatically part of CONFIG_PROVE_LOCKING=y), this time with better performance and fewer false positives. (Byungchul Park) - Introduce lockdep_assert_irqs_enabled()/disabled() and convert open-coded equivalents to lockdep variants. (Frederic Weisbecker) - Add down_read_killable() and use it in the VFS's iterate_dir() method. (Kirill Tkhai) - Convert remaining uses of ACCESS_ONCE() to READ_ONCE()/WRITE_ONCE(). Most of the conversion was Coccinelle driven. (Mark Rutland, Paul E. McKenney) - Get rid of lockless_dereference(), by strengthening Alpha atomics, strengthening READ_ONCE() with smp_read_barrier_depends() and thus being able to convert users of lockless_dereference() to READ_ONCE(). (Will Deacon) - Various micro-optimizations: - better PV qspinlocks (Waiman Long), - better x86 barriers (Michael S. Tsirkin) - better x86 refcounts (Kees Cook) - ... plus other fixes and enhancements. (Borislav Petkov, Juergen Gross, Miguel Bernal Marin)" * 'locking-core-for-linus' of git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip: (70 commits) locking/x86: Use LOCK ADD for smp_mb() instead of MFENCE rcu: Use lockdep to assert IRQs are disabled/enabled netpoll: Use lockdep to assert IRQs are disabled/enabled timers/posix-cpu-timers: Use lockdep to assert IRQs are disabled/enabled sched/clock, sched/cputime: Use lockdep to assert IRQs are disabled/enabled irq_work: Use lockdep to assert IRQs are disabled/enabled irq/timings: Use lockdep to assert IRQs are disabled/enabled perf/core: Use lockdep to assert IRQs are disabled/enabled x86: Use lockdep to assert IRQs are disabled/enabled smp/core: Use lockdep to assert IRQs are disabled/enabled timers/hrtimer: Use lockdep to assert IRQs are disabled/enabled timers/nohz: Use lockdep to assert IRQs are disabled/enabled workqueue: Use lockdep to assert IRQs are disabled/enabled irq/softirqs: Use lockdep to assert IRQs are disabled/enabled locking/lockdep: Add IRQs disabled/enabled assertion APIs: lockdep_assert_irqs_enabled()/disabled() locking/pvqspinlock: Implement hybrid PV queued/unfair locks locking/rwlocks: Fix comments x86/paravirt: Set up the virt_spin_lock_key after static keys get initialized block, locking/lockdep: Assign a lock_class per gendisk used for wait_for_completion() workqueue: Remove now redundant lock acquisitions wrt. workqueue flushes ...
| * \ \ \ \ Merge branch 'linus' into locking/core, to resolve conflictsIngo Molnar2017-11-07
| |\ \ \ \ \ | | | |_|_|/ | | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Conflicts: include/linux/compiler-clang.h include/linux/compiler-gcc.h include/linux/compiler-intel.h include/uapi/linux/stddef.h Signed-off-by: Ingo Molnar <mingo@kernel.org>
| * | | | | locking/atomics: COCCINELLE/treewide: Convert trivial ACCESS_ONCE() patterns ↵Mark Rutland2017-10-25
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | to READ_ONCE()/WRITE_ONCE() Please do not apply this to mainline directly, instead please re-run the coccinelle script shown below and apply its output. For several reasons, it is desirable to use {READ,WRITE}_ONCE() in preference to ACCESS_ONCE(), and new code is expected to use one of the former. So far, there's been no reason to change most existing uses of ACCESS_ONCE(), as these aren't harmful, and changing them results in churn. However, for some features, the read/write distinction is critical to correct operation. To distinguish these cases, separate read/write accessors must be used. This patch migrates (most) remaining ACCESS_ONCE() instances to {READ,WRITE}_ONCE(), using the following coccinelle script: ---- // Convert trivial ACCESS_ONCE() uses to equivalent READ_ONCE() and // WRITE_ONCE() // $ make coccicheck COCCI=/home/mark/once.cocci SPFLAGS="--include-headers" MODE=patch virtual patch @ depends on patch @ expression E1, E2; @@ - ACCESS_ONCE(E1) = E2 + WRITE_ONCE(E1, E2) @ depends on patch @ expression E; @@ - ACCESS_ONCE(E) + READ_ONCE(E) ---- Signed-off-by: Mark Rutland <mark.rutland@arm.com> Signed-off-by: Paul E. McKenney <paulmck@linux.vnet.ibm.com> Cc: Linus Torvalds <torvalds@linux-foundation.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Thomas Gleixner <tglx@linutronix.de> Cc: davem@davemloft.net Cc: linux-arch@vger.kernel.org Cc: mpe@ellerman.id.au Cc: shuah@kernel.org Cc: snitzer@redhat.com Cc: thor.thayer@linux.intel.com Cc: tj@kernel.org Cc: viro@zeniv.linux.org.uk Cc: will.deacon@arm.com Link: http://lkml.kernel.org/r/1508792849-3115-19-git-send-email-paulmck@linux.vnet.ibm.com Signed-off-by: Ingo Molnar <mingo@kernel.org>
* | | | | perf tools: Fix eBPF event specification parsingJiri Olsa2017-11-09
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Looks like I've reached the new level of stupidity, adding missing braces. Committer testing: Given the following eBPF C filter, that will add a record when it returns true, i.e. when the tv_nsec variable is > 2000ns, should be built and installed via sys_bpf(), but fails to do so before this patch: # cat filter.c #include <uapi/linux/bpf.h> #define SEC(NAME) __attribute__((section(NAME), used)) SEC("func=hrtimer_nanosleep rqtp->tv_nsec") int func(void *ctx, int err, long nsec) { return nsec > 1000; } char _license[] SEC("license") = "GPL"; int _version SEC("version") = LINUX_VERSION_CODE; # # perf trace -e nanosleep,filter.c usleep 1 invalid or unsupported event: 'filter.c' Run 'perf list' for a list of valid events Usage: perf trace [<options>] [<command>] or: perf trace [<options>] -- <command> [<options>] or: perf trace record [<options>] [<command>] or: perf trace record [<options>] -- <command> [<options>] -e, --event <event> event/syscall selector. use 'perf list' to list available events # And works again after it is applied, the nothing is inserted when the co # perf trace -e *sleep,filter.c usleep 1 0.000 ( 0.066 ms): usleep/23994 nanosleep(rqtp: 0x7ffead94a0d0) = 0 # perf trace -e *sleep,filter.c usleep 2 0.000 ( 0.008 ms): usleep/24378 nanosleep(rqtp: 0x7fffa021ba50) ... 0.008 ( ): perf_bpf_probe:func:(ffffffffb410cb30) tv_nsec=2000) 0.000 ( 0.066 ms): usleep/24378 ... [continued]: nanosleep()) = 0 # The intent of 9445464bb831 is kept: # perf stat -e 'cpu/uops_executed.core,krava/' true event syntax error: '..cuted.core,krava/' \___ unknown term valid terms: cmask,pc,event,edge,in_tx,any,ldlat,inv,umask,in_tx_cp,offcore_rsp,config,config1,config2,name,period Run 'perf list' for a list of valid events Usage: perf stat [<options>] [<command>] -e, --event <event> event selector. use 'perf list' to list available events # # perf stat -e 'cpu/uops_executed.core,period=1/' true Performance counter stats for 'true': 808,332 cpu/uops_executed.core,period=1/ 0.002997237 seconds time elapsed # Reported-by: Arnaldo Carvalho de Melo <acme@kernel.org> Signed-off-by: Jiri Olsa <jolsa@kernel.org> Cc: Andi Kleen <andi@firstfloor.org> Cc: Namhyung Kim <namhyung@kernel.org> Fixes: 9445464bb831 ("perf tools: Unwind properly location after REJECT") Link: http://lkml.kernel.org/n/tip-diea0ihbwpxfw6938huv3whj@git.kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | | | | perf tools: Add "reject" option for parse-events.lJiri Olsa2017-11-09
| |/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Arnaldo reported broken builds in some distros using a newer flex release, 2.6.4, found in Alpine Linux 3.6 and Edge, with flex not spotting the REJECT macro: CC /tmp/build/perf/util/parse-events-flex.o util/parse-events.l: In function 'parse_events_lex': /tmp/build/perf/util/parse-events-flex.c:4734:16: error: \ 'reject_used_but_not_detected' undeclared (first use in this function) It's happening because we put the REJECT under another USER_REJECT macro in following commit: 9445464bb831 perf tools: Unwind properly location after REJECT Fortunately flex provides option for force it to use REJECT, adding it to parse-events.l. Reported-by: Arnaldo Carvalho de Melo <acme@kernel.org> Reported-by: Markus Trippelsdorf <markus@trippelsdorf.de> Signed-off-by: Jiri Olsa <jolsa@kernel.org> Reviewed-by: Andi Kleen <andi@firstfloor.org> Tested-by: Arnaldo Carvalho de Melo <acme@kernel.org> Cc: Namhyung Kim <namhyung@kernel.org> Fixes: 9445464bb831 ("perf tools: Unwind properly location after REJECT") Link: http://lkml.kernel.org/n/tip-7kdont984mw12ijk7rji6b8p@git.kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | | | Merge branch 'linus' into perf/urgent, to pick up dependent commitsIngo Molnar2017-11-03
|\ \ \ \ | | | | | | | | | | | | | | | Signed-off-by: Ingo Molnar <mingo@kernel.org>
| * | | | License cleanup: add SPDX GPL-2.0 license identifier to files with no licenseGreg Kroah-Hartman2017-11-02
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many source files in the tree are missing licensing information, which makes it harder for compliance tools to determine the correct license. By default all files without license information are under the default license of the kernel, which is GPL version 2. Update the files which contain no license information with the 'GPL-2.0' SPDX license identifier. The SPDX identifier is a legally binding shorthand, which can be used instead of the full boiler plate text. This patch is based on work done by Thomas Gleixner and Kate Stewart and Philippe Ombredanne. How this work was done: Patches were generated and checked against linux-4.14-rc6 for a subset of the use cases: - file had no licensing information it it. - file was a */uapi/* one with no licensing information in it, - file was a */uapi/* one with existing licensing information, Further patches will be generated in subsequent months to fix up cases where non-standard license headers were used, and references to license had to be inferred by heuristics based on keywords. The analysis to determine which SPDX License Identifier to be applied to a file was done in a spreadsheet of side by side results from of the output of two independent scanners (ScanCode & Windriver) producing SPDX tag:value files created by Philippe Ombredanne. Philippe prepared the base worksheet, and did an initial spot review of a few 1000 files. The 4.13 kernel was the starting point of the analysis with 60,537 files assessed. Kate Stewart did a file by file comparison of the scanner results in the spreadsheet to determine which SPDX license identifier(s) to be applied to the file. She confirmed any determination that was not immediately clear with lawyers working with the Linux Foundation. Criteria used to select files for SPDX license identifier tagging was: - Files considered eligible had to be source code files. - Make and config files were included as candidates if they contained >5 lines of source - File already had some variant of a license header in it (even if <5 lines). All documentation files were explicitly excluded. The following heuristics were used to determine which SPDX license identifiers to apply. - when both scanners couldn't find any license traces, file was considered to have no license information in it, and the top level COPYING file license applied. For non */uapi/* files that summary was: SPDX license identifier # files ---------------------------------------------------|------- GPL-2.0 11139 and resulted in the first patch in this series. If that file was a */uapi/* path one, it was "GPL-2.0 WITH Linux-syscall-note" otherwise it was "GPL-2.0". Results of that was: SPDX license identifier # files ---------------------------------------------------|------- GPL-2.0 WITH Linux-syscall-note 930 and resulted in the second patch in this series. - if a file had some form of licensing information in it, and was one of the */uapi/* ones, it was denoted with the Linux-syscall-note if any GPL family license was found in the file or had no licensing in it (per prior point). Results summary: SPDX license identifier # files ---------------------------------------------------|------ GPL-2.0 WITH Linux-syscall-note 270 GPL-2.0+ WITH Linux-syscall-note 169 ((GPL-2.0 WITH Linux-syscall-note) OR BSD-2-Clause) 21 ((GPL-2.0 WITH Linux-syscall-note) OR BSD-3-Clause) 17 LGPL-2.1+ WITH Linux-syscall-note 15 GPL-1.0+ WITH Linux-syscall-note 14 ((GPL-2.0+ WITH Linux-syscall-note) OR BSD-3-Clause) 5 LGPL-2.0+ WITH Linux-syscall-note 4 LGPL-2.1 WITH Linux-syscall-note 3 ((GPL-2.0 WITH Linux-syscall-note) OR MIT) 3 ((GPL-2.0 WITH Linux-syscall-note) AND MIT) 1 and that resulted in the third patch in this series. - when the two scanners agreed on the detected license(s), that became the concluded license(s). - when there was disagreement between the two scanners (one detected a license but the other didn't, or they both detected different licenses) a manual inspection of the file occurred. - In most cases a manual inspection of the information in the file resulted in a clear resolution of the license that should apply (and which scanner probably needed to revisit its heuristics). - When it was not immediately clear, the license identifier was confirmed with lawyers working with the Linux Foundation. - If there was any question as to the appropriate license identifier, the file was flagged for further research and to be revisited later in time. In total, over 70 hours of logged manual review was done on the spreadsheet to determine the SPDX license identifiers to apply to the source files by Kate, Philippe, Thomas and, in some cases, confirmation by lawyers working with the Linux Foundation. Kate also obtained a third independent scan of the 4.13 code base from FOSSology, and compared selected files where the other two scanners disagreed against that SPDX file, to see if there was new insights. The Windriver scanner is based on an older version of FOSSology in part, so they are related. Thomas did random spot checks in about 500 files from the spreadsheets for the uapi headers and agreed with SPDX license identifier in the files he inspected. For the non-uapi files Thomas did random spot checks in about 15000 files. In initial set of patches against 4.14-rc6, 3 files were found to have copy/paste license identifier errors, and have been fixed to reflect the correct identifier. Additionally Philippe spent 10 hours this week doing a detailed manual inspection and review of the 12,461 patched files from the initial patch version early this week with: - a full scancode scan run, collecting the matched texts, detected license ids and scores - reviewing anything where there was a license detected (about 500+ files) to ensure that the applied SPDX license was correct - reviewing anything where there was no detection but the patch license was not GPL-2.0 WITH Linux-syscall-note to ensure that the applied SPDX license was correct This produced a worksheet with 20 files needing minor correction. This worksheet was then exported into 3 different .csv files for the different types of files to be modified. These .csv files were then reviewed by Greg. Thomas wrote a script to parse the csv files and add the proper SPDX tag to the file, in the format that the file expected. This script was further refined by Greg based on the output to detect more types of files automatically and to distinguish between header and source .c files (which need different comment types.) Finally Greg ran the script using the .csv files to generate the patches. Reviewed-by: Kate Stewart <kstewart@linuxfoundation.org> Reviewed-by: Philippe Ombredanne <pombredanne@nexb.com> Reviewed-by: Thomas Gleixner <tglx@linutronix.de> Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
* | | | perf tools: Unwind properly location after REJECTJiri Olsa2017-10-27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We have defined YY_USER_ACTION to keep trace of the column location during events parsing, but we need to clean it up when we call REJECT. When REJECT is called, the lexer shrinks the text and re-runs the matching, so we need to address it in resuming the previous location value to keep it correct for error display, like: Before: $ perf stat -e 'cpu/uops_executed.core,krava/' true event syntax error: '..38;5;9:mi=01;05;37;41:su=48;5;196;38;5;15:sg=48;5;1\ 1;38;5;16:ca=48;5;196;38;5;226:tw=48;5;10;38;5;16:ow=48;5;10;38;5;21:st=48;5;\ 21;38;50 �' \___ unknown term After: $ ./perf stat -e 'cpu/uops_executed.core,krava/' true event syntax error: '..cuted.core,krava/' \___ unknown term Signed-off-by: Jiri Olsa <jolsa@kernel.org> Reported-by: Arnaldo Carvalho de Melo <acme@redhat.com> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Tested-by: Andi Kleen <ak@linux.intel.com> Cc: Changbin Du <changbin.du@intel.com> Cc: David Ahern <dsahern@gmail.com> Cc: Jin Yao <yao.jin@linux.intel.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Wang Nan <wangnan0@huawei.com> Link: http://lkml.kernel.org/n/tip-vug2hchlny30jfsfrumbym26@git.kernel.org Link: http://lkml.kernel.org/r/20171009140944.GD28623@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | | | perf symbols: Fix memory corruption because of zero length symbolsRavi Bangoria2017-10-25
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Perf top is often crashing at very random locations on powerpc. After investigating, I found the crash only happens when sample is of zero length symbol. Powerpc kernel has many such symbols which does not contain length details in vmlinux binary and thus start and end addresses of such symbols are same. Structure struct sym_hist { u64 nr_samples; u64 period; struct sym_hist_entry addr[0]; }; has last member 'addr[]' of size zero. 'addr[]' is an array of addresses that belongs to one symbol (function). If function consist of 100 instructions, 'addr' points to an array of 100 'struct sym_hist_entry' elements. For zero length symbol, it points to the *empty* array, i.e. no members in the array and thus offset 0 is also invalid for such array. static int __symbol__inc_addr_samples(...) { ... offset = addr - sym->start; h = annotation__histogram(notes, evidx); h->nr_samples++; h->addr[offset].nr_samples++; h->period += sample->period; h->addr[offset].period += sample->period; ... } Here, when 'addr' is same as 'sym->start', 'offset' becomes 0, which is valid for normal symbols but *invalid* for zero length symbols and thus updating h->addr[offset] causes memory corruption. Fix this by adding one dummy element for zero length symbols. Link: https://lkml.org/lkml/2016/10/10/148 Fixes: edee44be5919 ("perf annotate: Don't throw error for zero length symbols") Signed-off-by: Ravi Bangoria <ravi.bangoria@linux.vnet.ibm.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Acked-by: Namhyung Kim <namhyung@kernel.org> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Jin Yao <yao.jin@linux.intel.com> Cc: Kim Phillips <kim.phillips@arm.com> Cc: Naveen N. Rao <naveen.n.rao@linux.vnet.ibm.com> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Taeung Song <treeze.taeung@gmail.com> Link: http://lkml.kernel.org/r/1508854806-10542-1-git-send-email-ravi.bangoria@linux.vnet.ibm.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | | perf xyarray: Fix wrong processing when closing evsel fdJin Yao2017-10-18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In current xyarray code, xyarray__max_x() returns max_y, and xyarray__max_y() returns max_x. It's confusing and for code logic it looks not correct. Error happens when closing evsel fd. Let's see this scenario: 1. Allocate an fd (pseudo-code) perf_evsel__alloc_fd(struct perf_evsel *evsel, int ncpus, int nthreads) { evsel->fd = xyarray__new(ncpus, nthreads, sizeof(int)); } xyarray__new(int xlen, int ylen, size_t entry_size) { size_t row_size = ylen * entry_size; struct xyarray *xy = zalloc(sizeof(*xy) + xlen * row_size); xy->entry_size = entry_size; xy->row_size = row_size; xy->entries = xlen * ylen; xy->max_x = xlen; xy->max_y = ylen; ...... } So max_x is ncpus, max_y is nthreads and row_size = nthreads * 4. 2. Use perf syscall and get the fd int perf_evsel__open(struct perf_evsel *evsel, struct cpu_map *cpus, struct thread_map *threads) { for (cpu = 0; cpu < cpus->nr; cpu++) { for (thread = 0; thread < nthreads; thread++) { int fd, group_fd; fd = sys_perf_event_open(&evsel->attr, pid, cpus->map[cpu], group_fd, flags); FD(evsel, cpu, thread) = fd; } } static inline void *xyarray__entry(struct xyarray *xy, int x, int y) { return &xy->contents[x * xy->row_size + y * xy->entry_size]; } These codes don't have issues. The issue happens in the closing of fd. 3. Close fd. void perf_evsel__close_fd(struct perf_evsel *evsel) { int cpu, thread; for (cpu = 0; cpu < xyarray__max_x(evsel->fd); cpu++) for (thread = 0; thread < xyarray__max_y(evsel->fd); ++thread) { close(FD(evsel, cpu, thread)); FD(evsel, cpu, thread) = -1; } } Since xyarray__max_x() returns max_y (nthreads) and xyarry__max_y() returns max_x (ncpus), so above code is actually to be: for (cpu = 0; cpu < nthreads; cpu++) for (thread = 0; thread < ncpus; ++thread) { close(FD(evsel, cpu, thread)); FD(evsel, cpu, thread) = -1; } It's not correct! This change is introduced by "475fb533fb7d" ("perf evsel: Fix buffer overflow while freeing events") This fix is to let xyarray__max_x() return max_x (ncpus) and let xyarry__max_y() return max_y (nthreads) Committer note: This was also fixed by Ravi Bangoria, who provided the same patch, noticing the problem with 'perf record': <quote Ravi> I see 'perf record -p <pid>' crashes with following log: *** Error in `./perf': free(): invalid next size (normal): 0x000000000298b340 *** ======= Backtrace: ========= /lib/x86_64-linux-gnu/libc.so.6(+0x777e5)[0x7f7fd85c87e5] /lib/x86_64-linux-gnu/libc.so.6(+0x8037a)[0x7f7fd85d137a] /lib/x86_64-linux-gnu/libc.so.6(cfree+0x4c)[0x7f7fd85d553c] ./perf(perf_evsel__close+0xb4)[0x4b7614] ./perf(perf_evlist__delete+0x100)[0x4ab180] ./perf(cmd_record+0x1d9)[0x43a5a9] ./perf[0x49aa2f] ./perf(main+0x631)[0x427841] /lib/x86_64-linux-gnu/libc.so.6(__libc_start_main+0xf0)[0x7f7fd8571830] ./perf(_start+0x29)[0x427a59] </> Signed-off-by: Jin Yao <yao.jin@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Andi Kleen <ak@linux.intel.com> Cc: Kan Liang <kan.liang@intel.com> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Ravi Bangoria <ravi.bangoria@linux.vnet.ibm.com> Fixes: d74be4767367 ("perf xyarray: Save max_x, max_y") Link: http://lkml.kernel.org/r/1508339478-26674-1-git-send-email-yao.jin@linux.intel.com Link: http://lkml.kernel.org/r/1508327446-15302-1-git-send-email-ravi.bangoria@linux.vnet.ibm.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | | perf buildid-list: Fix crash when processing PERF_RECORD_NAMESPACENamhyung Kim2017-10-17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Thomas reported that 'perf buildid-list' gets a SEGFAULT due to NULL pointer deref when he ran it on a data with namespace events. It was because the buildid_id__mark_dso_hit_ops lacks the namespace event handler and perf_too__fill_default() didn't set it. Program received signal SIGSEGV, Segmentation fault. 0x0000000000000000 in ?? () Missing separate debuginfos, use: dnf debuginfo-install audit-libs-2.7.7-1.fc25.s390x bzip2-libs-1.0.6-21.fc25.s390x elfutils-libelf-0.169-1.fc25.s390x +elfutils-libs-0.169-1.fc25.s390x libcap-ng-0.7.8-1.fc25.s390x numactl-libs-2.0.11-2.ibm.fc25.s390x openssl-libs-1.1.0e-1.1.ibm.fc25.s390x perl-libs-5.24.1-386.fc25.s390x +python-libs-2.7.13-2.fc25.s390x slang-2.3.0-7.fc25.s390x xz-libs-5.2.3-2.fc25.s390x zlib-1.2.8-10.fc25.s390x (gdb) where #0 0x0000000000000000 in ?? () #1 0x00000000010fad6a in machines__deliver_event (machines=<optimized out>, machines@entry=0x2c6fd18, evlist=<optimized out>, event=event@entry=0x3fffdf00470, sample=0x3ffffffe880, sample@entry=0x3ffffffe888, tool=tool@entry=0x1312968 <build_id.mark_dso_hit_ops>, file_offset=1136) at util/session.c:1287 #2 0x00000000010fbf4e in perf_session__deliver_event (file_offset=1136, tool=0x1312968 <build_id.mark_dso_hit_ops>, sample=0x3ffffffe888, event=0x3fffdf00470, session=0x2c6fc30) at util/session.c:1340 #3 perf_session__process_event (session=0x2c6fc30, session@entry=0x0, event=event@entry=0x3fffdf00470, file_offset=file_offset@entry=1136) at util/session.c:1522 #4 0x00000000010fddde in __perf_session__process_events (file_size=11880, data_size=<optimized out>, data_offset=<optimized out>, session=0x0) at util/session.c:1899 #5 perf_session__process_events (session=0x0, session@entry=0x2c6fc30) at util/session.c:1953 #6 0x000000000103b2ac in perf_session__list_build_ids (with_hits=<optimized out>, force=<optimized out>) at builtin-buildid-list.c:83 #7 cmd_buildid_list (argc=<optimized out>, argv=<optimized out>) at builtin-buildid-list.c:115 #8 0x00000000010a026c in run_builtin (p=0x1311f78 <commands+24>, argc=argc@entry=2, argv=argv@entry=0x3fffffff3c0) at perf.c:296 #9 0x000000000102bc00 in handle_internal_command (argv=<optimized out>, argc=2) at perf.c:348 #10 run_argv (argcp=<synthetic pointer>, argv=<synthetic pointer>) at perf.c:392 #11 main (argc=<optimized out>, argv=0x3fffffff3c0) at perf.c:536 (gdb) Fix it by adding a stub event handler for namespace event. Committer testing: Further clarifying, plain using 'perf buildid-list' will not end up in a SEGFAULT when processing a perf.data file with namespace info: # perf record -a --namespaces sleep 1 [ perf record: Woken up 1 times to write data ] [ perf record: Captured and wrote 2.024 MB perf.data (1058 samples) ] # perf buildid-list | wc -l 38 # perf buildid-list | head -5 e2a171c7b905826fc8494f0711ba76ab6abbd604 /lib/modules/4.14.0-rc3+/build/vmlinux 874840a02d8f8a31cedd605d0b8653145472ced3 /lib/modules/4.14.0-rc3+/kernel/arch/x86/kvm/kvm-intel.ko ea7223776730cd8a22f320040aae4d54312984bc /lib/modules/4.14.0-rc3+/kernel/drivers/gpu/drm/i915/i915.ko 5961535e6732a8edb7f22b3f148bb2fa2e0be4b9 /lib/modules/4.14.0-rc3+/kernel/drivers/gpu/drm/drm.ko f045f54aa78cf1931cc893f78b6cbc52c72a8cb1 /usr/lib64/libc-2.25.so # It is only when one asks for checking what of those entries actually had samples, i.e. when we use either -H or --with-hits, that we will process all the PERF_RECORD_ events, and since tools/perf/builtin-buildid-list.c neither explicitely set a perf_tool.namespaces() callback nor the default stub was set that we end up, when processing a PERF_RECORD_NAMESPACE record, causing a SEGFAULT: # perf buildid-list -H Segmentation fault (core dumped) ^C # Reported-and-Tested-by: Thomas-Mich Richter <tmricht@linux.vnet.ibm.com> Signed-off-by: Namhyung Kim <namhyung@kernel.org> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: Hari Bathini <hbathini@linux.vnet.ibm.com> Cc: Hendrik Brueckner <brueckner@linux.vnet.ibm.com> Cc: Jiri Olsa <jolsa@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Thomas-Mich Richter <tmricht@linux.vnet.ibm.com> Fixes: f3b3614a284d ("perf tools: Add PERF_RECORD_NAMESPACES to include namespaces related info") Link: http://lkml.kernel.org/r/20171017132900.11043-1-namhyung@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | | perf tools: Check wether the eBPF file exists in event parsingJiri Olsa2017-10-13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adding the check wether the eBPF file exists, to consider it as eBPF input file. This way we can differentiate eBPF events from events that end up with same suffix as eBPF file. Before: $ perf stat -e 'cpu/uops_executed.core/' true bpf: builtin compilation failed: -95, try external compiler WARNING: unable to get correct kernel building directory. Hint: Set correct kbuild directory using 'kbuild-dir' option in [llvm] section of ~/.perfconfig or set it to "" to suppress kbuild detection. event syntax error: 'cpu/uops_executed.core/' \___ Failed to load cpu/uops_executed.c from source: 'version' section incorrect or lost After: $ perf stat -e 'cpu/uops_executed.core/' true Performance counter stats for 'true': 181,533 cpu/uops_executed.core/:u 0.002795447 seconds time elapsed If user makes type in the eBPF file, we prioritize the event syntax and show following warning: $ perf stat -e 'krava.c//' true event syntax error: 'krava.c//' \___ Cannot find PMU `krava.c'. Missing kernel support? Reported-and-Tested-by: Andi Kleen <ak@linux.intel.com> Signed-off-by: Jiri Olsa <jolsa@kernel.org> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: Changbin Du <changbin.du@intel.com> Cc: David Ahern <dsahern@gmail.com> Cc: Jin Yao <yao.jin@linux.intel.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Wang Nan <wangnan0@huawei.com> Link: http://lkml.kernel.org/r/20171013083736.15037-9-jolsa@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | | perf pmu: Unbreak perf record for arm/arm64 with events with explicit PMUMark Rutland2017-10-09
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, perf record is broken on arm/arm64 systems when the PMU is specified explicitly as part of the event, e.g. $ ./perf record -e armv8_cortex_a53/cpu_cycles/u true In such cases, perf record fails to open events unless perf_event_paranoid is set to -1, even if the PMU in question supports mode exclusion. Further, even when perf_event_paranoid is toggled, no samples are recorded. This is an unintended side effect of commit: e3ba76deef23064f ("perf tools: Force uncore events to system wide monitoring) ... which assumes that if a PMU has an associated cpu_map, it is an uncore PMU, and forces events for such PMUs to be system-wide. This is not true for arm/arm64 systems, which can have heterogeneous CPUs. To account for this, multiple CPU PMUs are exposed, each with a "cpus" field under sysfs, which the perf tool parses into a cpu_map. ARM PMUs do not have a "cpumask" file, and only have a "cpus" file. For the gory details as to why, see commit: 7e3fcffe95544010 ("perf pmu: Support alternative sysfs cpumask") Given all of this, we can instead identify uncore PMUs by explicitly checking for a "cpumask" file, and restore arm/arm64 PMU support back to a working state. This patch does so, adding a new perf_pmu::is_uncore field, and splitting the existing cpumask parsing so that it can be reused. Signed-off-by: Mark Rutland <mark.rutland@arm.com> Tested-by Will Deacon <will.deacon@arm.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Cc: Adrian Hunter <adrian.hunter@intel.com> Cc: Borislav Petkov <bp@alien8.de> Cc: David Ahern <dsahern@gmail.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: 4.12+ <stable@vger.kernel.org> Fixes: e3ba76deef23064f ("perf tools: Force uncore events to system wide monitoring) Link: http://lkml.kernel.org/r/1507315102-5942-1-git-send-email-mark.rutland@arm.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | | perf callchain: Compare dsos (as well) for CCKEY_FUNCTIONRavi Bangoria2017-10-05
| |/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Two functions from different binaries can have same start address. Thus, comparing only start address in match_chain() leads to inconsistent callchains. Fix this by adding a check for dsos as well. Ex, https://www.spinics.net/lists/linux-perf-users/msg04067.html Reported-by: Alexander Pozdneev <pozdneyev@gmail.com> Signed-off-by: Ravi Bangoria <ravi.bangoria@linux.vnet.ibm.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Andi Kleen <ak@linux.intel.com> Cc: Krister Johansen <kjlx@templeofstupid.com> Cc: Milian Wolff <milian.wolff@kdab.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Yao Jin <yao.jin@linux.intel.com> Cc: zhangmengting@huawei.com Link: http://lkml.kernel.org/r/20171005091234.5874-1-ravi.bangoria@linux.vnet.ibm.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | perf test: Fix vmlinux failure on s390xThomas Richter2017-09-28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On s390x perf test 1 failed. It turned out that commit 4a084ecfc821 ("perf report: Fix module symbol adjustment for s390x") was incorrect. The previous implementation in dso__load_sym() is also suitable for s390x. Therefore this patch undoes commit 4a084ecfc821. Signed-off-by: Thomas-Mich Richter <tmricht@linux.vnet.ibm.com> Cc: Hendrik Brueckner <brueckner@linux.vnet.ibm.com> Cc: Zvonko Kosic <zvonko.kosic@de.ibm.com> Fixes: 4a084ecfc821 ("perf report: Fix module symbol adjustment for s390x") LPU-Reference: 20170915071404.58398-1-tmricht@linux.vnet.ibm.com Link: http://lkml.kernel.org/n/tip-5ani7ly57zji7s0hmzkx416l@git.kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | perf tools: Fix syscalltbl build failureAkemi Yagi2017-09-25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The build of kernel v4.14-rc1 for i686 fails on RHEL 6 with the error in tools/perf: util/syscalltbl.c:157: error: expected ';', ',' or ')' before '__maybe_unused' mv: cannot stat `util/.syscalltbl.o.tmp': No such file or directory Fix it by placing/moving: #include <linux/compiler.h> outside of #ifdef HAVE_SYSCALL_TABLE block. Signed-off-by: Akemi Yagi <toracat@elrepo.org> Cc: Alan Bartlett <ajb@elrepo.org> Link: http://lkml.kernel.org/r/oq41r8$1v9$1@blaine.gmane.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | perf report: Fix debug messages with --call-graph optionMengting Zhang2017-09-25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With --call-graph option, perf report can display call chains using type, min percent threshold, optional print limit and order. And the default call-graph parameter is 'graph,0.5,caller,function,percent'. Before this patch, 'perf report --call-graph' shows incorrect debug messages as below: # perf report --call-graph Invalid callchain mode: 0.5 Invalid callchain order: 0.5 Invalid callchain sort key: 0.5 Invalid callchain config key: 0.5 Invalid callchain mode: caller Invalid callchain mode: function Invalid callchain order: function Invalid callchain mode: percent Invalid callchain order: percent Invalid callchain sort key: percent That is because in function __parse_callchain_report_opt(),each field of the call-graph parameter is passed to parse_callchain_{mode,order, sort_key,value} in turn until it meets the matching value. For example, the order field "caller" is passed to parse_callchain_mode() firstly and obviously it doesn't match any mode field. Therefore parse_callchain_mode() will shows the debug message "Invalid callchain mode: caller", which could confuse users. The patch fixes this issue by moving the warning out of the function parse_callchain_{mode,order,sort_key,value}. Signed-off-by: Mengting Zhang <zhangmengting@huawei.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Andi Kleen <ak@linux.intel.com> Cc: Krister Johansen <kjlx@templeofstupid.com> Cc: Li Bin <huawei.libin@huawei.com> Cc: Milian Wolff <milian.wolff@kdab.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Wang Nan <wangnan0@huawei.com> Cc: Yao Jin <yao.jin@linux.intel.com> Link: http://lkml.kernel.org/r/1506154694-39691-1-git-send-email-zhangmengting@huawei.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | perf evsel: Fix attr.exclude_kernel setting for default cycles:pArnaldo Carvalho de Melo2017-09-25
|/ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Yet another fix for probing the max attr.precise_ip setting: it is not enough settting attr.exclude_kernel for !root users, as they _can_ profile the kernel if the kernel.perf_event_paranoid sysctl is set to -1, so check that as well. Testing it: As non root: $ sysctl kernel.perf_event_paranoid kernel.perf_event_paranoid = 2 $ perf record sleep 1 $ perf evlist -v cycles:uppp: ..., exclude_kernel: 1, ... precise_ip: 3, ... Now as non-root, but with kernel.perf_event_paranoid set set to the most permissive value, -1: $ sysctl kernel.perf_event_paranoid kernel.perf_event_paranoid = -1 $ perf record sleep 1 $ perf evlist -v cycles:ppp: ..., exclude_kernel: 0, ... precise_ip: 3, ... $ I.e. non-root, default kernel.perf_event_paranoid: :uppp modifier = not allowed to sample the kernel, non-root, most permissible kernel.perf_event_paranoid: :ppp = allowed to sample the kernel. In both cases, use the highest available precision: attr.precise_ip = 3. Reported-and-Tested-by: Ingo Molnar <mingo@kernel.org> Cc: Adrian Hunter <adrian.hunter@intel.com> Cc: Andy Lutomirski <luto@kernel.org> Cc: David Ahern <dsahern@gmail.com> Cc: Jiri Olsa <jolsa@kernel.org> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Wang Nan <wangnan0@huawei.com> Fixes: d37a36979077 ("perf evsel: Fix attr.exclude_kernel setting for default cycles:p") Link: http://lkml.kernel.org/n/tip-nj2qkf75xsd6pw6hhjzfqqdx@git.kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Open perf.data with O_CLOEXEC flagJiri Olsa2017-09-12
| | | | | | | | | | | | | Do not carry the perf.data file descriptor into the workload process and close it when perf executes the workload. Signed-off-by: Jiri Olsa <jolsa@kernel.org> Cc: David Ahern <dsahern@gmail.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/20170908084621.31595-2-jolsa@kernel.org [ Add definitions for O_CLOEXEC for older systems ] Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf stat: Only auto-merge events that are PMU aliasesArnaldo Carvalho de Melo2017-09-01
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Peter reported that when he explicitely asked for multiple events with the same name on the command line it got coalesced into just one line, i.e.: # perf stat -e cycles -e cycles -e cycles usleep 1 Performance counter stats for 'usleep 1': 3,269,652 cycles 0.000884123 seconds time elapsed # And while there is the --no-merges option to disable that auto-merging, this is a blunt change in behaviour for such explicit request, so change the code so that this auto merging is done only when handling the multi PMU aliases with the same name that introduced this coalescing, restoring the previous behaviour for the explicit case: # perf stat -e cycles -e cycles -e cycles usleep 1 Performance counter stats for 'usleep 1': 1,472,837 cycles 1,472,837 cycles 1,472,837 cycles 0.001764870 seconds time elapsed # Reported-by: Peter Zijlstra <peterz@infradead.org> Acked-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Cc: Adrian Hunter <adrian.hunter@intel.com> Cc: Mark Rutland <mark.rutland@arm.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Wang Nan <wangnan0@huawei.com> Fixes: 430daf2dc7af ("perf stat: Collapse identically named events") Link: http://lkml.kernel.org/r/20170831184122.GK4831@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf sort: Add sort option for physical addressKan Liang2017-09-01
| | | | | | | | | | | | | | | Add a new sort option "phys_daddr" for --mem-mode sort. With this option applied, perf can sort and report by sample's physical address. Signed-off-by: Kan Liang <kan.liang@intel.com> Tested-by: Jiri Olsa <jolsa@redhat.com> Acked-by: Stephane Eranian <eranian@google.com> Cc: Andi Kleen <ak@linux.intel.com> Cc: Madhavan Srinivasan <maddy@linux.vnet.ibm.com> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Thomas Gleixner <tglx@linutronix.de> Link: http://lkml.kernel.org/r/1504026672-7304-3-git-send-email-kan.liang@intel.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Support new sample type for physical addressKan Liang2017-09-01
| | | | | | | | | | | | | | | | | Support new sample type PERF_SAMPLE_PHYS_ADDR for physical address. Add new option --phys-data to record sample physical address. Signed-off-by: Kan Liang <kan.liang@intel.com> Tested-by: Jiri Olsa <jolsa@redhat.com> Acked-by: Stephane Eranian <eranian@google.com> Cc: Andi Kleen <ak@linux.intel.com> Cc: Madhavan Srinivasan <maddy@linux.vnet.ibm.com> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Thomas Gleixner <tglx@linutronix.de> Link: http://lkml.kernel.org/r/1504026672-7304-2-git-send-email-kan.liang@intel.com [ Added missing printing in evsel.c patch sent by Jiri Olsa ] Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf syscalltbl: Support glob matching on syscall namesArnaldo Carvalho de Melo2017-09-01
| | | | | | | | | | | | | | | | | | | With two new methods, one to find the first match, returning its syscall id and its index in whatever internal database it keeps the syscall into, then one to find the next match, if any. Implemented only on arches where we actually read the syscall table from the kernel sources, i.e. x86-64 for now, all the others use the libaudit method for which this returns -1, i.e. just stubs were added, with the actual implementation using whatever libaudit functions for matching that may be available. Cc: Adrian Hunter <adrian.hunter@intel.com> Cc: Jiri Olsa <jolsa@kernel.org> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Wang Nan <wangnan0@huawei.com> Link: http://lkml.kernel.org/n/tip-i0sj4rxk1a63pfe9gl8z8irs@git.kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf report: Calculate the average cycles of iterationsJin Yao2017-08-30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The branch history code has a loop detection function. With this, we can get the number of iterations by calculating the removed loops. While it would be nice for knowing the average cycles of iterations. This patch adds up the cycles in branch entries of removed loops and save the result to the next branch entry (e.g. branch entry A). Finally it will display the iteration number and average cycles at the "from" of branch entry A. For example: perf record -g -j any,save_type ./div perf report --branch-history --no-children --stdio --22.63%--main div.c:42 (RET CROSS_2M) compute_flag div.c:28 (cycles:2 iter:173115 avg_cycles:2) | --10.73%--compute_flag div.c:27 (RET CROSS_2M) rand rand.c:28 (cycles:1) rand rand.c:28 (RET CROSS_2M) __random random.c:298 (cycles:1) __random random.c:297 (COND_BWD CROSS_2M) __random random.c:295 (cycles:1) __random random.c:295 (COND_BWD CROSS_2M) __random random.c:295 (cycles:1) __random random.c:295 (RET CROSS_2M) Signed-off-by: Yao Jin <yao.jin@linux.intel.com> Reviewed-by: Andi Kleen <ak@linux.intel.com> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Jiri Olsa <jolsa@kernel.org> Cc: Kan Liang <kan.liang@intel.com> Cc: Peter Zijlstra <peterz@infradead.org> Link: http://lkml.kernel.org/r/1502111115-18305-1-git-send-email-yao.jin@linux.intel.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf symbols: Fix plt entry calculation for ARM and AARCH64Li Bin2017-08-29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On x86, the plt header size is as same as the plt entry size, and can be identified from shdr's sh_entsize of the plt. But we can't assume that the sh_entsize of the plt shdr is always the plt entry size in all architecture, and the plt header size may be not as same as the plt entry size in some architecure. On ARM, the plt header size is 20 bytes and the plt entry size is 12 bytes (don't consider the FOUR_WORD_PLT case) that refer to the binutils implementation. The plt section is as follows: Disassembly of section .plt: 000004a0 <__cxa_finalize@plt-0x14>: 4a0: e52de004 push {lr} ; (str lr, [sp, #-4]!) 4a4: e59fe004 ldr lr, [pc, #4] ; 4b0 <_init+0x1c> 4a8: e08fe00e add lr, pc, lr 4ac: e5bef008 ldr pc, [lr, #8]! 4b0: 00008424 .word 0x00008424 000004b4 <__cxa_finalize@plt>: 4b4: e28fc600 add ip, pc, #0, 12 4b8: e28cca08 add ip, ip, #8, 20 ; 0x8000 4bc: e5bcf424 ldr pc, [ip, #1060]! ; 0x424 000004c0 <printf@plt>: 4c0: e28fc600 add ip, pc, #0, 12 4c4: e28cca08 add ip, ip, #8, 20 ; 0x8000 4c8: e5bcf41c ldr pc, [ip, #1052]! ; 0x41c On AARCH64, the plt header size is 32 bytes and the plt entry size is 16 bytes. The plt section is as follows: Disassembly of section .plt: 0000000000000560 <__cxa_finalize@plt-0x20>: 560: a9bf7bf0 stp x16, x30, [sp,#-16]! 564: 90000090 adrp x16, 10000 <__FRAME_END__+0xf8a8> 568: f944be11 ldr x17, [x16,#2424] 56c: 9125e210 add x16, x16, #0x978 570: d61f0220 br x17 574: d503201f nop 578: d503201f nop 57c: d503201f nop 0000000000000580 <__cxa_finalize@plt>: 580: 90000090 adrp x16, 10000 <__FRAME_END__+0xf8a8> 584: f944c211 ldr x17, [x16,#2432] 588: 91260210 add x16, x16, #0x980 58c: d61f0220 br x17 0000000000000590 <__gmon_start__@plt>: 590: 90000090 adrp x16, 10000 <__FRAME_END__+0xf8a8> 594: f944c611 ldr x17, [x16,#2440] 598: 91262210 add x16, x16, #0x988 59c: d61f0220 br x17 NOTES: In addition to ARM and AARCH64, other architectures, such as s390/alpha/mips/parisc/poperpc/sh/sparc/xtensa also need to consider this issue. Signed-off-by: Li Bin <huawei.libin@huawei.com> Acked-by: Namhyung Kim <namhyung@kernel.org> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Alexis Berlemont <alexis.berlemont@gmail.com> Cc: David Tolnay <dtolnay@gmail.com> Cc: Hanjun Guo <guohanjun@huawei.com> Cc: Hemant Kumar <hemant@linux.vnet.ibm.com> Cc: Masami Hiramatsu <mhiramat@kernel.org> Cc: Milian Wolff <milian.wolff@kdab.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Wang Nan <wangnan0@huawei.com> Cc: zhangmengting@huawei.com Link: http://lkml.kernel.org/r/1496622849-21877-1-git-send-email-huawei.libin@huawei.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf probe: Fix kprobe blacklist checking conditionLi Bin2017-08-29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The commit 9aaf5a5f479b ("perf probe: Check kprobes blacklist when adding new events"), 'perf probe' supports checking the blacklist of the fuctions which can not be probed. But the checking condition is wrong, that the end_addr of the symbol which is the start_addr of the next symbol can't be included. Committer notes: IOW make it match its kernel counterpart in kernel/kprobes.c: bool within_kprobe_blacklist(unsigned long addr) Each entry have as its end address not its end address, but the first address _outside_ that symbol, which for related functions, is the first address of the next symbol, like these from kernel/trace/trace_probe.c: 0xffffffffbd198df0-0xffffffffbd198e40 print_type_u8 0xffffffffbd198e40-0xffffffffbd198e90 print_type_u16 0xffffffffbd198e90-0xffffffffbd198ee0 print_type_u32 0xffffffffbd198ee0-0xffffffffbd198f30 print_type_u64 0xffffffffbd198f30-0xffffffffbd198f80 print_type_s8 0xffffffffbd198f80-0xffffffffbd198fd0 print_type_s16 0xffffffffbd198fd0-0xffffffffbd199020 print_type_s32 0xffffffffbd199020-0xffffffffbd199070 print_type_s64 0xffffffffbd199070-0xffffffffbd1990c0 print_type_x8 0xffffffffbd1990c0-0xffffffffbd199110 print_type_x16 0xffffffffbd199110-0xffffffffbd199160 print_type_x32 0xffffffffbd199160-0xffffffffbd1991b0 print_type_x64 But not always: 0xffffffffbd1997b0-0xffffffffbd1997c0 fetch_kernel_stack_address (kernel/trace/trace_probe.c) 0xffffffffbd1c57f0-0xffffffffbd1c58b0 __context_tracking_enter (kernel/context_tracking.c) Signed-off-by: Li Bin <huawei.libin@huawei.com> Cc: Masami Hiramatsu <mhiramat@kernel.org> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Wang Nan <wangnan0@huawei.com> Cc: zhangmengting@huawei.com Fixes: 9aaf5a5f479b ("perf probe: Check kprobes blacklist when adding new events") Link: http://lkml.kernel.org/r/1504011443-7269-1-git-send-email-huawei.libin@huawei.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Robustify detection of clang binaryDavid Carrillo-Cisneros2017-08-28
| | | | | | | | | | | | | | | Prior to this patch, make scripts tested for CLANG with ifeq ($(CC), clang), failing to detect CLANG binaries with different names. Fix it by testing for the existence of __clang__ macro in the list of compiler defined macros. Signed-off-by: David Carrillo-Cisneros <davidcc@google.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Paul Turner <pjt@google.com> Cc: Stephane Eranian <eranian@google.com> Link: http://lkml.kernel.org/r/20170827075442.108534-5-davidcc@google.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf report: Group stat values on global event idJiri Olsa2017-08-28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no big value on displaying counts for every event ID, which is one per every CPU. Rather than that, displaying the whole sum for the event. $ perf record -c 100000 -e cycles:u -s test $ perf report -T Before: # PID TID cycles:u cycles:u cycles:u cycles:u ... [20 more columns of 'cycles:u'] 3339 3339 0 0 0 0 3340 3340 0 0 0 0 3341 3341 0 0 0 0 3342 3342 0 0 0 0 Now: # PID TID cycles:u 3339 3339 19678 3340 3340 18744 3341 3341 17335 3342 3342 26414 Signed-off-by: Jiri Olsa <jolsa@kernel.org> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Andi Kleen <andi@firstfloor.org> Cc: David Ahern <dsahern@gmail.com> Cc: Mark Rutland <mark.rutland@arm.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/20170824162737.7813-10-jolsa@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf values: Zero value buffersJiri Olsa2017-08-28
| | | | | | | | | | | | | | | | We need to make sure the array of value pointers are zero initialized, because we use them in realloc later on and uninitialized non zero value will cause allocation error and aborted execution. Signed-off-by: Jiri Olsa <jolsa@kernel.org> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Andi Kleen <andi@firstfloor.org> Cc: David Ahern <dsahern@gmail.com> Cc: Mark Rutland <mark.rutland@arm.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/20170824162737.7813-9-jolsa@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf values: Fix allocation checkJiri Olsa2017-08-28
| | | | | | | | | | | | | | Bailing out in case the allocation failed, not the other way round. Signed-off-by: Jiri Olsa <jolsa@kernel.org> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Andi Kleen <andi@firstfloor.org> Cc: David Ahern <dsahern@gmail.com> Cc: Mark Rutland <mark.rutland@arm.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/20170824162737.7813-8-jolsa@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf values: Fix thread index bugJiri Olsa2017-08-28
| | | | | | | | | | | | | | | We are taking wrong index (+1) for first thread, which leaves thread with index 0 unused and uninitialized. Signed-off-by: Jiri Olsa <jolsa@kernel.org> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Andi Kleen <andi@firstfloor.org> Cc: David Ahern <dsahern@gmail.com> Cc: Mark Rutland <mark.rutland@arm.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/20170824162737.7813-7-jolsa@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf report: Add dump_read functionJiri Olsa2017-08-28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adding dump_read function to gather all the dump output of read function. Adding output of enabled and running times and id if enabled (3 new lines with '...' prefix below). $ perf record -s ... $ perf report -D 958358311769 0x91f8 [0x40]: PERF_RECORD_READ: 3339 3339 cycles:u 0 ... time enabled : 958358313731 ... time running : 958358313731 ... id : 80 Committer note: Do not use 'read' as a variable name as it breaks the build on older systems, such as RHEL6: CC /tmp/build/perf/util/session.o cc1: warnings being treated as errors util/session.c: In function 'dump_read': util/session.c:1132: error: declaration of 'read' shadows a global declaration /usr/include/bits/unistd.h:35: error: shadowed declaration is here mv: cannot stat `/tmp/build/perf/util/.session.o.tmp': No such file or directory Signed-off-by: Jiri Olsa <jolsa@kernel.org> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Andi Kleen <andi@firstfloor.org> Cc: David Ahern <dsahern@gmail.com> Cc: Mark Rutland <mark.rutland@arm.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/20170824162737.7813-6-jolsa@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf record: Set read_format for inherit_statJiri Olsa2017-08-28
| | | | | | | | | | | | | | | Set read_format for what we expect to get from read event generated by perf_event_attr::inherit_stat. Signed-off-by: Jiri Olsa <jolsa@kernel.org> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Andi Kleen <andi@firstfloor.org> Cc: David Ahern <dsahern@gmail.com> Cc: Mark Rutland <mark.rutland@arm.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/20170824162737.7813-5-jolsa@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf c2c: Fix remote HITM detection for SkylakeJiri Olsa2017-08-28
| | | | | | | | | | | | | | | | | | | | | Skylake introduced new mem_remote bit in union perf_mem_data_src [1]. It applies to any other memory level to express Remote unknown level, as is reported by Skylake. Adding this extra check to c2c_decode_stats to properly decode remote HITMs on Skylake. [1] http://lkml.kernel.org/r/20170816222156.19953-4-andi@firstfloor.org Signed-off-by: Jiri Olsa <jolsa@kernel.org> Acked-by: Andi Kleen <ak@linux.intel.com> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: David Ahern <dsahern@gmail.com> Cc: Joe Mario <jmario@redhat.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/20170824085732.28481-1-jolsa@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf: Fix documentation for sysctls perf_event_paranoid and perf_event_mlock_kbKonstantin Khlebnikov2017-08-22
| | | | | | | | | | | | | | Fix misprint CAP_IOC_LOCK -> CAP_IPC_LOCK. This capability have nothing to do with raw tracepoints. This part is about bypassing mlock limits. Sysctl kernel.perf_event_paranoid = -1 allows raw and ftrace function tracepoints without CAP_SYS_ADMIN. Signed-off-by: Konstantin Khlebnikov <khlebnikov@yandex-team.ru> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Peter Zijlstra <peterz@infradead.org> Link: http://lkml.kernel.org/r/150322916080.129746.11285255474738558340.stgit@buzz Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Add support for printing new mem_info encodingsAndi Kleen2017-08-22
| | | | | | | | | | | | | | | | | Add decoding for the new "lvlx" and "snoopx" meminfo fields added earlier to the kernel so that "perf mem report" and other tools can print it properly. v2: Merge with persistent memory patch. Switch to new bit encoding for each combination. v3: Switch to generic lvlnum field. Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Peter Zijlstra <peterz@infradead.org> Cc: Jiri Olsa <jolsa@kernel.org> Link: http://lkml.kernel.org/r/20170816222156.19953-4-andi@firstfloor.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Dedup events in expression parsingAndi Kleen2017-08-22
| | | | | | | | | | | | Avoid adding redundant events while parsing an expression. When we add an "other" event check first if it already exists. v2: Fix perf test failure. Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Link: http://lkml.kernel.org/r/20170811232634.30465-10-andi@firstfloor.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Increase maximum number of events in expressionsAndi Kleen2017-08-22
| | | | | | | | | | Some of the upcoming metrics need more than 8 events. Increase the maximum number the parser supports. Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Link: http://lkml.kernel.org/r/20170811232634.30465-9-andi@firstfloor.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Expression parser enhancements for metricsAndi Kleen2017-08-22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Enhance the expression parser for more complex metric formulas. - Support python style IF ELSE operators - Add an #SMT_On magic variable for formulas that depend on the SMT status. Example: 4 *( CPU_CLK_UNHALTED.THREAD_ANY / 2 ) if #SMT_on else cycles - Support MIN/MAX operations Example: min(1 , IDQ.MITE_UOPS / ( UPI * 16 * ( ICACHE.HIT + ICACHE.MISSES ) / 4.0 ) ) This is useful to fix up problems caused by multiplexing. - Support | & ^ operators - Minor cleanups and fixes - Support an \ escape for operators. This allows to specify event names like c2-residency - Support @ as an alternative for / to be able to specify pmus without conflicts with operators (like msr/tsc/ as msr@tsc@) Example: (cstate_core@c3\\-residency@ / msr@tsc@) * 100 Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Link: http://lkml.kernel.org/r/20170811232634.30465-8-andi@firstfloor.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Add utility function to detect SMT statusAndi Kleen2017-08-22
| | | | | | | | | | Add an smt_on() function to return if SMT is enabled or disabled. Used in the next patch. Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Link: http://lkml.kernel.org/r/20170811232634.30465-7-andi@firstfloor.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf bpf: Tighten detection of BPF eventsAndi Kleen2017-08-22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | perf stat -e cpu/uops_executed.core,cmask=1/ would be detected as a BPF source event because the .c matches the .c source BPF pattern. v2: Originally I tried to use lex lookahead, but it doesn't seem to work. This now extends the BPF pattern to match longer events, but then does an extra check in the C code to reject BPF matches that do not end with .c/.o/.obj This uses REJECT, which makes the flex scanner slower, but that shouldn't be a big problem for the perf events. Committer testing: # perf trace -e write -e /home/acme/bpf/tracepoint.c cat /etc/passwd > /dev/null 0.000 ( 0.006 ms): cat/18485 write(fd: 1, buf: 0x7f59eebe1000, count: 3494 ) ... 0.006 ( ): raw_syscalls:sys_enter:NR 1 (1, 7f59eebe1000, da6, 22, 7f59eebe0010, 0)) 0.008 ( ): perf_bpf_probe:_write:(ffffffff9626b2c0)) 0.000 ( 0.010 ms): cat/18485 ... [continued]: write()) = 3494 # It continues doing what was expected, i.e. identifying /home/acme/bpf/tracepoint.c as a BPF event and activates the clang machinery to build an eBPF object and then uses sys_bpf() to hook it up to the raw_syscalls:sys_enter tracepoint, etc. Andi forgot to add Wang to the CC list, fix it. Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: Wang Nan <wangnan0@huawei.com> Link: http://lkml.kernel.org/r/20170811232634.30465-4-andi@firstfloor.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf evsel: Fix buffer overflow while freeing eventsAndi Kleen2017-08-22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fix buffer overflow for: % perf stat -e msr/tsc/,cstate_core/c7-residency/ true that causes glibc free list corruption. For some reason it doesn't trigger in valgrind, but it is visible in AS: ================================================================= ==32681==ERROR: AddressSanitizer: heap-buffer-overflow on address 0x603000003f5c at pc 0x0000005671ef bp 0x7ffdaaac9ac0 sp 0x7ffdaaac9ab0 READ of size 4 at 0x603000003f5c thread T0 #0 0x5671ee in perf_evsel__close_fd util/evsel.c:1196 #1 0x56c57a in perf_evsel__close util/evsel.c:1717 #2 0x55ed5f in perf_evlist__close util/evlist.c:1631 #3 0x4647e1 in __run_perf_stat /home/ak/hle/linux-hle-2.6/tools/perf/builtin-stat.c:749 #4 0x4648e3 in run_perf_stat /home/ak/hle/linux-hle-2.6/tools/perf/builtin-stat.c:767 #5 0x46e1bc in cmd_stat /home/ak/hle/linux-hle-2.6/tools/perf/builtin-stat.c:2785 #6 0x52f83d in run_builtin /home/ak/hle/linux-hle-2.6/tools/perf/perf.c:296 #7 0x52fd49 in handle_internal_command /home/ak/hle/linux-hle-2.6/tools/perf/perf.c:348 #8 0x5300de in run_argv /home/ak/hle/linux-hle-2.6/tools/perf/perf.c:392 #9 0x5308f3 in main /home/ak/hle/linux-hle-2.6/tools/perf/perf.c:530 #10 0x7f0672d13400 in __libc_start_main (/lib64/libc.so.6+0x20400) #11 0x428419 in _start (/home/ak/hle/obj-perf/perf+0x428419) 0x603000003f5c is located 0 bytes to the right of 28-byte region [0x603000003f40,0x603000003f5c) allocated by thread T0 here: #0 0x7f0675139020 in calloc (/lib64/libasan.so.3+0xc7020) #1 0x648a2d in zalloc util/util.h:23 #2 0x648a88 in xyarray__new util/xyarray.c:9 #3 0x566419 in perf_evsel__alloc_fd util/evsel.c:1039 #4 0x56b427 in perf_evsel__open util/evsel.c:1529 #5 0x56c620 in perf_evsel__open_per_thread util/evsel.c:1730 #6 0x461dea in create_perf_stat_counter /home/ak/hle/linux-hle-2.6/tools/perf/builtin-stat.c:263 #7 0x4637d7 in __run_perf_stat /home/ak/hle/linux-hle-2.6/tools/perf/builtin-stat.c:600 #8 0x4648e3 in run_perf_stat /home/ak/hle/linux-hle-2.6/tools/perf/builtin-stat.c:767 #9 0x46e1bc in cmd_stat /home/ak/hle/linux-hle-2.6/tools/perf/builtin-stat.c:2785 #10 0x52f83d in run_builtin /home/ak/hle/linux-hle-2.6/tools/perf/perf.c:296 #11 0x52fd49 in handle_internal_command /home/ak/hle/linux-hle-2.6/tools/perf/perf.c:348 #12 0x5300de in run_argv /home/ak/hle/linux-hle-2.6/tools/perf/perf.c:392 #13 0x5308f3 in main /home/ak/hle/linux-hle-2.6/tools/perf/perf.c:530 #14 0x7f0672d13400 in __libc_start_main (/lib64/libc.so.6+0x20400) The event is allocated with cpus == 1, but freed with cpus == real number When the evsel close function walks the file descriptors it exceeds the fd xyarray boundaries and reads random memory. v2: Now that xyarrays save their original dimensions we can use these to iterate the two dimensional fd arrays. Fix some users (close, ioctl) in evsel.c to use these fields directly. This allows simplifying the code and dropping quite a few function arguments. Adjust all callers by removing the unneeded arguments. The actual perf event reading still uses the original values from the evsel list. Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Link: http://lkml.kernel.org/r/20170811232634.30465-2-andi@firstfloor.org [ Fix up xy_max_[xy]() -> xyarray__max_[xy]() ] Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf xyarray: Save max_x, max_yAndi Kleen2017-08-22
| | | | | | | | | | | Save the original array dimensions in xyarrays, so that users can retrieve them later. Add some inline functions to access these fields. Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Link: http://lkml.kernel.org/r/20170811232634.30465-1-andi@firstfloor.org [ As noticed by Jiri, fix up namespacing: xy__method() -> xyarray__method() ] Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf annotate stdio: Support --show-nr-samples optionTaeung Song2017-08-18
| | | | | | | | | | | | | | | | | | | | Add --show-nr-samples option to "perf annotate" so that it matches "perf report". Committer note: Note that it can't be used together with --show-total-period, which seems like a silly limitation, that can be lifted at some point. Made it bail out if not on --stdio. Signed-off-by: Taeung Song <treeze.taeung@gmail.com> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: Jiri Olsa <jolsa@redhat.com> Cc: Milian Wolff <milian.wolff@kdab.com> Cc: Namhyung Kim <namhyung@kernel.org> Link: http://lkml.kernel.org/r/1503046008-5511-1-git-send-email-treeze.taeung@gmail.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Use default CPUINFO_PROC where it fitsArnaldo Carvalho de Melo2017-08-17
| | | | | | | | | | | | | Several architectures don't need to define it since the string is the same as the default one, so nuke them. Cc: Adrian Hunter <adrian.hunter@intel.com> Cc: David Ahern <dsahern@gmail.com> Cc: Jiri Olsa <jolsa@kernel.org> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Wang Nan <wangnan0@huawei.com> Link: http://lkml.kernel.org/n/tip-v1e1jr1u474w9xcelpaoxamu@git.kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>